DK2197874T3 - Pyrazin-2-YL-PYRIDIN-2-YL-AMINE AND pyrazin-2-yl-pyrimidine-4-YL-AMINE COMPOUNDS AND THEIR USE - Google Patents
Pyrazin-2-YL-PYRIDIN-2-YL-AMINE AND pyrazin-2-yl-pyrimidine-4-YL-AMINE COMPOUNDS AND THEIR USE Download PDFInfo
- Publication number
- DK2197874T3 DK2197874T3 DK08806506.5T DK08806506T DK2197874T3 DK 2197874 T3 DK2197874 T3 DK 2197874T3 DK 08806506 T DK08806506 T DK 08806506T DK 2197874 T3 DK2197874 T3 DK 2197874T3
- Authority
- DK
- Denmark
- Prior art keywords
- independently
- ylamino
- synthesis
- alkyl
- optionally substituted
- Prior art date
Links
- IXZMTZOSMOHJMU-UHFFFAOYSA-N n-pyrazin-2-ylpyrimidin-4-amine Chemical class C=1N=CC=NC=1NC1=CC=NC=N1 IXZMTZOSMOHJMU-UHFFFAOYSA-N 0.000 title description 4
- GOYIJZBEFGZUSR-UHFFFAOYSA-N n-pyridin-2-ylpyrazin-2-amine Chemical compound C=1N=CC=NC=1NC1=CC=CC=N1 GOYIJZBEFGZUSR-UHFFFAOYSA-N 0.000 title description 3
- 150000001875 compounds Chemical class 0.000 claims description 323
- 238000000034 method Methods 0.000 claims description 191
- -1 pyrrolidino, piperidino, piperazino Chemical group 0.000 claims description 169
- 238000011282 treatment Methods 0.000 claims description 119
- 125000001931 aliphatic group Chemical group 0.000 claims description 111
- 206010028980 Neoplasm Diseases 0.000 claims description 69
- 239000003795 chemical substances by application Substances 0.000 claims description 69
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 55
- 239000003112 inhibitor Substances 0.000 claims description 52
- 201000011510 cancer Diseases 0.000 claims description 51
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 49
- 125000003118 aryl group Chemical group 0.000 claims description 32
- 125000004573 morpholin-4-yl group Chemical group N1(CCOCC1)* 0.000 claims description 31
- 230000005764 inhibitory process Effects 0.000 claims description 30
- 239000012623 DNA damaging agent Substances 0.000 claims description 24
- 230000000340 anti-metabolite Effects 0.000 claims description 24
- 229940100197 antimetabolite Drugs 0.000 claims description 24
- 239000002256 antimetabolite Substances 0.000 claims description 24
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 24
- 125000001424 substituent group Chemical group 0.000 claims description 24
- 102000003915 DNA Topoisomerases Human genes 0.000 claims description 23
- 108090000323 DNA Topoisomerases Proteins 0.000 claims description 23
- 102000007537 Type II DNA Topoisomerases Human genes 0.000 claims description 23
- 108010046308 Type II DNA Topoisomerases Proteins 0.000 claims description 23
- 239000003814 drug Substances 0.000 claims description 21
- 125000005913 (C3-C6) cycloalkyl group Chemical group 0.000 claims description 19
- 230000001404 mediated effect Effects 0.000 claims description 19
- 150000003839 salts Chemical class 0.000 claims description 18
- 238000002560 therapeutic procedure Methods 0.000 claims description 17
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 claims description 15
- 125000000217 alkyl group Chemical group 0.000 claims description 14
- 201000010099 disease Diseases 0.000 claims description 14
- 239000008194 pharmaceutical composition Substances 0.000 claims description 14
- 239000003085 diluting agent Substances 0.000 claims description 12
- 229920006395 saturated elastomer Polymers 0.000 claims description 12
- 239000012453 solvate Substances 0.000 claims description 12
- 230000002062 proliferating effect Effects 0.000 claims description 11
- 125000006273 (C1-C3) alkyl group Chemical group 0.000 claims description 10
- 125000003226 pyrazolyl group Chemical group 0.000 claims description 10
- 206010009944 Colon cancer Diseases 0.000 claims description 9
- 238000004519 manufacturing process Methods 0.000 claims description 9
- 201000001441 melanoma Diseases 0.000 claims description 9
- 125000001544 thienyl group Chemical group 0.000 claims description 9
- 208000001333 Colorectal Neoplasms Diseases 0.000 claims description 8
- 239000003937 drug carrier Substances 0.000 claims description 8
- 206010006187 Breast cancer Diseases 0.000 claims description 7
- 208000026310 Breast neoplasm Diseases 0.000 claims description 7
- 206010058467 Lung neoplasm malignant Diseases 0.000 claims description 7
- 206010033128 Ovarian cancer Diseases 0.000 claims description 7
- 206010061535 Ovarian neoplasm Diseases 0.000 claims description 7
- 201000005202 lung cancer Diseases 0.000 claims description 7
- 208000020816 lung neoplasm Diseases 0.000 claims description 7
- 125000000882 C2-C6 alkenyl group Chemical group 0.000 claims description 6
- 125000003601 C2-C6 alkynyl group Chemical group 0.000 claims description 6
- 101000777293 Homo sapiens Serine/threonine-protein kinase Chk1 Proteins 0.000 claims description 6
- 241001465754 Metazoa Species 0.000 claims description 6
- 102100031081 Serine/threonine-protein kinase Chk1 Human genes 0.000 claims description 6
- 230000005865 ionizing radiation Effects 0.000 claims description 4
- 125000004169 (C1-C6) alkyl group Chemical group 0.000 claims description 3
- 101100079135 Arabidopsis thaliana NAC92 gene Proteins 0.000 claims description 2
- 101100231811 Saccharomyces cerevisiae (strain ATCC 204508 / S288c) HSP150 gene Proteins 0.000 claims description 2
- 125000002947 alkylene group Chemical group 0.000 claims 15
- 210000004498 neuroglial cell Anatomy 0.000 claims 2
- 101150110809 ORM1 gene Proteins 0.000 claims 1
- 125000000392 cycloalkenyl group Chemical group 0.000 claims 1
- 125000000753 cycloalkyl group Chemical group 0.000 claims 1
- 125000001072 heteroaryl group Chemical group 0.000 claims 1
- 238000003786 synthesis reaction Methods 0.000 description 377
- 230000015572 biosynthetic process Effects 0.000 description 373
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 356
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 266
- 238000005160 1H NMR spectroscopy Methods 0.000 description 182
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 164
- 238000004895 liquid chromatography mass spectrometry Methods 0.000 description 163
- 239000000203 mixture Substances 0.000 description 142
- 239000000243 solution Substances 0.000 description 109
- 229910052739 hydrogen Inorganic materials 0.000 description 86
- 239000002904 solvent Substances 0.000 description 78
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 74
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 72
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 70
- 125000005842 heteroatom Chemical group 0.000 description 70
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 69
- IAZDPXIOMUYVGZ-WFGJKAKNSA-N Dimethyl sulfoxide Chemical compound [2H]C([2H])([2H])S(=O)C([2H])([2H])[2H] IAZDPXIOMUYVGZ-WFGJKAKNSA-N 0.000 description 63
- 239000011541 reaction mixture Substances 0.000 description 61
- 235000019439 ethyl acetate Nutrition 0.000 description 57
- 239000007787 solid Substances 0.000 description 56
- 108010019244 Checkpoint Kinase 1 Proteins 0.000 description 55
- 102000006459 Checkpoint Kinase 1 Human genes 0.000 description 55
- 210000004027 cell Anatomy 0.000 description 55
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 54
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 51
- 239000011347 resin Substances 0.000 description 45
- 229920005989 resin Polymers 0.000 description 45
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 43
- 230000002378 acidificating effect Effects 0.000 description 39
- 229910052757 nitrogen Inorganic materials 0.000 description 39
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 35
- 239000012043 crude product Substances 0.000 description 32
- 238000009472 formulation Methods 0.000 description 32
- 239000003921 oil Substances 0.000 description 32
- 235000019198 oils Nutrition 0.000 description 28
- 150000001412 amines Chemical class 0.000 description 27
- CBHOOMGKXCMKIR-UHFFFAOYSA-N azane;methanol Chemical compound N.OC CBHOOMGKXCMKIR-UHFFFAOYSA-N 0.000 description 27
- 238000003818 flash chromatography Methods 0.000 description 27
- 238000005342 ion exchange Methods 0.000 description 27
- OKKJLVBELUTLKV-VMNATFBRSA-N methanol-d1 Chemical compound [2H]OC OKKJLVBELUTLKV-VMNATFBRSA-N 0.000 description 27
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 26
- 239000000377 silicon dioxide Substances 0.000 description 26
- 239000002585 base Substances 0.000 description 25
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 24
- 238000012746 preparative thin layer chromatography Methods 0.000 description 24
- QTBSBXVTEAMEQO-UHFFFAOYSA-N acetic acid Substances CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 23
- 229910021529 ammonia Inorganic materials 0.000 description 23
- 102000029749 Microtubule Human genes 0.000 description 22
- 108091022875 Microtubule Proteins 0.000 description 22
- 238000010438 heat treatment Methods 0.000 description 22
- 210000004688 microtubule Anatomy 0.000 description 22
- 239000012074 organic phase Substances 0.000 description 22
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 21
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 20
- 239000008346 aqueous phase Substances 0.000 description 20
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 18
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 18
- 239000000543 intermediate Substances 0.000 description 17
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 17
- 230000005855 radiation Effects 0.000 description 17
- 239000000843 powder Substances 0.000 description 16
- 239000000047 product Substances 0.000 description 16
- 239000000725 suspension Substances 0.000 description 16
- CXNIUSPIQKWYAI-UHFFFAOYSA-N xantphos Chemical compound C=12OC3=C(P(C=4C=CC=CC=4)C=4C=CC=CC=4)C=CC=C3C(C)(C)C2=CC=CC=1P(C=1C=CC=CC=1)C1=CC=CC=C1 CXNIUSPIQKWYAI-UHFFFAOYSA-N 0.000 description 16
- 238000013459 approach Methods 0.000 description 15
- 238000006243 chemical reaction Methods 0.000 description 15
- 150000002148 esters Chemical class 0.000 description 15
- 239000007788 liquid Substances 0.000 description 15
- 229910000069 nitrogen hydride Inorganic materials 0.000 description 15
- 125000003386 piperidinyl group Chemical group 0.000 description 15
- 125000006239 protecting group Chemical group 0.000 description 15
- 238000007429 general method Methods 0.000 description 14
- 239000000741 silica gel Substances 0.000 description 14
- 229910002027 silica gel Inorganic materials 0.000 description 14
- 125000000876 trifluoromethoxy group Chemical group FC(F)(F)O* 0.000 description 14
- 230000005778 DNA damage Effects 0.000 description 13
- 231100000277 DNA damage Toxicity 0.000 description 13
- 239000002253 acid Substances 0.000 description 13
- 238000003556 assay Methods 0.000 description 13
- 125000002147 dimethylamino group Chemical group [H]C([H])([H])N(*)C([H])([H])[H] 0.000 description 13
- 125000004433 nitrogen atom Chemical group N* 0.000 description 13
- 125000006574 non-aromatic ring group Chemical group 0.000 description 13
- 238000000746 purification Methods 0.000 description 13
- 125000000719 pyrrolidinyl group Chemical group 0.000 description 13
- 125000003718 tetrahydrofuranyl group Chemical group 0.000 description 13
- 125000001412 tetrahydropyranyl group Chemical group 0.000 description 13
- 125000002757 morpholinyl group Chemical group 0.000 description 12
- 229910052763 palladium Inorganic materials 0.000 description 12
- 125000004193 piperazinyl group Chemical group 0.000 description 12
- 125000000524 functional group Chemical group 0.000 description 11
- 230000002401 inhibitory effect Effects 0.000 description 11
- 125000002112 pyrrolidino group Chemical group [*]N1C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 description 11
- PVNIIMVLHYAWGP-UHFFFAOYSA-N Niacin Chemical compound OC(=O)C1=CC=CN=C1 PVNIIMVLHYAWGP-UHFFFAOYSA-N 0.000 description 10
- CSCPPACGZOOCGX-WFGJKAKNSA-N acetone d6 Chemical compound [2H]C([2H])([2H])C(=O)C([2H])([2H])[2H] CSCPPACGZOOCGX-WFGJKAKNSA-N 0.000 description 10
- 238000005576 amination reaction Methods 0.000 description 10
- 230000004663 cell proliferation Effects 0.000 description 10
- LNAMMBFJMYMQTO-FNEBRGMMSA-N chloroform;(1e,4e)-1,5-diphenylpenta-1,4-dien-3-one;palladium Chemical compound [Pd].[Pd].ClC(Cl)Cl.C=1C=CC=CC=1\C=C\C(=O)\C=C\C1=CC=CC=C1.C=1C=CC=CC=1\C=C\C(=O)\C=C\C1=CC=CC=C1.C=1C=CC=CC=1\C=C\C(=O)\C=C\C1=CC=CC=C1 LNAMMBFJMYMQTO-FNEBRGMMSA-N 0.000 description 10
- 230000000694 effects Effects 0.000 description 10
- 238000004128 high performance liquid chromatography Methods 0.000 description 10
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 10
- 229910000029 sodium carbonate Inorganic materials 0.000 description 10
- 239000003826 tablet Substances 0.000 description 10
- DYHSDKLCOJIUFX-UHFFFAOYSA-N tert-butoxycarbonyl anhydride Chemical compound CC(C)(C)OC(=O)OC(=O)OC(C)(C)C DYHSDKLCOJIUFX-UHFFFAOYSA-N 0.000 description 10
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 9
- VYANAPRTDDQFJY-UHFFFAOYSA-N 5-aminopyrazine-2-carbonitrile Chemical compound NC1=CN=C(C#N)C=N1 VYANAPRTDDQFJY-UHFFFAOYSA-N 0.000 description 9
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 9
- 230000012820 cell cycle checkpoint Effects 0.000 description 9
- 239000006071 cream Substances 0.000 description 9
- 230000002950 deficient Effects 0.000 description 9
- 238000000338 in vitro Methods 0.000 description 9
- 238000001727 in vivo Methods 0.000 description 9
- 239000004615 ingredient Substances 0.000 description 9
- 235000001968 nicotinic acid Nutrition 0.000 description 9
- 239000011664 nicotinic acid Substances 0.000 description 9
- NFHFRUOZVGFOOS-UHFFFAOYSA-N palladium;triphenylphosphane Chemical compound [Pd].C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 NFHFRUOZVGFOOS-UHFFFAOYSA-N 0.000 description 9
- 229910000104 sodium hydride Inorganic materials 0.000 description 9
- 230000001225 therapeutic effect Effects 0.000 description 9
- 239000003643 water by type Substances 0.000 description 9
- 230000033616 DNA repair Effects 0.000 description 8
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 8
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 8
- 108091000080 Phosphotransferase Proteins 0.000 description 8
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 8
- 239000012267 brine Substances 0.000 description 8
- FJDQFPXHSGXQBY-UHFFFAOYSA-L caesium carbonate Chemical compound [Cs+].[Cs+].[O-]C([O-])=O FJDQFPXHSGXQBY-UHFFFAOYSA-L 0.000 description 8
- 229910000024 caesium carbonate Inorganic materials 0.000 description 8
- 101150113535 chek1 gene Proteins 0.000 description 8
- OAYLNYINCPYISS-UHFFFAOYSA-N ethyl acetate;hexane Chemical compound CCCCCC.CCOC(C)=O OAYLNYINCPYISS-UHFFFAOYSA-N 0.000 description 8
- 125000000250 methylamino group Chemical group [H]N(*)C([H])([H])[H] 0.000 description 8
- 239000000546 pharmaceutical excipient Substances 0.000 description 8
- 102000020233 phosphotransferase Human genes 0.000 description 8
- 229940002612 prodrug Drugs 0.000 description 8
- 239000000651 prodrug Substances 0.000 description 8
- 125000004076 pyridyl group Chemical group 0.000 description 8
- MFRIHAYPQRLWNB-UHFFFAOYSA-N sodium tert-butoxide Chemical compound [Na+].CC(C)(C)[O-] MFRIHAYPQRLWNB-UHFFFAOYSA-N 0.000 description 8
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 8
- YGDHJAMSJWLAFR-UHFFFAOYSA-N tert-butyl 3-[[[5-amino-2-[(5-cyanopyrazin-2-yl)amino]pyridin-4-yl]amino]methyl]piperidine-1-carboxylate Chemical compound C1N(C(=O)OC(C)(C)C)CCCC1CNC1=CC(NC=2N=CC(=NC=2)C#N)=NC=C1N YGDHJAMSJWLAFR-UHFFFAOYSA-N 0.000 description 8
- 210000004881 tumor cell Anatomy 0.000 description 8
- 108020004414 DNA Proteins 0.000 description 7
- 208000032612 Glial tumor Diseases 0.000 description 7
- 206010018338 Glioma Diseases 0.000 description 7
- 230000001668 ameliorated effect Effects 0.000 description 7
- 150000001408 amides Chemical class 0.000 description 7
- 239000000969 carrier Substances 0.000 description 7
- 231100000024 genotoxic Toxicity 0.000 description 7
- 230000001738 genotoxic effect Effects 0.000 description 7
- 125000002883 imidazolyl group Chemical group 0.000 description 7
- 125000000842 isoxazolyl group Chemical group 0.000 description 7
- 125000002971 oxazolyl group Chemical group 0.000 description 7
- 239000012071 phase Substances 0.000 description 7
- 125000004482 piperidin-4-yl group Chemical group N1CCC(CC1)* 0.000 description 7
- 229960005235 piperonyl butoxide Drugs 0.000 description 7
- 125000000714 pyrimidinyl group Chemical group 0.000 description 7
- 230000001105 regulatory effect Effects 0.000 description 7
- 238000012360 testing method Methods 0.000 description 7
- 125000000335 thiazolyl group Chemical group 0.000 description 7
- 125000001425 triazolyl group Chemical group 0.000 description 7
- DEJUUKULVAIMNF-UHFFFAOYSA-N 2-chloro-5-iodopyridin-4-amine Chemical compound NC1=CC(Cl)=NC=C1I DEJUUKULVAIMNF-UHFFFAOYSA-N 0.000 description 6
- MCFUHWBBTIHPCP-UHFFFAOYSA-N 3-amino-2h-pyrazine-1-carbonitrile Chemical compound NC1=NC=CN(C#N)C1 MCFUHWBBTIHPCP-UHFFFAOYSA-N 0.000 description 6
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 6
- WMFOQBRAJBCJND-UHFFFAOYSA-M Lithium hydroxide Chemical compound [Li+].[OH-] WMFOQBRAJBCJND-UHFFFAOYSA-M 0.000 description 6
- 229920001213 Polysorbate 20 Polymers 0.000 description 6
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- 230000006907 apoptotic process Effects 0.000 description 6
- 125000002785 azepinyl group Chemical group 0.000 description 6
- 125000002393 azetidinyl group Chemical group 0.000 description 6
- MUALRAIOVNYAIW-UHFFFAOYSA-N binap Chemical compound C1=CC=CC=C1P(C=1C(=C2C=CC=CC2=CC=1)C=1C2=CC=CC=C2C=CC=1P(C=1C=CC=CC=1)C=1C=CC=CC=1)C1=CC=CC=C1 MUALRAIOVNYAIW-UHFFFAOYSA-N 0.000 description 6
- 238000004587 chromatography analysis Methods 0.000 description 6
- 239000000306 component Substances 0.000 description 6
- 238000001816 cooling Methods 0.000 description 6
- 125000002576 diazepinyl group Chemical group N1N=C(C=CC=C1)* 0.000 description 6
- 125000000532 dioxanyl group Chemical group 0.000 description 6
- 239000000839 emulsion Substances 0.000 description 6
- 239000003925 fat Substances 0.000 description 6
- 235000019197 fats Nutrition 0.000 description 6
- 125000002541 furyl group Chemical group 0.000 description 6
- 125000002632 imidazolidinyl group Chemical group 0.000 description 6
- 238000004255 ion exchange chromatography Methods 0.000 description 6
- 125000001786 isothiazolyl group Chemical group 0.000 description 6
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 6
- 230000037361 pathway Effects 0.000 description 6
- HXITXNWTGFUOAU-UHFFFAOYSA-N phenylboronic acid Chemical compound OB(O)C1=CC=CC=C1 HXITXNWTGFUOAU-UHFFFAOYSA-N 0.000 description 6
- 239000000256 polyoxyethylene sorbitan monolaurate Substances 0.000 description 6
- 235000010486 polyoxyethylene sorbitan monolaurate Nutrition 0.000 description 6
- 238000002953 preparative HPLC Methods 0.000 description 6
- 125000003072 pyrazolidinyl group Chemical group 0.000 description 6
- 125000002098 pyridazinyl group Chemical group 0.000 description 6
- 125000000168 pyrrolyl group Chemical group 0.000 description 6
- 239000011734 sodium Substances 0.000 description 6
- 229910052708 sodium Inorganic materials 0.000 description 6
- 239000003039 volatile agent Substances 0.000 description 6
- HJWNYVVSEUNNMO-UHFFFAOYSA-N 2-bromo-4-chloro-5-nitropyridine Chemical compound [O-][N+](=O)C1=CN=C(Br)C=C1Cl HJWNYVVSEUNNMO-UHFFFAOYSA-N 0.000 description 5
- JGFZNNIVVJXRND-UHFFFAOYSA-N N,N-Diisopropylethylamine (DIPEA) Chemical compound CCN(C(C)C)C(C)C JGFZNNIVVJXRND-UHFFFAOYSA-N 0.000 description 5
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical group CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 5
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 5
- 239000000853 adhesive Substances 0.000 description 5
- 230000001070 adhesive effect Effects 0.000 description 5
- 238000004458 analytical method Methods 0.000 description 5
