DK141681B - Separationsapparat med plane, semipermeable membraner. - Google Patents
Separationsapparat med plane, semipermeable membraner. Download PDFInfo
- Publication number
- DK141681B DK141681B DK87072AA DK87072A DK141681B DK 141681 B DK141681 B DK 141681B DK 87072A A DK87072A A DK 87072AA DK 87072 A DK87072 A DK 87072A DK 141681 B DK141681 B DK 141681B
- Authority
- DK
- Denmark
- Prior art keywords
- plates
- plate
- support
- liquid
- membrane
- Prior art date
Links
- 239000012528 membrane Substances 0.000 title description 39
- 239000007788 liquid Substances 0.000 description 26
- 239000000853 adhesive Substances 0.000 description 3
- 230000001070 adhesive effect Effects 0.000 description 3
- -1 polyethylene Polymers 0.000 description 3
- 238000000926 separation method Methods 0.000 description 3
- 238000000108 ultra-filtration Methods 0.000 description 3
- 239000004698 Polyethylene Substances 0.000 description 2
- 239000012530 fluid Substances 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- 238000000465 moulding Methods 0.000 description 2
- 229920003023 plastic Polymers 0.000 description 2
- 239000004033 plastic Substances 0.000 description 2
- 229920000573 polyethylene Polymers 0.000 description 2
- 238000011084 recovery Methods 0.000 description 2
- 241000334937 Hypsypops rubicundus Species 0.000 description 1
- 239000002202 Polyethylene glycol Substances 0.000 description 1
- 239000002390 adhesive tape Substances 0.000 description 1
- 239000013060 biological fluid Substances 0.000 description 1
- 238000004891 communication Methods 0.000 description 1
- 238000010276 construction Methods 0.000 description 1
- 238000007599 discharging Methods 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 238000003780 insertion Methods 0.000 description 1
- 230000037431 insertion Effects 0.000 description 1
- 235000021056 liquid food Nutrition 0.000 description 1
- 229920001223 polyethylene glycol Polymers 0.000 description 1
- 239000004800 polyvinyl chloride Substances 0.000 description 1
- 229920000915 polyvinyl chloride Polymers 0.000 description 1
- 238000001223 reverse osmosis Methods 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- KKEYFWRCBNTPAC-UHFFFAOYSA-L terephthalate(2-) Chemical compound [O-]C(=O)C1=CC=C(C([O-])=O)C=C1 KKEYFWRCBNTPAC-UHFFFAOYSA-L 0.000 description 1
Classifications
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B01—PHYSICAL OR CHEMICAL PROCESSES OR APPARATUS IN GENERAL
- B01D—SEPARATION
- B01D61/00—Processes of separation using semi-permeable membranes, e.g. dialysis, osmosis or ultrafiltration; Apparatus, accessories or auxiliary operations specially adapted therefor
- B01D61/14—Ultrafiltration; Microfiltration
- B01D61/18—Apparatus therefor
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B01—PHYSICAL OR CHEMICAL PROCESSES OR APPARATUS IN GENERAL
- B01D—SEPARATION
- B01D63/00—Apparatus in general for separation processes using semi-permeable membranes
- B01D63/08—Flat membrane modules
- B01D63/082—Flat membrane modules comprising a stack of flat membranes
- B01D63/0822—Plate-and-frame devices
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B01—PHYSICAL OR CHEMICAL PROCESSES OR APPARATUS IN GENERAL
- B01D—SEPARATION
