DK142105B - Fast phosphorsyrekatalysator og fremgangsmåde til dens fremstilling. - Google Patents
Fast phosphorsyrekatalysator og fremgangsmåde til dens fremstilling. Download PDFInfo
- Publication number
- DK142105B DK142105B DK344171AA DK344171A DK142105B DK 142105 B DK142105 B DK 142105B DK 344171A A DK344171A A DK 344171AA DK 344171 A DK344171 A DK 344171A DK 142105 B DK142105 B DK 142105B
- Authority
- DK
- Denmark
- Prior art keywords
- catalyst
- acid
- phosphoric acid
- approx
- preparation
- Prior art date
Links
- 239000003054 catalyst Substances 0.000 title description 42
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 title description 35
- 229910000147 aluminium phosphate Inorganic materials 0.000 title description 12
- 238000000034 method Methods 0.000 title description 11
- 239000007787 solid Substances 0.000 title description 10
- 238000002360 preparation method Methods 0.000 title description 5
- 239000002245 particle Substances 0.000 description 20
- 239000002253 acid Substances 0.000 description 17
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Chemical compound O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 17
- 235000011007 phosphoric acid Nutrition 0.000 description 16
- 239000000203 mixture Substances 0.000 description 14
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 12
- 238000001035 drying Methods 0.000 description 12
- 150000001336 alkenes Chemical class 0.000 description 10
- 230000000694 effects Effects 0.000 description 9
- 239000005909 Kieselgur Substances 0.000 description 8
- 238000011282 treatment Methods 0.000 description 8
- 238000006243 chemical reaction Methods 0.000 description 7
- 239000000463 material Substances 0.000 description 7
- 238000002156 mixing Methods 0.000 description 7
- 238000006116 polymerization reaction Methods 0.000 description 7
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 6
- 229910052698 phosphorus Inorganic materials 0.000 description 6
- 239000011574 phosphorus Substances 0.000 description 6
- YDHWWBZFRZWVHO-UHFFFAOYSA-N [hydroxy(phosphonooxy)phosphoryl] phosphono hydrogen phosphate Chemical compound OP(O)(=O)OP(O)(=O)OP(O)(=O)OP(O)(O)=O YDHWWBZFRZWVHO-UHFFFAOYSA-N 0.000 description 5
- 238000010438 heat treatment Methods 0.000 description 5
- 229930195733 hydrocarbon Natural products 0.000 description 5
- 150000002430 hydrocarbons Chemical class 0.000 description 5
- 239000007788 liquid Substances 0.000 description 5
- QQONPFPTGQHPMA-UHFFFAOYSA-N propylene Natural products CC=C QQONPFPTGQHPMA-UHFFFAOYSA-N 0.000 description 5
- 125000004805 propylene group Chemical group [H]C([H])([H])C([H])([*:1])C([H])([H])[*:2] 0.000 description 5
- 239000012808 vapor phase Substances 0.000 description 5
- 239000003463 adsorbent Substances 0.000 description 4
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 4
- XPPKVPWEQAFLFU-UHFFFAOYSA-N diphosphoric acid Chemical compound OP(O)(=O)OP(O)(O)=O XPPKVPWEQAFLFU-UHFFFAOYSA-N 0.000 description 4
- 239000007789 gas Substances 0.000 description 4
- JRZJOMJEPLMPRA-UHFFFAOYSA-N olefin Natural products CCCCCCCC=C JRZJOMJEPLMPRA-UHFFFAOYSA-N 0.000 description 4
- 239000001301 oxygen Substances 0.000 description 4
- 229910052760 oxygen Inorganic materials 0.000 description 4
- 229940005657 pyrophosphoric acid Drugs 0.000 description 4
- 239000011949 solid catalyst Substances 0.000 description 4
- DLYUQMMRRRQYAE-UHFFFAOYSA-N tetraphosphorus decaoxide Chemical compound O1P(O2)(=O)OP3(=O)OP1(=O)OP2(=O)O3 DLYUQMMRRRQYAE-UHFFFAOYSA-N 0.000 description 4
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 3
- 150000007513 acids Chemical class 0.000 description 3
- 150000001491 aromatic compounds Chemical class 0.000 description 3