- 230000008901 benefit Effects 0.000 description 5
- 230000022131 cell cycle Effects 0.000 description 5
- 238000004440 column chromatography Methods 0.000 description 5
- 239000000356 contaminant Substances 0.000 description 5
- 229910001873 dinitrogen Inorganic materials 0.000 description 5
- 229940079593 drug Drugs 0.000 description 5
- 239000003480 eluent Substances 0.000 description 5
- 239000003995 emulsifying agent Substances 0.000 description 5
- 239000006260 foam Substances 0.000 description 5
- 150000002500 ions Chemical class 0.000 description 5
- 239000000463 material Substances 0.000 description 5
- 230000011278 mitosis Effects 0.000 description 5
- OCPBARJDSLJOBE-UHFFFAOYSA-N n-[5-bromo-4-[(1-methylpiperidin-4-yl)amino]pyridin-2-yl]-2,2-dimethylpropanamide Chemical compound C1CN(C)CCC1NC1=CC(NC(=O)C(C)(C)C)=NC=C1Br OCPBARJDSLJOBE-UHFFFAOYSA-N 0.000 description 5
- 238000002414 normal-phase solid-phase extraction Methods 0.000 description 5
- 239000012044 organic layer Substances 0.000 description 5
- KJIFKLIQANRMOU-UHFFFAOYSA-N oxidanium;4-methylbenzenesulfonate Chemical compound O.CC1=CC=C(S(O)(=O)=O)C=C1 KJIFKLIQANRMOU-UHFFFAOYSA-N 0.000 description 5
- 235000010603 pastilles Nutrition 0.000 description 5
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 5
- 239000003381 stabilizer Substances 0.000 description 5
- IWWLTOAYUKSNCC-UHFFFAOYSA-N tert-butyl 4-[[(2-chloro-5-iodopyridin-4-yl)amino]methyl]piperidine-1-carboxylate Chemical compound C1CN(C(=O)OC(C)(C)C)CCC1CNC1=CC(Cl)=NC=C1I IWWLTOAYUKSNCC-UHFFFAOYSA-N 0.000 description 5
- MUPJQNCYUZYQBS-UHFFFAOYSA-N tert-butyl 4-[[2-[(5-cyanopyrazin-2-yl)amino]-5-nitropyridin-4-yl]oxymethyl]piperidine-1-carboxylate Chemical compound C1CN(C(=O)OC(C)(C)C)CCC1COC1=CC(NC=2N=CC(=NC=2)C#N)=NC=C1[N+]([O-])=O MUPJQNCYUZYQBS-UHFFFAOYSA-N 0.000 description 5
- POSUPFIUDWFHOQ-UHFFFAOYSA-N tert-butyl 4-[[[2-[(5-cyanopyrazin-2-yl)amino]-5-phenylpyridin-4-yl]amino]methyl]piperidine-1-carboxylate Chemical compound C1CN(C(=O)OC(C)(C)C)CCC1CNC1=CC(NC=2N=CC(=NC=2)C#N)=NC=C1C1=CC=CC=C1 POSUPFIUDWFHOQ-UHFFFAOYSA-N 0.000 description 5
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 5
- 238000000825 ultraviolet detection Methods 0.000 description 5
- VOAAEKKFGLPLLU-UHFFFAOYSA-N (4-methoxyphenyl)boronic acid Chemical compound COC1=CC=C(B(O)O)C=C1 VOAAEKKFGLPLLU-UHFFFAOYSA-N 0.000 description 4
- DMELBDGPDOJCTC-BYPYZUCNSA-N (6s)-6-(hydroxymethyl)morpholin-3-one Chemical compound OC[C@@H]1CNC(=O)CO1 DMELBDGPDOJCTC-BYPYZUCNSA-N 0.000 description 4
- LMDZBCPBFSXMTL-UHFFFAOYSA-N 1-ethyl-3-(3-dimethylaminopropyl)carbodiimide Chemical compound CCN=C=NCCCN(C)C LMDZBCPBFSXMTL-UHFFFAOYSA-N 0.000 description 4
- XJPZKYIHCLDXST-UHFFFAOYSA-N 4,6-dichloropyrimidine Chemical compound ClC1=CC(Cl)=NC=N1 XJPZKYIHCLDXST-UHFFFAOYSA-N 0.000 description 4
- VHYFNPMBLIVWCW-UHFFFAOYSA-N 4-Dimethylaminopyridine Chemical compound CN(C)C1=CC=NC=C1 VHYFNPMBLIVWCW-UHFFFAOYSA-N 0.000 description 4
- GBMZNQWVMHWDHY-UHFFFAOYSA-N 5-[(5-chloro-4-morpholin-4-ylpyridin-2-yl)amino]pyrazine-2-carbonitrile Chemical compound C1=C(N2CCOCC2)C(Cl)=CN=C1NC1=CN=C(C#N)C=N1 GBMZNQWVMHWDHY-UHFFFAOYSA-N 0.000 description 4
- ZPBNABIKZKTQQH-UHFFFAOYSA-N 5-bromopyrazine-2-carbonitrile Chemical compound BrC1=CN=C(C#N)C=N1 ZPBNABIKZKTQQH-UHFFFAOYSA-N 0.000 description 4
- SKIGTTIHAIFPEU-UHFFFAOYSA-N 5-chloro-4-morpholin-4-ylpyridin-2-amine Chemical compound C1=NC(N)=CC(N2CCOCC2)=C1Cl SKIGTTIHAIFPEU-UHFFFAOYSA-N 0.000 description 4
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 4
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 4
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 4
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 4
- FFDGPVCHZBVARC-UHFFFAOYSA-N N,N-dimethylglycine Chemical compound CN(C)CC(O)=O FFDGPVCHZBVARC-UHFFFAOYSA-N 0.000 description 4
- KYRVNWMVYQXFEU-UHFFFAOYSA-N Nocodazole Chemical compound C1=C2NC(NC(=O)OC)=NC2=CC=C1C(=O)C1=CC=CS1 KYRVNWMVYQXFEU-UHFFFAOYSA-N 0.000 description 4
- 239000000443 aerosol Substances 0.000 description 4
- KIYBNLDMVXYWAA-UHFFFAOYSA-N benzyl 4-[[[5-chloro-2-(2,2-dimethylpropanoylamino)pyridin-4-yl]amino]methyl]piperidine-1-carboxylate Chemical compound C1=NC(NC(=O)C(C)(C)C)=CC(NCC2CCN(CC2)C(=O)OCC=2C=CC=CC=2)=C1Cl KIYBNLDMVXYWAA-UHFFFAOYSA-N 0.000 description 4
- YNHIGQDRGKUECZ-UHFFFAOYSA-L bis(triphenylphosphine)palladium(ii) dichloride Chemical compound [Cl-].[Cl-].[Pd+2].C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 YNHIGQDRGKUECZ-UHFFFAOYSA-L 0.000 description 4
- 230000006369 cell cycle progression Effects 0.000 description 4
- 238000002648 combination therapy Methods 0.000 description 4
- 239000013058 crude material Substances 0.000 description 4
- PMSVVUSIPKHUMT-UHFFFAOYSA-N cyanopyrazine Chemical compound N#CC1=CN=CC=N1 PMSVVUSIPKHUMT-UHFFFAOYSA-N 0.000 description 4
- 230000007547 defect Effects 0.000 description 4
- NZFLCMXHLMXUBT-UHFFFAOYSA-N ethyl 2,5-dimethoxy-2,5-dihydrofuran-3-carboxylate Chemical compound CCOC(=O)C1=CC(OC)OC1OC NZFLCMXHLMXUBT-UHFFFAOYSA-N 0.000 description 4
- POXSNMGXOZADKJ-UHFFFAOYSA-N ethyl 2,5-dimethoxyoxolane-3-carboxylate Chemical compound CCOC(=O)C1CC(OC)OC1OC POXSNMGXOZADKJ-UHFFFAOYSA-N 0.000 description 4
- VJJPUSNTGOMMGY-MRVIYFEKSA-N etoposide Chemical compound COC1=C(O)C(OC)=CC([C@@H]2C3=CC=4OCOC=4C=C3[C@@H](O[C@H]3[C@@H]([C@@H](O)[C@@H]4O[C@H](C)OC[C@H]4O3)O)[C@@H]3[C@@H]2C(OC3)=O)=C1 VJJPUSNTGOMMGY-MRVIYFEKSA-N 0.000 description 4
- 229960005420 etoposide Drugs 0.000 description 4
- 239000000284 extract Substances 0.000 description 4
- 239000000706 filtrate Substances 0.000 description 4
- 239000000499 gel Substances 0.000 description 4
- 239000008187 granular material Substances 0.000 description 4
- 230000000155 isotopic effect Effects 0.000 description 4
- 230000007246 mechanism Effects 0.000 description 4
- 239000002609 medium Substances 0.000 description 4
- 239000002324 mouth wash Substances 0.000 description 4
- FRMVYHSNVIYKNI-UHFFFAOYSA-N n-(4,5-dichloropyridin-2-yl)-2,2-dimethylpropanamide Chemical compound CC(C)(C)C(=O)NC1=CC(Cl)=C(Cl)C=N1 FRMVYHSNVIYKNI-UHFFFAOYSA-N 0.000 description 4
- HDLIWEMWMDOCHM-UHFFFAOYSA-N n-(4-chloropyridin-2-yl)-2,2-dimethylpropanamide Chemical compound CC(C)(C)C(=O)NC1=CC(Cl)=CC=N1 HDLIWEMWMDOCHM-UHFFFAOYSA-N 0.000 description 4
- WFGNVNINMAXPDI-UHFFFAOYSA-N n-(5-bromo-4-chloropyridin-2-yl)-2,2-dimethylpropanamide Chemical compound CC(C)(C)C(=O)NC1=CC(Cl)=C(Br)C=N1 WFGNVNINMAXPDI-UHFFFAOYSA-N 0.000 description 4
- FNARWWKHSPGLAU-UHFFFAOYSA-N n-[5-chloro-4-[(1-methylpiperidin-4-yl)amino]pyridin-2-yl]-2,2-dimethylpropanamide Chemical compound C1CN(C)CCC1NC1=CC(NC(=O)C(C)(C)C)=NC=C1Cl FNARWWKHSPGLAU-UHFFFAOYSA-N 0.000 description 4
- 229950006344 nocodazole Drugs 0.000 description 4
- 239000002674 ointment Substances 0.000 description 4
- YJVFFLUZDVXJQI-UHFFFAOYSA-L palladium(ii) acetate Chemical compound [Pd+2].CC([O-])=O.CC([O-])=O YJVFFLUZDVXJQI-UHFFFAOYSA-L 0.000 description 4
- 239000006072 paste Substances 0.000 description 4
- 239000002244 precipitate Substances 0.000 description 4
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 4
- 239000000829 suppository Substances 0.000 description 4
- RQDPKXAFPSWQHO-UHFFFAOYSA-N tert-butyl 3-[[[2-[(5-cyanopyrazin-2-yl)amino]-5-nitropyridin-4-yl]amino]methyl]piperidine-1-carboxylate Chemical compound C1N(C(=O)OC(C)(C)C)CCCC1CNC1=CC(NC=2N=CC(=NC=2)C#N)=NC=C1[N+]([O-])=O RQDPKXAFPSWQHO-UHFFFAOYSA-N 0.000 description 4
- PRZCRJZSPQJWGM-UHFFFAOYSA-N tert-butyl 4-[(2-amino-5-bromopyridin-4-yl)amino]piperidine-1-carboxylate Chemical compound C1CN(C(=O)OC(C)(C)C)CCC1NC1=CC(N)=NC=C1Br PRZCRJZSPQJWGM-UHFFFAOYSA-N 0.000 description 4
- RPSIHBUUTTZMAD-UHFFFAOYSA-N tert-butyl 4-[[(2-amino-5-bromopyridin-4-yl)amino]methyl]piperidine-1-carboxylate Chemical compound C1CN(C(=O)OC(C)(C)C)CCC1CNC1=CC(N)=NC=C1Br RPSIHBUUTTZMAD-UHFFFAOYSA-N 0.000 description 4
- FWYQKCUGDFXBQO-UHFFFAOYSA-N tert-butyl 4-[[(2-amino-5-chloropyridin-4-yl)amino]methyl]piperidine-1-carboxylate Chemical compound C1CN(C(=O)OC(C)(C)C)CCC1CNC1=CC(N)=NC=C1Cl FWYQKCUGDFXBQO-UHFFFAOYSA-N 0.000 description 4
- NQROCICBOBFVMC-UHFFFAOYSA-N tert-butyl 4-[[2-[(5-cyanopyrazin-2-yl)amino]-5-[[2-(dimethylamino)acetyl]amino]pyridin-4-yl]oxymethyl]piperidine-1-carboxylate Chemical compound C1=C(OCC2CCN(CC2)C(=O)OC(C)(C)C)C(NC(=O)CN(C)C)=CN=C1NC1=CN=C(C#N)C=N1 NQROCICBOBFVMC-UHFFFAOYSA-N 0.000 description 4
- RKNSKWWULBNETA-UHFFFAOYSA-N tert-butyl 4-[[2-amino-5-(4-methoxyphenyl)pyridin-4-yl]amino]piperidine-1-carboxylate Chemical compound C1=CC(OC)=CC=C1C1=CN=C(N)C=C1NC1CCN(C(=O)OC(C)(C)C)CC1 RKNSKWWULBNETA-UHFFFAOYSA-N 0.000 description 4
- FZVPHAQWBDDMOL-UHFFFAOYSA-N tert-butyl 4-[[5-amino-2-[(5-cyanopyrazin-2-yl)amino]pyridin-4-yl]oxymethyl]piperidine-1-carboxylate Chemical compound C1CN(C(=O)OC(C)(C)C)CCC1COC1=CC(NC=2N=CC(=NC=2)C#N)=NC=C1N FZVPHAQWBDDMOL-UHFFFAOYSA-N 0.000 description 4
- MMUURJDASHUSTL-AATRIKPKSA-N tert-butyl 4-[[[2-[(5-cyanopyrazin-2-yl)amino]-5-[(e)-3-methoxyprop-1-enyl]pyridin-4-yl]amino]methyl]piperidine-1-carboxylate Chemical compound C1=C(NCC2CCN(CC2)C(=O)OC(C)(C)C)C(/C=C/COC)=CN=C1NC1=CN=C(C#N)C=N1 MMUURJDASHUSTL-AATRIKPKSA-N 0.000 description 4
- LENZDBCJOHFCAS-UHFFFAOYSA-N tris Chemical compound OCC(N)(CO)CO LENZDBCJOHFCAS-UHFFFAOYSA-N 0.000 description 4
- 239000003656 tris buffered saline Substances 0.000 description 4
- IACOSNWREMNEKT-UHFFFAOYSA-N 1-[6-[(5-cyanopyrazin-2-yl)amino]-4-(piperidin-3-ylmethylamino)pyridin-3-yl]pyrrole-3-carboxylic acid Chemical compound C1=C(C(=O)O)C=CN1C(C(=C1)NCC2CNCCC2)=CN=C1NC1=CN=C(C#N)C=N1 IACOSNWREMNEKT-UHFFFAOYSA-N 0.000 description 3
- SORZQZWEZUPWLL-UHFFFAOYSA-N 1-[6-[(5-cyanopyrazin-2-yl)amino]-4-[[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-3-yl]methylamino]pyridin-3-yl]pyrrole-3-carboxylic acid Chemical compound C1N(C(=O)OC(C)(C)C)CCCC1CNC1=CC(NC=2N=CC(=NC=2)C#N)=NC=C1N1C=C(C(O)=O)C=C1 SORZQZWEZUPWLL-UHFFFAOYSA-N 0.000 description 3
- NAPIQNUAYLKBHM-UHFFFAOYSA-N 3-bromopyrazine-2-carbonitrile Chemical compound BrC1=NC=CN=C1C#N NAPIQNUAYLKBHM-UHFFFAOYSA-N 0.000 description 3
- ILMIEWNDXAKVNI-UHFFFAOYSA-N 4,6-dichloropyridine-3-carboxylic acid Chemical class OC(=O)C1=CN=C(Cl)C=C1Cl ILMIEWNDXAKVNI-UHFFFAOYSA-N 0.000 description 3
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 3
- QXTORUGYSIVLCY-UHFFFAOYSA-N 5-[(4-morpholin-4-yl-5-phenylpyridin-2-yl)amino]pyrazine-2-carbonitrile Chemical compound C1=NC(C#N)=CN=C1NC1=CC(N2CCOCC2)=C(C=2C=CC=CC=2)C=N1 QXTORUGYSIVLCY-UHFFFAOYSA-N 0.000 description 3
- ZVIFSSHTDFXJMV-UHFFFAOYSA-N 5-[[4-(piperidin-3-ylmethylamino)-5-pyrrol-1-ylpyridin-2-yl]amino]pyrazine-2-carbonitrile Chemical compound C1=NC(C#N)=CN=C1NC1=CC(NCC2CNCCC2)=C(N2C=CC=C2)C=N1 ZVIFSSHTDFXJMV-UHFFFAOYSA-N 0.000 description 3
- SOEZBNINDNIVAE-UHFFFAOYSA-N 5-[[4-(piperidin-3-ylmethylamino)-5-pyrrolidin-1-ylpyridin-2-yl]amino]pyrazine-2-carbonitrile Chemical compound C1=NC(C#N)=CN=C1NC1=CC(NCC2CNCCC2)=C(N2CCCC2)C=N1 SOEZBNINDNIVAE-UHFFFAOYSA-N 0.000 description 3
- PDJQFURLPZPRIL-UHFFFAOYSA-N 5-[[5-(4-methoxyphenyl)-4-(piperidin-4-ylamino)pyridin-2-yl]amino]pyrazine-2-carbonitrile Chemical compound C1=CC(OC)=CC=C1C(C(=C1)NC2CCNCC2)=CN=C1NC1=CN=C(C#N)C=N1 PDJQFURLPZPRIL-UHFFFAOYSA-N 0.000 description 3
- FJSJRAIEAXEZOF-UHFFFAOYSA-N 5-[[5-(4-methoxyphenyl)-4-[(1-methylpiperidin-4-yl)amino]pyridin-2-yl]amino]pyrazine-2-carbonitrile Chemical compound C1=CC(OC)=CC=C1C(C(=C1)NC2CCN(C)CC2)=CN=C1NC1=CN=C(C#N)C=N1 FJSJRAIEAXEZOF-UHFFFAOYSA-N 0.000 description 3
- ZFVVXSOSXKGWAI-UHFFFAOYSA-N 5-[[5-[3-(hydroxymethyl)pyrrol-1-yl]-4-(piperidin-3-ylmethylamino)pyridin-2-yl]amino]pyrazine-2-carbonitrile Chemical compound C1=C(CO)C=CN1C(C(=C1)NCC2CNCCC2)=CN=C1NC1=CN=C(C#N)C=N1 ZFVVXSOSXKGWAI-UHFFFAOYSA-N 0.000 description 3
- VORWXCSTZOOCFR-UHFFFAOYSA-N 5-[[5-[3-(morpholin-4-ylmethyl)pyrrol-1-yl]-4-(piperidin-3-ylmethylamino)pyridin-2-yl]amino]pyrazine-2-carbonitrile Chemical compound C1=NC(C#N)=CN=C1NC1=CC(NCC2CNCCC2)=C(N2C=C(CN3CCOCC3)C=C2)C=N1 VORWXCSTZOOCFR-UHFFFAOYSA-N 0.000 description 3
- BJGGLKYJLCHWSP-UHFFFAOYSA-N 5-[[5-amino-4-(piperidin-4-ylmethylamino)pyridin-2-yl]amino]pyrazine-2-carbonitrile Chemical compound C1=C(NCC2CCNCC2)C(N)=CN=C1NC1=CN=C(C#N)C=N1 BJGGLKYJLCHWSP-UHFFFAOYSA-N 0.000 description 3
- OFJNQLWCLWKDNQ-UHFFFAOYSA-N 5-[[5-chloro-4-(piperidin-4-ylmethylamino)pyridin-2-yl]amino]pyrazine-2-carbonitrile Chemical compound C1=C(NCC2CCNCC2)C(Cl)=CN=C1NC1=CN=C(C#N)C=N1 OFJNQLWCLWKDNQ-UHFFFAOYSA-N 0.000 description 3
- IEPBUWSAYKIVTJ-UHFFFAOYSA-N 5-bromo-4-n-(1-methylpiperidin-4-yl)pyridine-2,4-diamine Chemical compound C1CN(C)CCC1NC1=CC(N)=NC=C1Br IEPBUWSAYKIVTJ-UHFFFAOYSA-N 0.000 description 3
- AZNOBAZMALTBSN-UHFFFAOYSA-N 5-chloro-4-n-(1-methylpiperidin-4-yl)pyridine-2,4-diamine Chemical compound C1CN(C)CCC1NC1=CC(N)=NC=C1Cl AZNOBAZMALTBSN-UHFFFAOYSA-N 0.000 description 3
- HBAQYPYDRFILMT-UHFFFAOYSA-N 8-[3-(1-cyclopropylpyrazol-4-yl)-1H-pyrazolo[4,3-d]pyrimidin-5-yl]-3-methyl-3,8-diazabicyclo[3.2.1]octan-2-one Chemical class C1(CC1)N1N=CC(=C1)C1=NNC2=C1N=C(N=C2)N1C2C(N(CC1CC2)C)=O HBAQYPYDRFILMT-UHFFFAOYSA-N 0.000 description 3
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 3
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 3
- 230000004543 DNA replication Effects 0.000 description 3
- 229910052693 Europium Inorganic materials 0.000 description 3
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 3
- 235000010643 Leucaena leucocephala Nutrition 0.000 description 3
- 240000007472 Leucaena leucocephala Species 0.000 description 3
- 206010025323 Lymphomas Diseases 0.000 description 3
- 241000124008 Mammalia Species 0.000 description 3
- 229910006074 SO2NH2 Inorganic materials 0.000 description 3
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 3
- 239000007983 Tris buffer Substances 0.000 description 3
- VLAZLCVSFAYIIL-RXMQYKEDSA-N [(2r)-morpholin-2-yl]methanol Chemical compound OC[C@H]1CNCCO1 VLAZLCVSFAYIIL-RXMQYKEDSA-N 0.000 description 3
- VLAZLCVSFAYIIL-YFKPBYRVSA-N [(2s)-morpholin-2-yl]methanol Chemical compound OC[C@@H]1CNCCO1 VLAZLCVSFAYIIL-YFKPBYRVSA-N 0.000 description 3
- 150000007513 acids Chemical class 0.000 description 3
- 230000003213 activating effect Effects 0.000 description 3
- 230000004913 activation Effects 0.000 description 3
- 238000010640 amide synthesis reaction Methods 0.000 description 3
- 239000002246 antineoplastic agent Substances 0.000 description 3
- 239000012131 assay buffer Substances 0.000 description 3
- UUOOZNYNJMTNFD-UHFFFAOYSA-N benzyl 4-[[[5-bromo-2-(2,2-dimethylpropanoylamino)pyridin-4-yl]amino]methyl]piperidine-1-carboxylate Chemical compound C1=NC(NC(=O)C(C)(C)C)=CC(NCC2CCN(CC2)C(=O)OCC=2C=CC=CC=2)=C1Br UUOOZNYNJMTNFD-UHFFFAOYSA-N 0.000 description 3
- 239000000872 buffer Substances 0.000 description 3
- 239000002775 capsule Substances 0.000 description 3
- 239000003054 catalyst Substances 0.000 description 3
- 150000001768 cations Chemical class 0.000 description 3
- 230000025084 cell cycle arrest Effects 0.000 description 3
- 230000030833 cell death Effects 0.000 description 3
- 125000005266 diarylamine group Chemical group 0.000 description 3
- 239000002552 dosage form Substances 0.000 description 3
- OGPBJKLSAFTDLK-UHFFFAOYSA-N europium atom Chemical compound [Eu] OGPBJKLSAFTDLK-UHFFFAOYSA-N 0.000 description 3
- 238000001704 evaporation Methods 0.000 description 3
- 230000008020 evaporation Effects 0.000 description 3
- 239000000796 flavoring agent Substances 0.000 description 3
- 235000019253 formic acid Nutrition 0.000 description 3
- 238000010914 gene-directed enzyme pro-drug therapy Methods 0.000 description 3
- 235000011187 glycerol Nutrition 0.000 description 3
- 230000001965 increasing effect Effects 0.000 description 3
- 239000007924 injection Substances 0.000 description 3
- 238000002347 injection Methods 0.000 description 3
- 229910052740 iodine Inorganic materials 0.000 description 3
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 3
- 125000000468 ketone group Chemical group 0.000 description 3
- 239000006210 lotion Substances 0.000 description 3
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 3
- 230000000873 masking effect Effects 0.000 description 3
- 238000005259 measurement Methods 0.000 description 3
- VECLGHRVJLUYFO-UHFFFAOYSA-N methyl 6-[(5-cyanopyrazin-2-yl)amino]-4-(piperidin-4-ylmethylamino)pyridine-3-carboxylate Chemical compound C1=C(NCC2CCNCC2)C(C(=O)OC)=CN=C1NC1=CN=C(C#N)C=N1 VECLGHRVJLUYFO-UHFFFAOYSA-N 0.000 description 3
- VWCOELSGXGLYKL-UHFFFAOYSA-N methyl 6-[(5-cyanopyrazin-2-yl)amino]-4-[(1-methylpiperidin-4-yl)amino]pyridine-3-carboxylate Chemical compound C1=C(NC2CCN(C)CC2)C(C(=O)OC)=CN=C1NC1=CN=C(C#N)C=N1 VWCOELSGXGLYKL-UHFFFAOYSA-N 0.000 description 3
- XZWYXBPMIPCKRO-UHFFFAOYSA-N n-[6-[(5-cyanopyrazin-2-yl)amino]-4-(piperidin-4-ylmethoxy)pyridin-3-yl]-2-(dimethylamino)acetamide Chemical compound C1=C(OCC2CCNCC2)C(NC(=O)CN(C)C)=CN=C1NC1=CN=C(C#N)C=N1 XZWYXBPMIPCKRO-UHFFFAOYSA-N 0.000 description 3
- NBVCYGVLLHVUEV-UHFFFAOYSA-N n-[6-[(5-cyanopyrazin-2-yl)amino]-4-(piperidin-4-ylmethylamino)pyridin-3-yl]-2-(dimethylamino)acetamide Chemical compound C1=C(NCC2CCNCC2)C(NC(=O)CN(C)C)=CN=C1NC1=CN=C(C#N)C=N1 NBVCYGVLLHVUEV-UHFFFAOYSA-N 0.000 description 3
- PUWXRWRIEGIWQC-UHFFFAOYSA-N n-[6-[(5-cyanopyrazin-2-yl)amino]-4-(piperidin-4-ylmethylamino)pyridin-3-yl]acetamide Chemical compound C1=C(NCC2CCNCC2)C(NC(=O)C)=CN=C1NC1=CN=C(C#N)C=N1 PUWXRWRIEGIWQC-UHFFFAOYSA-N 0.000 description 3
- APKTWYJGWWASMA-UHFFFAOYSA-N n-[6-[(5-cyanopyrazin-2-yl)amino]-4-(piperidin-4-ylmethylamino)pyridin-3-yl]ethanesulfonamide Chemical compound C1=C(NCC2CCNCC2)C(NS(=O)(=O)CC)=CN=C1NC1=CN=C(C#N)C=N1 APKTWYJGWWASMA-UHFFFAOYSA-N 0.000 description 3
- LXNAVEXFUKBNMK-UHFFFAOYSA-N palladium(II) acetate Substances [Pd].CC(O)=O.CC(O)=O LXNAVEXFUKBNMK-UHFFFAOYSA-N 0.000 description 3
- 239000002953 phosphate buffered saline Substances 0.000 description 3
- 230000026731 phosphorylation Effects 0.000 description 3
- 238000006366 phosphorylation reaction Methods 0.000 description 3
- 239000006187 pill Substances 0.000 description 3
- DNUTZBZXLPWRJG-UHFFFAOYSA-M piperidine-1-carboxylate Chemical compound [O-]C(=O)N1CCCCC1 DNUTZBZXLPWRJG-UHFFFAOYSA-M 0.000 description 3
- 239000011505 plaster Substances 0.000 description 3
- 239000003755 preservative agent Substances 0.000 description 3
- 230000008569 process Effects 0.000 description 3
- 230000035755 proliferation Effects 0.000 description 3
- 108090000623 proteins and genes Proteins 0.000 description 3
- 150000003222 pyridines Chemical class 0.000 description 3
- 238000001959 radiotherapy Methods 0.000 description 3
- 230000009467 reduction Effects 0.000 description 3
- 230000010076 replication Effects 0.000 description 3
- 239000012312 sodium hydride Substances 0.000 description 3
- 239000007921 spray Substances 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- 230000004083 survival effect Effects 0.000 description 3
- LOBHRXDXENCDIZ-CQSZACIVSA-N tert-butyl (2r)-2-[(4-methylphenyl)sulfonyloxymethyl]morpholine-4-carboxylate Chemical compound C1=CC(C)=CC=C1S(=O)(=O)OC[C@@H]1OCCN(C(=O)OC(C)(C)C)C1 LOBHRXDXENCDIZ-CQSZACIVSA-N 0.000 description 3
- TVVYIRPIGMWFEW-SNVBAGLBSA-N tert-butyl (2r)-2-[[(2-chloro-5-iodopyridin-4-yl)amino]methyl]morpholine-4-carboxylate Chemical compound C1N(C(=O)OC(C)(C)C)CCO[C@@H]1CNC1=CC(Cl)=NC=C1I TVVYIRPIGMWFEW-SNVBAGLBSA-N 0.000 description 3
- KVSMEUHLZOCRIX-OAQYLSRUSA-N tert-butyl (2r)-2-[[[2-[(5-cyanopyrazin-2-yl)amino]-5-(4-methoxyphenyl)pyridin-4-yl]amino]methyl]morpholine-4-carboxylate Chemical compound C1=CC(OC)=CC=C1C(C(=C1)NC[C@H]2OCCN(C2)C(=O)OC(C)(C)C)=CN=C1NC1=CN=C(C#N)C=N1 KVSMEUHLZOCRIX-OAQYLSRUSA-N 0.000 description 3
- DWKMZGBWUCXXTN-QGZVFWFLSA-N tert-butyl (2r)-2-[[[2-chloro-5-(4-methoxyphenyl)pyridin-4-yl]amino]methyl]morpholine-4-carboxylate Chemical compound C1=CC(OC)=CC=C1C1=CN=C(Cl)C=C1NC[C@H]1OCCN(C(=O)OC(C)(C)C)C1 DWKMZGBWUCXXTN-QGZVFWFLSA-N 0.000 description 3
