FI52216C - Menetelmä gamma-piperidinobutyrofenonijohdannaisten valmistamiseksi. - Google Patents
Menetelmä gamma-piperidinobutyrofenonijohdannaisten valmistamiseksi.Info
- Publication number
- FI52216C FI52216C FI701982A FI198270A FI52216C FI 52216 C FI52216 C FI 52216C FI 701982 A FI701982 A FI 701982A FI 198270 A FI198270 A FI 198270A FI 52216 C FI52216 C FI 52216C
- Authority
- FI
- Finland
- Prior art keywords
- piperidinobutyrophenone
- gamma
- derivatives
- preparation
- piperidinobutyrophenone derivatives
- Prior art date
Links
- WLTFPYVGECWXFO-UHFFFAOYSA-N 1-phenyl-4-piperidin-1-ylbutan-1-one Chemical class C=1C=CC=CC=1C(=O)CCCN1CCCCC1 WLTFPYVGECWXFO-UHFFFAOYSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D295/00—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms
- C07D295/04—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms
- C07D295/10—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by doubly bound oxygen or sulphur atoms
- C07D295/104—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by doubly bound oxygen or sulphur atoms with the ring nitrogen atoms and the doubly bound oxygen or sulfur atoms attached to the same carbon chain, which is not interrupted by carbocyclic rings
- C07D295/108—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by doubly bound oxygen or sulphur atoms with the ring nitrogen atoms and the doubly bound oxygen or sulfur atoms attached to the same carbon chain, which is not interrupted by carbocyclic rings to an acyclic saturated chain
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D211/00—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings
- C07D211/04—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D211/06—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members
- C07D211/08—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hydrocarbon or substituted hydrocarbon radicals directly attached to ring carbon atoms
- C07D211/10—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hydrocarbon or substituted hydrocarbon radicals directly attached to ring carbon atoms with radicals containing only carbon and hydrogen atoms attached to ring carbon atoms
- C07D211/14—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hydrocarbon or substituted hydrocarbon radicals directly attached to ring carbon atoms with radicals containing only carbon and hydrogen atoms attached to ring carbon atoms with hydrocarbon or substituted hydrocarbon radicals attached to the ring nitrogen atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D211/00—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings
- C07D211/04—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D211/06—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members
- C07D211/36—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D211/40—Oxygen atoms
- C07D211/44—Oxygen atoms attached in position 4
- C07D211/52—Oxygen atoms attached in position 4 having an aryl radical as the second substituent in position 4
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Hydrogenated Pyridines (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (6)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP5660769 | 1969-07-16 | ||
| JP6214669A JPS504670B1 (cs) | 1969-08-05 | 1969-08-05 | |
| JP44062479A JPS504671B1 (cs) | 1969-08-06 | 1969-08-06 | |
| JP1940070 | 1970-03-07 | ||
| JP2372370 | 1970-03-20 | ||
| FR7130087A FR2149291B2 (cs) | 1969-07-16 | 1971-08-18 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| FI52216B FI52216B (cs) | 1977-03-31 |
| FI52216C true FI52216C (fi) | 1977-07-11 |
Family
ID=27546325
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| FI701982A FI52216C (fi) | 1969-07-16 | 1970-07-14 | Menetelmä gamma-piperidinobutyrofenonijohdannaisten valmistamiseksi. |
Country Status (7)
| Country | Link |
|---|---|
| BE (1) | BE753472A (cs) |
| DK (1) | DK125245B (cs) |
| FI (1) | FI52216C (cs) |
| FR (2) | FR2059517B1 (cs) |
| GB (1) | GB1304599A (cs) |
| NL (1) | NL7010451A (cs) |
| SE (1) | SE379348B (cs) |
Families Citing this family (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR2081493B1 (cs) * | 1970-02-06 | 1975-04-18 | Sumitomo Chemical Co | |
| HU167671B (cs) * | 1972-03-18 | 1975-11-28 | ||
| JPS5755714B2 (cs) * | 1972-03-18 | 1982-11-25 | ||
| JPS5116677A (ja) * | 1974-07-29 | 1976-02-10 | Sumitomo Chemical Co | Shinkinabuchirofuenonjudotai oyobi sonosanfukaennoseiho |
| JPS596304B2 (ja) * | 1975-11-18 | 1984-02-10 | 住友化学工業株式会社 | シンキナブチロフエノンユウドウタイノセイホウ |
