DK141201B - Analogifremgangsmåde til fremstilling af derivater af pyranoindol, oxazinoindol og indenopyran samt deres thioanaloge eller syreadditionssalte deraf. - Google Patents
Analogifremgangsmåde til fremstilling af derivater af pyranoindol, oxazinoindol og indenopyran samt deres thioanaloge eller syreadditionssalte deraf. Download PDFInfo
- Publication number
- DK141201B DK141201B DK20973AA DK20973A DK141201B DK 141201 B DK141201 B DK 141201B DK 20973A A DK20973A A DK 20973AA DK 20973 A DK20973 A DK 20973A DK 141201 B DK141201 B DK 141201B
- Authority
- DK
- Denmark
- Prior art keywords
- formula
- compound
- indole
- acid
- methyl
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims description 88
- 239000002253 acid Substances 0.000 title claims description 47
- 230000008569 process Effects 0.000 title claims description 35
- 238000002360 preparation method Methods 0.000 title claims description 28
- TXSPITKKVMLDDL-UHFFFAOYSA-N pyrrolo[2,3-f][2,1]benzoxazine Chemical compound C1=CC2=NOC=CC2=C2C1=CC=N2 TXSPITKKVMLDDL-UHFFFAOYSA-N 0.000 title claims description 7
- UCHFDMKGRKDMAZ-UHFFFAOYSA-N indeno[2,1-b]pyran Chemical compound C1=COC2=CC3=CC=CC=C3C2=C1 UCHFDMKGRKDMAZ-UHFFFAOYSA-N 0.000 title claims description 5
- ABPJREHLAYHTHW-UHFFFAOYSA-N pyrano[2,3-g]indole Chemical class O1C=CC=C2C3=NC=CC3=CC=C21 ABPJREHLAYHTHW-UHFFFAOYSA-N 0.000 title claims description 3
- 150000003839 salts Chemical class 0.000 title description 38
- 150000001875 compounds Chemical class 0.000 claims description 254
- -1 piperidino, morpholino, piperazino Chemical group 0.000 claims description 84
- 125000000217 alkyl group Chemical group 0.000 claims description 50
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 claims description 34
- 150000001412 amines Chemical class 0.000 claims description 29
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 27
- 150000001408 amides Chemical class 0.000 claims description 25
- 229910052739 hydrogen Inorganic materials 0.000 claims description 25
- 229910052757 nitrogen Inorganic materials 0.000 claims description 24
- 239000001257 hydrogen Substances 0.000 claims description 22
- 239000003054 catalyst Substances 0.000 claims description 21
- 230000002378 acidificating effect Effects 0.000 claims description 14
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 13
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 12
- 125000000051 benzyloxy group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])O* 0.000 claims description 10
- 150000004820 halides Chemical class 0.000 claims description 10
- 239000003795 chemical substances by application Substances 0.000 claims description 9
- 229910052736 halogen Inorganic materials 0.000 claims description 9
- 230000029936 alkylation Effects 0.000 claims description 7
- 238000005804 alkylation reaction Methods 0.000 claims description 7
- 125000004432 carbon atom Chemical group C* 0.000 claims description 7
- 150000008064 anhydrides Chemical class 0.000 claims description 6
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 6
- 229910052700 potassium Inorganic materials 0.000 claims description 6
- 150000002367 halogens Chemical class 0.000 claims description 5
- 239000003638 chemical reducing agent Substances 0.000 claims description 4
- 150000002431 hydrogen Chemical class 0.000 claims description 4
- 230000003301 hydrolyzing effect Effects 0.000 claims description 4
- 150000003138 primary alcohols Chemical class 0.000 claims description 4
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 claims description 3
- FZFAMSAMCHXGEF-UHFFFAOYSA-N chloro formate Chemical compound ClOC=O FZFAMSAMCHXGEF-UHFFFAOYSA-N 0.000 claims description 3
