EG13318A - Substituted pyridyl methyl esters of cyclopronecarboxylic acids useful as insecticides - Google Patents
Substituted pyridyl methyl esters of cyclopronecarboxylic acids useful as insecticidesInfo
- Publication number
- EG13318A EG13318A EG167/78A EG16778A EG13318A EG 13318 A EG13318 A EG 13318A EG 167/78 A EG167/78 A EG 167/78A EG 16778 A EG16778 A EG 16778A EG 13318 A EG13318 A EG 13318A
- Authority
- EG
- Egypt
- Prior art keywords
- cyclopronecarboxylic
- insecticides
- methyl esters
- substituted pyridyl
- acids useful
- Prior art date
Links
- 239000002253 acid Substances 0.000 title 1
- 150000007513 acids Chemical class 0.000 title 1
- 239000002917 insecticide Substances 0.000 title 1
- 125000005344 pyridylmethyl group Chemical group [H]C1=C([H])C([H])=C([H])C(=N1)C([H])([H])* 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/62—Oxygen or sulfur atoms
- C07D213/63—One oxygen atom
- C07D213/64—One oxygen atom attached in position 2 or 6
- C07D213/647—One oxygen atom attached in position 2 or 6 and having in the molecule an acyl radical containing a saturated three-membered ring, e.g. chrysanthemumic acid esters
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01N—PRESERVATION OF BODIES OF HUMANS OR ANIMALS OR PLANTS OR PARTS THEREOF; BIOCIDES, e.g. AS DISINFECTANTS, AS PESTICIDES OR AS HERBICIDES; PEST REPELLANTS OR ATTRACTANTS; PLANT GROWTH REGULATORS
- A01N53/00—Biocides, pest repellants or attractants, or plant growth regulators containing cyclopropane carboxylic acids or derivatives thereof
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/62—Oxygen or sulfur atoms
- C07D213/70—Sulfur atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Life Sciences & Earth Sciences (AREA)
- Dentistry (AREA)
- Wood Science & Technology (AREA)
- Plant Pathology (AREA)
- Health & Medical Sciences (AREA)
- Engineering & Computer Science (AREA)
- Agronomy & Crop Science (AREA)
- General Health & Medical Sciences (AREA)
- Pest Control & Pesticides (AREA)
- Zoology (AREA)
- Environmental Sciences (AREA)
- Pyridine Compounds (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Plural Heterocyclic Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US77718877A | 1977-03-14 | 1977-03-14 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| EG13318A true EG13318A (en) | 1981-03-31 |
Family
ID=25109528
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| EG167/78A EG13318A (en) | 1977-03-14 | 1978-03-13 | Substituted pyridyl methyl esters of cyclopronecarboxylic acids useful as insecticides |
Country Status (19)
| Country | Link |
|---|---|
| US (1) | US4163787A (ro) |
| JP (1) | JPS53112881A (ro) |
| AR (1) | AR220330A1 (ro) |
| AU (1) | AU512291B2 (ro) |
| BR (1) | BR7801496A (ro) |
| CA (1) | CA1072559A (ro) |
| DE (1) | DE2810881A1 (ro) |
| DK (1) | DK113878A (ro) |
| EG (1) | EG13318A (ro) |
| ES (1) | ES467727A1 (ro) |
| FR (1) | FR2383927A1 (ro) |
| GB (1) | GB1572149A (ro) |
| IL (1) | IL54048A (ro) |
| IN (1) | IN149140B (ro) |
| IT (1) | IT1155862B (ro) |
| NZ (1) | NZ186490A (ro) |
| SE (1) | SE7802866L (ro) |
| TR (1) | TR19917A (ro) |
| YU (1) | YU52278A (ro) |
Families Citing this family (56)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4256893A (en) * | 1977-03-14 | 1981-03-17 | The Dow Chemical Company | Substituted phenoxy and phenylthio pyridine methanols and substituted methanols |
| JPS5579368A (en) * | 1978-12-11 | 1980-06-14 | Nissan Chem Ind Ltd | Phenylcyclopropanecarboxylic acid derivative, its preparation, and insecticide and acaricide |
