ES445177A1 - Un procedimiento para la produccion de nuevos derivados de isoxazolibenzamida. - Google Patents
Un procedimiento para la produccion de nuevos derivados de isoxazolibenzamida.Info
- Publication number
- ES445177A1 ES445177A1 ES445177A ES445177A ES445177A1 ES 445177 A1 ES445177 A1 ES 445177A1 ES 445177 A ES445177 A ES 445177A ES 445177 A ES445177 A ES 445177A ES 445177 A1 ES445177 A1 ES 445177A1
- Authority
- ES
- Spain
- Prior art keywords
- isoxazolibenzamide
- procedure
- production
- new derivatives
- substituted
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 125000000094 2-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 abstract 1
- 239000002253 acid Substances 0.000 abstract 1
- 239000000411 inducer Substances 0.000 abstract 1
- 229940035363 muscle relaxants Drugs 0.000 abstract 1
- 239000003158 myorelaxant agent Substances 0.000 abstract 1
- WRWNOAXKVPQYBV-UHFFFAOYSA-N n-(1,2-oxazol-3-yl)benzamide Chemical class C=1C=CC=CC=1C(=O)NC=1C=CON=1 WRWNOAXKVPQYBV-UHFFFAOYSA-N 0.000 abstract 1
- HSYAEFRDQRNICN-UHFFFAOYSA-N n-methyl-2-(3-phenyl-1,2-oxazol-5-yl)benzamide Chemical compound CNC(=O)C1=CC=CC=C1C1=CC(C=2C=CC=CC=2)=NO1 HSYAEFRDQRNICN-UHFFFAOYSA-N 0.000 abstract 1
- 239000003204 tranquilizing agent Substances 0.000 abstract 1
- 230000002936 tranquilizing effect Effects 0.000 abstract 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D209/00—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D209/02—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom condensed with one carbocyclic ring
- C07D209/44—Iso-indoles; Hydrogenated iso-indoles
- C07D209/48—Iso-indoles; Hydrogenated iso-indoles with oxygen atoms in positions 1 and 3, e.g. phthalimide
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D261/00—Heterocyclic compounds containing 1,2-oxazole or hydrogenated 1,2-oxazole rings
- C07D261/02—Heterocyclic compounds containing 1,2-oxazole or hydrogenated 1,2-oxazole rings not condensed with other rings
- C07D261/06—Heterocyclic compounds containing 1,2-oxazole or hydrogenated 1,2-oxazole rings not condensed with other rings having two or more double bonds between ring members or between ring members and non-ring members
- C07D261/08—Heterocyclic compounds containing 1,2-oxazole or hydrogenated 1,2-oxazole rings not condensed with other rings having two or more double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Nitrogen And Oxygen As The Only Ring Hetero Atoms (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US05/549,934 US3987179A (en) | 1975-02-14 | 1975-02-14 | Isoxazolyl benzamides as pharmacological agents |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| ES445177A1 true ES445177A1 (es) | 1977-08-16 |
Family
ID=24194993
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| ES445177A Expired ES445177A1 (es) | 1975-02-14 | 1976-02-13 | Un procedimiento para la produccion de nuevos derivados de isoxazolibenzamida. |
Country Status (16)
| Country | Link |
|---|---|
| US (2) | US3987179A (enExample) |
| JP (1) | JPS51105055A (enExample) |
| AU (1) | AU1106076A (enExample) |
| BE (1) | BE838509A (enExample) |
| DE (1) | DE2604119A1 (enExample) |
| DK (1) | DK48276A (enExample) |
| ES (1) | ES445177A1 (enExample) |
| FI (1) | FI760275A7 (enExample) |
| FR (2) | FR2300560A1 (enExample) |
| IL (1) | IL49022A0 (enExample) |
| NL (1) | NL7601318A (enExample) |
| NO (1) | NO760401L (enExample) |
| PT (1) | PT64789B (enExample) |
| SE (1) | SE7601274L (enExample) |
| YU (1) | YU33476A (enExample) |
| ZA (1) | ZA76859B (enExample) |
Families Citing this family (26)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4112108A (en) * | 1976-12-06 | 1978-09-05 | Sandoz, Inc. | Isoxazolyl benzamides |
| US4140515A (en) * | 1977-05-12 | 1979-02-20 | Monsanto Company | Aryl-3-isoxazole benzoates as plant growth regulants and herbicides |