- 230000002140 halogenating effect Effects 0.000 claims description 3
- 125000004214 1-pyrrolidinyl group Chemical group [H]C1([H])N(*)C([H])([H])C([H])([H])C1([H])[H] 0.000 claims description 2
- 125000003545 alkoxy group Chemical group 0.000 claims description 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims 1
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 191
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 144
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 132
- 239000007858 starting material Substances 0.000 description 104
- 239000000203 mixture Substances 0.000 description 92
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 90
- 239000000243 solution Substances 0.000 description 84
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 76
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 58
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 57
- 150000002148 esters Chemical class 0.000 description 46
- 239000000047 product Substances 0.000 description 46
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 40
- HEMHJVSKTPXQMS-UHFFFAOYSA-M sodium hydroxide Inorganic materials [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 39
- SIKJAQJRHWYJAI-UHFFFAOYSA-N Indole Chemical compound C1=CC=C2NC=CC2=C1 SIKJAQJRHWYJAI-UHFFFAOYSA-N 0.000 description 38
- HEDRZPFGACZZDS-MICDWDOJSA-N Trichloro(2H)methane Chemical compound [2H]C(Cl)(Cl)Cl HEDRZPFGACZZDS-MICDWDOJSA-N 0.000 description 38
- 239000011734 sodium Substances 0.000 description 38
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 38
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 34
- 239000011541 reaction mixture Substances 0.000 description 34
- 239000000543 intermediate Substances 0.000 description 33
- 239000003921 oil Substances 0.000 description 32
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 30
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 30
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 28
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 27
- 239000012280 lithium aluminium hydride Substances 0.000 description 26
- 238000006243 chemical reaction Methods 0.000 description 25
- KZMGYPLQYOPHEL-UHFFFAOYSA-N Boron trifluoride etherate Chemical compound FB(F)F.CCOCC KZMGYPLQYOPHEL-UHFFFAOYSA-N 0.000 description 24
- 238000003756 stirring Methods 0.000 description 24
- MBBOMCVGYCRMEA-UHFFFAOYSA-N tryptophol Chemical compound C1=CC=C2C(CCO)=CNC2=C1 MBBOMCVGYCRMEA-UHFFFAOYSA-N 0.000 description 24
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 23
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 22
- 238000010992 reflux Methods 0.000 description 22
- 239000002904 solvent Substances 0.000 description 22
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 21
- 239000007864 aqueous solution Substances 0.000 description 20
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 19
- 239000000706 filtrate Substances 0.000 description 19
- PZOUSPYUWWUPPK-UHFFFAOYSA-N indole Natural products CC1=CC=CC2=C1C=CN2 PZOUSPYUWWUPPK-UHFFFAOYSA-N 0.000 description 19
- RKJUIXBNRJVNHR-UHFFFAOYSA-N indolenine Natural products C1=CC=C2CC=NC2=C1 RKJUIXBNRJVNHR-UHFFFAOYSA-N 0.000 description 19
- 230000009467 reduction Effects 0.000 description 19
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 17
- 235000019341 magnesium sulphate Nutrition 0.000 description 17
- 238000001953 recrystallisation Methods 0.000 description 17
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 16
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 16
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 16
- 239000000741 silica gel Substances 0.000 description 16
