DK5378A - Fremgangsmaade til fremstilling af cephalosporinderivater - Google Patents
Fremgangsmaade til fremstilling af cephalosporinderivaterInfo
- Publication number
- DK5378A DK5378A DK5378A DK5378A DK5378A DK 5378 A DK5378 A DK 5378A DK 5378 A DK5378 A DK 5378A DK 5378 A DK5378 A DK 5378A DK 5378 A DK5378 A DK 5378A
- Authority
- DK
- Denmark
- Prior art keywords
- preparing
- procedure
- cephalosporine derivatives
- cephalosporine
- derivatives
- Prior art date
Links
- HOKIDJSKDBPKTQ-UHFFFAOYSA-N 3-(acetyloxymethyl)-7-[(5-amino-5-carboxypentanoyl)amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical class S1CC(COC(=O)C)=C(C(O)=O)N2C(=O)C(NC(=O)CCCC(N)C(O)=O)C12 HOKIDJSKDBPKTQ-UHFFFAOYSA-N 0.000 title 1
Applications Claiming Priority (14)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP152174 | 1973-12-25 | ||
| JP741521A JPS57873B2 (da) | 1973-12-25 | 1973-12-25 | |
| JP2075274 | 1974-02-20 | ||
| JP49020752A JPS50111093A (da) | 1974-02-20 | 1974-02-20 | |
| JP4257474 | 1974-04-15 | ||
| JP4257474A JPS57874B2 (da) | 1974-04-15 | 1974-04-15 | |
| JP8262374A JPS5652908B2 (da) | 1974-07-17 | 1974-07-17 | |
| JP8262374 | 1974-07-17 | ||
| JP13138174A JPS5512913B2 (da) | 1974-11-13 | 1974-11-13 | |
| JP13138174 | 1974-11-13 | ||
| DK669174A DK151339C (da) | 1973-12-25 | 1974-12-20 | Analogifremgangsmaade til fremstilling af 7-(2-(2-imino-4-thiazolin-4-yl)-acetamido)-cephalosporinderivater |
| DK669174 | 1974-12-20 | ||
| KR7500661A KR800001569B1 (ko) | 1973-12-25 | 1975-03-29 | 세팔로스포린 유도체의 제조법 |
| KR750000661 | 1975-03-29 |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DK5378A true DK5378A (da) | 1978-01-05 |
| DK151026B DK151026B (da) | 1987-10-12 |
| DK151026C DK151026C (da) | 1988-06-06 |
Family
ID=27561823
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DK005378A DK151026C (da) | 1973-12-25 | 1978-01-05 | 7-(4-halogen-3-oxobutyryl)-cephalosporinderivater til anvendelse som mellemprodukt ved fremstilling af 7-(2-(2-imino-4-thiazolin-4-yl)-acetamido)-cephalosporinderivater |
Country Status (1)
| Country | Link |
|---|---|
| DK (1) | DK151026C (da) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5413465A (en) * | 1994-02-15 | 1995-05-09 | Lcd, Inc. | Propulsion device having circular array of inclined airfoil elements with radially-outwardly directed vacuum-inducing surfaces |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DK119672A (da) * |
-
1978
- 1978-01-05 DK DK005378A patent/DK151026C/da not_active IP Right Cessation
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5413465A (en) * | 1994-02-15 | 1995-05-09 | Lcd, Inc. | Propulsion device having circular array of inclined airfoil elements with radially-outwardly directed vacuum-inducing surfaces |
Also Published As
| Publication number | Publication date |
|---|---|
| DK151026C (da) | 1988-06-06 |
| DK151026B (da) | 1987-10-12 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| SE416299B (sv) | Forfarande for framstellning av heterocykliska foreningar | |
| SE419981B (sv) | Forfarande for framstellning av 1alfa-hydroxi-vitamin d-derivat | |
| DK155014C (da) | Fremgangsmaade til fremstilling af polyetherimider | |
| DK145157C (da) | Analogifremgangsmaade til fremstilling af penicilliner | |
| DK292475A (da) | Fremgangsmade til fremstilling af derivater af 3-amino-2-hydroxy-1-phenoxy-propan | |
| SE422581B (sv) | Analogiforfarande for framstellning av n-substituerade 3-hydroxi-8-oxamorfinaner | |
| DK156642C (da) | Analogifremgangsmaade til fremstilling af napthalenderivater | |
| SE420098B (sv) | Forfarande for framstellning av linkomycinderivat | |
| DK343275A (da) | Fremgangsmade til fremstilling af cephalosporinderivater | |
| DK147004C (da) | Analogifremgangsmaade til fremstilling af oxygenerede alkylxanthinderivater | |
| NO151585C (no) | Fremgangsmaate for fremstilling 6-deoksyoksytetracyklin | |
| DK143804C (da) | Analogifremgangsmaade til fremstilling af ergopeptinderivater | |
| SE421313B (sv) | Forfarande for framstellning av 2-(fenoxialkyltio)-5-nitroimidazoler | |
| SE421129B (sv) | Forfarande for framstellning av poly-n-alkyl-iminoalaner | |
| SE419543B (sv) | Forfarande for framstellning av vissa angivna isokinolinderivat | |
| DK131633C (da) | Fremgangsmade til fremstilling af 3-(17beta-4-androsten-3-on-17beta-yl)-propiolacton | |
| DK296175A (da) | Fremgangsmade til fremstilling af cephalosporinderivater | |
| IT1023026B (it) | Procedimento per preparare composti pirimidinici | |
| DK435375A (da) | Fremgangsmade til fremstilling af cephalosporinderivater | |
| DK156391C (da) | Analogifremgangsmaade til fremstilling af 3-aminopyrrolderivater | |
| TR18287A (tr) | Triasetonamin hazirlamaya mahsus usul | |
| DK145156C (da) | Fremgangsmaade til fremstilling af sulfonylmethyl-perhydroindan-5-oner | |
| SE415100B (sv) | Forfarande for framstellning av kinuklidin-kinolinderivat | |
| SE417966B (sv) | Forfarande for framstellning av pyrimidinoaminometyl-ergolinderivat | |
| DK368675A (da) | Fremgangsmade til fremstilling af cephalosporinforbindelser |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PUP | Patent expired |