- FJYBLMJHXRWDAQ-QMMMGPOBSA-N tert-butyl (2s)-2-(hydroxymethyl)morpholine-4-carboxylate Chemical compound CC(C)(C)OC(=O)N1CCO[C@H](CO)C1 FJYBLMJHXRWDAQ-QMMMGPOBSA-N 0.000 description 3
- DWKMZGBWUCXXTN-KRWDZBQOSA-N tert-butyl (2s)-2-[[[2-chloro-5-(4-methoxyphenyl)pyridin-4-yl]amino]methyl]morpholine-4-carboxylate Chemical compound C1=CC(OC)=CC=C1C1=CN=C(Cl)C=C1NC[C@@H]1OCCN(C(=O)OC(C)(C)C)C1 DWKMZGBWUCXXTN-KRWDZBQOSA-N 0.000 description 3
- WZBBJLWNIZRCEX-UHFFFAOYSA-N tert-butyl 3-[[(2-bromo-5-nitropyridin-4-yl)amino]methyl]piperidine-1-carboxylate Chemical compound C1N(C(=O)OC(C)(C)C)CCCC1CNC1=CC(Br)=NC=C1[N+]([O-])=O WZBBJLWNIZRCEX-UHFFFAOYSA-N 0.000 description 3
- HFKSDNSESGGNEY-UHFFFAOYSA-N tert-butyl 3-[[[2-[(5-cyanopyrazin-2-yl)amino]-5-(3-formylpyrrol-1-yl)pyridin-4-yl]amino]methyl]piperidine-1-carboxylate Chemical compound C1N(C(=O)OC(C)(C)C)CCCC1CNC1=CC(NC=2N=CC(=NC=2)C#N)=NC=C1N1C=C(C=O)C=C1 HFKSDNSESGGNEY-UHFFFAOYSA-N 0.000 description 3
- KZHFWSDKOUNXST-UHFFFAOYSA-N tert-butyl 3-[[[2-[(5-cyanopyrazin-2-yl)amino]-5-[3-(morpholin-4-ylmethyl)pyrrol-1-yl]pyridin-4-yl]amino]methyl]piperidine-1-carboxylate Chemical compound C1N(C(=O)OC(C)(C)C)CCCC1CNC1=CC(NC=2N=CC(=NC=2)C#N)=NC=C1N1C=C(CN2CCOCC2)C=C1 KZHFWSDKOUNXST-UHFFFAOYSA-N 0.000 description 3
- VXMQNHNWUQFPNM-UHFFFAOYSA-N tert-butyl 4-[(2-bromo-5-nitropyridin-4-yl)oxymethyl]piperidine-1-carboxylate Chemical compound C1CN(C(=O)OC(C)(C)C)CCC1COC1=CC(Br)=NC=C1[N+]([O-])=O VXMQNHNWUQFPNM-UHFFFAOYSA-N 0.000 description 3
- CDLYZOBCSKUCDN-UHFFFAOYSA-N tert-butyl 4-[[2-[(5-cyanopyrazin-2-yl)amino]-5-(4-methoxyphenyl)pyridin-4-yl]amino]piperidine-1-carboxylate Chemical compound C1=CC(OC)=CC=C1C(C(=C1)NC2CCN(CC2)C(=O)OC(C)(C)C)=CN=C1NC1=CN=C(C#N)C=N1 CDLYZOBCSKUCDN-UHFFFAOYSA-N 0.000 description 3
- WZSVWIZBYRCCFC-UHFFFAOYSA-N tert-butyl 4-[[[2-[(5-cyanopyrazin-2-yl)amino]-5-(3-hydroxy-3-methylbut-1-ynyl)pyridin-4-yl]amino]methyl]piperidine-1-carboxylate Chemical compound C1CN(C(=O)OC(C)(C)C)CCC1CNC1=CC(NC=2N=CC(=NC=2)C#N)=NC=C1C#CC(C)(C)O WZSVWIZBYRCCFC-UHFFFAOYSA-N 0.000 description 3
- PWZXLKSHRZKSMG-UHFFFAOYSA-N tert-butyl 4-[[[2-[(5-cyanopyrazin-2-yl)amino]-5-(4-methoxyphenyl)pyridin-4-yl]amino]methyl]piperidine-1-carboxylate Chemical compound C1=CC(OC)=CC=C1C(C(=C1)NCC2CCN(CC2)C(=O)OC(C)(C)C)=CN=C1NC1=CN=C(C#N)C=N1 PWZXLKSHRZKSMG-UHFFFAOYSA-N 0.000 description 3
- BJGFGSFPTFEECK-UHFFFAOYSA-N tert-butyl 4-[[[2-[(5-cyanopyrazin-2-yl)amino]-5-nitropyridin-4-yl]amino]methyl]piperidine-1-carboxylate Chemical compound C1CN(C(=O)OC(C)(C)C)CCC1CNC1=CC(NC=2N=CC(=NC=2)C#N)=NC=C1[N+]([O-])=O BJGFGSFPTFEECK-UHFFFAOYSA-N 0.000 description 3
- IEAXUHYXTNYQGH-AATRIKPKSA-N tert-butyl 4-[[[2-chloro-5-[(e)-3-methoxyprop-1-enyl]pyridin-4-yl]amino]methyl]piperidine-1-carboxylate Chemical compound COC\C=C\C1=CN=C(Cl)C=C1NCC1CCN(C(=O)OC(C)(C)C)CC1 IEAXUHYXTNYQGH-AATRIKPKSA-N 0.000 description 3
- CTGKLYWOIGGXBL-UHFFFAOYSA-N tert-butyl 4-[[[5-amino-2-[(5-cyanopyrazin-2-yl)amino]pyridin-4-yl]amino]methyl]piperidine-1-carboxylate Chemical compound C1CN(C(=O)OC(C)(C)C)CCC1CNC1=CC(NC=2N=CC(=NC=2)C#N)=NC=C1N CTGKLYWOIGGXBL-UHFFFAOYSA-N 0.000 description 3
- QBTITBHTELUUHH-UHFFFAOYSA-N tert-butyl 4-[[[5-chloro-2-[(5-cyanopyrazin-2-yl)amino]pyridin-4-yl]amino]methyl]piperidine-1-carboxylate Chemical compound C1CN(C(=O)OC(C)(C)C)CCC1CNC1=CC(NC=2N=CC(=NC=2)C#N)=NC=C1Cl QBTITBHTELUUHH-UHFFFAOYSA-N 0.000 description 3
- 150000003512 tertiary amines Chemical class 0.000 description 3
- PUPZLCDOIYMWBV-UHFFFAOYSA-N (+/-)-1,3-Butanediol Chemical compound CC(O)CCO PUPZLCDOIYMWBV-UHFFFAOYSA-N 0.000 description 2
- CYPYTURSJDMMMP-WVCUSYJESA-N (1e,4e)-1,5-diphenylpenta-1,4-dien-3-one;palladium Chemical compound [Pd].[Pd].C=1C=CC=CC=1\C=C\C(=O)\C=C\C1=CC=CC=C1.C=1C=CC=CC=1\C=C\C(=O)\C=C\C1=CC=CC=C1.C=1C=CC=CC=1\C=C\C(=O)\C=C\C1=CC=CC=C1 CYPYTURSJDMMMP-WVCUSYJESA-N 0.000 description 2
- TXLNUQZRUQOJSW-INIZCTEOSA-N (2s)-2-amino-5-[[5-amino-2-[(5-cyanopyrazin-2-yl)amino]pyridin-4-yl]amino]-n-phenylpentanamide Chemical compound C([C@H](N)C(=O)NC=1C=CC=CC=1)CCNC(C(=CN=1)N)=CC=1NC1=CN=C(C#N)C=N1 TXLNUQZRUQOJSW-INIZCTEOSA-N 0.000 description 2
- DMELBDGPDOJCTC-SCSAIBSYSA-N (6r)-6-(hydroxymethyl)morpholin-3-one Chemical compound OC[C@H]1CNC(=O)CO1 DMELBDGPDOJCTC-SCSAIBSYSA-N 0.000 description 2
- ULTHEAFYOOPTTB-UHFFFAOYSA-N 1,4-dibromobutane Chemical compound BrCCCCBr ULTHEAFYOOPTTB-UHFFFAOYSA-N 0.000 description 2
- ALOCUZOKRULSAA-UHFFFAOYSA-N 1-methylpiperidin-4-amine Chemical compound CN1CCC(N)CC1 ALOCUZOKRULSAA-UHFFFAOYSA-N 0.000 description 2
- VBICKXHEKHSIBG-UHFFFAOYSA-N 1-monostearoylglycerol Chemical compound CCCCCCCCCCCCCCCCCC(=O)OCC(O)CO VBICKXHEKHSIBG-UHFFFAOYSA-N 0.000 description 2
- IFFLKGMDBKQMAH-UHFFFAOYSA-N 2,4-diaminopyridine Chemical compound NC1=CC=NC(N)=C1 IFFLKGMDBKQMAH-UHFFFAOYSA-N 0.000 description 2
- HZAXFHJVJLSVMW-UHFFFAOYSA-N 2-Aminoethan-1-ol Chemical compound NCCO HZAXFHJVJLSVMW-UHFFFAOYSA-N 0.000 description 2
- AYFSYGFEOPUIFD-SCSAIBSYSA-N 2-chloro-n-[(2r)-2,3-dihydroxypropyl]acetamide Chemical compound OC[C@H](O)CNC(=O)CCl AYFSYGFEOPUIFD-SCSAIBSYSA-N 0.000 description 2
- HDECRAPHCDXMIJ-UHFFFAOYSA-N 2-methylbenzenesulfonyl chloride Chemical compound CC1=CC=CC=C1S(Cl)(=O)=O HDECRAPHCDXMIJ-UHFFFAOYSA-N 0.000 description 2
- CRRAQLWJVYODCL-UHFFFAOYSA-N 4,5-dichloropyridin-2-amine Chemical compound NC1=CC(Cl)=C(Cl)C=N1 CRRAQLWJVYODCL-UHFFFAOYSA-N 0.000 description 2
- 229960000549 4-dimethylaminophenol Drugs 0.000 description 2
- DGTCBCQKKRCTQH-UHFFFAOYSA-N 4-n-(1-methylpiperidin-4-yl)-5-phenylpyridine-2,4-diamine Chemical compound C1CN(C)CCC1NC1=CC(N)=NC=C1C1=CC=CC=C1 DGTCBCQKKRCTQH-UHFFFAOYSA-N 0.000 description 2
- ZTNDYWRELJXKEX-ONEGZZNKSA-N 5-[(e)-3-methoxyprop-1-enyl]-4-n-(1-methylpiperidin-4-yl)pyridine-2,4-diamine Chemical compound COC\C=C\C1=CN=C(N)C=C1NC1CCN(C)CC1 ZTNDYWRELJXKEX-ONEGZZNKSA-N 0.000 description 2
- KABBJMFMIQOXJZ-UHFFFAOYSA-N 5-[[4-(2-morpholin-2-ylethylamino)-5-phenylpyridin-2-yl]amino]pyrazine-2-carbonitrile Chemical compound C1=NC(C#N)=CN=C1NC1=CC(NCCC2OCCNC2)=C(C=2C=CC=CC=2)C=N1 KABBJMFMIQOXJZ-UHFFFAOYSA-N 0.000 description 2
- YEMKLPGJQSWXRV-UHFFFAOYSA-N 5-[[4-(piperidin-4-ylmethylamino)-5-(pyrrolidine-1-carbonyl)pyridin-2-yl]amino]pyrazine-2-carbonitrile Chemical compound C=1N=C(NC=2N=CC(=NC=2)C#N)C=C(NCC2CCNCC2)C=1C(=O)N1CCCC1 YEMKLPGJQSWXRV-UHFFFAOYSA-N 0.000 description 2
- FCABMFIMWFJUBL-UHFFFAOYSA-N 5-[[4-[(1-methylpiperidin-4-yl)amino]-5-(4-morpholin-4-ylphenyl)pyridin-2-yl]amino]pyrazine-2-carbonitrile Chemical compound C1CN(C)CCC1NC1=CC(NC=2N=CC(=NC=2)C#N)=NC=C1C1=CC=C(N2CCOCC2)C=C1 FCABMFIMWFJUBL-UHFFFAOYSA-N 0.000 description 2
- SKTXZEDKBMTNSR-UHFFFAOYSA-N 5-[[4-[(1-methylpiperidin-4-yl)amino]-5-nitropyridin-2-yl]amino]pyrazine-2-carbonitrile Chemical compound C1CN(C)CCC1NC1=CC(NC=2N=CC(=NC=2)C#N)=NC=C1[N+]([O-])=O SKTXZEDKBMTNSR-UHFFFAOYSA-N 0.000 description 2
- DUCMQNPWATZUMN-UHFFFAOYSA-N 5-[[4-[(1-methylpiperidin-4-yl)amino]-5-phenylpyridin-2-yl]amino]pyrazine-2-carbonitrile Chemical compound C1CN(C)CCC1NC1=CC(NC=2N=CC(=NC=2)C#N)=NC=C1C1=CC=CC=C1 DUCMQNPWATZUMN-UHFFFAOYSA-N 0.000 description 2
- PCNNHJICYRPRPA-UHFFFAOYSA-N 5-[[4-[(1-methylpiperidin-4-yl)amino]-5-pyrrol-1-ylpyridin-2-yl]amino]pyrazine-2-carbonitrile Chemical compound C1CN(C)CCC1NC1=CC(NC=2N=CC(=NC=2)C#N)=NC=C1N1C=CC=C1 PCNNHJICYRPRPA-UHFFFAOYSA-N 0.000 description 2
- YENQHLKDHJJHRE-UHFFFAOYSA-N 5-[[4-[(1-methylpiperidin-4-yl)amino]-5-thiophen-3-ylpyridin-2-yl]amino]pyrazine-2-carbonitrile Chemical compound C1CN(C)CCC1NC1=CC(NC=2N=CC(=NC=2)C#N)=NC=C1C1=CSC=C1 YENQHLKDHJJHRE-UHFFFAOYSA-N 0.000 description 2
- IIRPMBDNFZTTLA-CQSZACIVSA-N 5-[[4-[[(3r)-piperidin-3-yl]amino]-5-pyrrol-1-ylpyridin-2-yl]amino]pyrazine-2-carbonitrile Chemical compound C1=NC(C#N)=CN=C1NC1=CC(N[C@H]2CNCCC2)=C(N2C=CC=C2)C=N1 IIRPMBDNFZTTLA-CQSZACIVSA-N 0.000 description 2
- GZEKASFHVCLETB-UHFFFAOYSA-N 5-[[4-[methyl-(1-methylpiperidin-4-yl)amino]-5-phenylpyridin-2-yl]amino]pyrazine-2-carbonitrile Chemical compound C=1C(NC=2N=CC(=NC=2)C#N)=NC=C(C=2C=CC=CC=2)C=1N(C)C1CCN(C)CC1 GZEKASFHVCLETB-UHFFFAOYSA-N 0.000 description 2
- HGYKCQUYMKJVQI-HNNXBMFYSA-N 5-[[5-(1-methylpyrazol-4-yl)-4-[[(2s)-morpholin-2-yl]methylamino]pyridin-2-yl]amino]pyrazine-2-carbonitrile Chemical compound C1=NN(C)C=C1C(C(=C1)NC[C@H]2OCCNC2)=CN=C1NC1=CN=C(C#N)C=N1 HGYKCQUYMKJVQI-HNNXBMFYSA-N 0.000 description 2
- RZPBLTNNDXTKCI-UHFFFAOYSA-N 5-[[5-(2-methylphenyl)-4-[(1-methylpiperidin-4-yl)amino]pyridin-2-yl]amino]pyrazine-2-carbonitrile Chemical compound C1CN(C)CCC1NC1=CC(NC=2N=CC(=NC=2)C#N)=NC=C1C1=CC=CC=C1C RZPBLTNNDXTKCI-UHFFFAOYSA-N 0.000 description 2
- PSLAAUOSIGCHPK-UHFFFAOYSA-N 5-[[5-(3-fluorophenyl)-4-(piperidin-4-ylmethylamino)pyridin-2-yl]amino]pyrazine-2-carbonitrile Chemical compound FC1=CC=CC(C=2C(=CC(NC=3N=CC(=NC=3)C#N)=NC=2)NCC2CCNCC2)=C1 PSLAAUOSIGCHPK-UHFFFAOYSA-N 0.000 description 2
- BVSIZDQHJCGHDR-UHFFFAOYSA-N 5-[[5-(3-hydroxy-3-methylbut-1-ynyl)-4-(piperidin-4-ylmethylamino)pyridin-2-yl]amino]pyrazine-2-carbonitrile Chemical compound C1=C(NCC2CCNCC2)C(C#CC(C)(O)C)=CN=C1NC1=CN=C(C#N)C=N1 BVSIZDQHJCGHDR-UHFFFAOYSA-N 0.000 description 2
- IDZXROKRAQBADP-MRXNPFEDSA-N 5-[[5-(3-hydroxy-3-methylbut-1-ynyl)-4-[[(2r)-morpholin-2-yl]methylamino]pyridin-2-yl]amino]pyrazine-2-carbonitrile Chemical compound C1=C(NC[C@@H]2OCCNC2)C(C#CC(C)(O)C)=CN=C1NC1=CN=C(C#N)C=N1 IDZXROKRAQBADP-MRXNPFEDSA-N 0.000 description 2
- IDZXROKRAQBADP-INIZCTEOSA-N 5-[[5-(3-hydroxy-3-methylbut-1-ynyl)-4-[[(2s)-morpholin-2-yl]methylamino]pyridin-2-yl]amino]pyrazine-2-carbonitrile Chemical compound C1=C(NC[C@H]2OCCNC2)C(C#CC(C)(O)C)=CN=C1NC1=CN=C(C#N)C=N1 IDZXROKRAQBADP-INIZCTEOSA-N 0.000 description 2
- ARCKEDFLGKMUNT-UHFFFAOYSA-N 5-[[5-(3-hydroxypropyl)-4-(piperidin-4-ylmethylamino)pyridin-2-yl]amino]pyrazine-2-carbonitrile Chemical compound C1=C(NCC2CCNCC2)C(CCCO)=CN=C1NC1=CN=C(C#N)C=N1 ARCKEDFLGKMUNT-UHFFFAOYSA-N 0.000 description 2
- NJBXGDOOPZFCNF-IURRXHLWSA-N 5-[[5-(3-hydroxypyrrolidin-1-yl)-4-[[(3r)-piperidin-3-yl]methylamino]pyridin-2-yl]amino]pyrazine-2-carbonitrile Chemical compound C1C(O)CCN1C(C(=C1)NC[C@H]2CNCCC2)=CN=C1NC1=CN=C(C#N)C=N1 NJBXGDOOPZFCNF-IURRXHLWSA-N 0.000 description 2
- LVBPSVIPSCIHSD-KRWDZBQOSA-N 5-[[5-(3-methoxy-3-methylbut-1-ynyl)-4-[[(2s)-morpholin-2-yl]methylamino]pyridin-2-yl]amino]pyrazine-2-carbonitrile Chemical compound C1=C(NC[C@H]2OCCNC2)C(C#CC(C)(C)OC)=CN=C1NC1=CN=C(C#N)C=N1 LVBPSVIPSCIHSD-KRWDZBQOSA-N 0.000 description 2
- BQBFTAJNHQICSL-UHFFFAOYSA-N 5-[[5-(3-methoxyphenyl)-4-[(1-methylpiperidin-4-yl)amino]pyridin-2-yl]amino]pyrazine-2-carbonitrile Chemical compound COC1=CC=CC(C=2C(=CC(NC=3N=CC(=NC=3)C#N)=NC=2)NC2CCN(C)CC2)=C1 BQBFTAJNHQICSL-UHFFFAOYSA-N 0.000 description 2
- OIJQFQOIOUFWEO-INIZCTEOSA-N 5-[[5-(3-methoxyprop-1-ynyl)-4-[[(2s)-morpholin-2-yl]methylamino]pyridin-2-yl]amino]pyrazine-2-carbonitrile Chemical compound C1=C(NC[C@H]2OCCNC2)C(C#CCOC)=CN=C1NC1=CN=C(C#N)C=N1 OIJQFQOIOUFWEO-INIZCTEOSA-N 0.000 description 2
- BUGQURNBBVBRTI-UHFFFAOYSA-N 5-[[5-(3-methoxypropyl)-4-(piperidin-4-ylmethylamino)pyridin-2-yl]amino]pyrazine-2-carbonitrile Chemical compound C1=C(NCC2CCNCC2)C(CCCOC)=CN=C1NC1=CN=C(C#N)C=N1 BUGQURNBBVBRTI-UHFFFAOYSA-N 0.000 description 2
- UKFMFQUZEVBPRN-MRXNPFEDSA-N 5-[[5-(3-methoxypropyl)-4-[[(2r)-morpholin-2-yl]methylamino]pyridin-2-yl]amino]pyrazine-2-carbonitrile Chemical compound C1=C(NC[C@@H]2OCCNC2)C(CCCOC)=CN=C1NC1=CN=C(C#N)C=N1 UKFMFQUZEVBPRN-MRXNPFEDSA-N 0.000 description 2
- DLCWOIUMTMBPNM-UHFFFAOYSA-N 5-[[5-(3-methyl-1,2,4-oxadiazol-5-yl)-4-(piperidin-4-ylmethylamino)pyridin-2-yl]amino]pyrazine-2-carbonitrile Chemical compound CC1=NOC(C=2C(=CC(NC=3N=CC(=NC=3)C#N)=NC=2)NCC2CCNCC2)=N1 DLCWOIUMTMBPNM-UHFFFAOYSA-N 0.000 description 2
- OKBSVWMOYSAQKV-KRWDZBQOSA-N 5-[[5-(4-fluorophenyl)-4-[[(2s)-morpholin-2-yl]methylamino]pyridin-2-yl]amino]pyrazine-2-carbonitrile Chemical compound C1=CC(F)=CC=C1C(C(=C1)NC[C@H]2OCCNC2)=CN=C1NC1=CN=C(C#N)C=N1 OKBSVWMOYSAQKV-KRWDZBQOSA-N 0.000 description 2
- JZBAKPBECKJVKG-UHFFFAOYSA-N 5-[[5-(4-hydroxybutyl)-4-(piperidin-4-ylmethylamino)pyridin-2-yl]amino]pyrazine-2-carbonitrile Chemical compound C1=C(NCC2CCNCC2)C(CCCCO)=CN=C1NC1=CN=C(C#N)C=N1 JZBAKPBECKJVKG-UHFFFAOYSA-N 0.000 description 2
- UZWGWFZOJLKGHN-UHFFFAOYSA-N 5-[[5-(4-methoxyphenyl)-4-(2-morpholin-2-ylethylamino)pyridin-2-yl]amino]pyrazine-2-carbonitrile Chemical compound C1=CC(OC)=CC=C1C(C(=C1)NCCC2OCCNC2)=CN=C1NC1=CN=C(C#N)C=N1 UZWGWFZOJLKGHN-UHFFFAOYSA-N 0.000 description 2
- DUCPMDQCBAHLFH-UHFFFAOYSA-N 5-[[5-(4-methoxyphenyl)-4-(piperidin-4-ylmethylamino)pyridin-2-yl]amino]pyrazine-2-carbonitrile Chemical compound C1=CC(OC)=CC=C1C(C(=C1)NCC2CCNCC2)=CN=C1NC1=CN=C(C#N)C=N1 DUCPMDQCBAHLFH-UHFFFAOYSA-N 0.000 description 2
- WFWOXOUEEDYSLF-GOSISDBHSA-N 5-[[5-(4-methoxyphenyl)-4-[[(2r)-morpholin-2-yl]methylamino]pyridin-2-yl]amino]pyrazine-2-carbonitrile Chemical compound C1=CC(OC)=CC=C1C(C(=C1)NC[C@@H]2OCCNC2)=CN=C1NC1=CN=C(C#N)C=N1 WFWOXOUEEDYSLF-GOSISDBHSA-N 0.000 description 2
- WFWOXOUEEDYSLF-SFHVURJKSA-N 5-[[5-(4-methoxyphenyl)-4-[[(2s)-morpholin-2-yl]methylamino]pyridin-2-yl]amino]pyrazine-2-carbonitrile Chemical compound C1=CC(OC)=CC=C1C(C(=C1)NC[C@H]2OCCNC2)=CN=C1NC1=CN=C(C#N)C=N1 WFWOXOUEEDYSLF-SFHVURJKSA-N 0.000 description 2
- CSDMWZZUBAKUKR-UHFFFAOYSA-N 5-[[5-(morpholine-4-carbonyl)-4-(piperidin-4-ylmethylamino)pyridin-2-yl]amino]pyrazine-2-carbonitrile Chemical compound C=1N=C(NC=2N=CC(=NC=2)C#N)C=C(NCC2CCNCC2)C=1C(=O)N1CCOCC1 CSDMWZZUBAKUKR-UHFFFAOYSA-N 0.000 description 2
- NJBXGDOOPZFCNF-WMCAAGNKSA-N 5-[[5-[(3s)-3-hydroxypyrrolidin-1-yl]-4-(piperidin-3-ylmethylamino)pyridin-2-yl]amino]pyrazine-2-carbonitrile Chemical compound C1[C@@H](O)CCN1C(C(=C1)NCC2CNCCC2)=CN=C1NC1=CN=C(C#N)C=N1 NJBXGDOOPZFCNF-WMCAAGNKSA-N 0.000 description 2
- URVKPGGFWMNFAZ-NSCUHMNNSA-N 5-[[5-[(e)-3-methoxyprop-1-enyl]-4-(piperidin-4-ylmethylamino)pyridin-2-yl]amino]pyrazine-2-carbonitrile Chemical compound C1=C(NCC2CCNCC2)C(/C=C/COC)=CN=C1NC1=CN=C(C#N)C=N1 URVKPGGFWMNFAZ-NSCUHMNNSA-N 0.000 description 2
- LJQDMJBLYYXJDZ-ONEGZZNKSA-N 5-[[5-[(e)-3-methoxyprop-1-enyl]-4-[(1-methylpiperidin-4-yl)amino]pyridin-2-yl]amino]pyrazine-2-carbonitrile Chemical compound C1=C(NC2CCN(C)CC2)C(/C=C/COC)=CN=C1NC1=CN=C(C#N)C=N1 LJQDMJBLYYXJDZ-ONEGZZNKSA-N 0.000 description 2
- MXUUXPOVNSHLSK-UHFFFAOYSA-N 5-[[5-[3-(2-methoxyethoxy)phenyl]-4-[(1-methylpiperidin-4-yl)amino]pyridin-2-yl]amino]pyrazine-2-carbonitrile Chemical compound COCCOC1=CC=CC(C=2C(=CC(NC=3N=CC(=NC=3)C#N)=NC=2)NC2CCN(C)CC2)=C1 MXUUXPOVNSHLSK-UHFFFAOYSA-N 0.000 description 2
- FAAYCACWXAPZEZ-UHFFFAOYSA-N 5-[[5-[3-(methoxymethyl)phenyl]-4-[(1-methylpiperidin-4-yl)amino]pyridin-2-yl]amino]pyrazine-2-carbonitrile Chemical compound COCC1=CC=CC(C=2C(=CC(NC=3N=CC(=NC=3)C#N)=NC=2)NC2CCN(C)CC2)=C1 FAAYCACWXAPZEZ-UHFFFAOYSA-N 0.000 description 2
- JQWRFBLGZRPNIN-UHFFFAOYSA-N 5-[[5-[4-(2-hydroxyethoxy)phenyl]-4-(piperidin-4-ylmethylamino)pyridin-2-yl]amino]pyrazine-2-carbonitrile Chemical compound C1=CC(OCCO)=CC=C1C(C(=C1)NCC2CCNCC2)=CN=C1NC1=CN=C(C#N)C=N1 JQWRFBLGZRPNIN-UHFFFAOYSA-N 0.000 description 2
- MISHDKMKAPBLEB-UHFFFAOYSA-N 5-[[5-[4-(2-methoxyethoxy)phenyl]-4-[(1-methylpiperidin-4-yl)amino]pyridin-2-yl]amino]pyrazine-2-carbonitrile Chemical compound C1=CC(OCCOC)=CC=C1C(C(=C1)NC2CCN(C)CC2)=CN=C1NC1=CN=C(C#N)C=N1 MISHDKMKAPBLEB-UHFFFAOYSA-N 0.000 description 2
- JZMMIRSZDIQCEQ-HXUWFJFHSA-N 5-[[5-[4-(2-methoxyethoxy)phenyl]-4-[[(2r)-morpholin-2-yl]methylamino]pyridin-2-yl]amino]pyrazine-2-carbonitrile Chemical compound C1=CC(OCCOC)=CC=C1C(C(=C1)NC[C@@H]2OCCNC2)=CN=C1NC1=CN=C(C#N)C=N1 JZMMIRSZDIQCEQ-HXUWFJFHSA-N 0.000 description 2
- JZMMIRSZDIQCEQ-FQEVSTJZSA-N 5-[[5-[4-(2-methoxyethoxy)phenyl]-4-[[(2s)-morpholin-2-yl]methylamino]pyridin-2-yl]amino]pyrazine-2-carbonitrile Chemical compound C1=CC(OCCOC)=CC=C1C(C(=C1)NC[C@H]2OCCNC2)=CN=C1NC1=CN=C(C#N)C=N1 JZMMIRSZDIQCEQ-FQEVSTJZSA-N 0.000 description 2
- BOWAGPXUJHUYDM-UHFFFAOYSA-N 5-[[5-[4-(3-methoxypropoxy)phenyl]-4-(piperidin-4-ylmethylamino)pyridin-2-yl]amino]pyrazine-2-carbonitrile Chemical compound C1=CC(OCCCOC)=CC=C1C(C(=C1)NCC2CCNCC2)=CN=C1NC1=CN=C(C#N)C=N1 BOWAGPXUJHUYDM-UHFFFAOYSA-N 0.000 description 2
- UXVIGJNLQCBBJA-UHFFFAOYSA-N 5-[[5-[4-(methoxymethyl)phenyl]-4-(piperidin-4-ylmethylamino)pyridin-2-yl]amino]pyrazine-2-carbonitrile Chemical compound C1=CC(COC)=CC=C1C(C(=C1)NCC2CCNCC2)=CN=C1NC1=CN=C(C#N)C=N1 UXVIGJNLQCBBJA-UHFFFAOYSA-N 0.000 description 2
- GKUXGLPKOVKCTR-LJQANCHMSA-N 5-[[5-[4-(methoxymethyl)phenyl]-4-[[(2r)-morpholin-2-yl]methylamino]pyridin-2-yl]amino]pyrazine-2-carbonitrile Chemical compound C1=CC(COC)=CC=C1C(C(=C1)NC[C@@H]2OCCNC2)=CN=C1NC1=CN=C(C#N)C=N1 GKUXGLPKOVKCTR-LJQANCHMSA-N 0.000 description 2
- GKUXGLPKOVKCTR-IBGZPJMESA-N 5-[[5-[4-(methoxymethyl)phenyl]-4-[[(2s)-morpholin-2-yl]methylamino]pyridin-2-yl]amino]pyrazine-2-carbonitrile Chemical compound C1=CC(COC)=CC=C1C(C(=C1)NC[C@H]2OCCNC2)=CN=C1NC1=CN=C(C#N)C=N1 GKUXGLPKOVKCTR-IBGZPJMESA-N 0.000 description 2
- BOJRSQFDMHIPTI-UHFFFAOYSA-N 5-[[5-amino-4-(2-aminoethylamino)pyridin-2-yl]amino]pyrazine-2-carbonitrile Chemical compound C1=C(N)C(NCCN)=CC(NC=2N=CC(=NC=2)C#N)=N1 BOJRSQFDMHIPTI-UHFFFAOYSA-N 0.000 description 2
- DRSNLIAXOITDFE-UHFFFAOYSA-N 5-[[5-amino-4-(3-aminopropylamino)pyridin-2-yl]amino]pyrazine-2-carbonitrile Chemical compound C1=C(N)C(NCCCN)=CC(NC=2N=CC(=NC=2)C#N)=N1 DRSNLIAXOITDFE-UHFFFAOYSA-N 0.000 description 2
- KEVSIAPRHSSKNM-UHFFFAOYSA-N 5-[[5-amino-4-(cyclohexylamino)pyridin-2-yl]amino]pyrazine-2-carbonitrile Chemical compound C1=C(NC2CCCCC2)C(N)=CN=C1NC1=CN=C(C#N)C=N1 KEVSIAPRHSSKNM-UHFFFAOYSA-N 0.000 description 2
- NEQZGAFAXIUKHF-UHFFFAOYSA-N 5-[[5-amino-4-(cyclohexylmethylamino)pyridin-2-yl]amino]pyrazine-2-carbonitrile Chemical compound C1=C(NCC2CCCCC2)C(N)=CN=C1NC1=CN=C(C#N)C=N1 NEQZGAFAXIUKHF-UHFFFAOYSA-N 0.000 description 2
- BCOAZQZWGJZXQC-UHFFFAOYSA-N 5-[[5-amino-4-(methylamino)pyridin-2-yl]amino]pyrazine-2-carbonitrile Chemical compound C1=C(N)C(NC)=CC(NC=2N=CC(=NC=2)C#N)=N1 BCOAZQZWGJZXQC-UHFFFAOYSA-N 0.000 description 2
- XXIQECANVNQMHC-UHFFFAOYSA-N 5-[[5-amino-4-(piperidin-2-ylmethylamino)pyridin-2-yl]amino]pyrazine-2-carbonitrile Chemical compound C1=C(NCC2NCCCC2)C(N)=CN=C1NC1=CN=C(C#N)C=N1 XXIQECANVNQMHC-UHFFFAOYSA-N 0.000 description 2
- IMSFWGDPEQXDQA-UHFFFAOYSA-N 5-[[5-amino-4-(piperidin-4-ylamino)pyridin-2-yl]amino]pyrazine-2-carbonitrile Chemical compound C1=C(NC2CCNCC2)C(N)=CN=C1NC1=CN=C(C#N)C=N1 IMSFWGDPEQXDQA-UHFFFAOYSA-N 0.000 description 2
- MJFMPXFWAGMSAU-UHFFFAOYSA-N 5-[[5-amino-4-(piperidin-4-ylmethoxy)pyridin-2-yl]amino]pyrazine-2-carbonitrile Chemical compound C1=C(OCC2CCNCC2)C(N)=CN=C1NC1=CN=C(C#N)C=N1 MJFMPXFWAGMSAU-UHFFFAOYSA-N 0.000 description 2
- CQXHHCDEVHCGRI-UHFFFAOYSA-N 5-[[5-amino-4-[(1-methylpiperidin-4-yl)amino]pyridin-2-yl]amino]pyrazine-2-carbonitrile Chemical compound C1CN(C)CCC1NC1=CC(NC=2N=CC(=NC=2)C#N)=NC=C1N CQXHHCDEVHCGRI-UHFFFAOYSA-N 0.000 description 2
- YWUPEUKQMLMCFP-UHFFFAOYSA-N 5-[[5-amino-4-[(3-amino-3-phenylpropyl)amino]pyridin-2-yl]amino]pyrazine-2-carbonitrile Chemical compound C=1C=CC=CC=1C(N)CCNC(C(=CN=1)N)=CC=1NC1=CN=C(C#N)C=N1 YWUPEUKQMLMCFP-UHFFFAOYSA-N 0.000 description 2
- OJEALPHSYVCGIW-UHFFFAOYSA-N 5-[[5-amino-4-[(8-methyl-8-azabicyclo[3.2.1]octan-3-yl)amino]pyridin-2-yl]amino]pyrazine-2-carbonitrile Chemical compound CN1C(C2)CCC1CC2NC(C(=CN=1)N)=CC=1NC1=CN=C(C#N)C=N1 OJEALPHSYVCGIW-UHFFFAOYSA-N 0.000 description 2
- YXZPTTJDOPURBJ-UHFFFAOYSA-N 5-[[5-amino-4-[2-(dimethylamino)ethylamino]pyridin-2-yl]amino]pyrazine-2-carbonitrile Chemical compound C1=C(N)C(NCCN(C)C)=CC(NC=2N=CC(=NC=2)C#N)=N1 YXZPTTJDOPURBJ-UHFFFAOYSA-N 0.000 description 2
- YUNDOAHTKIZTKU-SNVBAGLBSA-N 5-[[5-amino-4-[[(3r)-piperidin-3-yl]amino]pyridin-2-yl]amino]pyrazine-2-carbonitrile Chemical compound C1=C(N[C@H]2CNCCC2)C(N)=CN=C1NC1=CN=C(C#N)C=N1 YUNDOAHTKIZTKU-SNVBAGLBSA-N 0.000 description 2
