DK159259C - Fremgangsmaade til fremstilling af iso- eller terephthalsyre - Google Patents
Fremgangsmaade til fremstilling af iso- eller terephthalsyreInfo
- Publication number
- DK159259C DK159259C DK477776A DK477776A DK159259C DK 159259 C DK159259 C DK 159259C DK 477776 A DK477776 A DK 477776A DK 477776 A DK477776 A DK 477776A DK 159259 C DK159259 C DK 159259C
- Authority
- DK
- Denmark
- Prior art keywords
- terephthalic acid
- producing iso
- iso
- producing
- terephthalic
- Prior art date
Links
- KKEYFWRCBNTPAC-UHFFFAOYSA-N Terephthalic acid Chemical compound OC(=O)C1=CC=C(C(O)=O)C=C1 KKEYFWRCBNTPAC-UHFFFAOYSA-N 0.000 title 2
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C51/00—Preparation of carboxylic acids or their salts, halides or anhydrides
- C07C51/16—Preparation of carboxylic acids or their salts, halides or anhydrides by oxidation
- C07C51/21—Preparation of carboxylic acids or their salts, halides or anhydrides by oxidation with molecular oxygen
- C07C51/255—Preparation of carboxylic acids or their salts, halides or anhydrides by oxidation with molecular oxygen of compounds containing six-membered aromatic rings without ring-splitting
- C07C51/265—Preparation of carboxylic acids or their salts, halides or anhydrides by oxidation with molecular oxygen of compounds containing six-membered aromatic rings without ring-splitting having alkyl side chains which are oxidised to carboxyl groups
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Engineering & Computer Science (AREA)
- Oil, Petroleum & Natural Gas (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US62567575A | 1975-10-24 | 1975-10-24 | |
| US62567575 | 1975-10-24 |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DK477776A DK477776A (da) | 1977-04-25 |
| DK159259B DK159259B (da) | 1990-09-24 |
| DK159259C true DK159259C (da) | 1991-04-08 |
Family
ID=24507104
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DK477776A DK159259C (da) | 1975-10-24 | 1976-10-22 | Fremgangsmaade til fremstilling af iso- eller terephthalsyre |
Country Status (11)
| Country | Link |
|---|---|
| JP (1) | JPS6048497B2 (Direct) |
| BE (1) | BE847474A (Direct) |
| CA (1) | CA1062279A (Direct) |
| DE (1) | DE2647698A1 (Direct) |
| DK (1) | DK159259C (Direct) |
| FR (1) | FR2328688A1 (Direct) |
| GB (1) | GB1555246A (Direct) |
| IT (1) | IT1073924B (Direct) |
| LU (1) | LU76048A1 (Direct) |
| NL (1) | NL188637C (Direct) |
| YU (1) | YU42274B (Direct) |
Families Citing this family (34)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2714985C2 (de) * | 1977-04-04 | 1982-05-06 | Chemische Werke Hüls AG, 4370 Marl | Verfahren zur Reinigung von Terephthalsäure |
| JPS5470235A (en) * | 1977-11-14 | 1979-06-05 | Mitsubishi Chem Ind Ltd | Preparation of terephthalic acid |
| US4334086A (en) * | 1981-03-16 | 1982-06-08 | Labofina S.A. | Production of terephthalic acid |
| DE3128147C2 (de) * | 1981-07-16 | 1986-03-06 | Dynamit Nobel Ag, 5210 Troisdorf | Verfahren zur Gewinnung von aromatischen Monocarbonsäuren |
| JP2893860B2 (ja) * | 1990-05-17 | 1999-05-24 | 三菱瓦斯化学株式会社 | 高純度イソフタル酸の製造法 |
| EP0465100B1 (en) * | 1990-06-25 | 1994-09-28 | Mitsubishi Gas Chemical Company, Inc. | Process for producing high purity isophthalic acid |
| US5183933A (en) * | 1991-10-15 | 1993-02-02 | Amoco Corporation | Process for preparing 2,6-naphthalene-dicarboxylic acid |
| US7572932B2 (en) | 2004-09-02 | 2009-08-11 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7692037B2 (en) | 2004-09-02 | 2010-04-06 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7582793B2 (en) | 2004-09-02 | 2009-09-01 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7504535B2 (en) | 2004-09-02 | 2009-03-17 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7589231B2 (en) | 2004-09-02 | 2009-09-15 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7572936B2 (en) | 2004-09-02 | 2009-08-11 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7586000B2 (en) | 2004-09-02 | 2009-09-08 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7507857B2 (en) | 2004-09-02 | 2009-03-24 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7741515B2 (en) | 2004-09-02 | 2010-06-22 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7608733B2 (en) | 2004-09-02 | 2009-10-27 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7563926B2 (en) | 2004-09-02 | 2009-07-21 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7399882B2 (en) | 2004-09-02 | 2008-07-15 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7608732B2 (en) | 2005-03-08 | 2009-10-27 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7482482B2 (en) | 2004-09-02 | 2009-01-27 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7568361B2 (en) | 2004-09-02 | 2009-08-04 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7683210B2 (en) | 