- 229910002027 silica gel Inorganic materials 0.000 description 16
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 14
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 14
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 14
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 14
- 238000004587 chromatography analysis Methods 0.000 description 14
- 239000007787 solid Substances 0.000 description 14
- 239000008346 aqueous phase Substances 0.000 description 13
- 125000000467 secondary amino group Chemical group [H]N([*:1])[*:2] 0.000 description 13
- 229910052708 sodium Inorganic materials 0.000 description 13
- 239000000725 suspension Substances 0.000 description 13
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 12
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 12
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 12
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 12
- 239000000284 extract Substances 0.000 description 12
- 229910052938 sodium sulfate Inorganic materials 0.000 description 12
- 235000011152 sodium sulphate Nutrition 0.000 description 12
- 238000009833 condensation Methods 0.000 description 11
- 230000005494 condensation Effects 0.000 description 11
- 238000001816 cooling Methods 0.000 description 11
- 150000004678 hydrides Chemical class 0.000 description 11
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 11
- 239000002243 precursor Substances 0.000 description 11
- 235000017557 sodium bicarbonate Nutrition 0.000 description 11
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 11
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 10
- 238000007126 N-alkylation reaction Methods 0.000 description 10
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 10
- 239000012442 inert solvent Substances 0.000 description 10
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical class O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 10
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 10
- DLYUQMMRRRQYAE-UHFFFAOYSA-N tetraphosphorus decaoxide Chemical compound O1P(O2)(=O)OP3(=O)OP1(=O)OP2(=O)O3 DLYUQMMRRRQYAE-UHFFFAOYSA-N 0.000 description 10
- RWRDLPDLKQPQOW-UHFFFAOYSA-N Pyrrolidine Chemical compound C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 description 9
- 238000002425 crystallisation Methods 0.000 description 9
- 230000008025 crystallization Effects 0.000 description 9
- 238000010828 elution Methods 0.000 description 9
- 238000001704 evaporation Methods 0.000 description 9
- 230000007062 hydrolysis Effects 0.000 description 9
- 238000006460 hydrolysis reaction Methods 0.000 description 9
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 9
- 239000002244 precipitate Substances 0.000 description 9
- FVAUCKIRQBBSSJ-UHFFFAOYSA-M sodium iodide Chemical compound [Na+].[I-] FVAUCKIRQBBSSJ-UHFFFAOYSA-M 0.000 description 9
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 9
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 8
- WRQNANDWMGAFTP-UHFFFAOYSA-N Methylacetoacetic acid Chemical compound COC(=O)CC(C)=O WRQNANDWMGAFTP-UHFFFAOYSA-N 0.000 description 8
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 description 8
- 150000001722 carbon compounds Chemical class 0.000 description 8
- XYIBRDXRRQCHLP-UHFFFAOYSA-N ethyl acetoacetate Chemical compound CCOC(=O)CC(C)=O XYIBRDXRRQCHLP-UHFFFAOYSA-N 0.000 description 8
- 230000008020 evaporation Effects 0.000 description 8
- ZFRKQXVRDFCRJG-UHFFFAOYSA-N skatole Chemical compound C1=CC=C2C(C)=CNC2=C1 ZFRKQXVRDFCRJG-UHFFFAOYSA-N 0.000 description 8
- QCDICCVJICKQQI-UHFFFAOYSA-N 2-(3-methylindol-1-yl)ethanol Chemical compound C1=CC=C2C(C)=CN(CCO)C2=C1 QCDICCVJICKQQI-UHFFFAOYSA-N 0.000 description 7
