ZA76850B - Novel penicillin and its preparation and use - Google Patents
Novel penicillin and its preparation and useInfo
- Publication number
- ZA76850B ZA76850B ZA850A ZA76850A ZA76850B ZA 76850 B ZA76850 B ZA 76850B ZA 850 A ZA850 A ZA 850A ZA 76850 A ZA76850 A ZA 76850A ZA 76850 B ZA76850 B ZA 76850B
- Authority
- ZA
- South Africa
- Prior art keywords
- preparation
- novel penicillin
- penicillin
- novel
- Prior art date
Links
- 229930182555 Penicillin Natural products 0.000 title 1
- JGSARLDLIJGVTE-MBNYWOFBSA-N Penicillin G Chemical compound N([C@H]1[C@H]2SC([C@@H](N2C1=O)C(O)=O)(C)C)C(=O)CC1=CC=CC=C1 JGSARLDLIJGVTE-MBNYWOFBSA-N 0.000 title 1
- 229940049954 penicillin Drugs 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D499/00—Heterocyclic compounds containing 4-thia-1-azabicyclo [3.2.0] heptane ring systems, i.e. compounds containing a ring system of the formula:, e.g. penicillins, penems; Such ring systems being further condensed, e.g. 2,3-condensed with an oxygen-, nitrogen- or sulfur-containing hetero ring
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Preparation Of Compounds By Using Micro-Organisms (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP50019040A JPS5195090A (en) | 1975-02-14 | 1975-02-14 | 66 * dd22 * 33 hidorokishipiridajin 44 karubokishiamido * 22 * paraahidorokishifueniru * asetoamido * penishiransanno seiho |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| ZA76850B true ZA76850B (en) | 1977-01-26 |
Family
ID=11988305
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| ZA850A ZA76850B (en) | 1975-02-14 | 1976-02-13 | Novel penicillin and its preparation and use |
Country Status (19)
| Country | Link |
|---|---|
| US (1) | US4046904A (en:Method) |
| JP (1) | JPS5195090A (en:Method) |
| AR (2) | AR211922A1 (en:Method) |
| AT (1) | AT343805B (en:Method) |
| BE (1) | BE838545R (en:Method) |
| CA (1) | CA1067893A (en:Method) |
| CH (1) | CH611625A5 (en:Method) |
| CS (2) | CS191999B2 (en:Method) |
| DD (1) | DD123607A5 (en:Method) |
| DE (1) | DE2605910A1 (en:Method) |
| DK (1) | DK144973C (en:Method) |
| ES (2) | ES445176A1 (en:Method) |
| FR (1) | FR2300565A2 (en:Method) |
| GB (1) | GB1507623A (en:Method) |
| MX (1) | MX3890E (en:Method) |
| NL (1) | NL7601409A (en:Method) |
| PL (1) | PL99090B1 (en:Method) |
| SE (1) | SE417517B (en:Method) |
| ZA (1) | ZA76850B (en:Method) |
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1465893A (en) * | 1973-02-09 | 1977-03-02 | Gist Brocades Nv | I-carboxypropenyl-4-iminothio-azetidine-2-one derivatives methods for their preparation and use |
| US4537886A (en) * | 1982-03-31 | 1985-08-27 | Beecham Group P.L.C. | β-lactam antibacterial agents and compositions containing them |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3864329A (en) * | 1970-12-29 | 1975-02-04 | Sumitomo Chemical Co | Penicillins substituted with heterocyclic groups |
| JPS5417754B2 (en:Method) * | 1972-12-15 | 1979-07-02 | ||
| JPS5751837B2 (en:Method) * | 1973-04-05 | 1982-11-04 |
-
1975
- 1975-02-14 JP JP50019040A patent/JPS5195090A/ja active Pending
-
1976
- 1976-01-16 AR AR262275A patent/AR211922A1/es active
- 1976-02-03 MX MX762397U patent/MX3890E/es unknown
- 1976-02-11 NL NL7601409A patent/NL7601409A/xx not_active Application Discontinuation
- 1976-02-12 DD DD191216A patent/DD123607A5/xx unknown
- 1976-02-12 GB GB5558/76A patent/GB1507623A/en not_active Expired
- 1976-02-13 US US05/658,035 patent/US4046904A/en not_active Expired - Lifetime
- 1976-02-13 BE BE164301A patent/BE838545R/xx active
- 1976-02-13 FR FR7604017A patent/FR2300565A2/fr active Pending
- 1976-02-13 DK DK60976A patent/DK144973C/da active