| US4226872A (en) * | 1979-08-24 | 1980-10-07 | Zoecon Corporation | Pyridyl esters of α-substituted amino acids |
| DE3005201A1 (de) * | 1979-03-02 | 1980-09-11 | Zoecon Corp | Neue ester und thiolester von n-phenylsubstituierten valinderivaten |
| US4281133A (en) * | 1979-03-05 | 1981-07-28 | The Dow Chemical Company | Substituted phenoxy and phenylthio picolinaldehydes |
| US4228172A (en) * | 1979-07-30 | 1980-10-14 | The Dow Chemical Company | Substituted pyridine methyl esters of 2-isopropyl-2-(4-chlorophenyl)acetic acid and their use as insecticides |
| US4262001A (en) * | 1979-07-30 | 1981-04-14 | The Dow Chemical Company | Substituted pyridine methyl esters of 2-isopropyl-2-(4-chlorophenyl)acetic acid and their use as insecticides |
| US4221799A (en) * | 1979-07-30 | 1980-09-09 | The Dow Chemical | Substituted pyridine methyl esters of tetramethyl cyclopropane carboxylic acids and their use as insecticides |
| US4390543A (en) * | 1979-07-30 | 1983-06-28 | Malhotra Sudarshan K | Substituted pyridine methyl esters of 2-isopropyl-2-(4-chlorophenyl) acetic acid and their use as insecticides |
| FR2464253A1 (fr) * | 1979-08-30 | 1981-03-06 | Roussel Uclaf | Esters d'acides cyclopropane carboxyliques, leur procede de preparation et les compositions pesticides les renfermant |
| US4238614A (en) * | 1979-08-30 | 1980-12-09 | Zoecon Corporation | Pyridyl esters of ether and thioether substituted cyclopropanecarboxylic acids |
| FR2499567A2 (fr) * | 1979-08-30 | 1982-08-13 | Roussel Uclaf | Esters d'acides cyclopropane carboxyliques, leur procede de preparation et les compositions pesticides les renfermant |
| US4248875A (en) * | 1979-08-31 | 1981-02-03 | Zoecon Corporation | Pyridyl esters and thiolesters of α-substituted unsaturated acids |
| US4224330A (en) * | 1979-09-13 | 1980-09-23 | Zoecon Corporation | Esters and thiolesters of benzothienyl acids |
| US4301155A (en) * | 1979-10-01 | 1981-11-17 | The Dow Chemical Company | Insecticidal synergistic mixtures of O,O-diethyl O-(3,5,6-trichloro-2-pyridinyl)phosphorothioate and 2,2,3,3-tetramethylcyclopropanecarboxylic acid:cyano(3-phenoxyphenyl)methyl ester |
| US4301154A (en) * | 1979-10-01 | 1981-11-17 | The Dow Chemical Company | Insecticidal synergistic mixtures of 0,0-diethyl 0-(3,5,6-trichloro-2-pyridinyl)phosphorothioate and 3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropane carboxylic acid:cyano(6-phenoxy-2-pyridinyl)methyl ester |
| FR2469403A1 (fr) * | 1979-11-14 | 1981-05-22 | Roussel Uclaf | Esters d'alcools heterocycliques, leurs procedes de preparation et les compositions les renfermant |
| US4338326A (en) * | 1979-11-27 | 1982-07-06 | Union Carbide Corporation | Phenoxypyridinemethyl esters of 4-alkenoic acids |
| US4254264A (en) * | 1979-12-10 | 1981-03-03 | Zoecon Corporation | (6-Phenoxy-2-pyridyl) methyl esters of imidates |
| JPS56147770A (en) * | 1980-04-15 | 1981-11-16 | Sumitomo Chem Co Ltd | Novel carboxylic ester, its preparation and insecticide and acaricide containing the same as active constituent |
| US4342770A (en) * | 1980-06-20 | 1982-08-03 | Dow Chemical Company Limited | Optically active isomers of substituted pyridine methyl esters of cyclopropane carboxylic acid and their use as insecticides |
| FR2486078A1 (fr) * | 1980-07-04 | 1982-01-08 | Roussel Uclaf | Nouveaux esters de l'acide cyclopropane carboxylique, leur procede de preparation et leur application a la lutte contre les parasites |
| US4324896A (en) * | 1980-09-18 | 1982-04-13 | The Dow Chemical Company | 6-(Substituted phenoxy)-2-di-(substituted phenoxy)methyl pyridines |