- NFWOMTTZUPDDOK-UHFFFAOYSA-N 2-(3h-inden-1-yl)ethanol Chemical compound C1=CC=C2C(CCO)=CCC2=C1 NFWOMTTZUPDDOK-UHFFFAOYSA-N 0.000 description 7
- IUUZMSMGSOUFTO-UHFFFAOYSA-N 2-indol-1-ylacetamide Chemical compound C1=CC=C2N(CC(=O)N)C=CC2=C1 IUUZMSMGSOUFTO-UHFFFAOYSA-N 0.000 description 7
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 7
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 7
- QDYBCIWLGJMJGO-UHFFFAOYSA-N dinitromethanone Chemical class [O-][N+](=O)C(=O)[N+]([O-])=O QDYBCIWLGJMJGO-UHFFFAOYSA-N 0.000 description 7
- 230000000694 effects Effects 0.000 description 7
- 239000010410 layer Substances 0.000 description 7
- 229910052987 metal hydride Inorganic materials 0.000 description 7
- 150000004681 metal hydrides Chemical class 0.000 description 7
- 239000002808 molecular sieve Substances 0.000 description 7
- 239000012074 organic phase Substances 0.000 description 7
- 239000003208 petroleum Substances 0.000 description 7
- URGAHOPLAPQHLN-UHFFFAOYSA-N sodium aluminosilicate Chemical compound [Na+].[Al+3].[O-][Si]([O-])=O.[O-][Si]([O-])=O URGAHOPLAPQHLN-UHFFFAOYSA-N 0.000 description 7
- JOOXCMJARBKPKM-UHFFFAOYSA-N 4-oxopentanoic acid Chemical compound CC(=O)CCC(O)=O JOOXCMJARBKPKM-UHFFFAOYSA-N 0.000 description 6
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical compound CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 description 6
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 6
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 6
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 6
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical compound [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 6
- 239000000370 acceptor Substances 0.000 description 6
- 239000003377 acid catalyst Substances 0.000 description 6
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 6
- 238000009835 boiling Methods 0.000 description 6
- WTEOIRVLGSZEPR-UHFFFAOYSA-N boron trifluoride Chemical compound FB(F)F WTEOIRVLGSZEPR-UHFFFAOYSA-N 0.000 description 6
- 239000003610 charcoal Substances 0.000 description 6
- WQJFIWXYPKYBTO-UHFFFAOYSA-N indole-1-acetic acid Chemical compound C1=CC=C2N(CC(=O)O)C=CC2=C1 WQJFIWXYPKYBTO-UHFFFAOYSA-N 0.000 description 6
- 239000011976 maleic acid Substances 0.000 description 6
- 239000012044 organic layer Substances 0.000 description 6
- 229910052760 oxygen Inorganic materials 0.000 description 6
- 239000000376 reactant Substances 0.000 description 6
- 150000003335 secondary amines Chemical class 0.000 description 6
- 239000012312 sodium hydride Substances 0.000 description 6
- 229910000104 sodium hydride Inorganic materials 0.000 description 6
- JSPLKZUTYZBBKA-UHFFFAOYSA-N trioxidane Chemical compound OOO JSPLKZUTYZBBKA-UHFFFAOYSA-N 0.000 description 6
- KKZPDPNTMKHMNU-UHFFFAOYSA-N 3-(2-bromoethyl)-1h-indene Chemical class C1=CC=C2C(CCBr)=CCC2=C1 KKZPDPNTMKHMNU-UHFFFAOYSA-N 0.000 description 5
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 5
- PHSPJQZRQAJPPF-UHFFFAOYSA-N N-alpha-Methylhistamine Chemical compound CNCCC1=CN=CN1 PHSPJQZRQAJPPF-UHFFFAOYSA-N 0.000 description 5
- 239000003513 alkali Substances 0.000 description 5
- 239000000935 antidepressant agent Substances 0.000 description 5
- 229940005513 antidepressants Drugs 0.000 description 5
- 239000002585 base Substances 0.000 description 5
- 239000012267 brine Substances 0.000 description 5
- 125000002147 dimethylamino group Chemical group [H]C([H])([H])N(*)C([H])([H])[H] 0.000 description 5
- 238000001914 filtration Methods 0.000 description 5
- 150000004797 ketoamides Chemical class 0.000 description 5
- 230000004048 modification Effects 0.000 description 5
