DK154085C - Fremgangsmaade til fremstilling af 1,1-dioxopenicillansyrederivater - Google Patents
Fremgangsmaade til fremstilling af 1,1-dioxopenicillansyrederivaterInfo
- Publication number
- DK154085C DK154085C DK424080A DK424080A DK154085C DK 154085 C DK154085 C DK 154085C DK 424080 A DK424080 A DK 424080A DK 424080 A DK424080 A DK 424080A DK 154085 C DK154085 C DK 154085C
- Authority
- DK
- Denmark
- Prior art keywords
- preparing
- acid derivatives
- dioxopenicillanic acid
- dioxopenicillanic
- derivatives
- Prior art date
Links
- FKENQMMABCRJMK-RITPCOANSA-N sulbactam Chemical class O=S1(=O)C(C)(C)[C@H](C(O)=O)N2C(=O)C[C@H]21 FKENQMMABCRJMK-RITPCOANSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D499/00—Heterocyclic compounds containing 4-thia-1-azabicyclo [3.2.0] heptane ring systems, i.e. compounds containing a ring system of the formula:, e.g. penicillins, penems; Such ring systems being further condensed, e.g. 2,3-condensed with an oxygen-, nitrogen- or sulfur-containing hetero ring
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Cephalosporin Compounds (AREA)
Applications Claiming Priority (4)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB7935284 | 1979-10-11 | ||
| GB7935284 | 1979-10-11 | ||
| GB7942062 | 1979-12-05 | ||
| GB7942062 | 1979-12-05 |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DK424080A DK424080A (da) | 1981-04-12 |
| DK154085B DK154085B (da) | 1988-10-10 |
| DK154085C true DK154085C (da) | 1989-02-27 |
Family
ID=26273161
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DK424080A DK154085C (da) | 1979-10-11 | 1980-10-08 | Fremgangsmaade til fremstilling af 1,1-dioxopenicillansyrederivater |
Country Status (11)
| Country | Link |
|---|---|
| CA (1) | CA1142174A (da) |
| CH (1) | CH646174A5 (da) |
| DE (1) | DE3037896A1 (da) |
| DK (1) | DK154085C (da) |
| FR (1) | FR2467210A1 (da) |
| GB (1) | GB2059960B (da) |
| IE (1) | IE50650B1 (da) |
| IT (1) | IT1132938B (da) |
| LU (1) | LU82842A1 (da) |
| NL (1) | NL8005626A (da) |
| SE (1) | SE449613B (da) |
Families Citing this family (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4331599A (en) * | 1981-02-02 | 1982-05-25 | Pfizer Inc. | Sparingly water-soluble salts of penicillanic acid 1,1-dioxide |
| IN159362B (da) * | 1981-03-23 | 1987-05-09 | Pfizer | |
| US4381263A (en) * | 1981-03-23 | 1983-04-26 | Pfizer Inc. | Process for the preparation of penicillanic acid esters |
| US4502988A (en) * | 1983-08-08 | 1985-03-05 | Eli Lilly And Company | Oxidation process |
| GB2206579B (en) * | 1987-07-10 | 1991-05-29 | Erba Farmitalia | 6a and 6b-(substituted methyl)-penicillanic acid derivatives |
| CN102977120B (zh) * | 2012-12-14 | 2015-05-27 | 江西富祥药业股份有限公司 | 一种舒巴坦匹酯制备及结晶方法 |
-
1980
- 1980-09-22 IE IE1963/80A patent/IE50650B1/en unknown
- 1980-09-23 GB GB8030709A patent/GB2059960B/en not_active Expired
- 1980-10-07 DE DE19803037896 patent/DE3037896A1/de not_active Withdrawn
- 1980-10-08 DK DK424080A patent/DK154085C/da active
- 1980-10-09 CA CA000362093A patent/CA1142174A/en not_active Expired
- 1980-10-09 IT IT25223/80A patent/IT1132938B/it active
- 1980-10-10 LU LU82842A patent/LU82842A1/fr unknown
- 1980-10-10 FR FR8021730A patent/FR2467210A1/fr active Granted