| US4358594A (en) * | 1980-09-18 | 1982-11-09 | The Dow Chemical Co. | Process for preparing certain 6-phenoxy-2-pyridinecarboxaldehydes |
| US4349680A (en) * | 1980-09-18 | 1982-09-14 | The Dow Chemical Company | 6-(Chloro or substituted phenoxy)-2-di-(substituted phenoxy) methyl pyridines |
| US4351943A (en) * | 1980-09-18 | 1982-09-28 | The Dow Chemical Co. | Production of 6-(chloro or substituted phenoxy)-2-di-(substituted phenoxy)methyl pyridines |
| CA1144169A (en) * | 1980-10-23 | 1983-04-05 | Andrew T.C. Au | Preparation of cyano(6-(substituted phenoxy)-2- pyridinyl)methyl esters of 3-(2,2-dihaloethenyl)-2,2- dimethyl cyclopropane carboxylic acids |
| US4546189A (en) * | 1980-10-23 | 1985-10-08 | The Dow Chemical Company | Preparation of cyano(6-(substituted phenoxy)-2-pyridinyl)methyl esters of 3-(2,2-dihaloethenyl)-2,2-dimethylcyclopropane carboxylic acids |
| US4323574A (en) * | 1980-11-24 | 1982-04-06 | Zoecon Corporation | Cis and trans isomers of α-methyl(6-phenoxy-2-pyridyl)methyl-3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropanecarboxylates and derivatives thereof |
| US4393213A (en) * | 1981-01-14 | 1983-07-12 | Nissan Chemical Industries, Ltd. | Process for producing 6-phenoxypicolinic aldehydes |
| DE3111644A1 (de) * | 1981-03-25 | 1982-10-07 | Bayer Ag, 5090 Leverkusen | Phenoxypyridylmethylester, verfahren zu ihrer herstellung und ihre verwendung in schaedlingsbekaempfungsmitteln |
| JPS5835175A (ja) * | 1981-08-25 | 1983-03-01 | Nissan Chem Ind Ltd | 新規カルボン酸エステルおよびこれらを含有する殺虫殺ダニ剤 |
| DE3140092A1 (de) * | 1981-10-09 | 1983-04-21 | Bayer Ag, 5090 Leverkusen | Substituierte vinylcyclopropancarbonsaeure-(6-phenoxy-2-pyridinyl)-methylester, verfahren zu ihrer herstellung sowie ihre verwendung als schaedlingsbekaempfungsmittel |
| FR2517677B1 (fr) * | 1981-12-09 | 1986-05-16 | Roussel Uclaf | Nouveaux ethers dont les restes organiques comportent des atomes chiraux, leur procede de preparation et leur application au dedoublement des alcools ou de certains composes de structure hemiacetalique. |
| US4485238A (en) * | 1981-12-16 | 1984-11-27 | The Dow Chemical Company | Preparation of ((6-substituted phenoxy-2-pyridinyl)-methyl)-3-(2,2-bis(trifluoromethyl)-1-ethenyl)-2,2-dimethylcyclopropane carboxylates |
| US4423222A (en) * | 1982-05-21 | 1983-12-27 | The Dow Chemical Company | Pyridinyl fungicides and herbicides |
| CA1215067A (en) * | 1982-10-18 | 1986-12-09 | Sudarshan K. Malhotra | 2-(6-phenoxy-3-nitro-2-pyridinoxy)-propionate compounds |
| US4618615A (en) * | 1982-11-18 | 1986-10-21 | Ciba-Geigy Corporation | Certain 6-phenoxy-2-pyridinyl-α-methyl-methylene esters of α-cyclopropyl-α-phenyl-acetic acid derivatives and their use for controlling pests |
| US4515956A (en) * | 1982-12-16 | 1985-05-07 | The Dow Chemical Company | Selective preparation of isomers and enantiomers of cyclopropane carboxylic acids |
| US4479005A (en) * | 1982-12-16 | 1984-10-23 | The Dow Chemical Company | Selective preparation of isomers and enantiomers of cyclopropane carboxylic acids |
| US4776880A (en) * | 1982-12-23 | 1988-10-11 | The Dow Chemical Company | Diphenoxymethylpyridines |
| AU576322B2 (en) * | 1983-07-22 | 1988-08-25 | Ici Australia Limited | Alpha-substituted-alpha-cyanomethyl alcohols |
| GB8327793D0 (en) * | 1983-10-18 | 1983-11-16 | Ici Plc | Halobenzyl esters |
| EP0145661A3 (de) * | 1983-12-02 | 1986-03-19 | Ciba-Geigy Ag | Neue Alkohole |
| WO1985004553A1 (en) * | 1984-04-13 | 1985-10-24 | Fmc Corporation | Fluoropyridinylmethyl cyclopropanecarboxylate insecticides and intermediates |
