DK144973C - Analogifremgangsmaade til fremstilling af 6-(d-2-(3-hydroxypyridazin-4-carbonamido)-2-(p-hydroxyphenyl)acetamido)penicillansyre eller salte deraf - Google Patents
Analogifremgangsmaade til fremstilling af 6-(d-2-(3-hydroxypyridazin-4-carbonamido)-2-(p-hydroxyphenyl)acetamido)penicillansyre eller salte derafInfo
- Publication number
- DK144973C DK144973C DK60976A DK60976A DK144973C DK 144973 C DK144973 C DK 144973C DK 60976 A DK60976 A DK 60976A DK 60976 A DK60976 A DK 60976A DK 144973 C DK144973 C DK 144973C
- Authority
- DK
- Denmark
- Prior art keywords
- hydroxypyridazine
- carbonamido
- acetamido
- hydroxyphenyl
- analogue
- Prior art date
Links
- -1 ACETAMIDO Chemical class 0.000 title 1
- RBKMMJSQKNKNEV-RITPCOANSA-N penicillanic acid Chemical compound OC(=O)[C@H]1C(C)(C)S[C@@H]2CC(=O)N21 RBKMMJSQKNKNEV-RITPCOANSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D499/00—Heterocyclic compounds containing 4-thia-1-azabicyclo [3.2.0] heptane ring systems, i.e. compounds containing a ring system of the formula:, e.g. penicillins, penems; Such ring systems being further condensed, e.g. 2,3-condensed with an oxygen-, nitrogen- or sulfur-containing hetero ring
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Preparation Of Compounds By Using Micro-Organisms (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP1904075 | 1975-02-14 | ||
| JP50019040A JPS5195090A (en) | 1975-02-14 | 1975-02-14 | 66 * dd22 * 33 hidorokishipiridajin 44 karubokishiamido * 22 * paraahidorokishifueniru * asetoamido * penishiransanno seiho |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DK60976A DK60976A (da) | 1976-08-15 |
| DK144973B DK144973B (da) | 1982-07-19 |
| DK144973C true DK144973C (da) | 1982-12-06 |
Family
ID=11988305
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DK60976A DK144973C (da) | 1975-02-14 | 1976-02-13 | Analogifremgangsmaade til fremstilling af 6-(d-2-(3-hydroxypyridazin-4-carbonamido)-2-(p-hydroxyphenyl)acetamido)penicillansyre eller salte deraf |
Country Status (19)
| Country | Link |
|---|---|
| US (1) | US4046904A (en:Method) |
| JP (1) | JPS5195090A (en:Method) |
| AR (2) | AR211922A1 (en:Method) |
| AT (1) | AT343805B (en:Method) |
| BE (1) | BE838545R (en:Method) |
| CA (1) | CA1067893A (en:Method) |
| CH (1) | CH611625A5 (en:Method) |
| CS (2) | CS191999B2 (en:Method) |
| DD (1) | DD123607A5 (en:Method) |
| DE (1) | DE2605910A1 (en:Method) |
| DK (1) | DK144973C (en:Method) |
| ES (2) | ES445176A1 (en:Method) |
| FR (1) | FR2300565A2 (en:Method) |
| GB (1) | GB1507623A (en:Method) |
| MX (1) | MX3890E (en:Method) |
| NL (1) | NL7601409A (en:Method) |
| PL (1) | PL99090B1 (en:Method) |
| SE (1) | SE417517B (en:Method) |
| ZA (1) | ZA76850B (en:Method) |
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1465893A (en) * | 1973-02-09 | 1977-03-02 | Gist Brocades Nv | I-carboxypropenyl-4-iminothio-azetidine-2-one derivatives methods for their preparation and use |