| US4135910A (en) * | 1977-05-12 | 1979-01-23 | Monsanto Company | Oxadiazol-3-yl-benzoates as plant growth regulants |
| US4268299A (en) * | 1978-08-17 | 1981-05-19 | Monsanto Company | Method and composition for plant growth regulation containing trifluoromethyl 1,3,4 oxadiazol benzoates |
| US4210762A (en) * | 1978-08-17 | 1980-07-01 | Monsanto Company | 2[5-(3-Trifluoromethylphenyl)-1,3,4-oxadiazol-2-yl] benzoates |
| US4229204A (en) * | 1978-12-04 | 1980-10-21 | Monsanto Company | Trifluoromethylphenyl isoxazolyl benzoates |
| US4727157A (en) * | 1986-08-27 | 1988-02-23 | Pennwalt Corporation | 3-(Substituted phenyl)-3-(1H-1,2,4-triazol-1-yl)methyl-2-methyl-5-[(substituted phenoxy)methyl]isoxazolidine derivatives |
| US4723021A (en) * | 1986-08-27 | 1988-02-02 | Pennwalt Corporation | Substituted 5-(phenoxyalkyl)-3-phenyl-3-(1H-imidazol-1-ylmethyl)-2-methylisoxazolidines |
| US4769471A (en) * | 1987-04-10 | 1988-09-06 | Pennwalt Corporation | Substituted 3,5-diphenyl-3-(1H-1,2,4-triazol-1-yl-methyl)-2-methylisoxazolidines |
| US4719306A (en) * | 1986-08-27 | 1988-01-12 | Pennwalt Corporation | Substituted 3,5-diphenyl-3-(1H-imidazol-1-ylmethyl)-2-methylisoxazolidines |
| US4831154A (en) * | 1987-04-10 | 1989-05-16 | Pennwalt Corporation | 5-alkyl(or alkenyl)-3-phenyl-3-(1H-imidazol-1-ylmethyl)-2-methylisoxazolidines |
| US4769468A (en) * | 1987-04-10 | 1988-09-06 | Penwalt Corporation | 5-(acyloxyalkyl)-3-phenyl-3-(1H-imidazol-1-ylmethyl)-2-methylisoxazolidines |
| US4767867A (en) * | 1987-04-10 | 1988-08-30 | Pennwalt Corporation | 5-(alkoxyalkyl)-3-phenyl-3-(1H-imidazol-1-ylmethyl)-2-methylisoxazolidines |
| US4727156A (en) * | 1986-08-27 | 1988-02-23 | Pennwalt Corporation | 3-(Substituted phenyl)-3-(1H-imidazol-1-ylmethyl)-2-methyl-5-{[(substituted phenyl)thio]me}isoxazolidine derivatives |
| US4767866A (en) * | 1987-04-10 | 1988-08-30 | Pennwalt Corporation | 3-Phenyl-3-(1H-1,2,4-triazol-1-ylmethyl)-2-methyl-5-alkylisoxazolidines |
| US4767868A (en) * | 1987-04-10 | 1988-08-30 | Pennwalt Corporation | 3-Phenyl-3-(1H-imidazol-1-ylmethyl)-2-methyl-5-[(phenylamino)methyl]isoxazolidines |
| US4769469A (en) * | 1987-04-10 | 1988-09-06 | Pennwalt Corporation | 5-(phenyl or phenoxyalkyl)-3-(2-furanyl)-3-(1H-imidazol-1-ylmethyl)-2-methylisoxazolidines |
| US4769470A (en) * | 1987-10-02 | 1988-09-06 | Pennwalt Corporation | 5-(phenyl or phenoxyalkyl)-3-(2-thienyl)-3-(1H-imidazol-1-ylmethyl)-2-methylisoxazolidines |
| US4777262A (en) * | 1987-10-02 | 1988-10-11 | Pennwalt Corporation | 5-(substituted thiomethyl)-3-phenyl-3-(1H-imidazol-1-ylmethyl)-2-methylisoxazolidine derivatives |
| US4777263A (en) * | 1987-10-02 | 1988-10-11 | Pennwalt Corporation | 5-substituted-3-(2-naphthalenyl)-3-((1H-imidazol-1-ylmethyl) or (1H-1,2,4-triazol-1-ylmethyl))-2-methylisoxazolidines |
| US4749793A (en) * | 1987-10-02 | 1988-06-07 | Pennwalt Corporation | 5-substituted-3-phenyl-3-[1H-imidazol-1-ylmethyl) or (1H-1,2,4-triazol-1-ylmethyl]-2-benzylisoxazolidines (ir 3011) |
| US4785117A (en) * | 1987-10-02 | 1988-11-15 | Pennwalt Corporation | 5,5-disubstituted-3-phenyl-3-phenyl-3-[(1H-imidazol-1-ylmethyl) or (1H-1,2,4-triazol-1-ylmethyl)]-2-methylisoxazolidine derivatives (IR 3012) |
| US4754042A (en) * | 1987-10-02 | 1988-06-28 | Pennwalt Corporation | 5-{[naphthyl(or 2-oxo-1,3-benzoxathiol-6-yl)oxy]methyl}-3-phenyl-3-(1H-imidazol-1-ylmethyl)-2-methylisoxazolidines |
| US4777264A (en) * | 1987-10-02 | 1988-10-11 | Pennwalt Corporation | 5-carbonyl derivatives of 3-phenyl-3-(1H-imadazol-1-ylmethyl)-2-methylisoxazolidines and related compounds thereof |
| US4835283A (en) * | 1988-03-07 | 1989-05-30 | Pennwalt Corporation | 3,5-diphenyl-3-[(1H-imidazol-1-ylmethyl) or (1H-1,2,4-triazol-1-ylmethyl)]-2 |
| JP2019526617A (ja) * | 2016-06-20 | 2019-09-19 | ラトガース ザ ステイト ユニバーシティー オブ ニュージャージー | 治療用化合物 |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB974894A (en) * | 1961-04-06 | 1964-11-11 | Parke Davis & Co | Process for the production of amine compounds |