- FICDGXNPBOQNHW-LLVKDONJSA-N 5-[[5-amino-4-[[(3r)-piperidin-3-yl]methylamino]pyridin-2-yl]amino]pyrazine-2-carbonitrile Chemical compound C1=C(NC[C@H]2CNCCC2)C(N)=CN=C1NC1=CN=C(C#N)C=N1 FICDGXNPBOQNHW-LLVKDONJSA-N 0.000 description 2
- YUNDOAHTKIZTKU-JTQLQIEISA-N 5-[[5-amino-4-[[(3s)-piperidin-3-yl]amino]pyridin-2-yl]amino]pyrazine-2-carbonitrile Chemical compound C1=C(N[C@@H]2CNCCC2)C(N)=CN=C1NC1=CN=C(C#N)C=N1 YUNDOAHTKIZTKU-JTQLQIEISA-N 0.000 description 2
- FICDGXNPBOQNHW-NSHDSACASA-N 5-[[5-amino-4-[[(3s)-piperidin-3-yl]methylamino]pyridin-2-yl]amino]pyrazine-2-carbonitrile Chemical compound C1=C(NC[C@@H]2CNCCC2)C(N)=CN=C1NC1=CN=C(C#N)C=N1 FICDGXNPBOQNHW-NSHDSACASA-N 0.000 description 2
- ZQRCLEWJESQBLV-UHFFFAOYSA-N 5-[[5-chloro-4-[(1-methylpiperidin-4-yl)amino]pyridin-2-yl]amino]pyrazine-2-carbonitrile Chemical compound C1CN(C)CCC1NC1=CC(NC=2N=CC(=NC=2)C#N)=NC=C1Cl ZQRCLEWJESQBLV-UHFFFAOYSA-N 0.000 description 2
- HLDBXTYLGQKBNQ-UHFFFAOYSA-N 5-[[5-chloro-4-[methyl-(1-methylpiperidin-4-yl)amino]pyridin-2-yl]amino]pyrazine-2-carbonitrile Chemical compound C=1C(NC=2N=CC(=NC=2)C#N)=NC=C(Cl)C=1N(C)C1CCN(C)CC1 HLDBXTYLGQKBNQ-UHFFFAOYSA-N 0.000 description 2
- KOPLRCYANOCCDI-UHFFFAOYSA-N 5-bromo-4-n-(piperidin-4-ylmethyl)pyridine-2,4-diamine Chemical compound C1=NC(N)=CC(NCC2CCNCC2)=C1Br KOPLRCYANOCCDI-UHFFFAOYSA-N 0.000 description 2
- WEUGYQVXWRLOCI-UHFFFAOYSA-N 5-chloro-4-n-(piperidin-4-ylmethyl)pyridine-2,4-diamine Chemical compound C1=NC(N)=CC(NCC2CCNCC2)=C1Cl WEUGYQVXWRLOCI-UHFFFAOYSA-N 0.000 description 2
- WSTAZAZSYYTWAC-UHFFFAOYSA-N 6-[(5-cyanopyrazin-2-yl)amino]-4-(morpholin-2-ylmethylamino)-n-phenylpyridine-3-carboxamide Chemical compound C=1N=C(NC=2N=CC(=NC=2)C#N)C=C(NCC2OCCNC2)C=1C(=O)NC1=CC=CC=C1 WSTAZAZSYYTWAC-UHFFFAOYSA-N 0.000 description 2
- IPKAEDRCDQYTBH-UHFFFAOYSA-N 6-[(5-cyanopyrazin-2-yl)amino]-4-(piperidin-4-ylmethylamino)-n-propan-2-ylpyridine-3-carboxamide Chemical compound C1=C(NCC2CCNCC2)C(C(=O)NC(C)C)=CN=C1NC1=CN=C(C#N)C=N1 IPKAEDRCDQYTBH-UHFFFAOYSA-N 0.000 description 2
- ALSWRIZRDIKCDV-UHFFFAOYSA-N 6-[(5-cyanopyrazin-2-yl)amino]-4-(piperidin-4-ylmethylamino)pyridine-3-carboxamide Chemical compound C1=C(NCC2CCNCC2)C(C(=O)N)=CN=C1NC1=CN=C(C#N)C=N1 ALSWRIZRDIKCDV-UHFFFAOYSA-N 0.000 description 2
- QFHUXWKUWBCZDA-UHFFFAOYSA-N 6-[(5-cyanopyrazin-2-yl)amino]-4-[(1-methylpiperidin-4-yl)amino]-n-phenylpyridine-3-carboxamide Chemical compound C1CN(C)CCC1NC1=CC(NC=2N=CC(=NC=2)C#N)=NC=C1C(=O)NC1=CC=CC=C1 QFHUXWKUWBCZDA-UHFFFAOYSA-N 0.000 description 2
- XREZEMOUSGFLEW-UHFFFAOYSA-N 6-[(5-cyanopyrazin-2-yl)amino]-4-[(1-methylpiperidin-4-yl)amino]pyridine-3-carboxylic acid Chemical compound C1CN(C)CCC1NC1=CC(NC=2N=CC(=NC=2)C#N)=NC=C1C(O)=O XREZEMOUSGFLEW-UHFFFAOYSA-N 0.000 description 2
- QPWHMDATXFXAQF-UHFFFAOYSA-N 6-[(5-cyanopyrazin-2-yl)amino]-n,n-dimethyl-4-(piperidin-4-ylmethylamino)pyridine-3-carboxamide Chemical compound C1=C(NCC2CCNCC2)C(C(=O)N(C)C)=CN=C1NC1=CN=C(C#N)C=N1 QPWHMDATXFXAQF-UHFFFAOYSA-N 0.000 description 2
- UVCHXZAIWULJEK-UHFFFAOYSA-N 6-[(5-cyanopyrazin-2-yl)amino]-n-(2-fluorophenyl)-4-(piperidin-4-ylmethylamino)pyridine-3-carboxamide Chemical compound FC1=CC=CC=C1NC(=O)C(C(=C1)NCC2CCNCC2)=CN=C1NC1=CN=C(C#N)C=N1 UVCHXZAIWULJEK-UHFFFAOYSA-N 0.000 description 2
- SMPXHWQYKJYLFM-UHFFFAOYSA-N 6-[(5-cyanopyrazin-2-yl)amino]-n-(2-hydroxyethyl)-4-(piperidin-4-ylmethylamino)pyridine-3-carboxamide Chemical compound C1=C(NCC2CCNCC2)C(C(=O)NCCO)=CN=C1NC1=CN=C(C#N)C=N1 SMPXHWQYKJYLFM-UHFFFAOYSA-N 0.000 description 2
- IVWDKXIUNCHXOK-UHFFFAOYSA-N 6-[(5-cyanopyrazin-2-yl)amino]-n-(2-methoxyethyl)-4-(piperidin-4-ylmethylamino)pyridine-3-carboxamide Chemical compound C1=C(NCC2CCNCC2)C(C(=O)NCCOC)=CN=C1NC1=CN=C(C#N)C=N1 IVWDKXIUNCHXOK-UHFFFAOYSA-N 0.000 description 2
- GYOBRPCLNAIMLL-UHFFFAOYSA-N 6-[(5-cyanopyrazin-2-yl)amino]-n-(2-methoxyethyl)-n-methyl-4-(piperidin-4-ylmethylamino)pyridine-3-carboxamide Chemical compound C1=C(NCC2CCNCC2)C(C(=O)N(C)CCOC)=CN=C1NC1=CN=C(C#N)C=N1 GYOBRPCLNAIMLL-UHFFFAOYSA-N 0.000 description 2
- IWIBPEQCNBYBNI-UHFFFAOYSA-N 6-[(5-cyanopyrazin-2-yl)amino]-n-(2-methoxyphenyl)-4-(piperidin-4-ylmethylamino)pyridine-3-carboxamide Chemical compound COC1=CC=CC=C1NC(=O)C(C(=C1)NCC2CCNCC2)=CN=C1NC1=CN=C(C#N)C=N1 IWIBPEQCNBYBNI-UHFFFAOYSA-N 0.000 description 2
- VGWLNIPMEARGPL-UHFFFAOYSA-N 6-[(5-cyanopyrazin-2-yl)amino]-n-(3-fluorophenyl)-4-(piperidin-4-ylmethylamino)pyridine-3-carboxamide Chemical compound FC1=CC=CC(NC(=O)C=2C(=CC(NC=3N=CC(=NC=3)C#N)=NC=2)NCC2CCNCC2)=C1 VGWLNIPMEARGPL-UHFFFAOYSA-N 0.000 description 2
- QUWQHXFTTRXGJH-UHFFFAOYSA-N 6-[(5-cyanopyrazin-2-yl)amino]-n-(3-methoxyphenyl)-4-(piperidin-4-ylmethylamino)pyridine-3-carboxamide Chemical compound COC1=CC=CC(NC(=O)C=2C(=CC(NC=3N=CC(=NC=3)C#N)=NC=2)NCC2CCNCC2)=C1 QUWQHXFTTRXGJH-UHFFFAOYSA-N 0.000 description 2
- BGGKCTJOATUWMC-UHFFFAOYSA-N 6-[(5-cyanopyrazin-2-yl)amino]-n-(3-morpholin-4-ylphenyl)-4-(piperidin-4-ylmethylamino)pyridine-3-carboxamide Chemical compound C=1N=C(NC=2N=CC(=NC=2)C#N)C=C(NCC2CCNCC2)C=1C(=O)NC(C=1)=CC=CC=1N1CCOCC1 BGGKCTJOATUWMC-UHFFFAOYSA-N 0.000 description 2
- ZPUOJJJMRIEZRF-UHFFFAOYSA-N 6-[(5-cyanopyrazin-2-yl)amino]-n-(4-fluorophenyl)-4-(piperidin-4-ylmethylamino)pyridine-3-carboxamide Chemical compound C1=CC(F)=CC=C1NC(=O)C(C(=C1)NCC2CCNCC2)=CN=C1NC1=CN=C(C#N)C=N1 ZPUOJJJMRIEZRF-UHFFFAOYSA-N 0.000 description 2
- PFSLGLWNVJPTNA-UHFFFAOYSA-N 6-[(5-cyanopyrazin-2-yl)amino]-n-(4-methoxyphenyl)-4-(piperidin-4-ylmethylamino)pyridine-3-carboxamide Chemical compound C1=CC(OC)=CC=C1NC(=O)C(C(=C1)NCC2CCNCC2)=CN=C1NC1=CN=C(C#N)C=N1 PFSLGLWNVJPTNA-UHFFFAOYSA-N 0.000 description 2
- SGDBMVRFBQBLFH-UHFFFAOYSA-N 6-[(5-cyanopyrazin-2-yl)amino]-n-(4-morpholin-4-ylphenyl)-4-(piperidin-4-ylmethylamino)pyridine-3-carboxamide Chemical compound C=1N=C(NC=2N=CC(=NC=2)C#N)C=C(NCC2CCNCC2)C=1C(=O)NC(C=C1)=CC=C1N1CCOCC1 SGDBMVRFBQBLFH-UHFFFAOYSA-N 0.000 description 2
- GXFNESJOOAPVOD-UHFFFAOYSA-N 6-[(5-cyanopyrazin-2-yl)amino]-n-ethyl-4-(piperidin-4-ylmethylamino)pyridine-3-carboxamide Chemical compound C1=C(NCC2CCNCC2)C(C(=O)NCC)=CN=C1NC1=CN=C(C#N)C=N1 GXFNESJOOAPVOD-UHFFFAOYSA-N 0.000 description 2
- QJFOLWYMDCVGMF-UHFFFAOYSA-N 6-[(5-cyanopyrazin-2-yl)amino]-n-ethyl-4-[(1-methylpiperidin-4-yl)amino]pyridine-3-carboxamide Chemical compound C1=C(NC2CCN(C)CC2)C(C(=O)NCC)=CN=C1NC1=CN=C(C#N)C=N1 QJFOLWYMDCVGMF-UHFFFAOYSA-N 0.000 description 2
- FRWQPYIBSFJXNH-UHFFFAOYSA-N 6-[(5-cyanopyrazin-2-yl)amino]-n-ethyl-4-[(8-methyl-8-azabicyclo[3.2.1]octan-3-yl)amino]pyridine-3-carboxamide Chemical compound C1=C(NC2CC3CCC(N3C)C2)C(C(=O)NCC)=CN=C1NC1=CN=C(C#N)C=N1 FRWQPYIBSFJXNH-UHFFFAOYSA-N 0.000 description 2
- OHPLTMNJIZQXSC-UHFFFAOYSA-N 6-[(5-cyanopyrazin-2-yl)amino]-n-phenyl-4-(piperidin-4-ylmethylamino)pyridine-3-carboxamide Chemical compound C=1N=C(NC=2N=CC(=NC=2)C#N)C=C(NCC2CCNCC2)C=1C(=O)NC1=CC=CC=C1 OHPLTMNJIZQXSC-UHFFFAOYSA-N 0.000 description 2
- PBCZSGKMGDDXIJ-HQCWYSJUSA-N 7-hydroxystaurosporine Chemical compound N([C@H](O)C1=C2C3=CC=CC=C3N3C2=C24)C(=O)C1=C2C1=CC=CC=C1N4[C@H]1C[C@@H](NC)[C@@H](OC)[C@]3(C)O1 PBCZSGKMGDDXIJ-HQCWYSJUSA-N 0.000 description 2
- PBCZSGKMGDDXIJ-UHFFFAOYSA-N 7beta-hydroxystaurosporine Natural products C12=C3N4C5=CC=CC=C5C3=C3C(O)NC(=O)C3=C2C2=CC=CC=C2N1C1CC(NC)C(OC)C4(C)O1 PBCZSGKMGDDXIJ-UHFFFAOYSA-N 0.000 description 2
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 2
- 241000416162 Astragalus gummifer Species 0.000 description 2
- 241000283690 Bos taurus Species 0.000 description 2
- 101150006084 CHKB gene Proteins 0.000 description 2
- 101100220616 Caenorhabditis elegans chk-2 gene Proteins 0.000 description 2
- 241000282693 Cercopithecidae Species 0.000 description 2
- 108010019243 Checkpoint Kinase 2 Proteins 0.000 description 2
- VGCXGMAHQTYDJK-UHFFFAOYSA-N Chloroacetyl chloride Chemical compound ClCC(Cl)=O VGCXGMAHQTYDJK-UHFFFAOYSA-N 0.000 description 2
- 102100032857 Cyclin-dependent kinase 1 Human genes 0.000 description 2
- 101710106279 Cyclin-dependent kinase 1 Proteins 0.000 description 2
- FBPFZTCFMRRESA-FSIIMWSLSA-N D-Glucitol Natural products OC[C@H](O)[C@H](O)[C@@H](O)[C@H](O)CO FBPFZTCFMRRESA-FSIIMWSLSA-N 0.000 description 2
- FBPFZTCFMRRESA-JGWLITMVSA-N D-glucitol Chemical compound OC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-JGWLITMVSA-N 0.000 description 2
- 230000012746 DNA damage checkpoint Effects 0.000 description 2
- AOJJSUZBOXZQNB-TZSSRYMLSA-N Doxorubicin Chemical compound O([C@H]1C[C@@](O)(CC=2C(O)=C3C(=O)C=4C=CC=C(C=4C(=O)C3=C(O)C=21)OC)C(=O)CO)[C@H]1C[C@H](N)[C@H](O)[C@H](C)O1 AOJJSUZBOXZQNB-TZSSRYMLSA-N 0.000 description 2
- 241000792859 Enema Species 0.000 description 2
- 241000283073 Equus caballus Species 0.000 description 2
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical compound CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 description 2
- 230000037060 G2 phase arrest Effects 0.000 description 2
- 108010010803 Gelatin Proteins 0.000 description 2
- 101000624625 Homo sapiens M-phase inducer phosphatase 1 Proteins 0.000 description 2
- 101000624643 Homo sapiens M-phase inducer phosphatase 3 Proteins 0.000 description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 2
- 208000007766 Kaposi sarcoma Diseases 0.000 description 2
- 102100023326 M-phase inducer phosphatase 1 Human genes 0.000 description 2
- 102100034069 MAP kinase-activated protein kinase 2 Human genes 0.000 description 2
- 101710141394 MAP kinase-activated protein kinase 2 Proteins 0.000 description 2
- TWRXJAOTZQYOKJ-UHFFFAOYSA-L Magnesium chloride Chemical compound [Mg+2].[Cl-].[Cl-] TWRXJAOTZQYOKJ-UHFFFAOYSA-L 0.000 description 2
- NWIBSHFKIJFRCO-WUDYKRTCSA-N Mytomycin Chemical compound C1N2C(C(C(C)=C(N)C3=O)=O)=C3[C@@H](COC(N)=O)[C@@]2(OC)[C@@H]2[C@H]1N2 NWIBSHFKIJFRCO-WUDYKRTCSA-N 0.000 description 2
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 2
- IMNFDUFMRHMDMM-UHFFFAOYSA-N N-Heptane Chemical compound CCCCCCC IMNFDUFMRHMDMM-UHFFFAOYSA-N 0.000 description 2
- WHNWPMSKXPGLAX-UHFFFAOYSA-N N-Vinyl-2-pyrrolidone Chemical compound C=CN1CCCC1=O WHNWPMSKXPGLAX-UHFFFAOYSA-N 0.000 description 2
- DFPAKSUCGFBDDF-UHFFFAOYSA-N Nicotinamide Chemical compound NC(=O)C1=CC=CN=C1 DFPAKSUCGFBDDF-UHFFFAOYSA-N 0.000 description 2
- GLUUGHFHXGJENI-UHFFFAOYSA-N Piperazine Chemical compound C1CNCCN1 GLUUGHFHXGJENI-UHFFFAOYSA-N 0.000 description 2
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 2
- 102000004257 Potassium Channel Human genes 0.000 description 2
- NPXOKRUENSOPAO-UHFFFAOYSA-N Raney nickel Chemical compound [Al].[Ni] NPXOKRUENSOPAO-UHFFFAOYSA-N 0.000 description 2
- 230000018199 S phase Effects 0.000 description 2
- 102100031075 Serine/threonine-protein kinase Chk2 Human genes 0.000 description 2
- 206010041067 Small cell lung cancer Diseases 0.000 description 2
- DBMJMQXJHONAFJ-UHFFFAOYSA-M Sodium laurylsulphate Chemical compound [Na+].CCCCCCCCCCCCOS([O-])(=O)=O DBMJMQXJHONAFJ-UHFFFAOYSA-M 0.000 description 2
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 2
- 229930006000 Sucrose Natural products 0.000 description 2
- 239000012317 TBTU Substances 0.000 description 2
- 229910021626 Tin(II) chloride Inorganic materials 0.000 description 2
- 229920001615 Tragacanth Polymers 0.000 description 2
- HEDRZPFGACZZDS-MICDWDOJSA-N Trichloro(2H)methane Chemical compound [2H]C(Cl)(Cl)Cl HEDRZPFGACZZDS-MICDWDOJSA-N 0.000 description 2
- 108010078814 Tumor Suppressor Protein p53 Proteins 0.000 description 2
- SDBLKDCGBOJVPW-UHFFFAOYSA-N [(z)-1-aminoethylideneamino] 6-[(5-cyanopyrazin-2-yl)amino]-4-[[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]methylamino]pyridine-3-carboxylate Chemical compound C1=C(NCC2CCN(CC2)C(=O)OC(C)(C)C)C(C(=O)O\N=C(N)/C)=CN=C1NC1=CN=C(C#N)C=N1 SDBLKDCGBOJVPW-UHFFFAOYSA-N 0.000 description 2
- CLZISMQKJZCZDN-UHFFFAOYSA-N [benzotriazol-1-yloxy(dimethylamino)methylidene]-dimethylazanium Chemical compound C1=CC=C2N(OC(N(C)C)=[N+](C)C)N=NC2=C1 CLZISMQKJZCZDN-UHFFFAOYSA-N 0.000 description 2
- 238000010521 absorption reaction Methods 0.000 description 2
- 230000009471 action Effects 0.000 description 2
- 239000013543 active substance Substances 0.000 description 2
- 150000001299 aldehydes Chemical class 0.000 description 2
- 150000001409 amidines Chemical class 0.000 description 2
- VZTDIZULWFCMLS-UHFFFAOYSA-N ammonium formate Chemical compound [NH4+].[O-]C=O VZTDIZULWFCMLS-UHFFFAOYSA-N 0.000 description 2
- 150000008064 anhydrides Chemical class 0.000 description 2
- 125000000129 anionic group Chemical group 0.000 description 2
- 238000010913 antigen-directed enzyme pro-drug therapy Methods 0.000 description 2
- 239000003963 antioxidant agent Substances 0.000 description 2
- 235000006708 antioxidants Nutrition 0.000 description 2
- 239000012300 argon atmosphere Substances 0.000 description 2
- 125000004429 atom Chemical group 0.000 description 2
- 125000001164 benzothiazolyl group Chemical group S1C(=NC2=C1C=CC=C2)* 0.000 description 2
- ABJVEAFRFGTATH-UHFFFAOYSA-N benzyl 4-(aminomethyl)piperidine-1-carboxylate Chemical compound C1CC(CN)CCN1C(=O)OCC1=CC=CC=C1 ABJVEAFRFGTATH-UHFFFAOYSA-N 0.000 description 2
- QYEQMISFIXXCKZ-UHFFFAOYSA-N benzyl 4-[[5-bromo-2-(2,2-dimethylpropanoylamino)pyridin-4-yl]amino]piperidine-1-carboxylate Chemical compound C1=NC(NC(=O)C(C)(C)C)=CC(NC2CCN(CC2)C(=O)OCC=2C=CC=CC=2)=C1Br QYEQMISFIXXCKZ-UHFFFAOYSA-N 0.000 description 2
- WGQKYBSKWIADBV-UHFFFAOYSA-N benzylamine Chemical compound NCC1=CC=CC=C1 WGQKYBSKWIADBV-UHFFFAOYSA-N 0.000 description 2
- LUFPJJNWMYZRQE-UHFFFAOYSA-N benzylsulfanylmethylbenzene Chemical compound C=1C=CC=CC=1CSCC1=CC=CC=C1 LUFPJJNWMYZRQE-UHFFFAOYSA-N 0.000 description 2
- 230000033228 biological regulation Effects 0.000 description 2
- QLFNUXTWJGXNLH-UHFFFAOYSA-N bis(2-methoxyethoxy)alumane Chemical compound COCCO[AlH]OCCOC QLFNUXTWJGXNLH-UHFFFAOYSA-N 0.000 description 2
- 230000000903 blocking effect Effects 0.000 description 2
- 210000004204 blood vessel Anatomy 0.000 description 2
- 210000000481 breast Anatomy 0.000 description 2
- HQABUPZFAYXKJW-UHFFFAOYSA-N butan-1-amine Chemical compound CCCCN HQABUPZFAYXKJW-UHFFFAOYSA-N 0.000 description 2
- 229910002092 carbon dioxide Inorganic materials 0.000 description 2
- 125000002843 carboxylic acid group Chemical group 0.000 description 2
- 125000002091 cationic group Chemical group 0.000 description 2
- 230000032823 cell division Effects 0.000 description 2
- 230000001413 cellular effect Effects 0.000 description 2
- 238000002512 chemotherapy Methods 0.000 description 2
- 210000001072 colon Anatomy 0.000 description 2
- 208000029742 colonic neoplasm Diseases 0.000 description 2
- 239000012230 colorless oil Substances 0.000 description 2
- 238000009833 condensation Methods 0.000 description 2
- 230000005494 condensation Effects 0.000 description 2
- 229940127089 cytotoxic agent Drugs 0.000 description 2
- 230000002939 deleterious effect Effects 0.000 description 2
- 230000001419 dependent effect Effects 0.000 description 2
- 238000011161 development Methods 0.000 description 2
- LWJYMKDMGMOTSB-UHFFFAOYSA-L dichlorotin;hydrate Chemical compound O.Cl[Sn]Cl LWJYMKDMGMOTSB-UHFFFAOYSA-L 0.000 description 2
- 125000006222 dimethylaminomethyl group Chemical group [H]C([H])([H])N(C([H])([H])[H])C([H])([H])* 0.000 description 2
- 108700003601 dimethylglycine Proteins 0.000 description 2
- 238000006073 displacement reaction Methods 0.000 description 2
- 239000007920 enema Substances 0.000 description 2
- 229940095399 enema Drugs 0.000 description 2
- 239000003623 enhancer Substances 0.000 description 2
- 125000002587 enol group Chemical group 0.000 description 2
- FRYHCSODNHYDPU-UHFFFAOYSA-N ethanesulfonyl chloride Chemical compound CCS(Cl)(=O)=O FRYHCSODNHYDPU-UHFFFAOYSA-N 0.000 description 2
- YAERONHOUIXHJW-UHFFFAOYSA-N ethyl 1-[6-[(5-cyanopyrazin-2-yl)amino]-4-(piperidin-3-ylmethylamino)pyridin-3-yl]pyrrole-3-carboxylate Chemical compound C1=C(C(=O)OCC)C=CN1C(C(=C1)NCC2CNCCC2)=CN=C1NC1=CN=C(C#N)C=N1 YAERONHOUIXHJW-UHFFFAOYSA-N 0.000 description 2
- BPZSHYWIQQBIKO-UHFFFAOYSA-N ethyl 4-[6-[(5-cyanopyrazin-2-yl)amino]-4-(piperidin-4-ylmethylamino)pyridin-3-yl]thiophene-2-carboxylate Chemical compound S1C(C(=O)OCC)=CC(C=2C(=CC(NC=3N=CC(=NC=3)C#N)=NC=2)NCC2CCNCC2)=C1 BPZSHYWIQQBIKO-UHFFFAOYSA-N 0.000 description 2
- 230000007717 exclusion Effects 0.000 description 2
- 239000003889 eye drop Substances 0.000 description 2
- 229940012356 eye drops Drugs 0.000 description 2
- 239000000945 filler Substances 0.000 description 2
- 238000001914 filtration Methods 0.000 description 2
- 235000019634 flavors Nutrition 0.000 description 2
- 230000037406 food intake Effects 0.000 description 2
- 235000003599 food sweetener Nutrition 0.000 description 2
- 229920000159 gelatin Polymers 0.000 description 2
- 239000008273 gelatin Substances 0.000 description 2
- 235000019322 gelatine Nutrition 0.000 description 2
- 235000011852 gelatine desserts Nutrition 0.000 description 2
- 230000012010 growth Effects 0.000 description 2
- 208000014829 head and neck neoplasm Diseases 0.000 description 2
- 230000006801 homologous recombination Effects 0.000 description 2
- 238000002744 homologous recombination Methods 0.000 description 2
- 150000004677 hydrates Chemical class 0.000 description 2
- 239000001257 hydrogen Substances 0.000 description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 2
- NPZTUJOABDZTLV-UHFFFAOYSA-N hydroxybenzotriazole Substances O=C1C=CC=C2NNN=C12 NPZTUJOABDZTLV-UHFFFAOYSA-N 0.000 description 2
- 239000001866 hydroxypropyl methyl cellulose Substances 0.000 description 2
- 235000010979 hydroxypropyl methyl cellulose Nutrition 0.000 description 2
- UFVKGYZPFZQRLF-UHFFFAOYSA-N hydroxypropyl methyl cellulose Chemical compound OC1C(O)C(OC)OC(CO)C1OC1C(O)C(O)C(OC2C(C(O)C(OC3C(C(O)C(O)C(CO)O3)O)C(CO)O2)O)C(CO)O1 UFVKGYZPFZQRLF-UHFFFAOYSA-N 0.000 description 2
- 229920003088 hydroxypropyl methyl cellulose Polymers 0.000 description 2
- 206010020718 hyperplasia Diseases 0.000 description 2
- 210000003734 kidney Anatomy 0.000 description 2
- 208000032839 leukemia Diseases 0.000 description 2
- 239000002502 liposome Substances 0.000 description 2
- HSZCZNFXUDYRKD-UHFFFAOYSA-M lithium iodide Chemical compound [Li+].[I-] HSZCZNFXUDYRKD-UHFFFAOYSA-M 0.000 description 2
- 210000004185 liver Anatomy 0.000 description 2
- 239000000314 lubricant Substances 0.000 description 2
- 210000004072 lung Anatomy 0.000 description 2
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 2
- 230000003211 malignant effect Effects 0.000 description 2
- 230000004060 metabolic process Effects 0.000 description 2
- 229910052751 metal Inorganic materials 0.000 description 2
- 239000002184 metal Substances 0.000 description 2
- LXXHCOPDPDBZCD-UHFFFAOYSA-N methyl 4-(azepan-4-ylamino)-6-[(5-cyanopyrazin-2-yl)amino]pyridine-3-carboxylate Chemical compound C1=C(NC2CCNCCC2)C(C(=O)OC)=CN=C1NC1=CN=C(C#N)C=N1 LXXHCOPDPDBZCD-UHFFFAOYSA-N 0.000 description 2
- UMWULLSTLUNDPD-UHFFFAOYSA-N methyl 6-[(5-cyanopyrazin-2-yl)amino]-4-(1-piperidin-4-ylethylamino)pyridine-3-carboxylate Chemical compound C1=C(NC(C)C2CCNCC2)C(C(=O)OC)=CN=C1NC1=CN=C(C#N)C=N1 UMWULLSTLUNDPD-UHFFFAOYSA-N 0.000 description 2
- KMQKUYZPKPAMNR-UHFFFAOYSA-N methyl 6-[(5-cyanopyrazin-2-yl)amino]-4-(2-piperidin-4-ylethylamino)pyridine-3-carboxylate Chemical compound C1=C(NCCC2CCNCC2)C(C(=O)OC)=CN=C1NC1=CN=C(C#N)C=N1 KMQKUYZPKPAMNR-UHFFFAOYSA-N 0.000 description 2
- PHPWNBVMNTWSJB-UHFFFAOYSA-N methyl 6-[(5-cyanopyrazin-2-yl)amino]-4-(morpholin-2-ylmethylamino)pyridine-3-carboxylate Chemical compound C1=C(NCC2OCCNC2)C(C(=O)OC)=CN=C1NC1=CN=C(C#N)C=N1 PHPWNBVMNTWSJB-UHFFFAOYSA-N 0.000 description 2
- LWIXFVOUYDMLAL-UHFFFAOYSA-N methyl 6-[(5-cyanopyrazin-2-yl)amino]-4-(piperidin-2-ylmethylamino)pyridine-3-carboxylate Chemical compound C1=C(NCC2NCCCC2)C(C(=O)OC)=CN=C1NC1=CN=C(C#N)C=N1 LWIXFVOUYDMLAL-UHFFFAOYSA-N 0.000 description 2
- KWKCNKSTWSRLEP-UHFFFAOYSA-N methyl 6-[(5-cyanopyrazin-2-yl)amino]-4-(piperidin-4-ylamino)pyridine-3-carboxylate Chemical compound C1=C(NC2CCNCC2)C(C(=O)OC)=CN=C1NC1=CN=C(C#N)C=N1 KWKCNKSTWSRLEP-UHFFFAOYSA-N 0.000 description 2
