DK147259C - Fremgangsmaade til fremstilling af 3-hydroxy-2-imino-1(2h)-pyridinsulfonsyre-monohydrat - Google Patents
Fremgangsmaade til fremstilling af 3-hydroxy-2-imino-1(2h)-pyridinsulfonsyre-monohydratInfo
- Publication number
- DK147259C DK147259C DK232577A DK232577A DK147259C DK 147259 C DK147259 C DK 147259C DK 232577 A DK232577 A DK 232577A DK 232577 A DK232577 A DK 232577A DK 147259 C DK147259 C DK 147259C
- Authority
- DK
- Denmark
- Prior art keywords
- imino
- hydroxy
- preparing
- sulphonic acid
- acid monohydrate
- Prior art date
Links
- MEWPEKKXNPDJNC-UHFFFAOYSA-N 3-hydroxy-2-iminopyridine-1-sulfonic acid;hydrate Chemical compound O.OC1=CC=CN(S(O)(=O)=O)C1=N MEWPEKKXNPDJNC-UHFFFAOYSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/89—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members with hetero atoms directly attached to the ring nitrogen atom
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pyridine Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US05/690,497 US4052406A (en) | 1976-05-27 | 1976-05-27 | Process for the production of 3-hydroxy-2-imino-(2h)-pyridinesulphonic acid monohydrate |
| US69049776 | 1976-05-27 |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DK232577A DK232577A (da) | 1977-11-28 |
| DK147259B DK147259B (da) | 1984-05-28 |
| DK147259C true DK147259C (da) | 1984-11-26 |
Family
ID=24772705
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DK232577A DK147259C (da) | 1976-05-27 | 1977-05-26 | Fremgangsmaade til fremstilling af 3-hydroxy-2-imino-1(2h)-pyridinsulfonsyre-monohydrat |
Country Status (8)
| Country | Link |
|---|---|
| US (1) | US4052406A (ref) |
| JP (1) | JPS609712B2 (ref) |
| BE (1) | BE855066A (ref) |
| CH (1) | CH628033A5 (ref) |
| DE (1) | DE2723389A1 (ref) |
| DK (1) | DK147259C (ref) |
| FR (1) | FR2352802A1 (ref) |
| GB (1) | GB1578886A (ref) |
Families Citing this family (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0210553B1 (de) * | 1985-07-26 | 1989-08-30 | Audi Ag | Vorrichtung zum Ausgleich der Radaufstands-Querkräfte an einem Federbein |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3706753A (en) * | 1965-04-29 | 1972-12-19 | Ciba Geigy Corp | Process for the preparation of 2-amino-3-pyridinol |
| CH449011A (de) * | 1965-04-29 | 1967-12-31 | Geigy Ag J R | Verfahren zur Herstellung von 2,3-Pyridindiol |
| US3808218A (en) * | 1970-06-26 | 1974-04-30 | Ciba Geigy Corp | 3h-oxazolo(4,5-b)pyridine-2-one,esters with 3-(-o-)or(-s-)-o,o'-diloweralkyl phosphates or thiophosphates |
-
1976
- 1976-05-27 US US05/690,497 patent/US4052406A/en not_active Expired - Lifetime
-
1977
- 1977-05-24 DE DE19772723389 patent/DE2723389A1/de not_active Withdrawn
- 1977-05-25 CH CH644177A patent/CH628033A5/de not_active IP Right Cessation
- 1977-05-25 GB GB22123/77A patent/GB1578886A/en not_active Expired
- 1977-05-26 DK DK232577A patent/DK147259C/da not_active IP Right Cessation
- 1977-05-26 FR FR7716128A patent/FR2352802A1/fr active Granted
- 1977-05-26 BE BE177928A patent/BE855066A/xx not_active IP Right Cessation
- 1977-05-27 JP JP52062040A patent/JPS609712B2/ja not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| US4052406A (en) | 1977-10-04 |
| GB1578886A (en) | 1980-11-12 |
| DK147259B (da) | 1984-05-28 |
| JPS609712B2 (ja) | 1985-03-12 |
| FR2352802A1 (fr) | 1977-12-23 |
| FR2352802B1 (ref) | 1980-06-06 |
| DE2723389A1 (de) | 1977-12-08 |
| JPS52144677A (en) | 1977-12-02 |
| BE855066A (fr) | 1977-11-28 |
| DK232577A (da) | 1977-11-28 |
| CH628033A5 (de) | 1982-02-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DK157026C (da) | Fremgangsmaade til fremstilling af 7-oed-alfa-amino-alfa-(p-hydroxy-phenyl)acetamidoaa-3-methyl-cephem-4-carboxylsyre | |
| DK337877A (da) | Fremgangsmade til fremstilling af phosphonsyrederivater | |
| DK286777A (da) | Fremgangsmade til fremstilling af penicillansyrederivater | |
| DK247076A (da) | Fremgangsmade til fremstilling af sur protease | |
| DK154180A (da) | Fremgangsmaade til fremstilling af penem-3-carboxylsyrederivatier | |
| DK455877A (da) | Fremgangsmaade til fremstilling af phenyleddikesyrederivater | |
| DK99980A (da) | Fremgangsmaade til fremstilling af mercaptoacyldihydropyrazolcarboxylsyrederivater | |
| DK153489C (da) | Analogifremgangsmaade til fremstilling af 7-aminothiazolylacetamidocephalosporansyrederivater | |
| DK152672C (da) | Fremgangsmaade til fremstilling af 2-hydroxymethyl-3-hydroxy-6-(1-hydroxy-2-t-butylaminoethyl)pyridin eller syreadditionssalte heraf | |
| DK431176A (da) | Fremgangsmade til fremstilling af hypolipemiske phenyleddikesyrederivater | |
| DK495881A (da) | Fremgangsmaade til fremstilling af omega-(2-oxo-benzazolinyl) alkansyrederivater | |
| DK150484C (da) | Analogifremgangsmaade til fremstilling af 4-amino-3-thiophencarboxylsyrederivater | |
| DK147680C (da) | Fremgangsmaade til rensning af vaadphosphorsyre | |
| DK157843C (da) | Fremgangsmaade til fremstilling af 2-hydroxynaphthalen-6-carboxylsyre | |
| DK143565C (da) | Fremgangsmaade til fremstilling af 1-aminoalkan-1,1-diphosphonsyrer | |
| DK236677A (da) | Fremgangsmade til fremstilling af kvadratsyre | |
| DK144277C (da) | Fremgangsmaade til fremstilling af 6-aminopenicillansyre | |
| DK149822C (da) | Fremgangsmaade til fremstilling af phosphonsyrederivater | |
| DK154554C (da) | Fremgangsmaade til fremstilling af alfa-methyl-carbazol-2-eddikesyrederivater | |
| DK147259C (da) | Fremgangsmaade til fremstilling af 3-hydroxy-2-imino-1(2h)-pyridinsulfonsyre-monohydrat | |
| DK444279A (da) | Fremgangsmaade til fremstilling af 6-hydroxymethyl-2-(beta-aminoethylthio)-1-carbadethiapen-2-em-3-carboxylsyre | |
| DK154085C (da) | Fremgangsmaade til fremstilling af 1,1-dioxopenicillansyrederivater | |
| DK148886C (da) | Fremgangsmaade til fremstilling af diacetone-2-ketogulonsyre | |
| DK57381A (da) | Fremgansmaade til fremstilling af bifenyloxypropionsyrederivater | |
| DK144823C (da) | Fremgangsmaade til fremstilling af o,o-dialkyl-thiophosphorsyreesterchlorider |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PBP | Patent lapsed |