DK147681C - Fremgangsmaade til fremstilling af propionsyre-3,4-dichloranilid - Google Patents
Fremgangsmaade til fremstilling af propionsyre-3,4-dichloranilidInfo
- Publication number
- DK147681C DK147681C DK70977A DK70977A DK147681C DK 147681 C DK147681 C DK 147681C DK 70977 A DK70977 A DK 70977A DK 70977 A DK70977 A DK 70977A DK 147681 C DK147681 C DK 147681C
- Authority
- DK
- Denmark
- Prior art keywords
- dichloranilide
- procedure
- propionic acid
- preparing propionic
- preparing
- Prior art date
Links
- LFULEKSKNZEWOE-UHFFFAOYSA-N propanil Chemical compound CCC(=O)NC1=CC=C(Cl)C(Cl)=C1 LFULEKSKNZEWOE-UHFFFAOYSA-N 0.000 title 1
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2606855 | 1976-02-20 | ||
| DE19762606855 DE2606855C2 (de) | 1976-02-20 | 1976-02-20 | Verfahren zur Herstellung von Propionsäure-3,4-dichloranilid |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DK70977A DK70977A (da) | 1977-08-21 |
| DK147681B DK147681B (da) | 1984-11-12 |
| DK147681C true DK147681C (da) | 1985-05-28 |
Family
ID=5970413
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DK70977A DK147681C (da) | 1976-02-20 | 1977-02-18 | Fremgangsmaade til fremstilling af propionsyre-3,4-dichloranilid |
Country Status (16)
| Country | Link |
|---|---|
| JP (1) | JPS5943456B2 (da) |
| BE (1) | BE851583A (da) |
| BR (1) | BR7701005A (da) |
| CH (1) | CH625782A5 (da) |
| DE (1) | DE2606855C2 (da) |
| DK (1) | DK147681C (da) |
| ES (1) | ES456028A1 (da) |
| FR (1) | FR2341560A1 (da) |
| GB (1) | GB1500895A (da) |
| HU (1) | HU174259B (da) |
| IL (1) | IL51478A (da) |
| IT (1) | IT1086209B (da) |
| NL (1) | NL7701697A (da) |
| RO (1) | RO73105A (da) |
| SU (1) | SU612623A3 (da) |
| TR (1) | TR18981A (da) |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1643741A1 (de) * | 1968-01-17 | 1971-07-01 | Basf Ag | Verfahren zur Herstellung von Propionsaeure-3,4-dichloranilid |
| CH583529A5 (da) * | 1974-03-28 | 1977-01-14 | Hoechst Ag |
-
1976
- 1976-02-20 DE DE19762606855 patent/DE2606855C2/de not_active Expired
-
1977
- 1977-02-16 CH CH192477A patent/CH625782A5/de not_active IP Right Cessation
- 1977-02-16 GB GB6470/77A patent/GB1500895A/en not_active Expired
- 1977-02-16 RO RO7789422A patent/RO73105A/ro unknown
- 1977-02-17 IL IL51478A patent/IL51478A/xx unknown
- 1977-02-17 TR TR1898177A patent/TR18981A/xx unknown
- 1977-02-17 BR BR7701005A patent/BR7701005A/pt unknown
- 1977-02-17 SU SU772452846A patent/SU612623A3/ru active
- 1977-02-17 NL NL7701697A patent/NL7701697A/xx not_active Application Discontinuation
- 1977-02-18 ES ES456028A patent/ES456028A1/es not_active Expired
- 1977-02-18 BE BE175057A patent/BE851583A/xx unknown
- 1977-02-18 IT IT2047277A patent/IT1086209B/it active
- 1977-02-18 FR FR7704760A patent/FR2341560A1/fr active Granted
- 1977-02-18 DK DK70977A patent/DK147681C/da not_active IP Right Cessation
- 1977-02-19 HU HU77BA3508A patent/HU174259B/hu not_active IP Right Cessation
- 1977-02-21 JP JP1723277A patent/JPS5943456B2/ja not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| DE2606855C2 (de) | 1982-12-02 |
| DE2606855A1 (de) | 1977-08-25 |