- 1980-10-10 CH CH760280A patent/CH646174A5/de not_active IP Right Cessation
- 1980-10-10 NL NL8005626A patent/NL8005626A/nl not_active Application Discontinuation
- 1980-10-10 SE SE8007141A patent/SE449613B/sv not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| IE50650B1 (en) | 1986-06-11 |
| DK424080A (da) | 1981-04-12 |
| IT1132938B (it) | 1986-07-09 |
| NL8005626A (nl) | 1981-04-14 |
| DE3037896A1 (de) | 1981-04-23 |
| DK154085B (da) | 1988-10-10 |
| FR2467210A1 (fr) | 1981-04-17 |
| CH646174A5 (en) | 1984-11-15 |
| GB2059960A (en) | 1981-04-29 |
| FR2467210B1 (da) | 1983-08-19 |
| LU82842A1 (fr) | 1981-06-04 |
| SE8007141L (sv) | 1981-04-12 |
| IE801963L (en) | 1981-04-11 |
| SE449613B (sv) | 1987-05-11 |
| GB2059960B (en) | 1983-10-19 |
| IT8025223A0 (it) | 1980-10-09 |
| CA1142174A (en) | 1983-03-01 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DK540080A (da) | Fremgangsmaade til fremstilling af 2-amino-4-hydroxyquinazolinderivater | |
| DK478980A (da) | Fremgangsmaade til fremstilling af imidazol-5-eddikesyrederivater | |
| DK268879A (da) | Fremgangsmaade til fremstilling af octahydropyrazolo (3,4-g)-quinoliner | |
| DK155946C (da) | Fremgangsmaade til fremstilling af 4,1',6'-trichlor-4,1',6'-tridesoxygalactosaccharose | |
| DK42480A (da) | Fremgangsmaade til fremstilling af 1-aryl-2-acylamido-3-fluor-1-propanoler | |
| DK172182A (da) | Fremgangsmaade til fremstilling af 1,4-dihydropyridinderivater | |
| DK158669C (da) | Fremgangsmaade til fremstilling af 6beta-halogensubstituerede penicillansyrederivater. | |
| DK396880A (da) | Fremgangsmaade til fremstilling af cyclohexancarboxylsyrederivater | |
| DK99980A (da) | Fremgangsmaade til fremstilling af mercaptoacyldihydropyrazolcarboxylsyrederivater | |
| DK159787C (da) | Fremgangsmaade til fremstilling af 3',4'-dideoxykanamycin b | |
| DK113483A (da) | Fremgangsmaade til fremstilling af 3,4-diphenyl-5-methylpyrazolderivater | |
| DK153543C (da) | Fremgangsmaade til fremstilling af 2',6'-dialkyl-n-alkoxymethyl-2-chlor-acetanilider | |
| DK454579A (da) | Fremgangsmaade til fremstilling af 6-piperidino-2,4-diaminopyrimidin-3-oxid | |
| DK154085C (da) | Fremgangsmaade til fremstilling af 1,1-dioxopenicillansyrederivater | |
| DK154554C (da) | Fremgangsmaade til fremstilling af alfa-methyl-carbazol-2-eddikesyrederivater | |
| DK313580A (da) | Fremgangsmaade til fremstilling af 1,2-dihydro-2-oxo-5-(pyridinyl) nicotinonitriler | |
| DK149962C (da) | Fremgangsmaade til fremstilling af 2,5-diketogluconsyre | |
| DK217480A (da) | Fremgangsmaade til fremstilling af 5-mercapto1,2,3-triazoler | |
| DK57381A (da) | Fremgansmaade til fremstilling af bifenyloxypropionsyrederivater | |
| DK375480A (da) | Fremgangsmaade til fremstilling af 1,2,4-triazol-3-thioler | |
| DK145741C (da) | Fremgangsmaade til fremstilling af 6-chlor-alfa-methyl-carbazol-2-eddikesyre | |
| DK311480A (da) | Fremgangsmaade til fremstilling af 1,1-dichloralkener | |
| DK164680A (da) | Fremgangsmaade til fremstilling af 2,3-dihydroxybenzoesyre | |
| DK309080A (da) | Fremgangsmaade til fremstilling af 3-(2,2-dichlorvinyl)-2,2-dimethyl-cyclopropan-1-carboxylsyrederivater | |
| DK212080A (da) | Fremgangsmaade til fremstilling af 2,2-dialkyl-4-methyl-5,5-dialkyl-3-formyl-3-pyrrolin |