| US4537886A (en) * | 1982-03-31 | 1985-08-27 | Beecham Group P.L.C. | β-lactam antibacterial agents and compositions containing them |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3864329A (en) * | 1970-12-29 | 1975-02-04 | Sumitomo Chemical Co | Penicillins substituted with heterocyclic groups |
| JPS5417754B2 (en:Method) * | 1972-12-15 | 1979-07-02 | ||
| JPS5751837B2 (en:Method) * | 1973-04-05 | 1982-11-04 |
-
1975
- 1975-02-14 JP JP50019040A patent/JPS5195090A/ja active Pending
-
1976
- 1976-01-16 AR AR262275A patent/AR211922A1/es active
- 1976-02-03 MX MX762397U patent/MX3890E/es unknown
- 1976-02-11 NL NL7601409A patent/NL7601409A/xx not_active Application Discontinuation
- 1976-02-12 DD DD191216A patent/DD123607A5/xx unknown
- 1976-02-12 GB GB5558/76A patent/GB1507623A/en not_active Expired
- 1976-02-13 US US05/658,035 patent/US4046904A/en not_active Expired - Lifetime
- 1976-02-13 BE BE164301A patent/BE838545R/xx active
- 1976-02-13 FR FR7604017A patent/FR2300565A2/fr active Pending
- 1976-02-13 DK DK60976A patent/DK144973C/da active
- 1976-02-13 ES ES445176A patent/ES445176A1/es not_active Expired
- 1976-02-13 DE DE19762605910 patent/DE2605910A1/de not_active Withdrawn
- 1976-02-13 SE SE7601640A patent/SE417517B/xx unknown
- 1976-02-13 AT AT102376A patent/AT343805B/de not_active IP Right Cessation
- 1976-02-13 CH CH180276A patent/CH611625A5/xx not_active IP Right Cessation
- 1976-02-13 ZA ZA850A patent/ZA76850B/xx unknown
- 1976-02-13 PL PL1976187216A patent/PL99090B1/pl unknown
- 1976-02-16 CA CA245,794A patent/CA1067893A/en not_active Expired
- 1976-02-16 CS CS763742A patent/CS191999B2/cs unknown
- 1976-02-16 CS CS76989A patent/CS191964B2/cs unknown
- 1976-09-24 AR AR264847A patent/AR211935A1/es active
-
1977
- 1977-05-13 ES ES458790A patent/ES458790A1/es not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| PL99090B1 (pl) | 1978-06-30 |
| NL7601409A (nl) | 1976-08-17 |
| SE417517B (sv) | 1981-03-23 |
| JPS5195090A (en) | 1976-08-20 |
| AR211922A1 (es) | 1978-04-14 |
| BE838545R (fr) | 1976-08-13 |
| ATA102376A (de) | 1977-10-15 |
| ES458790A1 (es) | 1978-03-01 |
| AT343805B (de) | 1978-06-26 |
| ES445176A1 (es) | 1977-10-01 |
| DD123607A5 (en:Method) | 1977-01-05 |
| AU1114676A (en) | 1977-08-25 |
| ZA76850B (en) | 1977-01-26 |
| CA1067893A (en) | 1979-12-11 |
| MX3890E (es) | 1981-09-03 |
| DE2605910A1 (de) | 1976-08-26 |
| DK144973B (da) | 1982-07-19 |
| FR2300565A2 (fr) | 1976-09-10 |
| GB1507623A (en) | 1978-04-19 |
| CS191964B2 (en) | 1979-07-31 |
| CS191999B2 (en:Method) | 1979-07-31 |
| AR211935A1 (es) | 1978-04-14 |
| CH611625A5 (en:Method) | 1979-06-15 |
| SE7601640L (sv) | 1976-08-16 |
| DK60976A (da) | 1976-08-15 |
| US4046904A (en) | 1977-09-06 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DK145339C (da) | Analogifremgangsmaade til fremstilling af 4-amino-5-hexensyre eller farmaceutisk acceptable salte deraf | |
| DK145119C (da) | Analogifremgangsmaade til fremstilling af phenolethere eller syreadditionssalte deraf | |
| DK144942C (da) | Analogifremgangsmaade til fremstilling af alkanophenon-o-(2-aminoethyl)-oximetherforbindelser eller deres salte | |
| DK146595C (da) | Analogifremgangsmaade til fremstilling af substituerede 9-alkoxymethyl- eller -alkylthiomethylpuriner eller salte heraf | |