- LANZMFRFDUCQMM-UHFFFAOYSA-N methyl 6-[(5-cyanopyrazin-2-yl)amino]-4-[(1,2,2,6,6-pentamethylpiperidin-4-yl)amino]pyridine-3-carboxylate Chemical compound C1=C(NC2CC(C)(C)N(C)C(C)(C)C2)C(C(=O)OC)=CN=C1NC1=CN=C(C#N)C=N1 LANZMFRFDUCQMM-UHFFFAOYSA-N 0.000 description 2
- NBXASWVFBAUSQM-UHFFFAOYSA-N methyl 6-[(5-cyanopyrazin-2-yl)amino]-4-[(1-methylpiperidin-4-yl)methylamino]pyridine-3-carboxylate Chemical compound C1=C(NCC2CCN(C)CC2)C(C(=O)OC)=CN=C1NC1=CN=C(C#N)C=N1 NBXASWVFBAUSQM-UHFFFAOYSA-N 0.000 description 2
- LVWQVESONMDYGL-UHFFFAOYSA-N methyl 6-[(5-cyanopyrazin-2-yl)amino]-4-[(1-propylpiperidin-4-yl)amino]pyridine-3-carboxylate Chemical compound C1CN(CCC)CCC1NC1=CC(NC=2N=CC(=NC=2)C#N)=NC=C1C(=O)OC LVWQVESONMDYGL-UHFFFAOYSA-N 0.000 description 2
- NIKCEZRYPMWTTB-UHFFFAOYSA-N methyl 6-[(5-cyanopyrazin-2-yl)amino]-4-[(3-methyloxetan-3-yl)methylamino]pyridine-3-carboxylate Chemical compound C1=C(NCC2(C)COC2)C(C(=O)OC)=CN=C1NC1=CN=C(C#N)C=N1 NIKCEZRYPMWTTB-UHFFFAOYSA-N 0.000 description 2
- FVMRXZSCNTVOIW-UHFFFAOYSA-N methyl 6-[(5-cyanopyrazin-2-yl)amino]-4-[(8-propyl-8-azabicyclo[3.2.1]octan-3-yl)amino]pyridine-3-carboxylate Chemical compound CCCN1C(C2)CCC1CC2NC(C(=CN=1)C(=O)OC)=CC=1NC1=CN=C(C#N)C=N1 FVMRXZSCNTVOIW-UHFFFAOYSA-N 0.000 description 2
- LDNJFYUZVVQTMR-UHFFFAOYSA-N methyl 6-[(5-cyanopyrazin-2-yl)amino]-4-[(9-methyl-9-azabicyclo[3.3.1]nonan-3-yl)amino]pyridine-3-carboxylate Chemical compound C1=C(NC2CC3CCCC(N3C)C2)C(C(=O)OC)=CN=C1NC1=CN=C(C#N)C=N1 LDNJFYUZVVQTMR-UHFFFAOYSA-N 0.000 description 2
- YHZYKVXTOKXJAB-ZDUSSCGKSA-N methyl 6-[(5-cyanopyrazin-2-yl)amino]-4-[2-[(2s)-morpholin-2-yl]ethylamino]pyridine-3-carboxylate Chemical compound C1=C(NCC[C@@H]2OCCNC2)C(C(=O)OC)=CN=C1NC1=CN=C(C#N)C=N1 YHZYKVXTOKXJAB-ZDUSSCGKSA-N 0.000 description 2
- JGPSCUNMNDSFBT-JXFKEZNVSA-N methyl 6-[(5-cyanopyrazin-2-yl)amino]-4-[[(2s,4s)-2-(phenylcarbamoyl)piperidin-4-yl]amino]pyridine-3-carboxylate Chemical compound C1=C(N[C@@H]2C[C@H](NCC2)C(=O)NC=2C=CC=CC=2)C(C(=O)OC)=CN=C1NC1=CN=C(C#N)C=N1 JGPSCUNMNDSFBT-JXFKEZNVSA-N 0.000 description 2
- KDTSWLDPVGDFOJ-UHFFFAOYSA-N methyl 6-[(5-cyanopyrazin-2-yl)amino]-4-[methyl(piperidin-4-ylmethyl)amino]pyridine-3-carboxylate Chemical compound C1=C(N(C)CC2CCNCC2)C(C(=O)OC)=CN=C1NC1=CN=C(C#N)C=N1 KDTSWLDPVGDFOJ-UHFFFAOYSA-N 0.000 description 2
- MZOOJNZWAAVSCO-UHFFFAOYSA-N methyl 6-[(5-cyanopyrazin-2-yl)amino]-4-[methyl-(1-methylpiperidin-4-yl)amino]pyridine-3-carboxylate Chemical compound C1=C(N(C)C2CCN(C)CC2)C(C(=O)OC)=CN=C1NC1=CN=C(C#N)C=N1 MZOOJNZWAAVSCO-UHFFFAOYSA-N 0.000 description 2
- 125000006533 methyl amino methyl group Chemical group [H]N(C([H])([H])[H])C([H])([H])* 0.000 description 2
- YNBADRVTZLEFNH-UHFFFAOYSA-N methyl nicotinate Chemical class COC(=O)C1=CC=CN=C1 YNBADRVTZLEFNH-UHFFFAOYSA-N 0.000 description 2
- MGJXBDMLVWIYOQ-UHFFFAOYSA-N methylazanide Chemical compound [NH-]C MGJXBDMLVWIYOQ-UHFFFAOYSA-N 0.000 description 2
- 238000000465 moulding Methods 0.000 description 2
- 230000035772 mutation Effects 0.000 description 2
- 229940078490 n,n-dimethylglycine Drugs 0.000 description 2
- VGPBPWRBXBKGRE-UHFFFAOYSA-N n-(oxomethylidene)hydroxylamine Chemical class ON=C=O VGPBPWRBXBKGRE-UHFFFAOYSA-N 0.000 description 2
- PQMSIVDFLJIQQV-UHFFFAOYSA-N n-[6-[(5-cyanopyrazin-2-yl)amino]-4-(oxan-4-ylmethoxy)pyridin-3-yl]-3-piperidin-4-ylpropanamide Chemical compound C=1N=C(NC=2N=CC(=NC=2)C#N)C=C(OCC2CCOCC2)C=1NC(=O)CCC1CCNCC1 PQMSIVDFLJIQQV-UHFFFAOYSA-N 0.000 description 2
- JEOQJTLWGMTAHZ-UHFFFAOYSA-N n-[6-[(5-cyanopyrazin-2-yl)amino]-4-(piperidin-3-ylmethylamino)pyridin-3-yl]-2-(dimethylamino)acetamide Chemical compound C1=C(NCC2CNCCC2)C(NC(=O)CN(C)C)=CN=C1NC1=CN=C(C#N)C=N1 JEOQJTLWGMTAHZ-UHFFFAOYSA-N 0.000 description 2
- MURSGYMYSVYPJN-UHFFFAOYSA-N n-[6-[(5-cyanopyrazin-2-yl)amino]-4-(piperidin-3-ylmethylamino)pyridin-3-yl]-3-(4-methyl-1,3-thiazol-5-yl)propanamide Chemical compound N1=CSC(CCC(=O)NC=2C(=CC(NC=3N=CC(=NC=3)C#N)=NC=2)NCC2CNCCC2)=C1C MURSGYMYSVYPJN-UHFFFAOYSA-N 0.000 description 2
- JDJXPULNEUMGTG-UHFFFAOYSA-N n-[6-[(5-cyanopyrazin-2-yl)amino]-4-(piperidin-3-ylmethylamino)pyridin-3-yl]-3-morpholin-4-ylpropanamide Chemical compound C=1N=C(NC=2N=CC(=NC=2)C#N)C=C(NCC2CNCCC2)C=1NC(=O)CCN1CCOCC1 JDJXPULNEUMGTG-UHFFFAOYSA-N 0.000 description 2
- UJJLRWAHTQUJEQ-UHFFFAOYSA-N n-[6-[(5-cyanopyrazin-2-yl)amino]-4-(piperidin-3-ylmethylamino)pyridin-3-yl]-3-piperidin-4-ylpropanamide Chemical compound C=1N=C(NC=2N=CC(=NC=2)C#N)C=C(NCC2CNCCC2)C=1NC(=O)CCC1CCNCC1 UJJLRWAHTQUJEQ-UHFFFAOYSA-N 0.000 description 2
- TVOFVMPOCGFVLK-UHFFFAOYSA-N n-[6-[(5-cyanopyrazin-2-yl)amino]-4-(piperidin-4-ylamino)pyridin-3-yl]-2-(dimethylamino)acetamide Chemical compound C1=C(NC2CCNCC2)C(NC(=O)CN(C)C)=CN=C1NC1=CN=C(C#N)C=N1 TVOFVMPOCGFVLK-UHFFFAOYSA-N 0.000 description 2
- RKEMHZRVJPKONG-UHFFFAOYSA-N n-[6-[(5-cyanopyrazin-2-yl)amino]-4-(piperidin-4-ylmethylamino)pyridin-3-yl]-2-(4-methoxyphenyl)acetamide Chemical compound C1=CC(OC)=CC=C1CC(=O)NC(C(=C1)NCC2CCNCC2)=CN=C1NC1=CN=C(C#N)C=N1 RKEMHZRVJPKONG-UHFFFAOYSA-N 0.000 description 2
- ZXSACNITYGYFJR-UHFFFAOYSA-N n-[6-[(5-cyanopyrazin-2-yl)amino]-4-(piperidin-4-ylmethylamino)pyridin-3-yl]-3-(4-methoxyphenyl)propanamide Chemical compound C1=CC(OC)=CC=C1CCC(=O)NC(C(=C1)NCC2CCNCC2)=CN=C1NC1=CN=C(C#N)C=N1 ZXSACNITYGYFJR-UHFFFAOYSA-N 0.000 description 2
- OTOQIDJPHYFLLJ-UHFFFAOYSA-N n-[6-[(5-cyanopyrazin-2-yl)amino]-4-(piperidin-4-ylmethylamino)pyridin-3-yl]-3-piperidin-1-ylpropanamide Chemical compound C=1N=C(NC=2N=CC(=NC=2)C#N)C=C(NCC2CCNCC2)C=1NC(=O)CCN1CCCCC1 OTOQIDJPHYFLLJ-UHFFFAOYSA-N 0.000 description 2
- HBNAYVNFOKBNGG-UHFFFAOYSA-N n-[6-[(5-cyanopyrazin-2-yl)amino]-4-(piperidin-4-ylmethylamino)pyridin-3-yl]-4-methoxybenzamide Chemical compound C1=CC(OC)=CC=C1C(=O)NC(C(=C1)NCC2CCNCC2)=CN=C1NC1=CN=C(C#N)C=N1 HBNAYVNFOKBNGG-UHFFFAOYSA-N 0.000 description 2
- VRVCVWBGUCHALW-CYBMUJFWSA-N n-[6-[(5-cyanopyrazin-2-yl)amino]-4-[[(3r)-piperidin-3-yl]amino]pyridin-3-yl]-2-(dimethylamino)acetamide Chemical compound C1=C(N[C@H]2CNCCC2)C(NC(=O)CN(C)C)=CN=C1NC1=CN=C(C#N)C=N1 VRVCVWBGUCHALW-CYBMUJFWSA-N 0.000 description 2
- VRVCVWBGUCHALW-ZDUSSCGKSA-N n-[6-[(5-cyanopyrazin-2-yl)amino]-4-[[(3s)-piperidin-3-yl]amino]pyridin-3-yl]-2-(dimethylamino)acetamide Chemical compound C1=C(N[C@@H]2CNCCC2)C(NC(=O)CN(C)C)=CN=C1NC1=CN=C(C#N)C=N1 VRVCVWBGUCHALW-ZDUSSCGKSA-N 0.000 description 2
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- 229940097496 nasal spray Drugs 0.000 description 2
- 239000007922 nasal spray Substances 0.000 description 2
- 208000002154 non-small cell lung carcinoma Diseases 0.000 description 2
- 239000003883 ointment base Substances 0.000 description 2
- 238000011275 oncology therapy Methods 0.000 description 2
- 150000002891 organic anions Chemical class 0.000 description 2
- 201000008968 osteosarcoma Diseases 0.000 description 2
- 125000001715 oxadiazolyl group Chemical group 0.000 description 2
- 125000003566 oxetanyl group Chemical group 0.000 description 2
- 238000004806 packaging method and process Methods 0.000 description 2
- 210000000496 pancreas Anatomy 0.000 description 2
- 230000035515 penetration Effects 0.000 description 2
- RGCLLPNLLBQHPF-HJWRWDBZSA-N phosphamidon Chemical compound CCN(CC)C(=O)C(\Cl)=C(/C)OP(=O)(OC)OC RGCLLPNLLBQHPF-HJWRWDBZSA-N 0.000 description 2
- 238000002428 photodynamic therapy Methods 0.000 description 2
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 2
- 229920005862 polyol Polymers 0.000 description 2
- 150000003077 polyols Chemical class 0.000 description 2
- 235000013855 polyvinylpyrrolidone Nutrition 0.000 description 2
- 229920000036 polyvinylpyrrolidone Polymers 0.000 description 2
- 229910052700 potassium Inorganic materials 0.000 description 2
- 239000011591 potassium Substances 0.000 description 2
- SCVFZCLFOSHCOH-UHFFFAOYSA-M potassium acetate Chemical compound [K+].CC([O-])=O SCVFZCLFOSHCOH-UHFFFAOYSA-M 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- 108020001213 potassium channel Proteins 0.000 description 2
- 230000003389 potentiating effect Effects 0.000 description 2
- 229940069328 povidone Drugs 0.000 description 2
- 238000002360 preparation method Methods 0.000 description 2
- 238000002203 pretreatment Methods 0.000 description 2
- 230000001737 promoting effect Effects 0.000 description 2
- 230000000069 prophylactic effect Effects 0.000 description 2
- 238000011321 prophylaxis Methods 0.000 description 2
- 210000002307 prostate Anatomy 0.000 description 2
- 102000004169 proteins and genes Human genes 0.000 description 2
- 230000002685 pulmonary effect Effects 0.000 description 2
- XFTQRUTUGRCSGO-UHFFFAOYSA-N pyrazin-2-amine Chemical class NC1=CN=CC=N1 XFTQRUTUGRCSGO-UHFFFAOYSA-N 0.000 description 2
- 125000004621 quinuclidinyl group Chemical group N12C(CC(CC1)CC2)* 0.000 description 2
- 101150069892 rad9 gene Proteins 0.000 description 2
- 230000008439 repair process Effects 0.000 description 2
- 230000000717 retained effect Effects 0.000 description 2
- 210000003491 skin Anatomy 0.000 description 2
- 208000000587 small cell lung carcinoma Diseases 0.000 description 2
- 235000017557 sodium bicarbonate Nutrition 0.000 description 2
- 235000019333 sodium laurylsulphate Nutrition 0.000 description 2
- 239000000600 sorbitol Substances 0.000 description 2
- 235000010356 sorbitol Nutrition 0.000 description 2
- 235000011150 stannous chloride Nutrition 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- 210000002784 stomach Anatomy 0.000 description 2
- UCSJYZPVAKXKNQ-HZYVHMACSA-N streptomycin Chemical compound CN[C@H]1[C@H](O)[C@@H](O)[C@H](CO)O[C@H]1O[C@@H]1[C@](C=O)(O)[C@H](C)O[C@H]1O[C@@H]1[C@@H](NC(N)=N)[C@H](O)[C@@H](NC(N)=N)[C@H](O)[C@H]1O UCSJYZPVAKXKNQ-HZYVHMACSA-N 0.000 description 2
- 239000000758 substrate Substances 0.000 description 2
- 239000005720 sucrose Substances 0.000 description 2
- 239000003765 sweetening agent Substances 0.000 description 2
- 208000024891 symptom Diseases 0.000 description 2
- 235000020357 syrup Nutrition 0.000 description 2
- 239000006188 syrup Substances 0.000 description 2
- FJYBLMJHXRWDAQ-MRVPVSSYSA-N tert-butyl (2r)-2-(hydroxymethyl)morpholine-4-carboxylate Chemical compound CC(C)(C)OC(=O)N1CCO[C@@H](CO)C1 FJYBLMJHXRWDAQ-MRVPVSSYSA-N 0.000 description 2
- LOBHRXDXENCDIZ-AWEZNQCLSA-N tert-butyl (2s)-2-[(4-methylphenyl)sulfonyloxymethyl]morpholine-4-carboxylate Chemical compound C1=CC(C)=CC=C1S(=O)(=O)OC[C@H]1OCCN(C(=O)OC(C)(C)C)C1 LOBHRXDXENCDIZ-AWEZNQCLSA-N 0.000 description 2
- KVSMEUHLZOCRIX-NRFANRHFSA-N tert-butyl (2s)-2-[[[2-[(5-cyanopyrazin-2-yl)amino]-5-(4-methoxyphenyl)pyridin-4-yl]amino]methyl]morpholine-4-carboxylate Chemical compound C1=CC(OC)=CC=C1C(C(=C1)NC[C@@H]2OCCN(C2)C(=O)OC(C)(C)C)=CN=C1NC1=CN=C(C#N)C=N1 KVSMEUHLZOCRIX-NRFANRHFSA-N 0.000 description 2
- WVZIDVYCMBDFBJ-UHFFFAOYSA-N tert-butyl 3-[[[2-[(5-cyanopyrazin-2-yl)amino]-5-(3-ethoxycarbonylpyrrol-1-yl)pyridin-4-yl]amino]methyl]piperidine-1-carboxylate Chemical compound C1=C(C(=O)OCC)C=CN1C(C(=C1)NCC2CN(CCC2)C(=O)OC(C)(C)C)=CN=C1NC1=CN=C(C#N)C=N1 WVZIDVYCMBDFBJ-UHFFFAOYSA-N 0.000 description 2
- KLKBCNDBOVRQIJ-UHFFFAOYSA-N tert-butyl 4-(aminomethyl)piperidine-1-carboxylate Chemical compound CC(C)(C)OC(=O)N1CCC(CN)CC1 KLKBCNDBOVRQIJ-UHFFFAOYSA-N 0.000 description 2
- IGBWYUVEGOZDKR-UHFFFAOYSA-N tert-butyl 4-[[(2-bromo-5-nitropyridin-4-yl)amino]methyl]piperidine-1-carboxylate Chemical compound C1CN(C(=O)OC(C)(C)C)CCC1CNC1=CC(Br)=NC=C1[N+]([O-])=O IGBWYUVEGOZDKR-UHFFFAOYSA-N 0.000 description 2
- ZJZTVOKQGLQKAX-UHFFFAOYSA-N tert-butyl 4-[[[2-[(5-cyanopyrazin-2-yl)amino]-5-(3-methyl-1,2,4-oxadiazol-5-yl)pyridin-4-yl]amino]methyl]piperidine-1-carboxylate Chemical compound CC1=NOC(C=2C(=CC(NC=3N=CC(=NC=3)C#N)=NC=2)NCC2CCN(CC2)C(=O)OC(C)(C)C)=N1 ZJZTVOKQGLQKAX-UHFFFAOYSA-N 0.000 description 2
- OHDQPULYJWDALL-UHFFFAOYSA-N tert-butyl 4-[[[2-[(5-cyanopyrazin-2-yl)amino]-5-(phenylcarbamoyl)pyridin-4-yl]amino]methyl]piperidine-1-carboxylate Chemical compound C1CN(C(=O)OC(C)(C)C)CCC1CNC1=CC(NC=2N=CC(=NC=2)C#N)=NC=C1C(=O)NC1=CC=CC=C1 OHDQPULYJWDALL-UHFFFAOYSA-N 0.000 description 2
- QKPDAQBJLYEJFA-UHFFFAOYSA-N tert-butyl 4-[[[2-amino-5-(4-methoxyphenyl)pyridin-4-yl]amino]methyl]piperidine-1-carboxylate Chemical compound C1=CC(OC)=CC=C1C1=CN=C(N)C=C1NCC1CCN(C(=O)OC(C)(C)C)CC1 QKPDAQBJLYEJFA-UHFFFAOYSA-N 0.000 description 2
- HLZKNKRTKFSKGZ-UHFFFAOYSA-N tetradecan-1-ol Chemical compound CCCCCCCCCCCCCCO HLZKNKRTKFSKGZ-UHFFFAOYSA-N 0.000 description 2
- 210000001685 thyroid gland Anatomy 0.000 description 2
- AXZWODMDQAVCJE-UHFFFAOYSA-L tin(II) chloride (anhydrous) Chemical compound [Cl-].[Cl-].[Sn+2] AXZWODMDQAVCJE-UHFFFAOYSA-L 0.000 description 2
- 239000000196 tragacanth Substances 0.000 description 2
- 235000010487 tragacanth Nutrition 0.000 description 2
- 229940116362 tragacanth Drugs 0.000 description 2
- 239000011534 wash buffer Substances 0.000 description 2
- 239000001993 wax Substances 0.000 description 2
- 239000000080 wetting agent Substances 0.000 description 2
- DOUCIMIQXTWTDF-CBLAIPOGSA-N (1r,5s)-8-methyl-8-azabicyclo[3.2.1]octane-3-carbonitrile Chemical compound C1C(C#N)C[C@@]2([H])CC[C@]1([H])N2C DOUCIMIQXTWTDF-CBLAIPOGSA-N 0.000 description 1
- KQIGMPWTAHJUMN-GSVOUGTGSA-N (2r)-3-aminopropane-1,2-diol Chemical compound NC[C@@H](O)CO KQIGMPWTAHJUMN-GSVOUGTGSA-N 0.000 description 1
- PSSRAPMBSMSACN-BYPYZUCNSA-N (2s)-1,4-dibromobutan-2-ol Chemical compound BrC[C@@H](O)CCBr PSSRAPMBSMSACN-BYPYZUCNSA-N 0.000 description 1
- IEJSCSAMMLUINT-NRFANRHFSA-N (2s)-2-[[4-[(2,7-dimethyl-4-oxo-1h-quinazolin-6-yl)methyl-prop-2-ynylamino]-2-fluorobenzoyl]amino]-4-(2h-tetrazol-5-yl)butanoic acid Chemical compound C([C@H](NC(=O)C1=CC=C(C=C1F)N(CC#C)CC=1C=C2C(=O)N=C(NC2=CC=1C)C)C(O)=O)CC=1N=NNN=1 IEJSCSAMMLUINT-NRFANRHFSA-N 0.000 description 1
- LLTWLOYZJCWIOT-PZLLXQLWSA-N (beta-D-mannosyl)methyl C32-phosphonomycoketide Chemical compound CCCCCCC[C@H](C)CCC[C@H](C)CCC[C@H](C)CCC[C@H](C)CCC[C@H](C)CCCOP(C[C@@H]([C@H]([C@H]1O)O)O[C@H](CO)[C@H]1O)(O)=O LLTWLOYZJCWIOT-PZLLXQLWSA-N 0.000 description 1
- QMMJWQMCMRUYTG-UHFFFAOYSA-N 1,2,4,5-tetrachloro-3-(trifluoromethyl)benzene Chemical compound FC(F)(F)C1=C(Cl)C(Cl)=CC(Cl)=C1Cl QMMJWQMCMRUYTG-UHFFFAOYSA-N 0.000 description 1
- TUSDEZXZIZRFGC-UHFFFAOYSA-N 1-O-galloyl-3,6-(R)-HHDP-beta-D-glucose Natural products OC1C(O2)COC(=O)C3=CC(O)=C(O)C(O)=C3C3=C(O)C(O)=C(O)C=C3C(=O)OC1C(O)C2OC(=O)C1=CC(O)=C(O)C(O)=C1 TUSDEZXZIZRFGC-UHFFFAOYSA-N 0.000 description 1
- IVSLBPOELJMDED-UHFFFAOYSA-N 1-amino-2h-pyrazine-3-carbonitrile Chemical compound NN1CC(C#N)=NC=C1 IVSLBPOELJMDED-UHFFFAOYSA-N 0.000 description 1
- BNCHUFZQNPJLLX-UHFFFAOYSA-N 1-bromo-2h-pyrazine-3-carbonitrile Chemical compound BrN1CC(C#N)=NC=C1 BNCHUFZQNPJLLX-UHFFFAOYSA-N 0.000 description 1
- PJUPKRYGDFTMTM-UHFFFAOYSA-N 1-hydroxybenzotriazole;hydrate Chemical compound O.C1=CC=C2N(O)N=NC2=C1 PJUPKRYGDFTMTM-UHFFFAOYSA-N 0.000 description 1
- VSNHCAURESNICA-NJFSPNSNSA-N 1-oxidanylurea Chemical compound N[14C](=O)NO VSNHCAURESNICA-NJFSPNSNSA-N 0.000 description 1
- LGEZTMRIZWCDLW-UHFFFAOYSA-N 14-methylpentadecyl octadecanoate Chemical compound CCCCCCCCCCCCCCCCCC(=O)OCCCCCCCCCCCCCC(C)C LGEZTMRIZWCDLW-UHFFFAOYSA-N 0.000 description 1
- JVSFQJZRHXAUGT-UHFFFAOYSA-N 2,2-dimethylpropanoyl chloride Chemical compound CC(C)(C)C(Cl)=O JVSFQJZRHXAUGT-UHFFFAOYSA-N 0.000 description 1
- GFISDBXSWQMOND-UHFFFAOYSA-N 2,5-dimethoxyoxolane Chemical compound COC1CCC(OC)O1 GFISDBXSWQMOND-UHFFFAOYSA-N 0.000 description 1
- QMIGEDXMDGEZSR-UHFFFAOYSA-N 2,5-dimethoxyoxolane-3-carbaldehyde Chemical compound COC1CC(C=O)C(OC)O1 QMIGEDXMDGEZSR-UHFFFAOYSA-N 0.000 description 1
- FBAOFKFCKHJXRU-VOTSOKGWSA-N 2-[(e)-3-methoxyprop-1-enyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane Chemical compound COC\C=C\B1OC(C)(C)C(C)(C)O1 FBAOFKFCKHJXRU-VOTSOKGWSA-N 0.000 description 1
- AYFSYGFEOPUIFD-BYPYZUCNSA-N 2-chloro-n-[(2s)-2,3-dihydroxypropyl]acetamide Chemical compound OC[C@@H](O)CNC(=O)CCl AYFSYGFEOPUIFD-BYPYZUCNSA-N 0.000 description 1
- 125000004182 2-chlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(*)C([H])=C1[H] 0.000 description 1
- SFAAOBGYWOUHLU-UHFFFAOYSA-N 2-ethylhexyl hexadecanoate Chemical compound CCCCCCCCCCCCCCCC(=O)OCC(CC)CCCC SFAAOBGYWOUHLU-UHFFFAOYSA-N 0.000 description 1
- UPHOPMSGKZNELG-UHFFFAOYSA-N 2-hydroxynaphthalene-1-carboxylic acid Chemical compound C1=CC=C2C(C(=O)O)=C(O)C=CC2=C1 UPHOPMSGKZNELG-UHFFFAOYSA-N 0.000 description 1
- KQIGMPWTAHJUMN-VKHMYHEASA-N 3-aminopropane-1,2-diol Chemical compound NC[C@H](O)CO KQIGMPWTAHJUMN-VKHMYHEASA-N 0.000 description 1
- 125000004179 3-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(Cl)=C1[H] 0.000 description 1
- BLBDTBCGPHPIJK-UHFFFAOYSA-N 4-Amino-2-chloropyridine Chemical compound NC1=CC=NC(Cl)=C1 BLBDTBCGPHPIJK-UHFFFAOYSA-N 0.000 description 1
- RQMWVVBHJMUJNZ-UHFFFAOYSA-N 4-chloropyridin-2-amine Chemical compound NC1=CC(Cl)=CC=N1 RQMWVVBHJMUJNZ-UHFFFAOYSA-N 0.000 description 1
- HIQIXEFWDLTDED-UHFFFAOYSA-N 4-hydroxy-1-piperidin-4-ylpyrrolidin-2-one Chemical compound O=C1CC(O)CN1C1CCNCC1 HIQIXEFWDLTDED-UHFFFAOYSA-N 0.000 description 1
- 125000004172 4-methoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C([H])C([H])=C1* 0.000 description 1
- MIXUCXTUJUFAPV-UHFFFAOYSA-N 5-[[5-(3-hydroxyprop-1-ynyl)-4-(piperidin-4-ylmethylamino)pyridin-2-yl]amino]pyrazine-2-carbonitrile Chemical compound C1=C(NCC2CCNCC2)C(C#CCO)=CN=C1NC1=CN=C(C#N)C=N1 MIXUCXTUJUFAPV-UHFFFAOYSA-N 0.000 description 1
- HWJXFVLYPYGUCO-HNQUOIGGSA-N 5-[[5-[(e)-4-hydroxybut-1-enyl]-4-(piperidin-4-ylmethylamino)pyridin-2-yl]amino]pyrazine-2-carbonitrile Chemical compound C1=C(NCC2CCNCC2)C(/C=C/CCO)=CN=C1NC1=CN=C(C#N)C=N1 HWJXFVLYPYGUCO-HNQUOIGGSA-N 0.000 description 1
- MHVSESXQEPWHTO-UHFFFAOYSA-N 5-bromo-4-n-piperidin-4-ylpyridine-2,4-diamine Chemical compound C1=NC(N)=CC(NC2CCNCC2)=C1Br MHVSESXQEPWHTO-UHFFFAOYSA-N 0.000 description 1
- KRRTXVSBTPCDOS-UHFFFAOYSA-N 5-bromopyrazin-2-amine Chemical compound NC1=CN=C(Br)C=N1 KRRTXVSBTPCDOS-UHFFFAOYSA-N 0.000 description 1
- WJRKNLONLOMALV-UHFFFAOYSA-N 5-chloropyridine Chemical compound ClC1=C=NC=C[CH]1 WJRKNLONLOMALV-UHFFFAOYSA-N 0.000 description 1
- BWXBZAOCBVXFMQ-UHFFFAOYSA-N 5-methoxypyrazin-2-amine Chemical compound COC1=CN=C(N)C=N1 BWXBZAOCBVXFMQ-UHFFFAOYSA-N 0.000 description 1
- ZNQOALAKPLGUPH-UHFFFAOYSA-N 5-methylpyrazin-2-amine Chemical compound CC1=CN=C(N)C=N1 ZNQOALAKPLGUPH-UHFFFAOYSA-N 0.000 description 1
- STQGQHZAVUOBTE-UHFFFAOYSA-N 7-Cyan-hept-2t-en-4,6-diinsaeure Natural products C1=2C(O)=C3C(=O)C=4C(OC)=CC=CC=4C(=O)C3=C(O)C=2CC(O)(C(C)=O)CC1OC1CC(N)C(O)C(C)O1 STQGQHZAVUOBTE-UHFFFAOYSA-N 0.000 description 1
- FJHBVJOVLFPMQE-QFIPXVFZSA-N 7-Ethyl-10-Hydroxy-Camptothecin Chemical compound C1=C(O)C=C2C(CC)=C(CN3C(C4=C([C@@](C(=O)OC4)(O)CC)C=C33)=O)C3=NC2=C1 FJHBVJOVLFPMQE-QFIPXVFZSA-N 0.000 description 1
- DGGKXQQCVPAUEA-UHFFFAOYSA-N 8-azabicyclo[3.2.1]octane Chemical compound C1CCC2CCC1N2 DGGKXQQCVPAUEA-UHFFFAOYSA-N 0.000 description 1
- 208000024893 Acute lymphoblastic leukemia Diseases 0.000 description 1
- 208000014697 Acute lymphocytic leukaemia Diseases 0.000 description 1
- 208000031261 Acute myeloid leukaemia Diseases 0.000 description 1
- 208000036762 Acute promyelocytic leukaemia Diseases 0.000 description 1
- 239000004475 Arginine Substances 0.000 description 1
- 206010003571 Astrocytoma Diseases 0.000 description 1
- 201000001320 Atherosclerosis Diseases 0.000 description 1
- 241000271566 Aves Species 0.000 description 1
- 208000003950 B-cell lymphoma Diseases 0.000 description 1
- 208000032791 BCR-ABL1 positive chronic myelogenous leukemia Diseases 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical compound OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 1
- 206010005003 Bladder cancer Diseases 0.000 description 1
- 108010006654 Bleomycin Proteins 0.000 description 1
- 206010005949 Bone cancer Diseases 0.000 description 1
- 208000020084 Bone disease Diseases 0.000 description 1
- 208000018084 Bone neoplasm Diseases 0.000 description 1