2004-09-02 | 2010-03-23 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7495125B2 (en) * | 2004-09-02 | 2009-02-24 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7371894B2 (en) | 2004-09-02 | 2008-05-13 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7361784B2 (en) | 2004-09-02 | 2008-04-22 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7692036B2 (en) | 2004-11-29 | 2010-04-06 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7390921B2 (en) | 2004-09-02 | 2008-06-24 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7381836B2 (en) | 2004-09-02 | 2008-06-03 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7884232B2 (en) | 2005-06-16 | 2011-02-08 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7355068B2 (en) | 2006-01-04 | 2008-04-08 | Eastman Chemical Company | Oxidation system with internal secondary reactor |
| US7358389B2 (en) | 2006-01-04 | 2008-04-15 | Eastman Chemical Company | Oxidation system employing internal structure for enhanced hydrodynamics |
| US10843995B2 (en) | 2017-06-29 | 2020-11-24 | Bp Corporation North America Inc. | Processes for manufacturing aromatic carboxylic acids |
| CN112110813A (zh) * | 2020-09-18 | 2020-12-22 | 中国石化扬子石油化工有限公司 | 一种促进偏苯三甲酸结晶的方法 |
-
1976
- 1976-10-20 BE BE171665A patent/BE847474A/xx not_active IP Right Cessation
- 1976-10-21 DE DE19762647698 patent/DE2647698A1/de active Granted
- 1976-10-21 LU LU76048A patent/LU76048A1/xx unknown
- 1976-10-22 GB GB4400676A patent/GB1555246A/en not_active Expired
- 1976-10-22 IT IT5186376A patent/IT1073924B/it active
- 1976-10-22 NL NL7611720A patent/NL188637C/xx not_active IP Right Cessation
- 1976-10-22 DK DK477776A patent/DK159259C/da not_active IP Right Cessation
- 1976-10-22 CA CA263,924A patent/CA1062279A/en not_active Expired
- 1976-10-23 JP JP12681576A patent/JPS6048497B2/ja not_active Expired
- 1976-10-25 YU YU260576A patent/YU42274B/xx unknown
- 1976-10-25 FR FR7632100A patent/FR2328688A1/fr active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| NL188637C (nl) | 1992-08-17 |
| YU42274B (en) | 1988-08-31 |
| BE847474A (fr) | 1977-04-20 |
| LU76048A1 (Direct) | 1977-05-31 |
| JPS6048497B2 (ja) | 1985-10-28 |
| DE2647698C2 (Direct) | 1989-06-15 |
| DK477776A (da) | 1977-04-25 |
| JPS5285136A (en) | 1977-07-15 |
| YU260576A (en) | 1982-05-31 |
| FR2328688B1 (Direct) | 1978-12-15 |
| GB1555246A (en) | 1979-11-07 |
| DE2647698A1 (de) | 1977-04-28 |
| FR2328688A1 (fr) | 1977-05-20 |
| IT1073924B (it) | 1985-04-17 |
| CA1062279A (en) | 1979-09-11 |
| NL7611720A (nl) | 1977-04-26 |
| DK159259B (da) | 1990-09-24 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DK159259C (da) | Fremgangsmaade til fremstilling af iso- eller terephthalsyre | |
| DD134224A5 (de) | Verfahren zur herstellung von substituierten aminosaeuren | |
| DK156575C (da) | Fremgangsmaade til fremstilling af 3-hydroxy-3-cephem- eller 3-oxo-cepham-carboxylsyrederivater | |
| DK112576A (da) | Fremgangsmade til fremstilling af alkylencarbonater | |
| AT359977B (de) | Verfahren zur herstellung von mikrokapseln | |
| DK146656C (da) | Fremgangsmaade til fremstilling af mono- eller disalte af n-phosphonomethylglycin | |
| PL201671A1 (pl) | Sposob wytwarzania kwasu tereftalowego | |
| DK231576A (da) | Fremgangsmade til fremstilling af melkesyre | |
| PL198010A1 (pl) | Sposob wytwarzania kwasu tereftalowego | |
| DK152765C (da) | Fremgangsmaade til fremstilling af d-(-)-n-carbamylphenylglycin | |
| AT359054B (de) | Verfahren zur herstellung von hochreinem aethylenglykol | |
| AT358572B (de) | Verfahren zur herstellung von 5-aroyl-1- niederalkyl-pyrrol-2-essigsaeure-derivaten | |
| DD130352A5 (de) | Verfahren zur herstellung von prostaglandin-derivaten | |
| AT349016B (de) | Verfahren zur herstellung von nicotinsaeureamid | |
| AT353750B (de) | Verfahren zur herstellung von mikrokapseln | |
| DD130146A5 (de) | Verfahren zur herstellung von epoxyden | |
| DK157749C (da) | Fremgangsmaade til fremstilling af chrysantheminsyreestere | |
| ATA310976A (de) | Verfahren zur herstellung von pepropionsaeure | |
| DK148886C (da) | Fremgangsmaade til fremstilling af diacetone-2-ketogulonsyre | |
| DK144823C (da) | Fremgangsmaade til fremstilling af o,o-dialkyl-thiophosphorsyreesterchlorider | |
| AT351676B (de) | Verfahren zur herstellung von 7-alkoxy-3- chlormethyl-3-cephemen | |
| PL202798A1 (pl) | Sposob wytwarzania pochodnych kwasu azyrydynokarboksylowego-1 | |
| PL192334A1 (pl) | Sposob wytwarzania kwasu 6-(d-2-acyloamido-2-fenyloacetoamido)-penicylanowego | |
| DK66476A (da) | Fremgangsmade til fremstilling af substituerede indanylpropionsyrer | |
| AT352144B (de) | Verfahren zur herstellung von o,o-dialkyl-s-(n- methyl-carboxamidomethyl) -thiolphosphorsaeureestern |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PUP | Patent expired |