- B01D2313/00—Details relating to membrane modules or apparatus
- B01D2313/08—Flow guidance means within the module or the apparatus
Landscapes
- Engineering & Computer Science (AREA)
- Water Supply & Treatment (AREA)
- Chemical & Material Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Separation Using Semi-Permeable Membranes (AREA)
- Filtration Of Liquid (AREA)
Applications Claiming Priority (4)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| FR7106493A FR2127155A5 (en) | 1971-02-25 | 1971-02-25 | Plate-type ultra-filter - with semi-permeable membranes |
| FR7106493 | 1971-02-25 | ||
| FR7119774 | 1971-06-01 | ||
| FR717119774A FR2141417B2 (esLanguage) | 1971-02-25 | 1971-06-01 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DK141681B true DK141681B (da) | 1980-05-27 |
| DK141681C DK141681C (esLanguage) | 1980-10-20 |
Family
ID=26216226
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DK87072AA DK141681B (da) | 1971-02-25 | 1972-02-24 | Separationsapparat med plane, semipermeable membraner. |
Country Status (16)
| Country | Link |
|---|---|
| US (1) | US3831763A (esLanguage) |
| JP (1) | JPS5210113B1 (esLanguage) |
| BE (1) | BE779814A (esLanguage) |
| CA (1) | CA999531A (esLanguage) |
| CH (1) | CH545123A (esLanguage) |
| DE (1) | DE2209116C3 (esLanguage) |
| DK (1) | DK141681B (esLanguage) |
| ES (1) | ES400178A1 (esLanguage) |
| FR (1) | FR2141417B2 (esLanguage) |
| GB (1) | GB1362302A (esLanguage) |
| IL (1) | IL38833A (esLanguage) |
| IT (1) | IT947929B (esLanguage) |
| LU (1) | LU64836A1 (esLanguage) |
| NL (1) | NL7202108A (esLanguage) |
| NO (1) | NO133575C (esLanguage) |
| SE (1) | SE370018B (esLanguage) |
Families Citing this family (20)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3834544A (en) * | 1971-07-06 | 1974-09-10 | Cutter Lab | Membrane diffusion apparatus |
| GB1292421A (en) * | 1972-02-02 | 1972-10-11 | Sam Ellison Smith | Improvements in or relating to a method for fabricating a seamless plastic surface and a template therefor |
| FR2231411B1 (esLanguage) * | 1973-05-29 | 1978-06-30 | Rhone Poulenc Sa | |
| FR2236538B1 (esLanguage) * | 1973-07-11 | 1976-05-07 | Rhone Poulenc Ind | |
| US3984324A (en) * | 1973-10-11 | 1976-10-05 | Aqua-Chem, Inc. | Multiple plate ultrafilter |
| US4289623A (en) * | 1975-11-05 | 1981-09-15 | Extracorporeal Medical Specialties, Inc. | Hollow fiber dialysis |
| FR2392696A1 (fr) * | 1977-06-02 | 1978-12-29 | Rhone Poulenc Ind | Dispositif pour la fixation etanche de membranes semi-permeables sur chaque plaque-support d'un appareil separateur |
| US4430218A (en) | 1980-07-18 | 1984-02-07 | Sartorius Gmbh | Separating device for fluids, consisting of support plates and cut sections of a semi-permeable diaphragm |
| DE3127475A1 (de) * | 1980-07-19 | 1982-04-22 | Sartorius GmbH, 3400 Göttingen | Aus traegerplatten und membranzuschnitten einer semipermeablen membran bestehende trennvorrichtung fuer f luide |
| DE3206864A1 (de) * | 1982-02-26 | 1983-09-15 | Helmut Dr.-Ing. Michele | Plattenapparat zur permeationstrennung von fluiden |
| US4801381A (en) * | 1986-06-16 | 1989-01-31 | Niesen Lawrence J | Ultrafiltration apparatus |
| US4997565A (en) * | 1986-06-16 | 1991-03-05 | Niesen Lawrence J | Laboratory scale ultrafiltration apparatus |