- 208000003174 Brain Neoplasms Diseases 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- COVZYZSDYWQREU-UHFFFAOYSA-N Busulfan Chemical compound CS(=O)(=O)OCCCCOS(C)(=O)=O COVZYZSDYWQREU-UHFFFAOYSA-N 0.000 description 1
- 239000004358 Butane-1, 3-diol Substances 0.000 description 1
- 101100294106 Caenorhabditis elegans nhr-3 gene Proteins 0.000 description 1
- KLWPJMFMVPTNCC-UHFFFAOYSA-N Camptothecin Natural products CCC1(O)C(=O)OCC2=C1C=C3C4Nc5ccccc5C=C4CN3C2=O KLWPJMFMVPTNCC-UHFFFAOYSA-N 0.000 description 1
- 241000282465 Canis Species 0.000 description 1
- 229920002134 Carboxymethyl cellulose Polymers 0.000 description 1
- 201000009030 Carcinoma Diseases 0.000 description 1
- DLGOEMSEDOSKAD-UHFFFAOYSA-N Carmustine Chemical compound ClCCNC(=O)N(N=O)CCCl DLGOEMSEDOSKAD-UHFFFAOYSA-N 0.000 description 1
- 241000700199 Cavia porcellus Species 0.000 description 1
- 241000251556 Chordata Species 0.000 description 1
- 102100027397 Cilia- and flagella-associated protein 100 Human genes 0.000 description 1
- 244000060011 Cocos nucifera Species 0.000 description 1
- 235000013162 Cocos nucifera Nutrition 0.000 description 1
- 206010048832 Colon adenoma Diseases 0.000 description 1
- 241000699800 Cricetinae Species 0.000 description 1
- 229920002785 Croscarmellose sodium Polymers 0.000 description 1
- 102100021906 Cyclin-O Human genes 0.000 description 1
- CMSMOCZEIVJLDB-UHFFFAOYSA-N Cyclophosphamide Chemical compound ClCCN(CCCl)P1(=O)NCCCO1 CMSMOCZEIVJLDB-UHFFFAOYSA-N 0.000 description 1
- UHDGCWIWMRVCDJ-CCXZUQQUSA-N Cytarabine Chemical compound O=C1N=C(N)C=CN1[C@H]1[C@@H](O)[C@H](O)[C@@H](CO)O1 UHDGCWIWMRVCDJ-CCXZUQQUSA-N 0.000 description 1
- FBPFZTCFMRRESA-KVTDHHQDSA-N D-Mannitol Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-KVTDHHQDSA-N 0.000 description 1
- 239000012624 DNA alkylating agent Substances 0.000 description 1
- 231100001074 DNA strand break Toxicity 0.000 description 1
- 230000006820 DNA synthesis Effects 0.000 description 1
- 239000004338 Dichlorodifluoromethane Substances 0.000 description 1
- XBPCUCUWBYBCDP-UHFFFAOYSA-N Dicyclohexylamine Chemical compound C1CCCCC1NC1CCCCC1 XBPCUCUWBYBCDP-UHFFFAOYSA-N 0.000 description 1
- 206010059866 Drug resistance Diseases 0.000 description 1
- 239000006144 Dulbecco’s modified Eagle's medium Substances 0.000 description 1
- KCXVZYZYPLLWCC-UHFFFAOYSA-N EDTA Chemical compound OC(=O)CN(CC(O)=O)CCN(CC(O)=O)CC(O)=O KCXVZYZYPLLWCC-UHFFFAOYSA-N 0.000 description 1
- 238000012286 ELISA Assay Methods 0.000 description 1
- 239000004150 EU approved colour Substances 0.000 description 1
- 206010014733 Endometrial cancer Diseases 0.000 description 1
- 206010014759 Endometrial neoplasm Diseases 0.000 description 1
- 102000004190 Enzymes Human genes 0.000 description 1
- 108090000790 Enzymes Proteins 0.000 description 1
- NHXSTXWKZVAVOQ-UHFFFAOYSA-N Ethyl furoate Chemical compound CCOC(=O)C1=CC=CO1 NHXSTXWKZVAVOQ-UHFFFAOYSA-N 0.000 description 1
- JOYRKODLDBILNP-UHFFFAOYSA-N Ethyl urethane Chemical compound CCOC(N)=O JOYRKODLDBILNP-UHFFFAOYSA-N 0.000 description 1
- PIICEJLVQHRZGT-UHFFFAOYSA-N Ethylenediamine Chemical compound NCCN PIICEJLVQHRZGT-UHFFFAOYSA-N 0.000 description 1
- 244000166102 Eucalyptus leucoxylon Species 0.000 description 1
- 235000004694 Eucalyptus leucoxylon Nutrition 0.000 description 1
- 241000289695 Eutheria Species 0.000 description 1
- 239000001263 FEMA 3042 Substances 0.000 description 1
- 241000282324 Felis Species 0.000 description 1
- 241000282326 Felis catus Species 0.000 description 1
- 201000008808 Fibrosarcoma Diseases 0.000 description 1
- GHASVSINZRGABV-UHFFFAOYSA-N Fluorouracil Chemical compound FC1=CNC(=O)NC1=O GHASVSINZRGABV-UHFFFAOYSA-N 0.000 description 1
- 102000016621 Focal Adhesion Protein-Tyrosine Kinases Human genes 0.000 description 1
- 108010067715 Focal Adhesion Protein-Tyrosine Kinases Proteins 0.000 description 1
- 230000037057 G1 phase arrest Effects 0.000 description 1
- 230000010337 G2 phase Effects 0.000 description 1
- 201000003741 Gastrointestinal carcinoma Diseases 0.000 description 1
- 206010017993 Gastrointestinal neoplasms Diseases 0.000 description 1
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 1
- 241000282575 Gorilla Species 0.000 description 1
- 239000007821 HATU Substances 0.000 description 1
- 208000017604 Hodgkin disease Diseases 0.000 description 1
- 208000021519 Hodgkin lymphoma Diseases 0.000 description 1
- 208000010747 Hodgkins lymphoma Diseases 0.000 description 1
- 101000725206 Homo sapiens Cilia- and flagella-associated protein 100 Proteins 0.000 description 1
- 101000897441 Homo sapiens Cyclin-O Proteins 0.000 description 1
- 101001059454 Homo sapiens Serine/threonine-protein kinase MARK2 Proteins 0.000 description 1
- 241000282620 Hylobates sp. Species 0.000 description 1
- QZRGKCOWNLSUDK-UHFFFAOYSA-N Iodochlorine Chemical compound ICl QZRGKCOWNLSUDK-UHFFFAOYSA-N 0.000 description 1
- 229930194542 Keto Natural products 0.000 description 1
- 208000008839 Kidney Neoplasms Diseases 0.000 description 1
- ZDXPYRJPNDTMRX-VKHMYHEASA-N L-glutamine Chemical compound OC(=O)[C@@H](N)CCC(N)=O ZDXPYRJPNDTMRX-VKHMYHEASA-N 0.000 description 1
- 229930182816 L-glutamine Natural products 0.000 description 1
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 1
- 241000283953 Lagomorpha Species 0.000 description 1
- GQYIWUVLTXOXAJ-UHFFFAOYSA-N Lomustine Chemical compound ClCCN(N=O)C(=O)NC1CCCCC1 GQYIWUVLTXOXAJ-UHFFFAOYSA-N 0.000 description 1
- KDXKERNSBIXSRK-UHFFFAOYSA-N Lysine Natural products NCCCCC(N)C(O)=O KDXKERNSBIXSRK-UHFFFAOYSA-N 0.000 description 1
- 239000004472 Lysine Substances 0.000 description 1
- 102100023330 M-phase inducer phosphatase 3 Human genes 0.000 description 1
- 241000289581 Macropus sp. Species 0.000 description 1
- 229930195725 Mannitol Natural products 0.000 description 1
- 206010027476 Metastases Diseases 0.000 description 1
- 229920000168 Microcrystalline cellulose Polymers 0.000 description 1
- 241001529936 Murinae Species 0.000 description 1
- 201000003793 Myelodysplastic syndrome Diseases 0.000 description 1
- 208000033761 Myelogenous Chronic BCR-ABL Positive Leukemia Diseases 0.000 description 1
- 208000033776 Myeloid Acute Leukemia Diseases 0.000 description 1
- ZDZOTLJHXYCWBA-VCVYQWHSSA-N N-debenzoyl-N-(tert-butoxycarbonyl)-10-deacetyltaxol Chemical compound O([C@H]1[C@H]2[C@@](C([C@H](O)C3=C(C)[C@@H](OC(=O)[C@H](O)[C@@H](NC(=O)OC(C)(C)C)C=4C=CC=CC=4)C[C@]1(O)C3(C)C)=O)(C)[C@@H](O)C[C@H]1OC[C@]12OC(=O)C)C(=O)C1=CC=CC=C1 ZDZOTLJHXYCWBA-VCVYQWHSSA-N 0.000 description 1
- MBBZMMPHUWSWHV-BDVNFPICSA-N N-methylglucamine Chemical compound CNC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO MBBZMMPHUWSWHV-BDVNFPICSA-N 0.000 description 1
- 208000001894 Nasopharyngeal Neoplasms Diseases 0.000 description 1
- 206010061306 Nasopharyngeal cancer Diseases 0.000 description 1
- 206010029260 Neuroblastoma Diseases 0.000 description 1
- 208000015914 Non-Hodgkin lymphomas Diseases 0.000 description 1
- VYEAHXRPWKOEMY-UHFFFAOYSA-N O-(9H-fluoren-9-ylmethyl)hydroxylamine Chemical compound C1=CC=C2C(CON)C3=CC=CC=C3C2=C1 VYEAHXRPWKOEMY-UHFFFAOYSA-N 0.000 description 1
- BHVRCUAHXVLSNX-UHFFFAOYSA-N O-[(4,5-dimethoxy-2-nitrophenyl)methyl]hydroxylamine Chemical compound COC1=CC(CON)=C([N+]([O-])=O)C=C1OC BHVRCUAHXVLSNX-UHFFFAOYSA-N 0.000 description 1
- 235000019502 Orange oil Nutrition 0.000 description 1
- 241000283973 Oryctolagus cuniculus Species 0.000 description 1
- 241000282577 Pan troglodytes Species 0.000 description 1
- 206010061902 Pancreatic neoplasm Diseases 0.000 description 1
- 241001504519 Papio ursinus Species 0.000 description 1
- 208000031481 Pathologic Constriction Diseases 0.000 description 1
- 241001494479 Pecora Species 0.000 description 1
- 229930182555 Penicillin Natural products 0.000 description 1
- JGSARLDLIJGVTE-MBNYWOFBSA-N Penicillin G Chemical compound N([C@H]1[C@H]2SC([C@@H](N2C1=O)C(O)=O)(C)C)C(=O)CC1=CC=CC=C1 JGSARLDLIJGVTE-MBNYWOFBSA-N 0.000 description 1
- LRBQNJMCXXYXIU-PPKXGCFTSA-N Penta-digallate-beta-D-glucose Natural products OC1=C(O)C(O)=CC(C(=O)OC=2C(=C(O)C=C(C=2)C(=O)OC[C@@H]2[C@H]([C@H](OC(=O)C=3C=C(OC(=O)C=4C=C(O)C(O)=C(O)C=4)C(O)=C(O)C=3)[C@@H](OC(=O)C=3C=C(OC(=O)C=4C=C(O)C(O)=C(O)C=4)C(O)=C(O)C=3)[C@H](OC(=O)C=3C=C(OC(=O)C=4C=C(O)C(O)=C(O)C=4)C(O)=C(O)C=3)O2)OC(=O)C=2C=C(OC(=O)C=3C=C(O)C(O)=C(O)C=3)C(O)=C(O)C=2)O)=C1 LRBQNJMCXXYXIU-PPKXGCFTSA-N 0.000 description 1
- 239000002202 Polyethylene glycol Substances 0.000 description 1
- 239000004743 Polypropylene Substances 0.000 description 1
- 229920001214 Polysorbate 60 Polymers 0.000 description 1
- 208000006664 Precursor Cell Lymphoblastic Leukemia-Lymphoma Diseases 0.000 description 1
- 241000288906 Primates Species 0.000 description 1
- 206010060862 Prostate cancer Diseases 0.000 description 1
- 208000000236 Prostatic Neoplasms Diseases 0.000 description 1
- 102000001253 Protein Kinase Human genes 0.000 description 1
- 201000004681 Psoriasis Diseases 0.000 description 1
- 239000007868 Raney catalyst Substances 0.000 description 1
- 229910000564 Raney nickel Inorganic materials 0.000 description 1
- 208000015634 Rectal Neoplasms Diseases 0.000 description 1
- 206010038389 Renal cancer Diseases 0.000 description 1
- 208000006265 Renal cell carcinoma Diseases 0.000 description 1
- 239000008156 Ringer's lactate solution Substances 0.000 description 1
- 241000283984 Rodentia Species 0.000 description 1
- 241000235070 Saccharomyces Species 0.000 description 1
- 240000004808 Saccharomyces cerevisiae Species 0.000 description 1
- 235000014680 Saccharomyces cerevisiae Nutrition 0.000 description 1
- 206010039491 Sarcoma Diseases 0.000 description 1
- 229940124639 Selective inhibitor Drugs 0.000 description 1
- 201000010208 Seminoma Diseases 0.000 description 1
- 102100028904 Serine/threonine-protein kinase MARK2 Human genes 0.000 description 1
- 208000000453 Skin Neoplasms Diseases 0.000 description 1
- 108020004459 Small interfering RNA Proteins 0.000 description 1
- NWGKJDSIEKMTRX-AAZCQSIUSA-N Sorbitan monooleate Chemical compound CCCCCCCC\C=C/CCCCCCCC(=O)OC[C@@H](O)[C@H]1OC[C@H](O)[C@H]1O NWGKJDSIEKMTRX-AAZCQSIUSA-N 0.000 description 1
- 208000005718 Stomach Neoplasms Diseases 0.000 description 1
- 206010042971 T-cell lymphoma Diseases 0.000 description 1
- 208000027585 T-cell non-Hodgkin lymphoma Diseases 0.000 description 1
- BPEGJWRSRHCHSN-UHFFFAOYSA-N Temozolomide Chemical compound O=C1N(C)N=NC2=C(C(N)=O)N=CN21 BPEGJWRSRHCHSN-UHFFFAOYSA-N 0.000 description 1
- 208000024313 Testicular Neoplasms Diseases 0.000 description 1
- 206010057644 Testis cancer Diseases 0.000 description 1
- 208000024770 Thyroid neoplasm Diseases 0.000 description 1
- IVTVGDXNLFLDRM-HNNXBMFYSA-N Tomudex Chemical compound C=1C=C2NC(C)=NC(=O)C2=CC=1CN(C)C1=CC=C(C(=O)N[C@@H](CCC(O)=O)C(O)=O)S1 IVTVGDXNLFLDRM-HNNXBMFYSA-N 0.000 description 1
- 208000007097 Urinary Bladder Neoplasms Diseases 0.000 description 1
- 241000251539 Vertebrata <Metazoa> Species 0.000 description 1
- JXLYSJRDGCGARV-WWYNWVTFSA-N Vinblastine Natural products O=C(O[C@H]1[C@](O)(C(=O)OC)[C@@H]2N(C)c3c(cc(c(OC)c3)[C@]3(C(=O)OC)c4[nH]c5c(c4CCN4C[C@](O)(CC)C[C@H](C3)C4)cccc5)[C@@]32[C@H]2[C@@]1(CC)C=CCN2CC3)C JXLYSJRDGCGARV-WWYNWVTFSA-N 0.000 description 1
- 241000289674 Vombatidae Species 0.000 description 1
- 230000001594 aberrant effect Effects 0.000 description 1
- 230000002159 abnormal effect Effects 0.000 description 1
- DHKHKXVYLBGOIT-UHFFFAOYSA-N acetaldehyde Diethyl Acetal Natural products CCOC(C)OCC DHKHKXVYLBGOIT-UHFFFAOYSA-N 0.000 description 1
- 150000001241 acetals Chemical class 0.000 description 1
- PBCJIPOGFJYBJE-UHFFFAOYSA-N acetonitrile;hydrate Chemical compound O.CC#N PBCJIPOGFJYBJE-UHFFFAOYSA-N 0.000 description 1
- 239000004480 active ingredient Substances 0.000 description 1
- 230000001154 acute effect Effects 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 208000009956 adenocarcinoma Diseases 0.000 description 1
- 239000002671 adjuvant Substances 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 229910001413 alkali metal ion Inorganic materials 0.000 description 1
- 150000001345 alkine derivatives Chemical class 0.000 description 1
- 150000004703 alkoxides Chemical class 0.000 description 1
- 125000005907 alkyl ester group Chemical group 0.000 description 1
- 150000001350 alkyl halides Chemical class 0.000 description 1
- 239000002168 alkylating agent Substances 0.000 description 1
- 229940100198 alkylating agent Drugs 0.000 description 1
- 208000026935 allergic disease Diseases 0.000 description 1
- 150000001413 amino acids Chemical class 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- 150000008361 aminoacetonitriles Chemical class 0.000 description 1
- 238000002399 angioplasty Methods 0.000 description 1
- 150000001449 anionic compounds Chemical class 0.000 description 1
- 150000001450 anions Chemical class 0.000 description 1
- 230000001093 anti-cancer Effects 0.000 description 1
- 230000001028 anti-proliverative effect Effects 0.000 description 1
- 238000003782 apoptosis assay Methods 0.000 description 1
- 239000003125 aqueous solvent Substances 0.000 description 1
- ODKSFYDXXFIFQN-UHFFFAOYSA-N arginine Natural products OC(=O)C(N)CCCNC(N)=N ODKSFYDXXFIFQN-UHFFFAOYSA-N 0.000 description 1
- 229910052786 argon Inorganic materials 0.000 description 1
- 150000001543 aryl boronic acids Chemical class 0.000 description 1
- 238000011914 asymmetric synthesis Methods 0.000 description 1
- 239000012298 atmosphere Substances 0.000 description 1
- BHKICZDKIIDMNR-UHFFFAOYSA-L azane;cyclobutane-1,1-dicarboxylate;platinum(4+) Chemical compound N.N.[Pt+4].[O-]C(=O)C1(C([O-])=O)CCC1 BHKICZDKIIDMNR-UHFFFAOYSA-L 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- 125000000499 benzofuranyl group Chemical group O1C(=CC2=C1C=CC=C2)* 0.000 description 1
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid group Chemical group C(C1=CC=CC=C1)(=O)O WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 1
- 125000005872 benzooxazolyl group Chemical group 0.000 description 1
- 125000004196 benzothienyl group Chemical group S1C(=CC2=C1C=CC=C2)* 0.000 description 1
- 125000003354 benzotriazolyl group Chemical group N1N=NC2=C1C=CC=C2* 0.000 description 1
- 125000004541 benzoxazolyl group Chemical group O1C(=NC2=C1C=CC=C2)* 0.000 description 1
- YYIQGSYCCNQAGV-UHFFFAOYSA-N benzyl 4-aminopiperidine-1-carboxylate Chemical compound C1CC(N)CCN1C(=O)OCC1=CC=CC=C1 YYIQGSYCCNQAGV-UHFFFAOYSA-N 0.000 description 1
- WQZGKKKJIJFFOK-VFUOTHLCSA-N beta-D-glucose Chemical compound OC[C@H]1O[C@@H](O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-VFUOTHLCSA-N 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 238000010170 biological method Methods 0.000 description 1
- 230000002051 biphasic effect Effects 0.000 description 1
- 229960001561 bleomycin Drugs 0.000 description 1
- OYVAGSVQBOHSSS-UAPAGMARSA-O bleomycin A2 Chemical compound N([C@H](C(=O)N[C@H](C)[C@@H](O)[C@H](C)C(=O)N[C@@H]([C@H](O)C)C(=O)NCCC=1SC=C(N=1)C=1SC=C(N=1)C(=O)NCCC[S+](C)C)[C@@H](O[C@H]1[C@H]([C@@H](O)[C@H](O)[C@H](CO)O1)O[C@@H]1[C@H]([C@@H](OC(N)=O)[C@H](O)[C@@H](CO)O1)O)C=1N=CNC=1)C(=O)C1=NC([C@H](CC(N)=O)NC[C@H](N)C(N)=O)=NC(N)=C1C OYVAGSVQBOHSSS-UAPAGMARSA-O 0.000 description 1
- 210000004369 blood Anatomy 0.000 description 1
- 239000008280 blood Substances 0.000 description 1
- 239000012503 blood component Substances 0.000 description 1
- 210000001124 body fluid Anatomy 0.000 description 1
- 230000037396 body weight Effects 0.000 description 1
- 210000004556 brain Anatomy 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 235000019437 butane-1,3-diol Nutrition 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- FUFJGUQYACFECW-UHFFFAOYSA-L calcium hydrogenphosphate Chemical compound [Ca+2].OP([O-])([O-])=O FUFJGUQYACFECW-UHFFFAOYSA-L 0.000 description 1
- BPKIGYQJPYCAOW-FFJTTWKXSA-I calcium;potassium;disodium;(2s)-2-hydroxypropanoate;dichloride;dihydroxide;hydrate Chemical compound O.[OH-].[OH-].[Na+].[Na+].[Cl-].[Cl-].[K+].[Ca+2].C[C@H](O)C([O-])=O BPKIGYQJPYCAOW-FFJTTWKXSA-I 0.000 description 1
- 244000309466 calf Species 0.000 description 1
- 229940127093 camptothecin Drugs 0.000 description 1
- VSJKWCGYPAHWDS-FQEVSTJZSA-N camptothecin Chemical compound C1=CC=C2C=C(CN3C4=CC5=C(C3=O)COC(=O)[C@]5(O)CC)C4=NC2=C1 VSJKWCGYPAHWDS-FQEVSTJZSA-N 0.000 description 1
- 239000001569 carbon dioxide Substances 0.000 description 1
- SKOLWUPSYHWYAM-UHFFFAOYSA-N carbonodithioic O,S-acid Chemical compound SC(S)=O SKOLWUPSYHWYAM-UHFFFAOYSA-N 0.000 description 1
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 1
- 229960004562 carboplatin Drugs 0.000 description 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 1
- 239000001768 carboxy methyl cellulose Substances 0.000 description 1
- 235000010948 carboxy methyl cellulose Nutrition 0.000 description 1
- 239000008112 carboxymethyl-cellulose Substances 0.000 description 1
- 239000003183 carcinogenic agent Substances 0.000 description 1
- 150000001767 cationic compounds Chemical class 0.000 description 1
- 108010046616 cdc25 Phosphatases Proteins 0.000 description 1
- 102000007588 cdc25 Phosphatases Human genes 0.000 description 1
- 238000004113 cell culture Methods 0.000 description 1
- 230000010261 cell growth Effects 0.000 description 1
- 230000010325 cell repair pathway Effects 0.000 description 1
- 230000005754 cellular signaling Effects 0.000 description 1
- 210000003169 central nervous system Anatomy 0.000 description 1
- 210000003679 cervix uteri Anatomy 0.000 description 1
- 229940082500 cetostearyl alcohol Drugs 0.000 description 1
- OEYIOHPDSNJKLS-UHFFFAOYSA-N choline Chemical compound C[N+](C)(C)CCO OEYIOHPDSNJKLS-UHFFFAOYSA-N 0.000 description 1
- 229960001231 choline Drugs 0.000 description 1
- 125000000259 cinnolinyl group Chemical group N1=NC(=CC2=CC=CC=C12)* 0.000 description 1
- DQLATGHUWYMOKM-UHFFFAOYSA-L cisplatin Chemical compound N[Pt](N)(Cl)Cl DQLATGHUWYMOKM-UHFFFAOYSA-L 0.000 description 1
- 229960004316 cisplatin Drugs 0.000 description 1
- 239000011248 coating agent Substances 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 229940110456 cocoa butter Drugs 0.000 description 1
- 235000019868 cocoa butter Nutrition 0.000 description 1
- 201000010897 colon adenocarcinoma Diseases 0.000 description 1
- 238000011284 combination treatment Methods 0.000 description 1
- 239000007891 compressed tablet Substances 0.000 description 1
- 238000007906 compression Methods 0.000 description 1
- 230000006835 compression Effects 0.000 description 1
- 235000008504 concentrate Nutrition 0.000 description 1
- 239000012141 concentrate Substances 0.000 description 1
- 210000002808 connective tissue Anatomy 0.000 description 1
- 238000013270 controlled release Methods 0.000 description 1
- GBRBMTNGQBKBQE-UHFFFAOYSA-L copper;diiodide Chemical compound I[Cu]I GBRBMTNGQBKBQE-UHFFFAOYSA-L 0.000 description 1
- 239000002537 cosmetic Substances 0.000 description 1
- 230000008878 coupling Effects 0.000 description 1
- 238000010168 coupling process Methods 0.000 description 1
- 238000005859 coupling reaction Methods 0.000 description 1
- 238000006880 cross-coupling reaction Methods 0.000 description 1
- 239000001767 crosslinked sodium carboxy methyl cellulose Substances 0.000 description 1
- 235000010947 crosslinked sodium carboxy methyl cellulose Nutrition 0.000 description 1
- 208000035250 cutaneous malignant susceptibility to 1 melanoma Diseases 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 229960004397 cyclophosphamide Drugs 0.000 description 1
- 231100000433 cytotoxic Toxicity 0.000 description 1
- 239000002254 cytotoxic agent Substances 0.000 description 1
- 231100000599 cytotoxic agent Toxicity 0.000 description 1
- 230000001472 cytotoxic effect Effects 0.000 description 1
- 231100000135 cytotoxicity Toxicity 0.000 description 1
- 230000003013 cytotoxicity Effects 0.000 description 1
- 238000002784 cytotoxicity assay Methods 0.000 description 1