- 238000012986 modification Methods 0.000 description 5
- 230000035484 reaction time Effects 0.000 description 5
- 239000012258 stirred mixture Substances 0.000 description 5
- 125000000446 sulfanediyl group Chemical group *S* 0.000 description 5
- 125000003396 thiol group Chemical group [H]S* 0.000 description 5
- DNXIKVLOVZVMQF-UHFFFAOYSA-N (3beta,16beta,17alpha,18beta,20alpha)-17-hydroxy-11-methoxy-18-[(3,4,5-trimethoxybenzoyl)oxy]-yohimban-16-carboxylic acid, methyl ester Natural products C1C2CN3CCC(C4=CC=C(OC)C=C4N4)=C4C3CC2C(C(=O)OC)C(O)C1OC(=O)C1=CC(OC)=C(OC)C(OC)=C1 DNXIKVLOVZVMQF-UHFFFAOYSA-N 0.000 description 4
- CLQAPWVEHNTJLC-UHFFFAOYSA-N 2-(1h-indol-3-yl)ethanethiol Chemical compound C1=CC=C2C(CCS)=CNC2=C1 CLQAPWVEHNTJLC-UHFFFAOYSA-N 0.000 description 4
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 4
- WQVAMFRPCWXWSS-UHFFFAOYSA-N 4-(dimethylamino)butan-2-one Chemical compound CN(C)CCC(C)=O WQVAMFRPCWXWSS-UHFFFAOYSA-N 0.000 description 4
- DBERHVIZRVGDFO-UHFFFAOYSA-N Acetoxyacetone Chemical compound CC(=O)COC(C)=O DBERHVIZRVGDFO-UHFFFAOYSA-N 0.000 description 4
- 239000005909 Kieselgur Substances 0.000 description 4
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 4
- MZRVEZGGRBJDDB-UHFFFAOYSA-N N-Butyllithium Chemical compound [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 description 4
- FZRKAZHKEDOPNN-UHFFFAOYSA-N Nitric oxide anion Chemical compound O=[N-] FZRKAZHKEDOPNN-UHFFFAOYSA-N 0.000 description 4
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 4
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 4
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 4
- LCQMZZCPPSWADO-UHFFFAOYSA-N Reserpilin Natural products COC(=O)C1COCC2CN3CCc4c([nH]c5cc(OC)c(OC)cc45)C3CC12 LCQMZZCPPSWADO-UHFFFAOYSA-N 0.000 description 4
- QEVHRUUCFGRFIF-SFWBKIHZSA-N Reserpine Natural products O=C(OC)[C@@H]1[C@H](OC)[C@H](OC(=O)c2cc(OC)c(OC)c(OC)c2)C[C@H]2[C@@H]1C[C@H]1N(C2)CCc2c3c([nH]c12)cc(OC)cc3 QEVHRUUCFGRFIF-SFWBKIHZSA-N 0.000 description 4
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 4
- GURLNXRFQUUOMW-UHFFFAOYSA-K [Al](Cl)(Cl)Cl.[AlH3] Chemical compound [Al](Cl)(Cl)Cl.[AlH3] GURLNXRFQUUOMW-UHFFFAOYSA-K 0.000 description 4
- 229910021529 ammonia Inorganic materials 0.000 description 4
- 239000012259 ether extract Substances 0.000 description 4
- 239000005457 ice water Substances 0.000 description 4
- 238000004519 manufacturing process Methods 0.000 description 4
- 230000000144 pharmacologic effect Effects 0.000 description 4
- 239000011591 potassium Substances 0.000 description 4
- 150000003141 primary amines Chemical class 0.000 description 4
- BJOIZNZVOZKDIG-MDEJGZGSSA-N reserpine Chemical compound O([C@H]1[C@@H]([C@H]([C@H]2C[C@@H]3C4=C([C]5C=CC(OC)=CC5=N4)CCN3C[C@H]2C1)C(=O)OC)OC)C(=O)C1=CC(OC)=C(OC)C(OC)=C1 BJOIZNZVOZKDIG-MDEJGZGSSA-N 0.000 description 4
- 229960003147 reserpine Drugs 0.000 description 4
- MDMGHDFNKNZPAU-UHFFFAOYSA-N roserpine Natural products C1C2CN3CCC(C4=CC=C(OC)C=C4N4)=C4C3CC2C(OC(C)=O)C(OC)C1OC(=O)C1=CC(OC)=C(OC)C(OC)=C1 MDMGHDFNKNZPAU-UHFFFAOYSA-N 0.000 description 4
- 229940074386 skatole Drugs 0.000 description 4
- UTUFVOGCRYIYHO-UHFFFAOYSA-N 2-(1-methyl-4,9-dihydro-3h-pyrano[3,4-b]indol-1-yl)acetic acid Chemical compound N1C2=CC=CC=C2C2=C1C(C)(CC(O)=O)OCC2 UTUFVOGCRYIYHO-UHFFFAOYSA-N 0.000 description 3
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 3
- 229910015900 BF3 Inorganic materials 0.000 description 3
- GMEONFUTDYJSNV-UHFFFAOYSA-N Ethyl levulinate Chemical compound CCOC(=O)CCC(C)=O GMEONFUTDYJSNV-UHFFFAOYSA-N 0.000 description 3
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 3
- 229930194542 Keto Natural products 0.000 description 3