| US5049268A (en) * | 1987-10-02 | 1991-09-17 | Kopf Henry B | Filter plate, filter plate element, and filter comprising same |
| DE8813974U1 (de) * | 1988-11-08 | 1988-12-22 | Albert Handtmann Armaturenfabrik GmbH & Co KG, 7950 Biberach | Filtervorrichtung zum Filtern von Flüssigkeiten, insbesondere Getränken |
| US5192434A (en) * | 1990-06-07 | 1993-03-09 | Dow Danmark A/S | Membrane filtration apparatus and method of making a membrane filtration unit |
| DE4225060C1 (esLanguage) * | 1992-07-29 | 1993-09-23 | Deutsche Carbone Ag, 6680 Neunkirchen, De | |
| USD497660S1 (en) | 2003-02-27 | 2004-10-26 | Hydrotech Nils-Ake Persson Aktiebolag | Module for construction of a rotary disc filter |
| DE202006012948U1 (de) * | 2006-08-23 | 2008-01-03 | Mann + Hummel Gmbh | Filtereinheit und Filtervorrichtung zur Reinigung eines Fluids |
| EP2319610B1 (en) * | 2006-12-11 | 2012-06-27 | Pall Corporation | Filtration assemblies and methods of installing filtration units in filtration assemblies |
| WO2019219131A2 (de) * | 2018-05-16 | 2019-11-21 | Solarspring Gmbh | Plattenmodul zur membrandestillation |
Family Cites Families (17)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE30487C (de) * | J. SUKUP und A. WAGNER in Napagedl (Mähren) | Neuerung an Osmoseapparaten | ||
| AT8790B (de) * | 1899-05-06 | 1902-08-25 | Ludwig Fuchs | Zwischenplatten für Osmose-Apparate. |
| US3219573A (en) * | 1959-10-15 | 1965-11-23 | American Mach & Foundry | Multiple chamber electrodialysis apparatus |
| US3412865A (en) * | 1964-11-16 | 1968-11-26 | John F. Lontz | Artificial kidney |
| DE1285406B (de) * | 1965-06-16 | 1968-12-12 | Leybold Hochvakuum Anlagen Gmb | Gefriertrockner fuer fluessiges oder pastoeses Gut |
| US3397785A (en) * | 1965-07-20 | 1968-08-20 | Aerojet General Co | Water purifying apparatus employing stacked assembly of reverse osmosis cells |
| GB1132164A (en) * | 1965-12-10 | 1968-10-30 | Kimura Entetsu Kagaku Kikai Co | A method for recovering an electrolyte from a highly viscous solution by dialysis, and apparatus therefor |
| US3398091A (en) * | 1966-08-09 | 1968-08-20 | Ionics | Membrane separation apparatus and process |
| US3398833A (en) * | 1966-09-09 | 1968-08-27 | Aerojet General Co | Support plates for reverse osmosis desalination apparatus |
| US3398834A (en) * | 1966-10-10 | 1968-08-27 | Aerojet General Co | Reverse osmosis water purification apparatus and cell therefor |
| US3501010A (en) * | 1967-01-12 | 1970-03-17 | Eastman Kodak Co | Dialyzing apparatus and method of making the same |
| DE1611066C3 (de) * | 1967-12-05 | 1975-08-07 | Behringwerke Ag, 3550 Marburg | Vorrichtung zur Ultrafiltration |
| US3494469A (en) * | 1968-01-02 | 1970-02-10 | North American Rockwell | Reverse osmosis system |
| US3520803A (en) * | 1968-12-24 | 1970-07-21 | Ionics | Membrane fluid separation apparatus and process |
| US3560377A (en) * | 1969-01-21 | 1971-02-02 | Amicon Corp | Apparatus and process for filtering fluids |
| GB1268397A (en) * | 1969-06-13 | 1972-03-29 | Apv Co Ltd | Improvements in or relating to the concentration of liquids |
| DE7022655U (de) * | 1970-06-16 | 1970-09-24 | Sartorius-Membranfilter Gmbh | Filtrationsgeraet |
-
1971
- 1971-06-01 FR FR717119774A patent/FR2141417B2/fr not_active Expired
