DK156567C - Fremgangsmaade til fremstilling af metoprolol - Google Patents
Fremgangsmaade til fremstilling af metoprololInfo
- Publication number
- DK156567C DK156567C DK542082A DK542082A DK156567C DK 156567 C DK156567 C DK 156567C DK 542082 A DK542082 A DK 542082A DK 542082 A DK542082 A DK 542082A DK 156567 C DK156567 C DK 156567C
- Authority
- DK
- Denmark
- Prior art keywords
- metoprolol
- manufacturing
- manufacturing metoprolol
- Prior art date
Links
- 238000004519 manufacturing process Methods 0.000 title 1
- IUBSYMUCCVWXPE-UHFFFAOYSA-N metoprolol Chemical compound COCCC1=CC=C(OCC(O)CNC(C)C)C=C1 IUBSYMUCCVWXPE-UHFFFAOYSA-N 0.000 title 1
- 229960002237 metoprolol Drugs 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C213/00—Preparation of compounds containing amino and hydroxy, amino and etherified hydroxy or amino and esterified hydroxy groups bound to the same carbon skeleton
- C07C213/06—Preparation of compounds containing amino and hydroxy, amino and etherified hydroxy or amino and esterified hydroxy groups bound to the same carbon skeleton from hydroxy amines by reactions involving the etherification or esterification of hydroxy groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C217/00—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton
- C07C217/02—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton having etherified hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton
- C07C217/04—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton having etherified hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton the carbon skeleton being acyclic and saturated
- C07C217/28—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton having etherified hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton the carbon skeleton being acyclic and saturated having one amino group and at least two singly-bound oxygen atoms, with at least one being part of an etherified hydroxy group, bound to the carbon skeleton, e.g. ethers of polyhydroxy amines
- C07C217/30—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton having etherified hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton the carbon skeleton being acyclic and saturated having one amino group and at least two singly-bound oxygen atoms, with at least one being part of an etherified hydroxy group, bound to the carbon skeleton, e.g. ethers of polyhydroxy amines having the oxygen atom of at least one of the etherified hydroxy groups further bound to a carbon atom of a six-membered aromatic ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C233/00—Carboxylic acid amides
- C07C233/01—Carboxylic acid amides having carbon atoms of carboxamide groups bound to hydrogen atoms or to acyclic carbon atoms
- C07C233/30—Carboxylic acid amides having carbon atoms of carboxamide groups bound to hydrogen atoms or to acyclic carbon atoms having the nitrogen atom of at least one of the carboxamide groups bound to a carbon atom of a hydrocarbon radical substituted by doubly-bound oxygen atoms
- C07C233/33—Carboxylic acid amides having carbon atoms of carboxamide groups bound to hydrogen atoms or to acyclic carbon atoms having the nitrogen atom of at least one of the carboxamide groups bound to a carbon atom of a hydrocarbon radical substituted by doubly-bound oxygen atoms with the substituted hydrocarbon radical bound to the nitrogen atom of the carboxamide group by a carbon atom of a six-membered aromatic ring
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Heterocyclic Compounds That Contain Two Or More Ring Oxygen Atoms (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Oxygen Or Sulfur (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Saccharide Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| FI814053 | 1981-12-17 | ||
| FI814053 | 1981-12-17 |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DK542082A DK542082A (da) | 1983-06-18 |
| DK156567B DK156567B (da) | 1989-09-11 |
| DK156567C true DK156567C (da) | 1990-03-05 |
Family
ID=8514961
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DK542082A DK156567C (da) | 1981-12-17 | 1982-12-07 | Fremgangsmaade til fremstilling af metoprolol |
