FI115286B - Laonnostin sadonkorjuukoneiden leikkuujärjestelmiin - Google Patents
Laonnostin sadonkorjuukoneiden leikkuujärjestelmiin Download PDFInfo
- Publication number
- FI115286B FI115286B FI20020468A FI20020468A FI115286B FI 115286 B FI115286 B FI 115286B FI 20020468 A FI20020468 A FI 20020468A FI 20020468 A FI20020468 A FI 20020468A FI 115286 B FI115286 B FI 115286B
- Authority
- FI
- Finland
- Prior art keywords
- support rail
- som
- att
- axlyftare
- rail
- Prior art date
Links
- 241001124569 Lycaenidae Species 0.000 title 1
- 229910000831 Steel Inorganic materials 0.000 claims description 41
- 239000010959 steel Substances 0.000 claims description 41
- 238000003306 harvesting Methods 0.000 claims description 7
- 239000000463 material Substances 0.000 claims description 7
- 210000003127 knee Anatomy 0.000 claims description 4
- 230000003014 reinforcing effect Effects 0.000 claims description 4
- 229910000639 Spring steel Inorganic materials 0.000 claims description 2
- RYXPMWYHEBGTRV-UHFFFAOYSA-N Omeprazole sodium Chemical compound [Na+].N=1C2=CC(OC)=CC=C2[N-]C=1S(=O)CC1=NC=C(C)C(OC)=C1C RYXPMWYHEBGTRV-UHFFFAOYSA-N 0.000 claims 3
- 230000015572 biosynthetic process Effects 0.000 description 3
- 235000013339 cereals Nutrition 0.000 description 2
- 210000002414 leg Anatomy 0.000 description 2
- 235000021374 legumes Nutrition 0.000 description 2
- 238000005452 bending Methods 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 238000000034 method Methods 0.000 description 1
- 239000002689 soil Substances 0.000 description 1
- 230000003313 weakening effect Effects 0.000 description 1
Classifications
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01D—HARVESTING; MOWING
- A01D65/00—Grain-crop lifters
- A01D65/02—Lifting fingers
Landscapes
- Life Sciences & Earth Sciences (AREA)
- Environmental Sciences (AREA)
- Harvester Elements (AREA)
- Outside Dividers And Delivering Mechanisms For Harvesters (AREA)
- Agricultural Machines (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE10113107A DE10113107B4 (de) | 2001-03-15 | 2001-03-15 | Ährenheber für Erntemaschinenmähsysteme |
| DE10113107 | 2002-03-15 |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| FI20020468A0 FI20020468A0 (fi) | 2002-03-13 |
| FI20020468L FI20020468L (fi) | 2002-09-16 |
| FI115286B true FI115286B (fi) | 2005-04-15 |
Family
ID=7677977
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| FI20020468A FI115286B (fi) | 2001-03-15 | 2002-03-13 | Laonnostin sadonkorjuukoneiden leikkuujärjestelmiin |
Country Status (10)
| Country | Link |
|---|---|
| US (1) | US6655120B2 (enExample) |
| BR (1) | BR0200812B1 (enExample) |
| CA (1) | CA2374061C (enExample) |
| DE (1) | DE10113107B4 (enExample) |
| FI (1) | FI115286B (enExample) |
| FR (1) | FR2823060B1 (enExample) |
| GB (1) | GB2373163B (enExample) |
| HU (1) | HU228562B1 (enExample) |
| RU (1) | RU2222886C1 (enExample) |
| UA (1) | UA71990C2 (enExample) |
Families Citing this family (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE10123248C1 (de) * | 2001-05-12 | 2002-09-19 | Schumacher Gmbh Geb | Ährenheber für Erntemaschinenmähsysteme |
| US6960131B2 (en) | 2003-11-14 | 2005-11-01 | Td Moser Farms, L.L.C. | Green cicer bean harvesting apparatus and method |
| WO2006072158A1 (en) * | 2005-01-06 | 2006-07-13 | Dave Dietrich | Crop lifter and crop accessory attachment |
| US8539744B2 (en) | 2005-01-06 | 2013-09-24 | Dave Dietrich | Crop lifter and crop accessory attachment |
| CA2579398A1 (en) * | 2007-02-21 | 2008-08-21 | Ralph Mckay Industries Inc. | Crop lifting apparatus |