- 238000001354 calcination Methods 0.000 description 3
- 230000018044 dehydration Effects 0.000 description 3
- 238000006297 dehydration reaction Methods 0.000 description 3
- 229920000137 polyphosphoric acid Polymers 0.000 description 3
- 239000004215 Carbon black (E152) Substances 0.000 description 2
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 2
- 230000003197 catalytic effect Effects 0.000 description 2
- 239000000470 constituent Substances 0.000 description 2
- 238000001125 extrusion Methods 0.000 description 2
- 150000002894 organic compounds Chemical class 0.000 description 2
- 150000002989 phenols Chemical class 0.000 description 2
- 229920001155 polypropylene Polymers 0.000 description 2
- 239000000377 silicon dioxide Substances 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- 125000000383 tetramethylene group Chemical group [H]C([H])([*:1])C([H])([H])C([H])([H])C([H])([H])[*:2] 0.000 description 2
- UNXRWKVEANCORM-UHFFFAOYSA-N triphosphoric acid Chemical compound OP(O)(=O)OP(O)(=O)OP(O)(O)=O UNXRWKVEANCORM-UHFFFAOYSA-N 0.000 description 2
- 229940048102 triphosphoric acid Drugs 0.000 description 2
- KVHHQGIIZCJATJ-UHFFFAOYSA-N 1-(4-chlorophenyl)-4-(dimethylamino)-2,3-dimethyl-2-butanol Chemical compound CN(C)CC(C)C(C)(O)CC1=CC=C(Cl)C=C1 KVHHQGIIZCJATJ-UHFFFAOYSA-N 0.000 description 1
- VXNZUUAINFGPBY-UHFFFAOYSA-N 1-Butene Chemical compound CCC=C VXNZUUAINFGPBY-UHFFFAOYSA-N 0.000 description 1
- VQTUBCCKSQIDNK-UHFFFAOYSA-N Isobutene Chemical group CC(C)=C VQTUBCCKSQIDNK-UHFFFAOYSA-N 0.000 description 1
- PWHULOQIROXLJO-UHFFFAOYSA-N Manganese Chemical compound [Mn] PWHULOQIROXLJO-UHFFFAOYSA-N 0.000 description 1
- QCWXUUIWCKQGHC-UHFFFAOYSA-N Zirconium Chemical compound [Zr] QCWXUUIWCKQGHC-UHFFFAOYSA-N 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 150000001299 aldehydes Chemical class 0.000 description 1
- 230000029936 alkylation Effects 0.000 description 1
- 238000005804 alkylation reaction Methods 0.000 description 1
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 1
- 239000000440 bentonite Substances 0.000 description 1
- 229910000278 bentonite Inorganic materials 0.000 description 1
- SVPXDRXYRYOSEX-UHFFFAOYSA-N bentoquatam Chemical compound O.O=[Si]=O.O=[Al]O[Al]=O SVPXDRXYRYOSEX-UHFFFAOYSA-N 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 125000002837 carbocyclic group Chemical group 0.000 description 1
- 239000006229 carbon black Substances 0.000 description 1
- 239000003575 carbonaceous material Substances 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 239000012876 carrier material Substances 0.000 description 1
- 239000003245 coal Substances 0.000 description 1
- 229910017052 cobalt Inorganic materials 0.000 description 1
- 239000010941 cobalt Substances 0.000 description 1
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 description 1
- 239000000571 coke Substances 0.000 description 1
- 239000002131 composite material Substances 0.000 description 1
- 238000006482 condensation reaction Methods 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 238000005520 cutting process Methods 0.000 description 1
- 150000001923 cyclic compounds Chemical class 0.000 description 1
- 230000007423 decrease Effects 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 239000010439 graphite Substances 0.000 description 1
- 229910002804 graphite Inorganic materials 0.000 description 1
- BHEPBYXIRTUNPN-UHFFFAOYSA-N hydridophosphorus(.) (triplet) Chemical compound [PH] BHEPBYXIRTUNPN-UHFFFAOYSA-N 0.000 description 1
- 238000005647 hydrohalogenation reaction Methods 0.000 description 1
- 239000011261 inert gas Substances 0.000 description 1
- 238000006317 isomerization reaction Methods 0.000 description 1