| DK541982A DK541982A (da) | 1981-12-17 | 1982-12-07 | Fremgangsmaade til fremstilling af acebutolol |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DK541982A DK541982A (da) | 1981-12-17 | 1982-12-07 | Fremgangsmaade til fremstilling af acebutolol |
Country Status (9)
| Country | Link |
|---|---|
| JP (2) | JPS58159446A (da) |
| KR (1) | KR840002768A (da) |
| CA (1) | CA1198125A (da) |
| DK (2) | DK156567C (da) |
| HU (1) | HU186649B (da) |
| NO (2) | NO155619C (da) |
| SE (2) | SE452612B (da) |
| SU (1) | SU1170968A3 (da) |
| YU (2) | YU275982A (da) |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS56152461A (en) * | 1980-04-30 | 1981-11-26 | Ota Seiyaku Kk | Preparation of indole derivative |
-
1982
- 1982-12-06 KR KR1019820005450A patent/KR840002768A/ko unknown
- 1982-12-07 DK DK542082A patent/DK156567C/da not_active IP Right Cessation
- 1982-12-07 DK DK541982A patent/DK541982A/da not_active Application Discontinuation
- 1982-12-14 YU YU02759/82A patent/YU275982A/xx unknown
- 1982-12-14 YU YU02758/82A patent/YU275882A/xx unknown
- 1982-12-15 SU SU823523098A patent/SU1170968A3/ru active
- 1982-12-16 JP JP57221057A patent/JPS58159446A/ja active Pending
- 1982-12-16 NO NO824233A patent/NO155619C/no unknown
- 1982-12-16 SE SE8207199A patent/SE452612B/sv not_active IP Right Cessation
- 1982-12-16 JP JP57221058A patent/JPS58159449A/ja active Pending
- 1982-12-16 NO NO824232A patent/NO824232L/no unknown
- 1982-12-16 CA CA000417934A patent/CA1198125A/en not_active Expired
- 1982-12-16 HU HU824069A patent/HU186649B/hu not_active IP Right Cessation
- 1982-12-16 SE SE8207198A patent/SE8207198L/xx not_active Application Discontinuation
Also Published As
| Publication number | Publication date |
|---|---|
| SU1170968A3 (ru) | 1985-07-30 |
| NO824233L (no) | 1983-06-20 |
| SE8207198D0 (sv) | 1982-12-16 |
| NO155619C (no) | 1987-04-29 |
| DK542082A (da) | 1983-06-18 |
| CA1198125A (en) | 1985-12-17 |
| NO155619B (no) | 1987-01-19 |
| JPS58159446A (ja) | 1983-09-21 |
| DK156567B (da) | 1989-09-11 |
| SE452612B (sv) | 1987-12-07 |
| KR840002768A (ko) | 1984-07-16 |
| SE8207199D0 (sv) | 1982-12-16 |
| YU275982A (en) | 1985-03-20 |
| DK541982A (da) | 1983-06-18 |
| NO824232L (no) | 1983-06-20 |
| YU275882A (en) | 1985-03-20 |
| SE8207198L (sv) | 1983-06-18 |
| JPS58159449A (ja) | 1983-09-21 |
| SE8207199L (sv) | 1983-06-18 |
| HU186649B (en) | 1985-08-28 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DK350083A (da) | Fremgangsmaade til fremstilling af phenylethanolaminer | |
| DK180481A (da) | Fremgangsmaade til fremstilling af metaller | |
| DK150623C (da) | Fremgangsmaade til fremstilling af fiskemel | |
| DK319281A (da) | Femgangsmaade til fremstilling af benzisoselenazoloner | |
| DK155791C (da) | Fremgangsmaade til fremstilling af cementklinker | |
| DK366684A (da) | Fremgangsmaade til fremstilling af cefuroximaxetil | |
| DK582883D0 (da) | Fremgangsmaade til fremstilling af modelis | |
| DK212381A (da) | Fremgangsmaade til fremstilling af polynucleotider | |
| DK479981A (da) | Fremgangsmaade til fremstilling af 3-aryl-3-hydroxyphthalimidiner | |
| DK87082A (da) | Fremgangsmaade til fremstilling af cemnetklinker | |
| DK224681A (da) | Fremgangsmaade til fremstilling af diaet-oel | |
| DK68981A (da) | Fremgangsmaade til fremstilling af oel | |
| DK40883A (da) | Fremgangsmaade til fremstilling af benzothienylallylaminer | |
| DK424083D0 (da) | Fremgangsmade til fremstilling af anthracyclinglycosider | |
| DK501582A (da) | Fremgangsmaade til fremstilling af acylcyanider | |
| DK105082A (da) | Fremgangsmaade til fremstilling af substituerede trifluormethylphenyl-tetrahydropyridiner | |
| DK168082A (da) | Fremgangsmaade til fremstilling af metaboliter | |
| DK548081A (da) | Fremgangsmaade til fremstilling af buspiron | |
| DK202983A (da) | Fremgangsmaade til fremstilling af l-lysin | |
| DK118382A (da) | Fremgangsmaade til fremstilling af anthelmintika | |
| DK551582A (da) | Fremgangsmaade til fremstilling af encainid | |
| DK219483D0 (da) | Fremgangsmade til fremstilling af anthracyclinglycosider | |
| DK385983A (da) | Fremgangsmaade til fremstilling af 1-oxacephamer | |
| DK329685D0 (da) | Fremgangsmaade til fremstilling af alfa-l-aspartyl-l-phenylalaninalkylestere | |
| DK156567C (da) | Fremgangsmaade til fremstilling af metoprolol |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PBP | Patent lapsed |