| DE102009039670B9 (de) * | 2009-09-02 | 2011-07-14 | Gebr. Schumacher Gerätebaugesellschaft mbH, 57612 | Ährenheber |
| DE102012100302A1 (de) * | 2012-01-13 | 2013-07-18 | Gebr. Schumacher Gerätebaugesellschaft mbH | Heber für Erntegut |
| AT514972B1 (de) * | 2013-10-25 | 2015-08-15 | Röchling Leripa Papertech Gmbh & Co Kg | Befestigungsvorrichtung zur Montage eines Ährenhebers |
| DE102016112052A1 (de) | 2016-06-30 | 2018-01-04 | Claas Selbstfahrende Erntemaschinen Gmbh | Ährenheber |
| CA2991348C (en) | 2018-01-09 | 2020-03-10 | 101288550 Saskatchewan Ltd. | Preventing damage from dislodged crop saving accessories |
| CN113455186A (zh) * | 2021-08-19 | 2021-10-01 | 湖南农业大学 | 一种倒伏水稻机械化收割割台及其控制方法 |
Family Cites Families (29)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2734332A (en) * | 1956-02-14 | fisher | ||
| FR451123A (fr) * | 1912-11-20 | 1913-04-11 | Lucien Bouchet | Perfectionnements aux bras releveurs des moissonneuses-lieuses |
| US1862775A (en) * | 1928-11-28 | 1932-06-14 | Caterpillar Tractor Co | Pick-up guard adapter |
| US2141299A (en) * | 1936-03-04 | 1938-12-27 | Hume Love Company | Crop lifter |
| US2394838A (en) * | 1944-01-19 | 1946-02-12 | Beltz Ed | Supplemental lifting finger for cutter bars |
| US2484704A (en) * | 1944-03-31 | 1949-10-11 | Phillip Hyman | Pickup assembly |
| US2576122A (en) * | 1949-02-03 | 1951-11-27 | William I Kenison | Grain cutter guard |
| US2577324A (en) * | 1949-03-29 | 1951-12-04 | Reuben E Goesch | Pickup guard |
| GB752961A (en) * | 1953-05-20 | 1956-07-18 | August Claas And Franz Claas | Improvements in or relating to corn lifters, more particularly for reaping machines |
| US3313095A (en) * | 1964-01-22 | 1967-04-11 | William C Gaterman | Ground sensing crop harvesting apparatus |
| US3579967A (en) * | 1968-09-18 | 1971-05-25 | Gustav Schumacher | Grain-lifter for grain-cutting assemblies |
| US3633350A (en) * | 1969-08-04 | 1972-01-11 | Schumacher Guenter | Grain lifter adjusting devices |
| DE2142153C2 (de) * | 1971-03-08 | 1984-09-20 | Gustav Schumacher Ii | Gleitkufe für Mähwerke von Erntemaschinen |
| DE2207959A1 (de) * | 1972-02-21 | 1972-08-30 | Schumacher | Vorrichtung zum abstuetzen des schneidwerkes einer erntemaschine |
| US3821877A (en) * | 1972-12-11 | 1974-07-02 | J Weinheimer | Process for picking up downed crops and apparatuses therefor |
| DE2531435A1 (de) * | 1975-07-14 | 1977-02-03 | Schumacher | Aehrenheber fuer maehwerke von erntemaschinen |
| DD132751A1 (de) * | 1977-08-24 | 1978-11-01 | Hans Haufe | Aehrenheber fuer maehdrescher |
| US4295328A (en) * | 1978-08-12 | 1981-10-20 | Schumacher Gustav | Holding means for grain lifters, support skids and the like |
| DE3300769A1 (de) * | 1983-01-12 | 1984-07-12 | Gustav Schumacher Ii | Aehrenheber fuer fingerbalkenmaehwerke von erntemaschinen |
| US4704850A (en) * | 1986-02-14 | 1987-11-10 | Obermeier Dale T | Crop lifting attachment for combine snout |
| SU1440413A1 (ru) * | 1986-12-19 | 1988-11-30 | Украинский научно-исследовательский институт механизации и электрификации сельского хозяйства | Стеблеподъемник уборочной машины |
| CA1319019C (en) * | 1989-01-16 | 1993-06-15 | Louis J. Medernach | Crop lifter for swathers or combines |
| RU2045883C1 (ru) * | 1992-11-24 | 1995-10-20 | Всероссийский научно-исследовательский институт кормов им.В.Р.Вильямса | Стеблеподъемник |
| DE4323053C2 (de) * | 1993-07-12 | 1995-07-20 | Rasspe Soehne P | Haltevorrichtung an Ährenhebern für Mähbalken |
| US5906091A (en) * | 1997-08-01 | 1999-05-25 | Gemar; Leslie J. | Grain stalk lifter |