-
1972
- 1972-02-17 NL NL7202108A patent/NL7202108A/xx unknown
- 1972-02-23 CA CA135,426A patent/CA999531A/fr not_active Expired
- 1972-02-24 LU LU64836D patent/LU64836A1/xx unknown
- 1972-02-24 CH CH265272A patent/CH545123A/fr not_active IP Right Cessation
- 1972-02-24 JP JP47019340A patent/JPS5210113B1/ja active Pending
- 1972-02-24 SE SE02306/72A patent/SE370018B/xx unknown
- 1972-02-24 DK DK87072AA patent/DK141681B/da unknown
- 1972-02-24 NO NO578/72A patent/NO133575C/no unknown
- 1972-02-24 BE BE779814A patent/BE779814A/xx not_active IP Right Cessation
- 1972-02-24 US US00228887A patent/US3831763A/en not_active Expired - Lifetime
- 1972-02-24 IL IL38833A patent/IL38833A/xx unknown
- 1972-02-25 IT IT21069/72A patent/IT947929B/it active
- 1972-02-25 ES ES400178A patent/ES400178A1/es not_active Expired
- 1972-02-25 GB GB883272A patent/GB1362302A/en not_active Expired
- 1972-02-25 DE DE2209116A patent/DE2209116C3/de not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| CA999531A (fr) | 1976-11-09 |
| NL7202108A (esLanguage) | 1972-08-29 |
| DK141681C (esLanguage) | 1980-10-20 |
| DE2209116C3 (de) | 1986-07-31 |
| GB1362302A (en) | 1974-08-07 |
| IT947929B (it) | 1973-05-30 |
| IL38833A0 (en) | 1972-04-27 |
| FR2141417A2 (esLanguage) | 1973-01-26 |
| BE779814A (fr) | 1972-08-24 |
| AU3941072A (en) | 1973-08-30 |
| DE2209116A1 (de) | 1972-09-07 |
| NO133575B (esLanguage) | 1976-02-16 |
| JPS5210113B1 (esLanguage) | 1977-03-22 |
| CH545123A (fr) | 1973-12-15 |
| LU64836A1 (esLanguage) | 1972-12-05 |
| NO133575C (esLanguage) | 1976-05-26 |
| SE370018B (esLanguage) | 1974-09-30 |
| IL38833A (en) | 1975-05-22 |
| ES400178A1 (es) | 1975-07-01 |
| US3831763A (en) | 1974-08-27 |
| FR2141417B2 (esLanguage) | 1973-06-29 |
| DE2209116B2 (de) | 1980-02-14 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DK141681B (da) | Separationsapparat med plane, semipermeable membraner. | |
| CN105226311B (zh) | 加湿装置 | |
| US4715955A (en) | Ultrafiltration apparatus | |
| US4801381A (en) | Ultrafiltration apparatus | |
| DK141685B (da) | Apparat til separation af fluida. | |
| JP2015512332A5 (esLanguage) | ||
| GB2218352A (en) | Cross-flow filtration | |
| DK146704B (da) | Apparat til ultrafiltrering | |
| NO751427L (esLanguage) | ||
| KR101760980B1 (ko) | 여과장치 | |
| CN112823051A (zh) | 间距紧密的平板状浸没式膜和细气泡曝气 | |
| KR101299458B1 (ko) | 판상의 무-프레임 여과부재 | |
| US3980564A (en) | Membrane support-plates for fluid separating apparatus and apparatus using such support-plates | |
| US3965012A (en) | Membrane separation apparatus | |
| US3979297A (en) | Membrane support-plates for fluid separating apparatus and apparatus using such support-plates | |
| US6893563B2 (en) | Cross-flow filter with self-regulating transmembrane pressure | |
| US3534860A (en) | Pressure seal-manifold unit | |
| EP0078667A2 (en) | Apparatus for separating a liquid into two fractions by means of semipermeable membranes | |
| JP6479962B2 (ja) | 膜分離装置 | |
| US20140175003A1 (en) | Filtration module including hollow fiber supports | |
| US8764982B2 (en) | Membrane separation device | |
| USRE30632E (en) | Separation apparatus | |
| JP5935982B2 (ja) | 浸漬型膜分離装置 | |
| JP5473193B2 (ja) | 膜カートリッジ | |
| JP5442073B2 (ja) | 膜カートリッジ |