- 241000699670 Mus sp. Species 0.000 description 3
- 150000007513 acids Chemical class 0.000 description 3
- 150000001299 aldehydes Chemical class 0.000 description 3
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 3
- 239000000908 ammonium hydroxide Substances 0.000 description 3
- 230000001430 anti-depressive effect Effects 0.000 description 3
- 229910052799 carbon Inorganic materials 0.000 description 3
- 239000000460 chlorine Substances 0.000 description 3
- 239000002026 chloroform extract Substances 0.000 description 3
- FGRVOLIFQGXPCT-UHFFFAOYSA-L dipotassium;dioxido-oxo-sulfanylidene-$l^{6}-sulfane Chemical compound [K+].[K+].[O-]S([O-])(=O)=S FGRVOLIFQGXPCT-UHFFFAOYSA-L 0.000 description 3
- 150000002019 disulfides Chemical class 0.000 description 3
- 238000001035 drying Methods 0.000 description 3
- 239000000499 gel Substances 0.000 description 3
- 238000005984 hydrogenation reaction Methods 0.000 description 3
- 150000002469 indenes Chemical class 0.000 description 3
- 125000000468 ketone group Chemical group 0.000 description 3
- 229940040102 levulinic acid Drugs 0.000 description 3
- 150000002641 lithium Chemical class 0.000 description 3
- 125000000250 methylamino group Chemical group [H]N(*)C([H])([H])[H] 0.000 description 3
- 239000012071 phase Substances 0.000 description 3
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 3
- DHGFMVMDBNLMKT-UHFFFAOYSA-N propyl 3-oxobutanoate Chemical compound CCCOC(=O)CC(C)=O DHGFMVMDBNLMKT-UHFFFAOYSA-N 0.000 description 3
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 3
- 150000003334 secondary amides Chemical class 0.000 description 3
- 239000002002 slurry Substances 0.000 description 3
- 239000012279 sodium borohydride Substances 0.000 description 3
- 229910000033 sodium borohydride Inorganic materials 0.000 description 3
- 235000009518 sodium iodide Nutrition 0.000 description 3
- AKHNMLFCWUSKQB-UHFFFAOYSA-L sodium thiosulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=S AKHNMLFCWUSKQB-UHFFFAOYSA-L 0.000 description 3
- 235000019345 sodium thiosulphate Nutrition 0.000 description 3
- 229910052717 sulfur Inorganic materials 0.000 description 3
- 150000004764 thiosulfuric acid derivatives Chemical class 0.000 description 3
- 239000012485 toluene extract Substances 0.000 description 3
- 238000005406 washing Methods 0.000 description 3
- OMBPFGZWBIOSRO-UHFFFAOYSA-N (1-methyl-4,9-dihydro-3h-pyrano[3,4-b]indol-1-yl)methanamine Chemical compound N1C2=CC=CC=C2C2=C1C(C)(CN)OCC2 OMBPFGZWBIOSRO-UHFFFAOYSA-N 0.000 description 2
- PWRWHHGNJIBUPD-UHFFFAOYSA-N 1-methyl-4,9-dihydro-3h-pyrano[3,4-b]indole-1-carboxamide Chemical compound N1C2=CC=CC=C2C2=C1C(C)(C(N)=O)OCC2 PWRWHHGNJIBUPD-UHFFFAOYSA-N 0.000 description 2
- QCDJOJKIHZQJGX-UHFFFAOYSA-N 1-nitropropan-2-one Chemical compound CC(=O)C[N+]([O-])=O QCDJOJKIHZQJGX-UHFFFAOYSA-N 0.000 description 2
- IXZPQSXOSCAEGK-UHFFFAOYSA-N 2-(1,9-dimethyl-3,4-dihydropyrano[3,4-b]indol-1-yl)acetic acid Chemical compound C12=CC=CC=C2N(C)C2=C1CCOC2(C)CC(O)=O IXZPQSXOSCAEGK-UHFFFAOYSA-N 0.000 description 2
- FJJSKKBQSGDHQK-UHFFFAOYSA-N 2-(9-ethyl-1-methyl-3,4-dihydrothiopyrano[3,4-b]indol-1-yl)-n,n-dimethylethanamine;hydron;chloride Chemical compound Cl.C12=CC=CC=C2N(CC)C2=C1CCSC2(C)CCN(C)C FJJSKKBQSGDHQK-UHFFFAOYSA-N 0.000 description 2
- SZNYYWIUQFZLLT-UHFFFAOYSA-N 2-methyl-1-(2-methylpropoxy)propane Chemical compound CC(C)COCC(C)C SZNYYWIUQFZLLT-UHFFFAOYSA-N 0.000 description 2
- MGADZUXDNSDTHW-UHFFFAOYSA-N 2H-pyran Chemical compound C1OC=CC=C1 MGADZUXDNSDTHW-UHFFFAOYSA-N 0.000 description 2
- YYROPELSRYBVMQ-UHFFFAOYSA-N 4-toluenesulfonyl chloride Chemical compound CC1=CC=C(S(Cl)(=O)=O)C=C1 YYROPELSRYBVMQ-UHFFFAOYSA-N 0.000 description 2