| US3772284A (en) * | 1966-12-20 | 1973-11-13 | American Cyanamid Co | Azirine compounds |
-
1975
- 1975-02-14 US US05/549,934 patent/US3987179A/en not_active Expired - Lifetime
-
1976
- 1976-02-04 DE DE2604119A patent/DE2604119A1/de active Pending
- 1976-02-05 FI FI760275A patent/FI760275A7/fi not_active Application Discontinuation
- 1976-02-05 SE SE7601274A patent/SE7601274L/xx unknown
- 1976-02-05 DK DK48276*#A patent/DK48276A/da unknown
- 1976-02-06 NO NO760401A patent/NO760401L/no unknown
- 1976-02-10 NL NL7601318A patent/NL7601318A/xx unknown
- 1976-02-11 FR FR7603746A patent/FR2300560A1/fr not_active Withdrawn
- 1976-02-12 JP JP51013340A patent/JPS51105055A/ja active Pending
- 1976-02-12 YU YU00334/76A patent/YU33476A/xx unknown
- 1976-02-12 BE BE164283A patent/BE838509A/xx unknown
- 1976-02-12 IL IL49022A patent/IL49022A0/xx unknown
- 1976-02-12 AU AU11060/76A patent/AU1106076A/en not_active Expired
- 1976-02-12 PT PT64789A patent/PT64789B/pt unknown
- 1976-02-13 ES ES445177A patent/ES445177A1/es not_active Expired
- 1976-02-13 ZA ZA760859A patent/ZA76859B/xx unknown
- 1976-07-22 US US05/707,681 patent/US4086243A/en not_active Expired - Lifetime
- 1976-07-23 FR FR7622493A patent/FR2326420A1/fr not_active Withdrawn
Also Published As
| Publication number | Publication date |
|---|---|
| BE838509A (fr) | 1976-08-12 |
| FR2326420A1 (fr) | 1977-04-29 |
| FI760275A7 (enExample) | 1976-08-15 |
| NO760401L (enExample) | 1976-08-17 |
| JPS51105055A (enExample) | 1976-09-17 |
| IL49022A0 (en) | 1976-04-30 |
| US3987179A (en) | 1976-10-19 |
| FR2300560A1 (fr) | 1976-09-10 |
| AU1106076A (en) | 1977-08-18 |
| ZA76859B (en) | 1977-09-28 |
| PT64789A (fr) | 1976-03-01 |
| PT64789B (fr) | 1977-09-06 |
| NL7601318A (nl) | 1976-08-17 |
| SE7601274L (sv) | 1976-08-16 |
| DE2604119A1 (de) | 1976-08-26 |
| US4086243A (en) | 1978-04-25 |
| DK48276A (da) | 1976-08-15 |
| YU33476A (en) | 1982-05-31 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| ES445177A1 (es) | Un procedimiento para la produccion de nuevos derivados de isoxazolibenzamida. | |
| AU521031B2 (en) | I.c. engine cylinder power testing apparatus | |
| DK152643C (da) | Fremgangsmaade til fremstilling af et oxygen- og carbondioxid-overfoeringsmiddel | |
| IE42382L (en) | Cyclic amino acids | |
| AU504200B2 (en) | Lean mixture i/c engine | |
| JPS51146828A (en) | Photographic colour coupler | |
| JPS525746A (en) | Novel process for preparation of triarymethane derivatives | |
| RO68892A (ro) | Procedeu pentru prepararea unor oxazolidine,tiazolidine,imidazolidinesi oxazine | |
| RO75777A (ro) | Procedeu pentru prepararea unor 1,2-benzizotiazolin-3-one | |
| IT1059779B (it) | Miscuglio amminoalcanolico e procedimento per la sua produzione | |
| DK18776A (da) | Anticalculusblanding | |
| IT1059777B (it) | Miscuglio amminoalcanolico e procedimento per la sua produzione | |
| GB1473602A (enExample) | ||
| AU498818B2 (en) | Measuring r. p. m. & dwell angle of i. c. engine | |
| IL50634A (en) | Preparation of aliphatic 2-amino-1-alcohols, and oxazoline intermediates therefor | |
| FR2317294A1 (fr) | Preparation de 5-cyano-4 methyl-oxazole (1,3) | |
| GB1546189A (en) | Function monitoring by means of test signals | |
| JPS5236643A (en) | Production of nnacyl derivatives of glycine substituted at alphaaposition by novel aromatic group | |
| JPS51117341A (en) | Combustion apparatus | |
| GR60355B (en) | Preparation process of polyarylamines with methylene bridge | |
| BE842467A (fr) | Preparation de bisaminocomposes bis-(n,n-disubstitues | |
| JPS523414A (en) | Production method of magnetic head | |
| JPS5247308A (en) | Signal detection circuit | |
| IT1076495B (it) | Procedimento per produrre l-lisina mediante fermentazione | |
| SE412423B (sv) | Foerfarande foer blekning av fibermassa med en syreinnehallande gas |