| SI9800071A (sl) * | 1998-03-10 | 1999-10-31 | Gustav Schumacher | Vpenjalna naprava dvigovalca klasja |
| PL189109B1 (pl) * | 1998-03-10 | 2005-06-30 | Gustav Schumacher | Podnośnik kłosów |
| US6244026B1 (en) * | 1999-07-27 | 2001-06-12 | Case Corporation | Crop lifter mechanism |
| DE10123248C1 (de) * | 2001-05-12 | 2002-09-19 | Schumacher Gmbh Geb | Ährenheber für Erntemaschinenmähsysteme |
-
2001
- 2001-03-15 DE DE10113107A patent/DE10113107B4/de not_active Expired - Lifetime
-
2002
- 2002-02-21 GB GB0204097A patent/GB2373163B/en not_active Expired - Lifetime
- 2002-03-01 CA CA002374061A patent/CA2374061C/en not_active Expired - Lifetime
- 2002-03-13 FI FI20020468A patent/FI115286B/fi not_active IP Right Cessation
- 2002-03-13 UA UA2002032033A patent/UA71990C2/uk unknown
- 2002-03-14 RU RU2002106736/12A patent/RU2222886C1/ru active
- 2002-03-14 BR BRPI0200812-2A patent/BR0200812B1/pt not_active IP Right Cessation
- 2002-03-14 HU HU0200982A patent/HU228562B1/hu unknown
- 2002-03-15 FR FR0203220A patent/FR2823060B1/fr not_active Expired - Lifetime
- 2002-03-15 US US10/098,701 patent/US6655120B2/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| RU2222886C1 (ru) | 2004-02-10 |
| FI20020468L (fi) | 2002-09-16 |
| HUP0200982A3 (en) | 2004-05-28 |
| US20020148212A1 (en) | 2002-10-17 |
| FR2823060B1 (fr) | 2005-06-17 |
| HU228562B1 (en) | 2013-04-29 |
| HU0200982D0 (enExample) | 2002-05-29 |
| CA2374061C (en) | 2005-05-10 |
| GB2373163A (en) | 2002-09-18 |
| CA2374061A1 (en) | 2002-09-15 |
| UA71990C2 (en) | 2005-01-17 |
| FI20020468A0 (fi) | 2002-03-13 |
| DE10113107A1 (de) | 2002-09-19 |
| BR0200812A (pt) | 2003-01-07 |
| GB2373163B (en) | 2004-08-18 |
| DE10113107B4 (de) | 2010-01-21 |
| US6655120B2 (en) | 2003-12-02 |
| HUP0200982A2 (en) | 2002-09-28 |
| BR0200812B1 (pt) | 2010-06-29 |
| FR2823060A1 (fr) | 2002-10-11 |
| GB0204097D0 (en) | 2002-04-10 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| FI115286B (fi) | Laonnostin sadonkorjuukoneiden leikkuujärjestelmiin | |
| US6029429A (en) | Header for a crop harvesting machine with adjustment of a longitudinal shape of the cutter bar | |
| CA1267539A (en) | Adjustable leafspring suspension for flexible cutterbar | |
| US6543211B1 (en) | Crop harvesting header with angle adjustment of the knife guards | |
| US11425859B2 (en) | Header cutting system with knife guards | |
| CA1064263A (en) | Mowing apparatus adjustment means | |
| US20100251684A1 (en) | Mowing Finger Arrangement | |
| RU2277321C2 (ru) | Колосоподъемник для косилочных систем уборочных машин | |
| CA2359598C (en) | Crop harvesting header with angle adjustment of the knife guards | |
| US8955298B2 (en) | Mowing finger arrangement | |
| FI3732951T3 (en) | Crop lifter for harvested crops | |
| CS272391A3 (en) | Cutter for agricultural harvesting machines | |
| US6250057B1 (en) | Assembly having a mowing finger and a holding-down element | |
| US8220239B2 (en) | Offset guard bolt attachment system | |
| US20110126503A1 (en) | Sickle Assembly | |
| US20190053431A1 (en) | Crop lifter assembly | |
| CA3138245C (en) | Support rail of an ear lifter for crops | |
| US20220210978A1 (en) | Support rail of an ear lifter for crops | |
| JPH0629937Y2 (ja) | 刈取部の注油装置 | |
| CA2221055A1 (en) | A cutterbar assembly for a reciprocating mower | |
| JP2000262132A (ja) | 刈取収穫機の分草構造 | |
| CA2225662A1 (en) | A cutterbar assembly for a reciprocating mower |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| FG | Patent granted |
Ref document number: 115286 Country of ref document: FI |
|
| MA | Patent expired |