- 1976-02-13 ES ES445176A patent/ES445176A1/es not_active Expired
- 1976-02-13 DE DE19762605910 patent/DE2605910A1/de not_active Withdrawn
- 1976-02-13 SE SE7601640A patent/SE417517B/xx unknown
- 1976-02-13 AT AT102376A patent/AT343805B/de not_active IP Right Cessation
- 1976-02-13 CH CH180276A patent/CH611625A5/xx not_active IP Right Cessation
- 1976-02-13 ZA ZA850A patent/ZA76850B/xx unknown
- 1976-02-13 PL PL1976187216A patent/PL99090B1/pl unknown
- 1976-02-16 CA CA245,794A patent/CA1067893A/en not_active Expired
- 1976-02-16 CS CS763742A patent/CS191999B2/cs unknown
- 1976-02-16 CS CS76989A patent/CS191964B2/cs unknown
- 1976-09-24 AR AR264847A patent/AR211935A1/es active
-
1977
- 1977-05-13 ES ES458790A patent/ES458790A1/es not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| PL99090B1 (pl) | 1978-06-30 |
| NL7601409A (nl) | 1976-08-17 |
| SE417517B (sv) | 1981-03-23 |
| JPS5195090A (en) | 1976-08-20 |
| AR211922A1 (es) | 1978-04-14 |
| BE838545R (fr) | 1976-08-13 |
| ATA102376A (de) | 1977-10-15 |
| ES458790A1 (es) | 1978-03-01 |
| AT343805B (de) | 1978-06-26 |
| ES445176A1 (es) | 1977-10-01 |
| DD123607A5 (en:Method) | 1977-01-05 |
| AU1114676A (en) | 1977-08-25 |
| CA1067893A (en) | 1979-12-11 |
| MX3890E (es) | 1981-09-03 |
| DE2605910A1 (de) | 1976-08-26 |
| DK144973B (da) | 1982-07-19 |
| FR2300565A2 (fr) | 1976-09-10 |
| GB1507623A (en) | 1978-04-19 |
| DK144973C (da) | 1982-12-06 |
| CS191964B2 (en) | 1979-07-31 |
| CS191999B2 (en:Method) | 1979-07-31 |
| AR211935A1 (es) | 1978-04-14 |
| CH611625A5 (en:Method) | 1979-06-15 |
| SE7601640L (sv) | 1976-08-16 |
| DK60976A (da) | 1976-08-15 |
| US4046904A (en) | 1977-09-06 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| JPS52106877A (en) | Novel pyridinecarboxyamides and their preparation | |
| JPS51143667A (en) | 11substituted aralkylimidazoles and substituted arylcyanoalkylimidazoles and substituted diarylcyanoalkylimidazoles | |
| JPS5289662A (en) | Novel polyhalogenoosteroid and preparation thereof | |
| GB1538240A (en) | O-2-isocephem compounds and their preparation | |
| JPS54119473A (en) | Novel dibenzopyrane intermediate and its manufacture | |
| JPS5262399A (en) | Polyamideterpolymer and preparation thereof | |
| IL49516A (en) | 3-amino-4-deoxo-4-imino and amino-rifamycins and their preparation | |
| JPS51138609A (en) | 12222tetrafluoroethyll fluoromethilether and its preparation | |
| JPS51138626A (en) | Novel compound and preparation thereof | |
| JPS5253857A (en) | Novel oxazolidinee22one compound and preparation thereof | |
| IL50080A0 (en) | New azabicycloheptanes and their preparation | |
| JPS5419991A (en) | Novel penicillin compound*preparation and use thereof | |
| JPS51138667A (en) | Anthraquinoneebissamizine and preparation* | |
| JPS5212158A (en) | Epoxyandrostane and preparation thereof | |
| JPS51143630A (en) | Nnbenzyll2* 22dimethoxyyacetamide and preparation | |
| JPS5217454A (en) | Preparation and use of novel 22hydroxynaphthalinee 11aldehyde | |
| AU497053B2 (en) | Compounds and use thereof | |
| JPS5242801A (en) | Antibiotics aa3091 and preparation thereof | |
| ZA76850B (en) | Novel penicillin and its preparation and use | |
| JPS56103173A (en) | Novel dibenzopyrane intermediate and its manufacture | |
| JPS5259148A (en) | Novel ddhomosteroid and preparation thereof | |
| JPS51119096A (en) | Polyurethaneeelastmer and preparation thereof | |
| JPS51127064A (en) | Novel betaalactam antibiotics and intermediate and preparation thereof | |
| JPS5248679A (en) | Quinoxarinee1*44dioxides and use | |
| JPS51125330A (en) | Novel acetamidoximes* preparation thereof and medicine |