- 231100000263 cytotoxicity test Toxicity 0.000 description 1
- 230000006378 damage Effects 0.000 description 1
- STQGQHZAVUOBTE-VGBVRHCVSA-N daunorubicin Chemical compound O([C@H]1C[C@@](O)(CC=2C(O)=C3C(=O)C=4C=CC=C(C=4C(=O)C3=C(O)C=21)OC)C(C)=O)[C@H]1C[C@H](N)[C@H](O)[C@H](C)O1 STQGQHZAVUOBTE-VGBVRHCVSA-N 0.000 description 1
- 229960000975 daunorubicin Drugs 0.000 description 1
- SASYSVUEVMOWPL-NXVVXOECSA-N decyl oleate Chemical compound CCCCCCCCCCOC(=O)CCCCCCC\C=C/CCCCCCCC SASYSVUEVMOWPL-NXVVXOECSA-N 0.000 description 1
- 230000003111 delayed effect Effects 0.000 description 1
- 238000010511 deprotection reaction Methods 0.000 description 1
- 231100000223 dermal penetration Toxicity 0.000 description 1
- AQEFLFZSWDEAIP-UHFFFAOYSA-N di-tert-butyl ether Chemical compound CC(C)(C)OC(C)(C)C AQEFLFZSWDEAIP-UHFFFAOYSA-N 0.000 description 1
- 150000004985 diamines Chemical class 0.000 description 1
- 235000019700 dicalcium phosphate Nutrition 0.000 description 1
- PXBRQCKWGAHEHS-UHFFFAOYSA-N dichlorodifluoromethane Chemical compound FC(F)(Cl)Cl PXBRQCKWGAHEHS-UHFFFAOYSA-N 0.000 description 1
- 235000019404 dichlorodifluoromethane Nutrition 0.000 description 1
- WGLUMOCWFMKWIL-UHFFFAOYSA-N dichloromethane;methanol Chemical compound OC.ClCCl WGLUMOCWFMKWIL-UHFFFAOYSA-N 0.000 description 1
- 235000005911 diet Nutrition 0.000 description 1
- 230000037213 diet Effects 0.000 description 1
- 235000014113 dietary fatty acids Nutrition 0.000 description 1
- ZBCBWPMODOFKDW-UHFFFAOYSA-N diethanolamine Chemical compound OCCNCCO ZBCBWPMODOFKDW-UHFFFAOYSA-N 0.000 description 1
- HPNMFZURTQLUMO-UHFFFAOYSA-N diethylamine Chemical compound CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 description 1
- 230000004069 differentiation Effects 0.000 description 1
- ZZVUWRFHKOJYTH-UHFFFAOYSA-N diphenhydramine Chemical group C=1C=CC=CC=1C(OCCN(C)C)C1=CC=CC=C1 ZZVUWRFHKOJYTH-UHFFFAOYSA-N 0.000 description 1
- 125000005982 diphenylmethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])(*)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- LOKCTEFSRHRXRJ-UHFFFAOYSA-I dipotassium trisodium dihydrogen phosphate hydrogen phosphate dichloride Chemical compound P(=O)(O)(O)[O-].[K+].P(=O)(O)([O-])[O-].[Na+].[Na+].[Cl-].[K+].[Cl-].[Na+] LOKCTEFSRHRXRJ-UHFFFAOYSA-I 0.000 description 1
- 239000007884 disintegrant Substances 0.000 description 1
- 208000035475 disorder Diseases 0.000 description 1
- 239000002270 dispersing agent Substances 0.000 description 1
- VSJKWCGYPAHWDS-UHFFFAOYSA-N dl-camptothecin Natural products C1=CC=C2C=C(CN3C4=CC5=C(C3=O)COC(=O)C5(O)CC)C4=NC2=C1 VSJKWCGYPAHWDS-UHFFFAOYSA-N 0.000 description 1
- 239000003534 dna topoisomerase inhibitor Substances 0.000 description 1
- 229960003668 docetaxel Drugs 0.000 description 1
- 230000034431 double-strand break repair via homologous recombination Effects 0.000 description 1
- 229960004679 doxorubicin Drugs 0.000 description 1
- 239000006196 drop Substances 0.000 description 1
- 238000010828 elution Methods 0.000 description 1
- 230000001804 emulsifying effect Effects 0.000 description 1
- 239000008387 emulsifying waxe Substances 0.000 description 1
- 150000002081 enamines Chemical class 0.000 description 1
- 238000005516 engineering process Methods 0.000 description 1
- 230000002708 enhancing effect Effects 0.000 description 1
- 150000002085 enols Chemical class 0.000 description 1
- 239000002702 enteric coating Substances 0.000 description 1
- 238000009505 enteric coating Methods 0.000 description 1
- 238000006911 enzymatic reaction Methods 0.000 description 1
- 125000004185 ester group Chemical group 0.000 description 1
- 230000032050 esterification Effects 0.000 description 1
- 238000005886 esterification reaction Methods 0.000 description 1
- BEFDCLMNVWHSGT-UHFFFAOYSA-N ethenylcyclopentane Chemical compound C=CC1CCCC1 BEFDCLMNVWHSGT-UHFFFAOYSA-N 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 125000000816 ethylene group Chemical group [H]C([H])([*:1])C([H])([H])[*:2] 0.000 description 1
- 230000029142 excretion Effects 0.000 description 1
- 208000021045 exocrine pancreatic carcinoma Diseases 0.000 description 1
- 239000000194 fatty acid Substances 0.000 description 1
- 229930195729 fatty acid Natural products 0.000 description 1
- 150000004665 fatty acids Chemical class 0.000 description 1
- 230000000893 fibroproliferative effect Effects 0.000 description 1
- 229960000390 fludarabine Drugs 0.000 description 1
- GIUYCYHIANZCFB-FJFJXFQQSA-N fludarabine phosphate Chemical compound C1=NC=2C(N)=NC(F)=NC=2N1[C@@H]1O[C@H](COP(O)(O)=O)[C@@H](O)[C@@H]1O GIUYCYHIANZCFB-FJFJXFQQSA-N 0.000 description 1
- 229960002949 fluorouracil Drugs 0.000 description 1
- 230000003325 follicular Effects 0.000 description 1
- 235000013355 food flavoring agent Nutrition 0.000 description 1
- 238000001640 fractional crystallisation Methods 0.000 description 1
- 239000012737 fresh medium Substances 0.000 description 1
- 210000000232 gallbladder Anatomy 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 206010017758 gastric cancer Diseases 0.000 description 1
- 230000002496 gastric effect Effects 0.000 description 1
- 210000001035 gastrointestinal tract Anatomy 0.000 description 1
- 239000007903 gelatin capsule Substances 0.000 description 1
- SDUQYLNIPVEERB-QPPQHZFASA-N gemcitabine Chemical compound O=C1N=C(N)C=CN1[C@H]1C(F)(F)[C@H](O)[C@@H](CO)O1 SDUQYLNIPVEERB-QPPQHZFASA-N 0.000 description 1
- 229960005277 gemcitabine Drugs 0.000 description 1
- 238000001415 gene therapy Methods 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 239000008103 glucose Substances 0.000 description 1
- 229960001031 glucose Drugs 0.000 description 1
- 229940075507 glyceryl monostearate Drugs 0.000 description 1
- 229930182470 glycoside Natural products 0.000 description 1
- 150000002338 glycosides Chemical class 0.000 description 1
- 239000001963 growth medium Substances 0.000 description 1
- 230000003394 haemopoietic effect Effects 0.000 description 1
- 230000036541 health Effects 0.000 description 1
- 208000019691 hematopoietic and lymphoid cell neoplasm Diseases 0.000 description 1
- 230000002440 hepatic effect Effects 0.000 description 1
- UBHWBODXJBSFLH-UHFFFAOYSA-N hexadecan-1-ol;octadecan-1-ol Chemical compound CCCCCCCCCCCCCCCCO.CCCCCCCCCCCCCCCCCCO UBHWBODXJBSFLH-UHFFFAOYSA-N 0.000 description 1
- JYVHOGDBFNJNMR-UHFFFAOYSA-N hexane;hydrate Chemical compound O.CCCCCC JYVHOGDBFNJNMR-UHFFFAOYSA-N 0.000 description 1
- BHEPBYXIRTUNPN-UHFFFAOYSA-N hydridophosphorus(.) (triplet) Chemical compound [PH] BHEPBYXIRTUNPN-UHFFFAOYSA-N 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 239000008309 hydrophilic cream Substances 0.000 description 1
- UWYVPFMHMJIBHE-OWOJBTEDSA-N hydroxymaleic acid group Chemical group O/C(/C(=O)O)=C/C(=O)O UWYVPFMHMJIBHE-OWOJBTEDSA-N 0.000 description 1
- 125000004029 hydroxymethyl group Chemical group [H]OC([H])([H])* 0.000 description 1
- 230000002390 hyperplastic effect Effects 0.000 description 1
- 150000002466 imines Chemical class 0.000 description 1
- 238000009169 immunotherapy Methods 0.000 description 1
- 239000007943 implant Substances 0.000 description 1
- 238000000099 in vitro assay Methods 0.000 description 1
- 125000003453 indazolyl group Chemical group N1N=C(C2=C1C=CC=C2)* 0.000 description 1
- 125000001041 indolyl group Chemical group 0.000 description 1
- 229910001412 inorganic anion Inorganic materials 0.000 description 1
- 229910001411 inorganic cation Inorganic materials 0.000 description 1
- 201000002313 intestinal cancer Diseases 0.000 description 1
- 238000001361 intraarterial administration Methods 0.000 description 1
- 238000007918 intramuscular administration Methods 0.000 description 1
- 238000007913 intrathecal administration Methods 0.000 description 1
- 238000001990 intravenous administration Methods 0.000 description 1
- 230000009545 invasion Effects 0.000 description 1
- UWKQSNNFCGGAFS-XIFFEERXSA-N irinotecan Chemical compound C1=C2C(CC)=C3CN(C(C4=C([C@@](C(=O)OC4)(O)CC)C=4)=O)C=4C3=NC2=CC=C1OC(=O)N(CC1)CCC1N1CCCCC1 UWKQSNNFCGGAFS-XIFFEERXSA-N 0.000 description 1
- 229960004768 irinotecan Drugs 0.000 description 1
- 230000007794 irritation Effects 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 229940078545 isocetyl stearate Drugs 0.000 description 1
- XUGNVMKQXJXZCD-UHFFFAOYSA-N isopropyl palmitate Chemical compound CCCCCCCCCCCCCCCC(=O)OC(C)C XUGNVMKQXJXZCD-UHFFFAOYSA-N 0.000 description 1
- 125000002183 isoquinolinyl group Chemical group C1(=NC=CC2=CC=CC=C12)* 0.000 description 1
- 201000010982 kidney cancer Diseases 0.000 description 1
- 229940043355 kinase inhibitor Drugs 0.000 description 1
- 239000008101 lactose Substances 0.000 description 1
- 239000010410 layer Substances 0.000 description 1
- 150000002632 lipids Chemical class 0.000 description 1
- 229940057995 liquid paraffin Drugs 0.000 description 1
- 201000007270 liver cancer Diseases 0.000 description 1
- 208000014018 liver neoplasm Diseases 0.000 description 1
- 229910001629 magnesium chloride Inorganic materials 0.000 description 1
- 235000019359 magnesium stearate Nutrition 0.000 description 1
- 208000015486 malignant pancreatic neoplasm Diseases 0.000 description 1
- 208000026037 malignant tumor of neck Diseases 0.000 description 1
- 239000000594 mannitol Substances 0.000 description 1
- 235000010355 mannitol Nutrition 0.000 description 1
- 239000003550 marker Substances 0.000 description 1
- 241001515942 marmosets Species 0.000 description 1
- 239000011159 matrix material Substances 0.000 description 1
- 229960003194 meglumine Drugs 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 230000002503 metabolic effect Effects 0.000 description 1
- 230000009401 metastasis Effects 0.000 description 1
- JEJMDUMJSZTJTI-UHFFFAOYSA-N methyl 4,6-dichloropyridine-3-carboxylate Chemical compound COC(=O)C1=CN=C(Cl)C=C1Cl JEJMDUMJSZTJTI-UHFFFAOYSA-N 0.000 description 1
- HUXNNWWADUQZDV-UHFFFAOYSA-N methyl 6-chloro-4-[[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]methylamino]pyridine-3-carboxylate Chemical compound COC(=O)C1=CN=C(Cl)C=C1NCC1CCN(C(=O)OC(C)(C)C)CC1 HUXNNWWADUQZDV-UHFFFAOYSA-N 0.000 description 1
- 150000004702 methyl esters Chemical class 0.000 description 1
- 239000004292 methyl p-hydroxybenzoate Substances 0.000 description 1
- 235000010270 methyl p-hydroxybenzoate Nutrition 0.000 description 1
- 229960001238 methylnicotinate Drugs 0.000 description 1
- LXCFILQKKLGQFO-UHFFFAOYSA-N methylparaben Chemical compound COC(=O)C1=CC=C(O)C=C1 LXCFILQKKLGQFO-UHFFFAOYSA-N 0.000 description 1
- 229940016286 microcrystalline cellulose Drugs 0.000 description 1
- 235000019813 microcrystalline cellulose Nutrition 0.000 description 1
- 239000008108 microcrystalline cellulose Substances 0.000 description 1
- 235000013336 milk Nutrition 0.000 description 1
- 239000008267 milk Substances 0.000 description 1
- 210000004080 milk Anatomy 0.000 description 1
- 239000002480 mineral oil Substances 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 229960004857 mitomycin Drugs 0.000 description 1
- 230000004784 molecular pathogenesis Effects 0.000 description 1
- 239000001788 mono and diglycerides of fatty acids Substances 0.000 description 1
- 150000004682 monohydrates Chemical class 0.000 description 1
- 230000000877 morphologic effect Effects 0.000 description 1
- 229940043348 myristyl alcohol Drugs 0.000 description 1
- AEXITZJSLGALNH-UHFFFAOYSA-N n'-hydroxyethanimidamide Chemical compound CC(N)=NO AEXITZJSLGALNH-UHFFFAOYSA-N 0.000 description 1
- PUPKPAZSFZOLOR-UHFFFAOYSA-N n,n-dimethylformamide;toluene Chemical compound CN(C)C=O.CC1=CC=CC=C1 PUPKPAZSFZOLOR-UHFFFAOYSA-N 0.000 description 1
- MRHQBBSKCLIMRH-UHFFFAOYSA-N n-(acetamidomethoxymethyl)acetamide Chemical compound CC(=O)NCOCNC(C)=O MRHQBBSKCLIMRH-UHFFFAOYSA-N 0.000 description 1
- SYSQUGFVNFXIIT-UHFFFAOYSA-N n-[4-(1,3-benzoxazol-2-yl)phenyl]-4-nitrobenzenesulfonamide Chemical class C1=CC([N+](=O)[O-])=CC=C1S(=O)(=O)NC1=CC=C(C=2OC3=CC=CC=C3N=2)C=C1 SYSQUGFVNFXIIT-UHFFFAOYSA-N 0.000 description 1
- GTWJETSWSUWSEJ-UHFFFAOYSA-N n-benzylaniline Chemical compound C=1C=CC=CC=1CNC1=CC=CC=C1 GTWJETSWSUWSEJ-UHFFFAOYSA-N 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 239000007923 nasal drop Substances 0.000 description 1
- 229940100662 nasal drops Drugs 0.000 description 1
- 230000014399 negative regulation of angiogenesis Effects 0.000 description 1
- 230000001613 neoplastic effect Effects 0.000 description 1
- 208000007538 neurilemmoma Diseases 0.000 description 1
- 108010087904 neutravidin Proteins 0.000 description 1
- 235000005152 nicotinamide Nutrition 0.000 description 1
- 239000011570 nicotinamide Substances 0.000 description 1
- 229960003966 nicotinamide Drugs 0.000 description 1
- 229960003512 nicotinic acid Drugs 0.000 description 1
- 150000002825 nitriles Chemical class 0.000 description 1
- 125000000018 nitroso group Chemical group N(=O)* 0.000 description 1
- GQPLMRYTRLFLPF-UHFFFAOYSA-N nitrous oxide Inorganic materials [O-][N+]#N GQPLMRYTRLFLPF-UHFFFAOYSA-N 0.000 description 1
- LUHFJLLCZSYACL-UHFFFAOYSA-N o-(2,2,2-trichloroethyl)hydroxylamine Chemical compound NOCC(Cl)(Cl)Cl LUHFJLLCZSYACL-UHFFFAOYSA-N 0.000 description 1
- GWCBVFMHGHMALR-UHFFFAOYSA-N o-(2-trimethylsilylethyl)hydroxylamine Chemical compound C[Si](C)(C)CCON GWCBVFMHGHMALR-UHFFFAOYSA-N 0.000 description 1
- XYEOALKITRFCJJ-UHFFFAOYSA-N o-benzylhydroxylamine Chemical compound NOCC1=CC=CC=C1 XYEOALKITRFCJJ-UHFFFAOYSA-N 0.000 description 1
- KKVUFSINQFSJNK-UHFFFAOYSA-N o-tert-butylhydroxylamine Chemical compound CC(C)(C)ON KKVUFSINQFSJNK-UHFFFAOYSA-N 0.000 description 1
- ZQPPMHVWECSIRJ-KTKRTIGZSA-N oleic acid group Chemical group C(CCCCCCC\C=C/CCCCCCCC)(=O)O ZQPPMHVWECSIRJ-KTKRTIGZSA-N 0.000 description 1
- 229940006093 opthalmologic coloring agent diagnostic Drugs 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- 239000010502 orange oil Substances 0.000 description 1
- 210000000056 organ Anatomy 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 150000002892 organic cations Chemical class 0.000 description 1
- 208000008798 osteoma Diseases 0.000 description 1
- 229940127084 other anti-cancer agent Drugs 0.000 description 1
- 230000002611 ovarian Effects 0.000 description 1
- 210000001672 ovary Anatomy 0.000 description 1
- 150000002923 oximes Chemical class 0.000 description 1
- IPCSVZSSVZVIGE-UHFFFAOYSA-N palmitic acid group Chemical group C(CCCCCCCCCCCCCCC)(=O)O IPCSVZSSVZVIGE-UHFFFAOYSA-N 0.000 description 1
- 201000002528 pancreatic cancer Diseases 0.000 description 1
- 208000008443 pancreatic carcinoma Diseases 0.000 description 1
- RUVINXPYWBROJD-UHFFFAOYSA-N para-methoxyphenyl Natural products COC1=CC=C(C=CC)C=C1 RUVINXPYWBROJD-UHFFFAOYSA-N 0.000 description 1
- 239000012188 paraffin wax Substances 0.000 description 1
- 238000007911 parenteral administration Methods 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- 229940049954 penicillin Drugs 0.000 description 1
- 210000001428 peripheral nervous system Anatomy 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 239000008251 pharmaceutical emulsion Substances 0.000 description 1
- 229940124531 pharmaceutical excipient Drugs 0.000 description 1
- WLJVXDMOQOGPHL-UHFFFAOYSA-N phenylacetic acid Chemical compound OC(=O)CC1=CC=CC=C1 WLJVXDMOQOGPHL-UHFFFAOYSA-N 0.000 description 1
- 239000003757 phosphotransferase inhibitor Substances 0.000 description 1
- 125000004592 phthalazinyl group Chemical group C1(=NN=CC2=CC=CC=C12)* 0.000 description 1
- 229910052697 platinum Inorganic materials 0.000 description 1
- 229920001223 polyethylene glycol Polymers 0.000 description 1
- 229920001155 polypropylene Polymers 0.000 description 1
- 230000035119 positive regulation of cellular process Effects 0.000 description 1
- 235000011056 potassium acetate Nutrition 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- 235000008476 powdered milk Nutrition 0.000 description 1
- 150000003138 primary alcohols Chemical class 0.000 description 1
- 150000003140 primary amides Chemical class 0.000 description 1
- 108090000765 processed proteins & peptides Proteins 0.000 description 1
- 230000005522 programmed cell death Effects 0.000 description 1
- 239000003380 propellant Substances 0.000 description 1
- 239000004405 propyl p-hydroxybenzoate Substances 0.000 description 1
- 235000010232 propyl p-hydroxybenzoate Nutrition 0.000 description 1
- 235000013772 propylene glycol Nutrition 0.000 description 1
- QELSKZZBTMNZEB-UHFFFAOYSA-N propylparaben Chemical compound CCCOC(=O)C1=CC=C(O)C=C1 QELSKZZBTMNZEB-UHFFFAOYSA-N 0.000 description 1
- 108060006633 protein kinase Proteins 0.000 description 1
- 208000005069 pulmonary fibrosis Diseases 0.000 description 1
- 150000003216 pyrazines Chemical class 0.000 description 1
- 125000001453 quaternary ammonium group Chemical group 0.000 description 1
- 125000002294 quinazolinyl group Chemical group N1=C(N=CC2=CC=CC=C12)* 0.000 description 1
- 125000002943 quinolinyl group Chemical group N1=C(C=CC2=CC=CC=C12)* 0.000 description 1
- 125000001567 quinoxalinyl group Chemical group N1=C(C=NC2=CC=CC=C12)* 0.000 description 1
- 150000003254 radicals Chemical class 0.000 description 1
- 229960004432 raltitrexed Drugs 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 206010038038 rectal cancer Diseases 0.000 description 1
- 201000001275 rectum cancer Diseases 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 230000025053 regulation of cell proliferation Effects 0.000 description 1
- 238000011160 research Methods 0.000 description 1
- 230000004044 response Effects 0.000 description 1
- 230000028617 response to DNA damage stimulus Effects 0.000 description 1
- 208000037803 restenosis Diseases 0.000 description 1
- YGSDEFSMJLZEOE-UHFFFAOYSA-M salicylate Chemical compound OC1=CC=CC=C1C([O-])=O YGSDEFSMJLZEOE-UHFFFAOYSA-M 0.000 description 1
- 229960001860 salicylate Drugs 0.000 description 1
- 206010039667 schwannoma Diseases 0.000 description 1
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 210000002966 serum Anatomy 0.000 description 1
- 238000007493 shaping process Methods 0.000 description 1
- 201000000849 skin cancer Diseases 0.000 description 1
- 150000003384 small molecules Chemical class 0.000 description 1
- 210000000329 smooth muscle myocyte Anatomy 0.000 description 1
- 239000012279 sodium borohydride Substances 0.000 description 1
- 229910000033 sodium borohydride Inorganic materials 0.000 description 1
- 239000008354 sodium chloride injection Substances 0.000 description 1
- QDRKDTQENPPHOJ-UHFFFAOYSA-N sodium ethoxide Chemical compound [Na+].CC[O-] QDRKDTQENPPHOJ-UHFFFAOYSA-N 0.000 description 1
- 239000008109 sodium starch glycolate Substances 0.000 description 1
- 229940079832 sodium starch glycolate Drugs 0.000 description 1
- 229920003109 sodium starch glycolate Polymers 0.000 description 1
- 239000012321 sodium triacetoxyborohydride Substances 0.000 description 1
- 239000004334 sorbic acid Substances 0.000 description 1
- 235000010199 sorbic acid Nutrition 0.000 description 1
- 229940075582 sorbic acid Drugs 0.000 description 1
- 241000894007 species Species 0.000 description 1
- 230000020347 spindle assembly Effects 0.000 description 1
- 206010041823 squamous cell carcinoma Diseases 0.000 description 1
- 238000010186 staining Methods 0.000 description 1
- 230000036262 stenosis Effects 0.000 description 1
- 208000037804 stenosis Diseases 0.000 description 1
- 201000011549 stomach cancer Diseases 0.000 description 1
- 229960005322 streptomycin Drugs 0.000 description 1
- 238000007920 subcutaneous administration Methods 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- 150000005846 sugar alcohols Polymers 0.000 description 1
- 150000003456 sulfonamides Chemical class 0.000 description 1
- YBBRCQOCSYXUOC-UHFFFAOYSA-N sulfuryl dichloride Chemical compound ClS(Cl)(=O)=O YBBRCQOCSYXUOC-UHFFFAOYSA-N 0.000 description 1
- 239000004094 surface-active agent Substances 0.000 description 1