| US4701464A (en) * | 1984-04-13 | 1987-10-20 | Fmc Corporation | Fluoropyridinylmethyl cyclopropanecarboxylate insecticides |
| US4584304A (en) * | 1984-06-08 | 1986-04-22 | Shell Oil Company | 2-pyridinylmethyl oxyiminocyclopropanecarboxylates as pesticides |
| US4685953A (en) * | 1984-10-02 | 1987-08-11 | The Dow Chemical Company | Diphenoxymethyl-pyridinephosphates and phosphorothioates having herbicidal properties |
| US4731107A (en) * | 1984-10-02 | 1988-03-15 | The Dow Chemical Company | Certain 6-diphenoxymethyl-2-pyridinyl-oxy-propanoates having herbicidal properties |
| US4661144A (en) * | 1984-10-02 | 1987-04-28 | The Dow Chemical Company | Certain 6-aminomethyl or monoalkylamino or dialkylamino or heterocyclicamino-2-diphenoxymethyl pyridines having herbicidal activity |
| US4615728A (en) * | 1985-08-19 | 1986-10-07 | Sandoz Ltd. | Pyridinyloxy propoinamide derivatives useful in increasing the recoverable sugar in sugarcane |
| US4694013A (en) * | 1985-11-08 | 1987-09-15 | E. I. Du Pont De Nemours And Company | Insecticidal and acaricidal phenoxypyrdinyl esters and intermediates |
| US5013352A (en) * | 1990-03-30 | 1991-05-07 | Dowelanco | Substituted pyridyl-cyclohexanediones and their herbicidal uses |
| GB2318010A (en) * | 1996-10-07 | 1998-04-08 | Secr Defence | Reflecting transponder for calibrating phased-array radar |
| WO2012150207A1 (de) * | 2011-05-04 | 2012-11-08 | Bayer Cropscience Ag | Verwendung von cyclopropancarbonsäureeesterderivaten zur bekämpfung von insektizid-resistenten insekten |
| WO2012150223A1 (de) | 2011-05-04 | 2012-11-08 | Bayer Cropscience Ag | Neue pyridinmethylester der cyclopropancarbonsäure als schädlingsbekämpfungsmittel |
Family Cites Families (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1331706A (en) * | 1971-04-23 | 1973-09-26 | Shell Int Research | Cyclopropane derivatives and biologicall active compositions thereof |
| US3737450A (en) * | 1971-11-22 | 1973-06-05 | Zoecon Corp | Insect control agents |
| US3821938A (en) | 1971-12-17 | 1974-07-02 | Ibm | Toner usage sensing system |
| DE2326077C2 (de) * | 1972-05-25 | 1985-12-12 | National Research Development Corp., London | Ungesättigte Cyclopropancarbonsäuren und deren Derivate, deren Herstellung und diese enthaltende Insektizide |
| GB1512955A (en) | 1974-08-12 | 1978-06-01 | Nat Res Dev | Cyclopropane carboxylic esters |
| JPS5813522B2 (ja) | 1974-10-24 | 1983-03-14 | 住友化学工業株式会社 | 新しいシクロプロパンカルボン酸エステルを含有する殺虫、殺ダニ剤 |
| GB1528355A (en) * | 1974-12-03 | 1978-10-11 | Shell Int Research | Cyclopropane derivatives and compositions containing them |
| GB1518508A (en) * | 1974-12-05 | 1978-07-19 | Ici Ltd | Cyclopropane carboxylic acid esters useful as insecticide |
| US3962458A (en) * | 1975-02-13 | 1976-06-08 | American Cyanamid Company | Systemic control of ectoparasites with pyrethroids |
-
1977
- 1977-12-12 US US05/859,908 patent/US4163787A/en not_active Expired - Lifetime
-
1978
- 1978-02-07 CA CA296,403A patent/CA1072559A/en not_active Expired
- 1978-02-13 IN IN161/CAL/78A patent/IN149140B/en unknown
- 1978-02-13 AU AU33223/78A patent/AU512291B2/en not_active Expired
- 1978-02-14 IL IL54048A patent/IL54048A/xx unknown
- 1978-02-15 NZ NZ186490A patent/NZ186490A/xx unknown
- 1978-03-06 YU YU00522/78A patent/YU52278A/xx unknown
- 1978-03-06 IT IT48307/78A patent/IT1155862B/it active
- 1978-03-07 TR TR19917A patent/TR19917A/xx unknown
- 1978-03-09 FR FR7806810A patent/FR2383927A1/fr active Granted
- 1978-03-09 ES ES467727A patent/ES467727A1/es not_active Expired