- 239000007791 liquid phase Substances 0.000 description 1
- 229910052748 manganese Inorganic materials 0.000 description 1
- 239000011572 manganese Substances 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- 229910052759 nickel Inorganic materials 0.000 description 1
- ZQPPMHVWECSIRJ-KTKRTIGZSA-N oleic acid group Chemical group C(CCCCCCC\C=C/CCCCCCCC)(=O)O ZQPPMHVWECSIRJ-KTKRTIGZSA-N 0.000 description 1
- 238000006053 organic reaction Methods 0.000 description 1
- 239000012071 phase Substances 0.000 description 1
- 150000003017 phosphorus Chemical class 0.000 description 1
- 125000003367 polycyclic group Chemical group 0.000 description 1
- 239000002685 polymerization catalyst Substances 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 150000004760 silicates Chemical class 0.000 description 1
- 239000002689 soil Substances 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 229910052726 zirconium Inorganic materials 0.000 description 1
Classifications
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B01—PHYSICAL OR CHEMICAL PROCESSES OR APPARATUS IN GENERAL
- B01J—CHEMICAL OR PHYSICAL PROCESSES, e.g. CATALYSIS OR COLLOID CHEMISTRY; THEIR RELEVANT APPARATUS
- B01J27/00—Catalysts comprising the elements or compounds of halogens, sulfur, selenium, tellurium, phosphorus or nitrogen; Catalysts comprising carbon compounds
- B01J27/14—Phosphorus; Compounds thereof
- B01J27/16—Phosphorus; Compounds thereof containing oxygen, i.e. acids, anhydrides and their derivates with N, S, B or halogens without carriers or on carriers based on C, Si, Al or Zr; also salts of Si, Al and Zr
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C2/00—Preparation of hydrocarbons from hydrocarbons containing a smaller number of carbon atoms
- C07C2/02—Preparation of hydrocarbons from hydrocarbons containing a smaller number of carbon atoms by addition between unsaturated hydrocarbons
- C07C2/04—Preparation of hydrocarbons from hydrocarbons containing a smaller number of carbon atoms by addition between unsaturated hydrocarbons by oligomerisation of well-defined unsaturated hydrocarbons without ring formation
- C07C2/06—Preparation of hydrocarbons from hydrocarbons containing a smaller number of carbon atoms by addition between unsaturated hydrocarbons by oligomerisation of well-defined unsaturated hydrocarbons without ring formation of alkenes, i.e. acyclic hydrocarbons having only one carbon-to-carbon double bond
- C07C2/08—Catalytic processes
- C07C2/14—Catalytic processes with inorganic acids; with salts or anhydrides of acids
- C07C2/18—Acids of phosphorus; Salts thereof; Phosphorus oxides
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C2527/00—Catalysts comprising the elements or compounds of halogens, sulfur, selenium, tellurium, phosphorus or nitrogen; Catalysts comprising carbon compounds
- C07C2527/14—Phosphorus; Compounds thereof
- C07C2527/16—Phosphorus; Compounds thereof containing oxygen
- C07C2527/167—Phosphates or other compounds comprising the anion (PnO3n+1)(n+2)-
- C07C2527/173—Phosphoric acid or other acids with the formula Hn+2PnO3n+1
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Inorganic Chemistry (AREA)
- Engineering & Computer Science (AREA)
- Materials Engineering (AREA)
- Catalysts (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Transition And Organic Metals Composition Catalysts For Addition Polymerization (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US5461270A | 1970-07-13 | 1970-07-13 | |
| US5461270 | 1970-07-13 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DK142105B true DK142105B (da) | 1980-09-01 |
| DK142105C DK142105C (enExample) | 1981-01-26 |
Family
ID=21992298