- 238000001356 surgical procedure Methods 0.000 description 1
- 239000000375 suspending agent Substances 0.000 description 1
- 238000013268 sustained release Methods 0.000 description 1
- 239000012730 sustained-release form Substances 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 235000015523 tannic acid Nutrition 0.000 description 1
- LRBQNJMCXXYXIU-NRMVVENXSA-N tannic acid Chemical compound OC1=C(O)C(O)=CC(C(=O)OC=2C(=C(O)C=C(C=2)C(=O)OC[C@@H]2[C@H]([C@H](OC(=O)C=3C=C(OC(=O)C=4C=C(O)C(O)=C(O)C=4)C(O)=C(O)C=3)[C@@H](OC(=O)C=3C=C(OC(=O)C=4C=C(O)C(O)=C(O)C=4)C(O)=C(O)C=3)[C@@H](OC(=O)C=3C=C(OC(=O)C=4C=C(O)C(O)=C(O)C=4)C(O)=C(O)C=3)O2)OC(=O)C=2C=C(OC(=O)C=3C=C(O)C(O)=C(O)C=3)C(O)=C(O)C=2)O)=C1 LRBQNJMCXXYXIU-NRMVVENXSA-N 0.000 description 1
- 229920002258 tannic acid Polymers 0.000 description 1
- 229940033123 tannic acid Drugs 0.000 description 1
- 229960004964 temozolomide Drugs 0.000 description 1
- 208000001608 teratocarcinoma Diseases 0.000 description 1
- TVVYIRPIGMWFEW-JTQLQIEISA-N tert-butyl (2s)-2-[[(2-chloro-5-iodopyridin-4-yl)amino]methyl]morpholine-4-carboxylate Chemical compound C1N(C(=O)OC(C)(C)C)CCO[C@H]1CNC1=CC(Cl)=NC=C1I TVVYIRPIGMWFEW-JTQLQIEISA-N 0.000 description 1
- WPWXYQIMXTUMJB-UHFFFAOYSA-N tert-butyl 3-(aminomethyl)piperidine-1-carboxylate Chemical compound CC(C)(C)OC(=O)N1CCCC(CN)C1 WPWXYQIMXTUMJB-UHFFFAOYSA-N 0.000 description 1
- YGJXBTRLYHCWGD-UHFFFAOYSA-N tert-butyl 4-(bromomethyl)piperidine-1-carboxylate Chemical compound CC(C)(C)OC(=O)N1CCC(CBr)CC1 YGJXBTRLYHCWGD-UHFFFAOYSA-N 0.000 description 1
- CTEDVGRUGMPBHE-UHFFFAOYSA-N tert-butyl 4-(hydroxymethyl)piperidine-1-carboxylate Chemical compound CC(C)(C)OC(=O)N1CCC(CO)CC1 CTEDVGRUGMPBHE-UHFFFAOYSA-N 0.000 description 1
- KUUJABXLCBMKJX-UHFFFAOYSA-N tert-butyl 4-[[(2-chloro-5-phenylpyridin-4-yl)amino]methyl]piperidine-1-carboxylate Chemical compound C1CN(C(=O)OC(C)(C)C)CCC1CNC1=CC(Cl)=NC=C1C1=CC=CC=C1 KUUJABXLCBMKJX-UHFFFAOYSA-N 0.000 description 1
- OKODHFQUEQVBKD-UHFFFAOYSA-N tert-butyl 4-[[[2-[(5-cyanopyrazin-2-yl)amino]-5-(ethylsulfonylamino)pyridin-4-yl]amino]methyl]piperidine-1-carboxylate Chemical compound C1=C(NCC2CCN(CC2)C(=O)OC(C)(C)C)C(NS(=O)(=O)CC)=CN=C1NC1=CN=C(C#N)C=N1 OKODHFQUEQVBKD-UHFFFAOYSA-N 0.000 description 1
- RRAPXEAXYJLNHU-UHFFFAOYSA-N tert-butyl 4-[[[2-[(5-cyanopyrazin-2-yl)amino]-5-[[2-(dimethylamino)acetyl]amino]pyridin-4-yl]amino]methyl]piperidine-1-carboxylate Chemical compound C1=C(NCC2CCN(CC2)C(=O)OC(C)(C)C)C(NC(=O)CN(C)C)=CN=C1NC1=CN=C(C#N)C=N1 RRAPXEAXYJLNHU-UHFFFAOYSA-N 0.000 description 1
- FGTJJHCZWOVVNH-UHFFFAOYSA-N tert-butyl-[tert-butyl(dimethyl)silyl]oxy-dimethylsilane Chemical compound CC(C)(C)[Si](C)(C)O[Si](C)(C)C(C)(C)C FGTJJHCZWOVVNH-UHFFFAOYSA-N 0.000 description 1
- 201000003120 testicular cancer Diseases 0.000 description 1
- OULAJFUGPPVRBK-UHFFFAOYSA-N tetratriacontyl alcohol Natural products CCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCO OULAJFUGPPVRBK-UHFFFAOYSA-N 0.000 description 1
- 229940124597 therapeutic agent Drugs 0.000 description 1
- 231100001274 therapeutic index Toxicity 0.000 description 1
- 239000002562 thickening agent Substances 0.000 description 1
- 150000003568 thioethers Chemical class 0.000 description 1
- 125000003396 thiol group Chemical group [H]S* 0.000 description 1
- 201000002510 thyroid cancer Diseases 0.000 description 1
- GZNAASVAJNXPPW-UHFFFAOYSA-M tin(4+) chloride dihydrate Chemical compound O.O.[Cl-].[Sn+4] GZNAASVAJNXPPW-UHFFFAOYSA-M 0.000 description 1
- FWPIDFUJEMBDLS-UHFFFAOYSA-L tin(II) chloride dihydrate Substances O.O.Cl[Sn]Cl FWPIDFUJEMBDLS-UHFFFAOYSA-L 0.000 description 1
- 210000001519 tissue Anatomy 0.000 description 1
- 239000012049 topical pharmaceutical composition Substances 0.000 description 1
- 229940044693 topoisomerase inhibitor Drugs 0.000 description 1
- 231100000419 toxicity Toxicity 0.000 description 1
- 230000001988 toxicity Effects 0.000 description 1
- 238000013518 transcription Methods 0.000 description 1
- 230000035897 transcription Effects 0.000 description 1
- 230000016596 traversing start control point of mitotic cell cycle Effects 0.000 description 1
- 238000011269 treatment regimen Methods 0.000 description 1
- CYRMSUTZVYGINF-UHFFFAOYSA-N trichlorofluoromethane Chemical compound FC(Cl)(Cl)Cl CYRMSUTZVYGINF-UHFFFAOYSA-N 0.000 description 1
- 229940029284 trichlorofluoromethane Drugs 0.000 description 1
- 150000004684 trihydrates Chemical class 0.000 description 1
- JNRUXZIXAXHXTN-UHFFFAOYSA-N trimethyl(2-methylbut-3-yn-2-yloxy)silane Chemical compound C#CC(C)(C)O[Si](C)(C)C JNRUXZIXAXHXTN-UHFFFAOYSA-N 0.000 description 1
- 125000000026 trimethylsilyl group Chemical group [H]C([H])([H])[Si]([*])(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 229960000281 trometamol Drugs 0.000 description 1
- 208000029729 tumor suppressor gene on chromosome 11 Diseases 0.000 description 1
- 210000003932 urinary bladder Anatomy 0.000 description 1
- 201000005112 urinary bladder cancer Diseases 0.000 description 1
- 208000010570 urinary bladder carcinoma Diseases 0.000 description 1
- 235000015112 vegetable and seed oil Nutrition 0.000 description 1
- 239000008158 vegetable oil Substances 0.000 description 1
- 230000035899 viability Effects 0.000 description 1
- 229960003048 vinblastine Drugs 0.000 description 1
- JXLYSJRDGCGARV-XQKSVPLYSA-N vincaleukoblastine Chemical compound C([C@@H](C[C@]1(C(=O)OC)C=2C(=CC3=C([C@]45[C@H]([C@@]([C@H](OC(C)=O)[C@]6(CC)C=CCN([C@H]56)CC4)(O)C(=O)OC)N3C)C=2)OC)C[C@@](C2)(O)CC)N2CCC2=C1NC1=CC=CC=C21 JXLYSJRDGCGARV-XQKSVPLYSA-N 0.000 description 1
- OGWKCGZFUXNPDA-XQKSVPLYSA-N vincristine Chemical compound C([N@]1C[C@@H](C[C@]2(C(=O)OC)C=3C(=CC4=C([C@]56[C@H]([C@@]([C@H](OC(C)=O)[C@]7(CC)C=CCN([C@H]67)CC5)(O)C(=O)OC)N4C=O)C=3)OC)C[C@@](C1)(O)CC)CC1=C2NC2=CC=CC=C12 OGWKCGZFUXNPDA-XQKSVPLYSA-N 0.000 description 1
- 229960004528 vincristine Drugs 0.000 description 1
- OGWKCGZFUXNPDA-UHFFFAOYSA-N vincristine Natural products C1C(CC)(O)CC(CC2(C(=O)OC)C=3C(=CC4=C(C56C(C(C(OC(C)=O)C7(CC)C=CCN(C67)CC5)(O)C(=O)OC)N4C=O)C=3)OC)CN1CCC1=C2NC2=CC=CC=C12 OGWKCGZFUXNPDA-UHFFFAOYSA-N 0.000 description 1
- 230000006516 vital cellular process Effects 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 239000008215 water for injection Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings
- C07D401/12—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings linked by a chain containing hetero atoms as chain links
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P35/00—Antineoplastic agents
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P43/00—Drugs for specific purposes, not provided for in groups A61P1/00-A61P41/00
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/14—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing three or more hetero rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D403/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00
- C07D403/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00 containing two hetero rings
- C07D403/12—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00 containing two hetero rings linked by a chain containing hetero atoms as chain links
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D403/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00
- C07D403/14—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00 containing three or more hetero rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D405/00—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom
- C07D405/14—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom containing three or more hetero rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D409/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms
- C07D409/14—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms containing three or more hetero rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D413/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms
- C07D413/14—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms containing three or more hetero rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D417/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00
- C07D417/14—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00 containing three or more hetero rings
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- General Chemical & Material Sciences (AREA)
- Medicinal Chemistry (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Pharmacology & Pharmacy (AREA)
- Life Sciences & Earth Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Engineering & Computer Science (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US97770007P | 2007-10-05 | 2007-10-05 | |
| GBGB0719644.7A GB0719644D0 (en) | 2007-10-05 | 2007-10-05 | Therapeutic compounds and their use |
| PCT/GB2008/003362 WO2009044162A1 (en) | 2007-10-05 | 2008-10-06 | Pyrazin-2-yl-pyridin-2-yl-amine and pyrazin-2-yl-pyrimidin-4-yl-amine compounds and their use |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DK2197874T3 true DK2197874T3 (en) | 2016-12-19 |
Family
ID=38739312
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DK08806506.5T DK2197874T3 (en) | 2007-10-05 | 2008-10-06 | Pyrazin-2-YL-PYRIDIN-2-YL-AMINE AND pyrazin-2-yl-pyrimidine-4-YL-AMINE COMPOUNDS AND THEIR USE |
Country Status (9)
| Country | Link |
|---|---|
| US (2) | US8058045B2 (https=) |
| EP (1) | EP2197874B1 (https=) |
| JP (1) | JP5511668B2 (https=) |
| AU (1) | AU2008306625B2 (https=) |
| CA (1) | CA2738980C (https=) |
| DK (1) | DK2197874T3 (https=) |
| ES (1) | ES2604947T3 (https=) |
| GB (1) | GB0719644D0 (https=) |
| WO (1) | WO2009044162A1 (https=) |
Families Citing this family (31)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CA2655933C (en) | 2006-06-23 | 2014-09-09 | Alethia Biotherapeutics Inc. | Polynucleotides and polypeptide sequences involved in cancer |
| GB0719644D0 (en) | 2007-10-05 | 2007-11-14 | Cancer Rec Tech Ltd | Therapeutic compounds and their use |
| GB0803018D0 (en) | 2008-02-19 | 2008-03-26 | Cancer Rec Tech Ltd | Therapeutic compounds and their use |
| KR20110084280A (ko) | 2008-11-03 | 2011-07-21 | 알레시아 바이오쎄라퓨틱스 인코포레이티드 | 종양 항원의 생물 활성을 특이적으로 차단하는 항체 |
| JPWO2010058846A1 (ja) * | 2008-11-21 | 2012-04-19 | アステラス製薬株式会社 | 4,6−ジアミノニコチンアミド化合物 |
| AR076024A1 (es) * | 2009-04-03 | 2011-05-11 | Schering Corp | Derivados de heterociclos biciclicos puenteados y metodos de uso de los mismos |
| MX2012005332A (es) * | 2009-11-13 | 2012-10-15 | Oscotec Inc | Inhibidores de cinasa. |
| CA2787063C (en) | 2010-01-11 | 2018-11-27 | Astraea Therapeutics, Llc | Nicotinic acetylcholine receptor modulators |
| RS59080B1 (sr) | 2011-03-31 | 2019-09-30 | Adc Therapeutics Sa | Antitela protiv antigena 1 povezanog sa bubrezima i njihovi fragmenti koji se vezuju za antigen |
| KR20180084153A (ko) * | 2011-06-10 | 2018-07-24 | 메르크 파텐트 게엠베하 | Btk 억제 활성을 갖는 피리미딘 및 피리딘 화합물의 조성물 및 제조방법 |
| WO2013052393A1 (en) * | 2011-10-05 | 2013-04-11 | Merck Sharp & Dohme Corp. | 3-PYRIDYL CARBOXAMIDE-CONTAINING SPLEEN TYROSINE KINASE (Syk) INHIBITORS |
| RU2641693C2 (ru) * | 2011-11-09 | 2018-01-22 | Кансер Ресёрч Текнолоджи Лимитед | Соединения 5-(пиридин-2-иламино)-пиразин-2-карбонитрила и их терапевтическое применение |
| HRP20190946T1 (hr) | 2012-01-09 | 2019-07-26 | Adc Therapeutics Sa | Sredstva za liječenje trostruko negativnog raka dojke |
| WO2013106614A1 (en) * | 2012-01-13 | 2013-07-18 | Bristol-Myers Squibb Company | Triazolyl-substituted pyridyl compounds useful as kinase inhibitors |
| CN104254533B (zh) | 2012-01-13 | 2017-09-08 | 百时美施贵宝公司 | 用作激酶抑制剂的噻唑或噻二唑取代的吡啶基化合物 |
| EP2802576B1 (en) * | 2012-01-13 | 2018-06-27 | Bristol-Myers Squibb Company | Heterocyclic-substituted pyridyl compounds useful as kinase inhibitors |
| RU2659786C2 (ru) * | 2012-05-15 | 2018-07-04 | Кансер Ресёрч Текнолоджи Лимитед | 5-[[4-[[морфолин-2-ил]метиламино]-5-(трифторметил)-2-пиридил]амино]пиразин-2-карбонитрил, его терапевтические применения |
| CN104781251B (zh) | 2012-11-08 | 2016-12-14 | 百时美施贵宝公司 | 可作为激酶调节剂的经双环杂环取代的吡啶基化合物 |
| US9315494B2 (en) * | 2012-11-08 | 2016-04-19 | Bristol-Myers Squibb Company | Alkyl-amide-substituted pyridyl compounds useful as modulators of IL-12, IL-23 and/or IFNα responses |
| KR20150079963A (ko) | 2012-11-08 | 2015-07-08 | 브리스톨-마이어스 스큅 컴퍼니 | 키나제 조절제로서 유용한 헤테로아릴 치환된 피리딜 화합물 |
| JP2017001954A (ja) * | 2013-11-08 | 2017-01-05 | 石原産業株式会社 | 含窒素飽和複素環化合物 |
| EP3848370B1 (en) * | 2016-10-14 | 2025-05-07 | Takeda Pharmaceutical Company Limited | Tyk2 inhibitors and uses thereof |
| EP3728228A1 (en) | 2017-12-22 | 2020-10-28 | Ravenna Pharmaceuticals, Inc. | Aminopyridine derivatives as phosphatidylinositol phosphate kinase inhibitors |
| TW202112767A (zh) | 2019-06-17 | 2021-04-01 | 美商佩特拉製藥公司 | 作為磷脂酸肌醇磷酸激酶抑制劑之胺基吡啶衍生物 |
| CN110872277B (zh) * | 2019-11-14 | 2021-06-04 | 浙江大学 | N-取代芳环-2-氨基嘧啶类化合物及用途 |
| CN110684083B (zh) * | 2019-12-06 | 2020-05-15 | 北京诺赛启研再生医学研究院有限公司 | 抑制黑色素合成的偶联物ii及其在药品和化妆品中的应用 |
| TW202204348A (zh) | 2020-04-07 | 2022-02-01 | 美商西爾拉癌症醫學公司 | Chk1抑制劑之合成方法 |
| TW202241427A (zh) * | 2021-01-30 | 2022-11-01 | 香港商曙方醫藥有限公司 | 作為激酶抑制劑之雜環化合物及其用途 |
| TW202317106A (zh) * | 2021-08-27 | 2023-05-01 | 南韓商柳韓洋行 | 作為egfr抑制劑之取代胺基吡啶化合物 |
| TW202328096A (zh) | 2021-08-27 | 2023-07-16 | 南韓商柳韓洋行 | 作為egfr抑制劑之含五員雜芳基之胺基吡啶化合物 |
| CN117777048B (zh) * | 2023-09-25 | 2024-09-20 | 上海科利生物医药有限公司 | 一种手性2-羟甲基吗啉-4-羧酸叔丁酯的制备方法 |
Family Cites Families (30)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US805369A (en) * | 1904-10-14 | 1905-11-21 | David Marshall | Tomato-peeling machine. |
| US807554A (en) * | 1905-05-25 | 1905-12-19 | Francis S Heffernan | Non-refillable bottle. |
| US3032984A (en) * | 1959-05-12 | 1962-05-08 | United Aircraft Corp | Rocket pump starting system |
| US3101444A (en) * | 1959-06-30 | 1963-08-20 | John R Montgomery | Electronic pressure measuring means for internal combustion engines responsive to pressure caused spark gap resistance change |
| US3035065A (en) * | 1959-11-05 | 1962-05-15 | Union Carbide Corp | Isomaleimides and a process for the preparation thereof |
| US3093297A (en) * | 1961-09-25 | 1963-06-11 | New York Air Brake Co | Hydrostatic transmission |
| US5037285A (en) * | 1983-04-13 | 1991-08-06 | American National Can Company | Apparatus for injection molding and injection blow molding multi-layer articles |
| US5011597A (en) * | 1988-10-11 | 1991-04-30 | Canzoneri Anthony S | Single cell vertical static flow flotation unit |
| US5034869A (en) * | 1989-11-28 | 1991-07-23 | Choi Young J | Device for fixing a ceiling lamp to a ceiling |
| US5121126A (en) * | 1991-03-12 | 1992-06-09 | Bell Atlantic Network Services Inc. | Beacon enhanced telecommunications system and method |
| US6039718A (en) * | 1998-01-20 | 2000-03-21 | Bracco Research Usa | Multiple use universal connector |
| JP3809786B2 (ja) * | 2001-10-01 | 2006-08-16 | ソニー株式会社 | カートリッジ |
| EP1435947B1 (en) | 2001-10-19 | 2007-08-15 | Ortho-McNeil Pharmaceutical, Inc. | 2-phenyl benzimidazoles and imidazo-¬4,5|-pyridines as cds1/chk2-inhibitors and adjuvants to chemotherapy or radiation therapy in the treatment of cancer |
| JP5039268B2 (ja) | 2001-10-26 | 2012-10-03 | アベンティス・ファーマスーティカルズ・インコーポレイテツド | ベンゾイミダゾールおよび類縁体および蛋白キナーゼ阻害剤としてのその使用 |
| EP1501514B1 (en) * | 2002-05-03 | 2012-12-19 | Exelixis, Inc. | Protein kinase modulators and methods of use |
| US7202244B2 (en) | 2002-05-29 | 2007-04-10 | Millennium Pharmaceuticals, Inc. | Chk-1 inhibitors |
| GB0215775D0 (en) * | 2002-07-06 | 2002-08-14 | Astex Technology Ltd | Pharmaceutical compounds |
| GB0305152D0 (en) * | 2003-03-06 | 2003-04-09 | Novartis Ag | Organic compounds |
| MXPA06001098A (es) | 2003-07-29 | 2006-04-24 | Irm Llc | Compuestos y composiciones utiles como inhibidores de proteina cinasa. |
| WO2005035541A1 (en) * | 2003-10-07 | 2005-04-21 | Amedis Pharmaceuticals Ltd. | Silicon compounds and their use |
| AU2004279427B2 (en) | 2003-10-08 | 2008-07-03 | Irm Llc | Compounds and compositions as protein kinase inhibitors |
| CN1882345A (zh) | 2003-10-16 | 2006-12-20 | 希龙公司 | 作为raf激酶抑制剂以治疗癌症的2,6-二取代的喹唑啉、喹喔啉、喹啉和异喹啉 |
| ATE458730T1 (de) | 2004-04-13 | 2010-03-15 | Icagen Inc | Polycyclische pyrazine als kaliumionenkanal- modulatoren |
| US20070054916A1 (en) | 2004-10-01 | 2007-03-08 | Amgen Inc. | Aryl nitrogen-containing bicyclic compounds and methods of use |
| NZ565040A (en) | 2005-06-28 | 2010-05-28 | Sanofi Aventis | Isoquinoline derivatives as inhibitors of RHO-kinase |
| KR20090092303A (ko) | 2006-12-27 | 2009-08-31 | 사노피-아벤티스 | 사이클로알킬아민 치환된 이소퀴놀린 유도체 |
| DK2134689T3 (da) * | 2007-03-16 | 2014-06-30 | Scripps Research Inst | Inhibitorer af fokal adhæsionskinase |
| EP2014657A1 (de) * | 2007-06-21 | 2009-01-14 | Bayer Schering Pharma Aktiengesellschaft | Diaminopyrimidine als Modulatoren des EP2-Rezeptors |
| GB0719644D0 (en) | 2007-10-05 | 2007-11-14 | Cancer Rec Tech Ltd | Therapeutic compounds and their use |
| GB0803018D0 (en) | 2008-02-19 | 2008-03-26 | Cancer Rec Tech Ltd | Therapeutic compounds and their use |
-
2007
- 2007-10-05 GB GBGB0719644.7A patent/GB0719644D0/en not_active Ceased
-
2008
- 2008-10-06 JP JP2010527532A patent/JP5511668B2/ja active Active
- 2008-10-06 US US12/680,891 patent/US8058045B2/en active Active
- 2008-10-06 ES ES08806506.5T patent/ES2604947T3/es active Active
- 2008-10-06 AU AU2008306625A patent/AU2008306625B2/en active Active
- 2008-10-06 DK DK08806506.5T patent/DK2197874T3/en active
- 2008-10-06 WO PCT/GB2008/003362 patent/WO2009044162A1/en not_active Ceased
- 2008-10-06 EP EP08806506.5A patent/EP2197874B1/en active Active
- 2008-10-06 CA CA2738980A patent/CA2738980C/en active Active
-
2011
- 2011-09-23 US US13/241,887 patent/US8367658B2/en active Active
Also Published As
| Publication number | Publication date |
|---|---|
| EP2197874A1 (en) | 2010-06-23 |
| US8058045B2 (en) | 2011-11-15 |
| AU2008306625B2 (en) | 2014-10-16 |
| CA2738980A1 (en) | 2009-04-09 |
| CA2738980C (en) | 2015-12-01 |
| AU2008306625A1 (en) | 2009-04-09 |
| US20100311730A1 (en) | 2010-12-09 |
| ES2604947T3 (es) | 2017-03-10 |
| JP5511668B2 (ja) | 2014-06-04 |
| JP2010540610A (ja) | 2010-12-24 |
| US20120040967A1 (en) | 2012-02-16 |
| US8367658B2 (en) | 2013-02-05 |
| EP2197874B1 (en) | 2016-08-31 |
| WO2009044162A1 (en) | 2009-04-09 |
| GB0719644D0 (en) | 2007-11-14 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DK2197874T3 (en) | Pyrazin-2-YL-PYRIDIN-2-YL-AMINE AND pyrazin-2-yl-pyrimidine-4-YL-AMINE COMPOUNDS AND THEIR USE | |
| EP2288601B1 (en) | Bicyclylaryl-aryl-amine compounds and their use | |
| CA2939786C (en) | Pyrazolo[1,5-a]pyrimidine-5,7-diamine compounds as cdk inhibitors and their therapeutic use | |
| EP4626555A1 (en) | Glutarimide-containing pan-kras-mutant degrader compounds and uses thereof | |
| AU2013229229B2 (en) | 3-aryl-5-substituted-isoquinolin-1-one compounds and their therapeutic use | |
| EP3620456B1 (en) | Compound with kinase inhibitory activity and preparation method and use thereof | |
| WO2009004329A1 (en) | 9h-pyrimido[4,5-b]indoles, 9h-pyrido[4',3':4,5]pyrrolo[2,3-d]pyridines, and 9h-1,3,6,9-tetraaza-fluorenes as chk1 kinase function inhibitors | |
| EP3004085B1 (en) | Imidazole derivatives and methods of use thereof for improving the pharmacokinetics of a drug | |
| WO2008075007A1 (en) | Morpholino-substituted bicycloheteroaryl compounds and their use as anti cancer agents | |
| KR102920599B1 (ko) | 항종양 활성을 갖는 화합물 및 이의 용도 | |
| KR102920418B1 (ko) | 키나아제 억제 활성을 갖는 화합물 | |
| CA3219002A1 (en) | Substituted pyrazolo[1,5-a]pyrimidine-7-amine compounds as cdk inhibitors and their therapeutic use | |
| WO2010007389A1 (en) | 5 -amidothiazole derivatives and their use as checkpoint kinase inhibitors | |
| EP4308569A1 (en) | Selective modulators of ataxia telangiectasia mutated (atm) kinase and uses thereof | |
| HK1231852B (en) | Pyrazolo[1,5-a]pyrimidine-5,7-diamine compounds as cdk inhibitors and their therapeutic use | |
| HK1231852A1 (en) | Pyrazolo[1,5-a]pyrimidine-5,7-diamine compounds as cdk inhibitors and their therapeutic use |