- 1978-03-10 GB GB9658/78A patent/GB1572149A/en not_active Expired
- 1978-03-13 AR AR271398A patent/AR220330A1/es active
- 1978-03-13 DE DE19782810881 patent/DE2810881A1/de not_active Withdrawn
- 1978-03-13 EG EG167/78A patent/EG13318A/xx active
- 1978-03-13 SE SE7802866A patent/SE7802866L/xx unknown
- 1978-03-13 BR BR7801496A patent/BR7801496A/pt unknown
- 1978-03-14 JP JP2920478A patent/JPS53112881A/ja active Granted
- 1978-03-14 DK DK113878A patent/DK113878A/da not_active Application Discontinuation
Also Published As
| Publication number | Publication date |
|---|---|
| AU512291B2 (en) | 1980-10-02 |
| YU52278A (en) | 1982-10-31 |
| DK113878A (da) | 1978-09-15 |
| IL54048A (en) | 1981-03-31 |
| BR7801496A (pt) | 1979-01-02 |
| IT7848307A0 (it) | 1978-03-06 |
| US4163787A (en) | 1979-08-07 |
| CA1072559A (en) | 1980-02-26 |
| SE7802866L (sv) | 1978-09-15 |
| IT1155862B (it) | 1987-01-28 |
| FR2383927B1 (ro) | 1980-12-19 |
| IL54048A0 (en) | 1978-04-30 |
| NZ186490A (en) | 1981-03-16 |
| GB1572149A (en) | 1980-07-23 |
| ES467727A1 (es) | 1978-10-16 |
| TR19917A (tr) | 1980-04-28 |
| AU3322378A (en) | 1979-08-23 |
| DE2810881A1 (de) | 1978-09-21 |
| JPS53112881A (en) | 1978-10-02 |
| AR220330A1 (es) | 1980-10-31 |
| IN149140B (ro) | 1981-09-26 |
| FR2383927A1 (fr) | 1978-10-13 |
| JPS5745433B2 (ro) | 1982-09-28 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EG13318A (en) | Substituted pyridyl methyl esters of cyclopronecarboxylic acids useful as insecticides | |
| EG13028A (en) | Novel cyclopropane derivatives useful as insecticides | |
| GR64826B (en) | Method for the preparation of n-substituted-w-aminoalkanoyl-w-aminoalkanic acids | |
| DE2861599D1 (en) | Process for the preparation of optically active alpha-hydroxycarboxylic acids | |
| JPS5419913A (en) | Alphaahalomethyl derivative of alphaaamino acid | |
| JPS5414916A (en) | Alphaaacetylene derivative of alphaaamino acid | |
| GR64459B (en) | Method for the preparation of t-azaxanthono-3-carboxylic acids | |
| EG12767A (en) | Process for preparing of novel substituted benzoylureidodiphenyl esters and their use as insecticides | |
| BR7800822A (pt) | Process for the preparation of new esters | |
| AU524179B2 (en) | Pesticidal esters of substituted cyclopropane corboxylic acids | |
| JPS5579385A (en) | Manufacture of apovincamine ester derivative | |
| IL55933A (en) | Production of alkyl esters of ypsilon-chloroalkanoic acids from butyrolactones | |
| BR7806364A (pt) | Preparacao de esteres de alfa-ciano-benzila | |
| GB2010819B (en) | Insecticidal compounds of phenylcyclopropane carboxylic acid esters | |
| GB2005663B (en) | Basic esters of polyhydroxy compounds | |
| IL58711A (en) | Preparation of basic esters of substituted hydroxycyclohexanecarboxylic acids | |
| GB2010262B (en) | Cycloptopane carboxylic acid ester derivatives | |
| GB2010269B (en) | Methoxymethyl esters of certain substituted imidazolinyl-3-methyl-3-cephem-4-carboxylic acids | |
| GR64162B (en) | Method for the preparation of acylydrocarbilaminoalkanics acids | |
| GB2001963B (en) | Esters of mercaptopropanoic acids | |
| JPS54132556A (en) | Novel cyclobutane carboxylic acid derivative* its manufacture and use as insecticide | |
| JPS5392744A (en) | Derivative of omegaaaryloxyy133 prostin acid | |
| SE7806739L (sv) | Forfarande for framstellning av metylestrar av karboxylsyror | |
| EG13133A (en) | Process for preparing of cyclopropance carboxylic acid esters and their use as insecticides | |
| JPS5396313A (en) | Lysine salt of alphaa methyl *isopropyll22 indanyll5* acetic acid |