| US4066772A (en) | 1975-07-21 | 1978-01-03 | Janssen Pharmaceutica N.V. | 1,3-Dihydro-1-[3-(1-piperidinyl)propyl]-2H-benzimidazol-2-ones and related compounds |
| US4175129A (en) | 1975-07-21 | 1979-11-20 | Janssen Pharmaceutica N.V. | Antiemetic 1-(benzoxazolylalkyl)-piperidine derivatives |
| US4126687A (en) * | 1976-05-17 | 1978-11-21 | Janssen Pharmaceutica N.V. | Antiemetic, 1-(benzimidazolyl-alkyl)-piperidine derivatives |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR1459A (cs) * | 1901-10-12 | |||
| FR1458901A (fr) * | 1958-04-22 | 1966-04-29 | Procédé de fabrication de dérivés aroylpipéridiniques et notamment de 1-aroyl alcoyl-4-aryl-4-pipéridinols | |
| DE1695194A1 (de) * | 1966-07-11 | 1971-03-18 | Hoffmann La Roche | Verfahren zur Herstellung von Piperidinderivaten |
| US3476762A (en) * | 1966-12-27 | 1969-11-04 | Aldrich Chem Co Inc | 4' - dimethylamino - 4 - (4 - hydroxy-4-phenyl piperidino)butyrophenones and 4 - (4-phenyl-4-hydroxy - piperidino)-1,1-ethylenedioxy - 1 - (4 - dimethylaminophenyl)butanes |
| US3439991A (en) * | 1967-01-20 | 1969-04-22 | George H Fathauer | Dryer control |
-
1970
- 1970-07-14 GB GB3417870A patent/GB1304599A/en not_active Expired
- 1970-07-14 FI FI701982A patent/FI52216C/fi active
- 1970-07-15 FR FR7026007A patent/FR2059517B1/fr not_active Expired
- 1970-07-15 BE BE753472D patent/BE753472A/xx unknown
- 1970-07-15 SE SE7009844A patent/SE379348B/xx unknown
- 1970-07-15 NL NL7010451A patent/NL7010451A/xx unknown
- 1970-07-15 DK DK368170AA patent/DK125245B/da not_active IP Right Cessation
-
1971
- 1971-08-18 FR FR7130087A patent/FR2149291B2/fr not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| SE379348B (cs) | 1975-10-06 |
| FR2059517B1 (cs) | 1975-08-01 |
| FR2149291A2 (cs) | 1973-03-30 |
| DE2033909A1 (de) | 1971-02-04 |
| NL7010451A (cs) | 1971-01-19 |
| BE753472A (fr) | 1970-12-16 |
| FR2059517A1 (cs) | 1971-06-04 |
| GB1304599A (cs) | 1973-01-24 |
| FI52216B (cs) | 1977-03-31 |
| FR2149291B2 (cs) | 1975-10-31 |
| DE2033909B2 (de) | 1976-04-22 |
| DK125245B (da) | 1973-01-22 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| SE382459B (sv) | Forfarande for framstellning av xantonderivat. | |
| BG18599A3 (bg) | Метод за получаване на бета-арил-2-аминоалкоксистироли | |
| SE409708B (sv) | Forfarande for framstellning av 2,4-diamino-5-bensylpyrimidiner | |
| BG17749A3 (bg) | Метод за получаване на фенокси-2-хидрокси -3- циклоалкиламинопропани | |
| FI49723C (fi) | Menetelmä antidepressiivisesti vaikuttavien -morfolino-p-amino-butyro fenonien sekä niiden suolojen valmistamiseksi. | |
| DK134176B (da) | Fremgangsmåde til fremstilling af furan-3-carboxamidderivater. | |
| DK138315B (da) | Fremgangsmåde til fremstilling af pleuromutilin-derivater. | |
| BG17560A3 (bg) | Метод за получаане на 4,20, 22- буфатриеноли- драмнозид- етери | |
| DK125089B (da) | Analogifremgangsmåde til fremstilling af evomonosidderivater. | |
| DK126944B (da) | Analogifremgangsmåde til fremstilling af hexahydrobenzindolderivater. | |
| FI52216C (fi) | Menetelmä gamma-piperidinobutyrofenonijohdannaisten valmistamiseksi. | |
| NL143932B (nl) | Werkwijze ter bereiding van pyrimidopyridazinederivaten. | |
| DK128778B (da) | Analogifremgangsmåde til fremstilling af bis-2-carboxy-chromonylderivater. | |
| DK131863B (da) | Analogifremgangsmåde til fremstilling af thiazolino- eller thiazidino-pyrimidinderivater. | |
| DK124197B (da) | Fremgangsmåde til fremstilling af 14-monoacylderivater af antibiotikum T-2636C. | |
| DK123096B (da) | Analogifremgangsmåde til fremstilling af neriifolinderivater. | |
| DK137181B (da) | Analogifremgangsmåde til fremstilling af 3-amino-kinolinderivater. | |
| DK125096B (da) | Analogifremgangsmåde til fremstilling af thiazolidinderivater. | |
| DK125388B (da) | Fremgangsmåde til fremstilling af phenylaminoethanolderivater. | |
| FI52088C (fi) | Menetelmä 3-(4-asyylioksialkyyli-1-piperatsinyyli)-karbonyylimetyyli-2 -bentsotiatsolinonijohdannaisten valmistamiseksi. | |
| DK137860B (da) | Analogifremgangsmåde til fremstilling af triazolobenzodiazepin-5N-oxydderivater. | |
| NL169870C (nl) | Werkwijze voor de bereiding van 4-pentenalderivaten. | |
| DK123527B (da) | Fremgangsmåde til fremstilling af lumilysergsyrederivater. | |
| FI46157C (fi) | Menetelmä 18-metyyli-5alfa-H-androstaanijohdannaisten valmistamiseksi. | |
| DK135798B (da) | Analogifremgangsmåde til fremstilling af isobutyl-cyclohexenyl-derivater. |