| ES456028A1 (es) | 1978-02-01 |
| IT1086209B (it) | 1985-05-28 |
| JPS52102233A (en) | 1977-08-27 |
| SU612623A3 (ru) | 1978-06-25 |
| TR18981A (tr) | 1978-02-06 |
| NL7701697A (nl) | 1977-08-23 |
| IL51478A0 (en) | 1977-04-29 |
| BR7701005A (pt) | 1977-11-01 |
| JPS5943456B2 (ja) | 1984-10-22 |
| CH625782A5 (en) | 1981-10-15 |
| GB1500895A (en) | 1978-02-15 |
| HU174259B (hu) | 1979-12-28 |
| BE851583A (fr) | 1977-08-18 |
| DK70977A (da) | 1977-08-21 |
| FR2341560B1 (da) | 1981-04-30 |
| DK147681B (da) | 1984-11-12 |
| IL51478A (en) | 1979-12-30 |
| FR2341560A1 (fr) | 1977-09-16 |
| RO73105A (ro) | 1981-09-24 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DK13177A (da) | Fremgangsmade til fremstilling af phthalaner | |
| DK116177A (da) | Fremgangsmade til fremstilling af hentriakontapeptider | |
| DK565977A (da) | Fremgangsmaade til fremstilling af n-phosphonomethylglycinsalte | |
| DK301077A (da) | Fremgangsmade til fremstilling af 6a,10a-transhexahydrodibenzo (b,d) pyran-9-oner | |
| DK147068C (da) | Analogifremgangsmaade til fremstilling af 1-naphthylmethyl-cinnamyl-aminderivater | |
| DK161597C (da) | Analogifremgangsmaade til fremstilling af polyprenylderivater | |
| DK455877A (da) | Fremgangsmaade til fremstilling af phenyleddikesyrederivater | |
| DK117677A (da) | Fremgangsmade til fremstilling af piperidinderivater | |
| DK153379A (da) | Fremgangsmaade til fremstilling af n,n,n!,n!-tetraacetylethylendiamin | |
| DK329577A (da) | Fremgangsmade til fremstilling af derivater af phenoxyhydroxypropylamin | |
| DK153489C (da) | Analogifremgangsmaade til fremstilling af 7-aminothiazolylacetamidocephalosporansyrederivater | |
| DK145877A (da) | Fremgangsmade til immoblisering af glucoseisomerase | |
| DK150484C (da) | Analogifremgangsmaade til fremstilling af 4-amino-3-thiophencarboxylsyrederivater | |
| DK233377A (da) | Fremgangsmade til fremstilling af omega-noraromatiske-13,14-dehydro-prostaglandiner | |
| DK301277A (da) | Fremgangsmade til fremstilling af substituerede 2,6-methano-2h-1-benzoxociner | |
| DK146017C (da) | Analogifremgangsmaade til fremstilling af 17alfa-acyloxy-9alfa,21-dihalogen-11beta-hydroxy-6alfa-fluor-16beta-methyl-pregna-1,4-dien-3,20-dion-forbindelser | |
| DK143340C (da) | Fremgangsmaade til fremstilling af 2-(4-furoylpiperazin-1-yl)-4-amino-6,7-dimethoxyquinazoliner | |
| DK139029B (da) | Analogifremgangsmåde til fremstilling af 5-m-tolyloxyuracil. | |
| DK128277A (da) | Fremgangsmade til fremstilling af pyridinderivater | |
| DK158837C (da) | Fremgangsmaade til fremstilling af p-hydroxyphenylglycin. | |
| DK73077A (da) | Fremgangsmade til fremstilling af 2,9-dioxatricyclo (4,3,1,03,7) decaner | |
| DK428377A (da) | Fremgangsmaade til fremstilling af pyridobenzodiazepinoner | |
| DK310777A (da) | Fremgangsmade til fremstilling af guaiacol-p-isobutyl-hydratropat | |
| DK146624C (da) | Analogifremgangsmaade til fremstilling af 1-aminoalkyl-3,4-diphenyl-1h-pyrazoler | |
| DK156955C (da) | Fremgangsmaade til fremstilling af cyanosubstituerede cyclopropanderivater |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PBP | Patent lapsed |