| DK160099C (da) | Analogifremgangsmaade til fremstilling af optisk aktive eller racemiske 6-substituerede 2-penem-3-carboxylsyreforbindelser eller farmaceutisk anvendelige salte deraf | |
| DK151331C (da) | Analogifremgangsmaade til fremstilling af 5-pyridinyl-2(1h)-pyridinon-forbindelser eller farmaceutisk acceptable syreadditionssalte deraf | |
| DK163244C (da) | Analogifremgangsmaade til fremstilling af 7-oe2-(2-aminothiazol-4-yl)-2-oxyimino-acetamidoaa-ceph-3-em-4-carboxylsyrederivater eller fysiologisk acceptable salte deraf | |
| DK143755C (da) | Analogifremgangsmaade til fremstilling af peptidphosphonsyrederivater eller salte deraf | |
| DK149609C (da) | Analogifremgangsmaade til fremstilling af hydroxyamino-alkan- eller -alkenphosphonsyrederivater eller estere eller salte deraf | |
| DK157079C (da) | Fremgangsmaade til fremstilling af 7beta-amino-3-cephem-3-ol-4-carboxylsyreforbindelser eller salte deraf | |
| DK147940C (da) | Analogifremgangsmaade til fremstilling af 4-substituerede thiazol-2-oxamsyrederivater eller salte eller estre deraf | |
| DK145262C (da) | Analogifremgangsmaade til fremstilling af cephalosporansyrederivater og estere og salte deraf | |
| DK149230C (da) | Analogifremgangsmaade til fremstilling af 5-benzoyl-6-hydroxy-indan-1-carboxylsyrederivater eller farmaceutisk acceptable salte deraf | |
| DK149129C (da) | Fremgangsmaade til fremstilling af 6-(d-(-)alfa-amino-alfa-(p-hydroxyphenyl)acetamido)penicillansyre hydrat eller salte deraf | |
| DK159154C (da) | Fremgangsmaade til fremstilling af cephalosporinderivater eller salte deraf | |
| DK143278C (da) | Analogifremgangsmaade til fremstilling af n-(r-tetrahydrofurfuryl)-noroxymorphon eller syreadditionssalte deraf | |
| DK150197C (da) | Analogifremgangsmaade til fremstilling af 2-substituerede 1-aminoalkoximino-cycloalkaner eller et syreadditionssalt eller quaternaert ammoniumderivat deraf | |
| DK151810C (da) | Fremgangsmaade til fremstilling af cephalosporansyrederivater | |
| DK144973C (da) | Analogifremgangsmaade til fremstilling af 6-(d-2-(3-hydroxypyridazin-4-carbonamido)-2-(p-hydroxyphenyl)acetamido)penicillansyre eller salte deraf | |
| DK143844C (da) | Analogifremgangsmaade til fremstilling af alkanophenon-o-(2-aminoethyl)-oximetherforbindelser eller salte deraf | |
| DK146127C (da) | Analogifremgangsmaade til fremstilling af 5-(2-hydroxy-n-propoxy)-4-oxo-8-n-propyl-4h-1-benzopyran-2-carboxylsyre eller salte eller estre deraf | |
| DK147577C (da) | Analogifremgangsmaade til fremstilling af 2-phenyl-bicyclooctan- eller -octenaminer eller farmaceutisk acceptable syreadditionssalte deraf | |
| DK143405C (da) | Analogifremgangsmaade til fremstilling af 6-(2-aminomethylphenylacetamido)penicillansyre eller estere eller salte deraf | |
| DK147235C (da) | Analogifremgangsmaade til fremstilling af penicillin- eller cephalosporin-forbindelser eller farmaceutisk acceptable salte deraf | |
| DK142172C (da) | Analogifremgangsmaade til fremstilling af basisk substituerede2-alkylamino-4-phenylimidazoliner eller syreadditionssalte heraf |