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DK344171AA DK142105B (da) | 1970-07-13 | 1971-07-12 | Fast phosphorsyrekatalysator og fremgangsmåde til dens fremstilling. |
Country Status (14)
| Country | Link |
|---|---|
| US (1) | US3673111A (enExample) |
| JP (1) | JPS5412432B1 (enExample) |
| CA (1) | CA959819A (enExample) |
| DK (1) | DK142105B (enExample) |
| ES (1) | ES393151A1 (enExample) |
| FI (1) | FI57356C (enExample) |
| FR (1) | FR2101590A5 (enExample) |
| GB (1) | GB1347074A (enExample) |
| NL (1) | NL171539C (enExample) |
| RO (1) | RO61741A (enExample) |
| SE (1) | SE374497B (enExample) |
| SU (1) | SU413658A3 (enExample) |
| YU (1) | YU34491B (enExample) |
| ZA (1) | ZA714486B (enExample) |
Families Citing this family (21)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3846337A (en) * | 1972-07-20 | 1974-11-05 | Union Oil Co | Phosphate-silica-aluminosilicate compositions of improved crushing strength and methods of preparing the same |
| US4038211A (en) * | 1973-12-17 | 1977-07-26 | National Distillers And Chemical Corporation | Olefin hydration catalyst |
| US4329520A (en) * | 1980-03-21 | 1982-05-11 | Union Carbide Corporation | Process and catalyst for olefin hydration |
| US4392986A (en) * | 1981-10-08 | 1983-07-12 | Exxon Research & Engineering Co. | Catalyst for carboxylic anhydride production |
| WO1983001911A1 (en) * | 1981-12-02 | 1983-06-09 | Exxon Research Engineering Co | Catalyst carboxylic anhydride production |
| US4384157A (en) * | 1982-03-31 | 1983-05-17 | Uop Inc. | Catalytic condensation process with propane product stream |
| US4487632A (en) * | 1983-08-11 | 1984-12-11 | Stauffer Chemical Company | Fast-setting cements from liquid waste phosphorus pentoxide containing materials |
| US4755227A (en) * | 1983-08-11 | 1988-07-05 | Stauffer Chemical Company | Production of solid phosphorus pentioxide containing materials for fast-setting cements |
| US4505752A (en) * | 1983-08-11 | 1985-03-19 | Stauffer Chemical Company | Fast-setting cements from solid phosphorus pentoxide containing materials |
| US4717708A (en) * | 1983-12-27 | 1988-01-05 | Stauffer Chemical Company | Inorganic oxide aerogels and their preparation |
| US4619908A (en) * | 1984-12-24 | 1986-10-28 | Stauffer Chemical Company | Non-aged inorganic oxide-containing aerogels and their preparation |
| US4931097A (en) * | 1985-10-15 | 1990-06-05 | Rhone-Poulenc Basic Chemicals Co. | Process for preparing activators for fast-setting cements |
| US4806165A (en) * | 1985-10-15 | 1989-02-21 | Stauffer Chemical Company | Preparation of activators for fast-setting cements |
| US5059737A (en) * | 1988-12-23 | 1991-10-22 | Uop | Catalytic condensation process |
| US4946815A (en) * | 1988-12-23 | 1990-08-07 | Uop | Solid phosphoric acid catalyst |
| US4912279A (en) * | 1988-12-29 | 1990-03-27 | Uop | Solid phosphoric acid catalyst |
| US5097085A (en) * | 1990-07-12 | 1992-03-17 | Texaco Chemical Company | Process for oligomerizing olefins using phosphorous-containing acid on montmorillonite clay |
| US5191130A (en) * | 1991-12-16 | 1993-03-02 | Texaco Chemical Company | Process for oligomerizing olefins using halogenated phosphorous-containing acid on montmorillonite clay |
| FR2860733B1 (fr) * | 2003-10-13 | 2006-10-27 | Inst Francais Du Petrole | Methode de pretraitement de catalyseurs a base d'acide phosphorique |
| JP4366338B2 (ja) * | 2004-07-16 | 2009-11-18 | 新日本石油株式会社 | 固体リン酸触媒およびそれを用いたオレフィンの二量化方法 |
| GB0921451D0 (en) | 2009-12-08 | 2010-01-20 | Univ St Andrews | Membrane |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2231452A (en) * | 1939-10-16 | 1941-02-11 | Universal Oil Prod Co | Treatment of paraffin hydrocarbons |
| US2275182A (en) * | 1940-06-20 | 1942-03-03 | Universal Oil Prod Co | Manufacture of catalysts |
| US3213036A (en) * | 1963-09-20 | 1965-10-19 | Jacque C Morrell | Phosphorus cotaining polymerization catalyst |
-
1970
- 1970-07-13 US US54612A patent/US3673111A/en not_active Expired - Lifetime
-
1971
- 1971-07-07 ZA ZA714486A patent/ZA714486B/xx unknown
- 1971-07-08 FI FI1946/71A patent/FI57356C/fi active
- 1971-07-10 ES ES393151A patent/ES393151A1/es not_active Expired
- 1971-07-12 FR FR7125501A patent/FR2101590A5/fr not_active Expired
- 1971-07-12 RO RO67625A patent/RO61741A/ro unknown
- 1971-07-12 YU YU1821/71A patent/YU34491B/xx unknown
- 1971-07-12 SE SE7109017A patent/SE374497B/xx unknown
- 1971-07-12 CA CA117,974A patent/CA959819A/en not_active Expired
- 1971-07-12 GB GB3258371A patent/GB1347074A/en not_active Expired
- 1971-07-12 DK DK344171AA patent/DK142105B/da not_active IP Right Cessation
- 1971-07-12 SU SU1684118A patent/SU413658A3/ru active
- 1971-07-13 JP JP5150271A patent/JPS5412432B1/ja active Pending
- 1971-07-13 NL NLAANVRAGE7109634,A patent/NL171539C/xx not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| GB1347074A (en) | 1974-02-13 |
| JPS5412432B1 (enExample) | 1979-05-23 |
| YU182171A (en) | 1979-02-28 |
| US3673111A (en) | 1972-06-27 |
| CA959819A (en) | 1974-12-24 |
| NL171539B (nl) | 1982-11-16 |
| DK142105C (enExample) | 1981-01-26 |
| SU413658A3 (enExample) | 1974-01-30 |
| RO61741A (enExample) | 1977-03-15 |
| ES393151A1 (es) | 1973-09-16 |
| NL171539C (nl) | 1983-04-18 |
| NL7109634A (enExample) | 1972-01-17 |
| FI57356C (fi) | 1980-08-11 |
| SE374497B (enExample) | 1975-03-10 |
| FR2101590A5 (enExample) | 1972-03-31 |
| DE2134153A1 (de) | 1972-01-20 |
| DE2134153B2 (de) | 1976-01-22 |
| ZA714486B (en) | 1972-03-29 |
| YU34491B (en) | 1979-09-10 |
| FI57356B (fi) | 1980-04-30 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DK142105B (da) | Fast phosphorsyrekatalysator og fremgangsmåde til dens fremstilling. | |
| Kumar et al. | SBA-15 supported HPW: Effective catalytic performance in the alkylation of phenol | |
| CN104411402B (zh) | 用于在流化催化裂化中增产丙烯的催化剂 | |
| CN102548656B (zh) | 含磷沸石催化剂及其制备方法 | |
| US4727209A (en) | Hydrocarbon alkylation processes employing a phosphorus-modified alumina composite | |
| CA2022583C (en) | Solid crystalline phosphoric acid hydrocarbon conversion catalyst | |
| AU622002B2 (en) | Porous solid phosphoric acid catalyst system and process using same | |
| US2275182A (en) | Manufacture of catalysts | |
| US2656323A (en) | Manufacture of phosphoric acidgroup iv metal oxide containing catalyst | |
| US2748090A (en) | Manufacture of solid polymerization catalysts | |
| US2650201A (en) | Production of phosphoric acid catalyst | |
| US2586852A (en) | Kaolin-phosphoric acid polymerization catalyst | |
| US2833727A (en) | Manufacture of solid phosphoric acid catalysts | |
| US3112350A (en) | Polymerization of olefins using a solid phosphoric acid catalyst | |
| US3044964A (en) | Catalyst and process of making the same | |
| US2575457A (en) | Preparation of phosphoric acid catalyst on a precalcined silico-phosphoric acid base | |
| US2596497A (en) | Process of strengthening a calcined supported phosphoric acid catalyst | |
| US2447599A (en) | Methylation of aromatic hydrocarbons | |
| US2713560A (en) | Catalyst and methods of making same | |
| US3201486A (en) | Alkylation of alkylatable organic compounds | |
| JPH0657664B2 (ja) | アルデヒドからのジエンの製造方法 | |
| US2772244A (en) | Titanium-phosphorus catalyst | |
| US5059737A (en) | Catalytic condensation process | |
| US2871199A (en) | Manufacture of solid phosphoric acid catalysts | |
| US2704747A (en) | Production of catalysts |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PBP | Patent lapsed |