- MBFOTTCUUAIBDW-UHFFFAOYSA-N 5-nitropentan-2-one Chemical compound CC(=O)CCC[N+]([O-])=O MBFOTTCUUAIBDW-UHFFFAOYSA-N 0.000 description 2
- DLFVBJFMPXGRIB-UHFFFAOYSA-N Acetamide Chemical compound CC(N)=O DLFVBJFMPXGRIB-UHFFFAOYSA-N 0.000 description 2
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 2
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 2
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Chemical compound OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 2
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 2
- 241001465754 Metazoa Species 0.000 description 2
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical group CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 2
- QTBSBXVTEAMEQO-UHFFFAOYSA-N acetic acid Substances CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 2
- 230000001476 alcoholic effect Effects 0.000 description 2
- 229910000288 alkali metal carbonate Inorganic materials 0.000 description 2
- 150000008041 alkali metal carbonates Chemical class 0.000 description 2
- 230000009435 amidation Effects 0.000 description 2
- 238000007112 amidation reaction Methods 0.000 description 2
- 230000000767 anti-ulcer Effects 0.000 description 2
- 229940054051 antipsychotic indole derivative Drugs 0.000 description 2
- 239000003699 antiulcer agent Substances 0.000 description 2
- 239000012298 atmosphere Substances 0.000 description 2
- WGQKYBSKWIADBV-UHFFFAOYSA-N benzylamine Chemical compound NCC1=CC=CC=C1 WGQKYBSKWIADBV-UHFFFAOYSA-N 0.000 description 2
- RDHPKYGYEGBMSE-UHFFFAOYSA-N bromoethane Chemical compound CCBr RDHPKYGYEGBMSE-UHFFFAOYSA-N 0.000 description 2
- GZUXJHMPEANEGY-UHFFFAOYSA-N bromomethane Chemical compound BrC GZUXJHMPEANEGY-UHFFFAOYSA-N 0.000 description 2
- 244000309464 bull Species 0.000 description 2
- 239000003153 chemical reaction reagent Substances 0.000 description 2
- HPNMFZURTQLUMO-UHFFFAOYSA-N diethylamine Chemical compound CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 description 2
- RIFGWPKJUGCATF-UHFFFAOYSA-N ethyl chloroformate Chemical compound CCOC(Cl)=O RIFGWPKJUGCATF-UHFFFAOYSA-N 0.000 description 2
- 125000000031 ethylamino group Chemical group [H]C([H])([H])C([H])([H])N([H])[*] 0.000 description 2
- 238000002474 experimental method Methods 0.000 description 2
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 description 2
- 239000012458 free base Substances 0.000 description 2
- 238000007429 general method Methods 0.000 description 2
- RERZNCLIYCABFS-UHFFFAOYSA-N harmaline Chemical compound C1CN=C(C)C2=C1C1=CC=C(OC)C=C1N2 RERZNCLIYCABFS-UHFFFAOYSA-N 0.000 description 2
- 238000007327 hydrogenolysis reaction Methods 0.000 description 2
- RJTZUHVCZIGJMB-UHFFFAOYSA-N hydron;1h-indole;chloride Chemical compound Cl.C1=CC=C2NC=CC2=C1 RJTZUHVCZIGJMB-UHFFFAOYSA-N 0.000 description 2
- 150000002475 indoles Chemical class 0.000 description 2
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 2
- 150000004715 keto acids Chemical class 0.000 description 2
- 150000002596 lactones Chemical class 0.000 description 2
- 229910052744 lithium Inorganic materials 0.000 description 2
- HSZCZNFXUDYRKD-UHFFFAOYSA-M lithium iodide Chemical compound [Li+].[I-] HSZCZNFXUDYRKD-UHFFFAOYSA-M 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- 239000000155 melt Substances 0.000 description 2
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 2
- KXKVLQRXCPHEJC-UHFFFAOYSA-N methyl acetate Chemical compound COC(C)=O KXKVLQRXCPHEJC-UHFFFAOYSA-N 0.000 description 2
- SHUOMIRTNDZIDH-UHFFFAOYSA-N n,n-dimethyl-2-(1-methyl-4,9-dihydro-3h-pyrano[3,4-b]indol-1-yl)acetamide Chemical compound N1C2=CC=CC=C2C2=C1C(CC(=O)N(C)C)(C)OCC2 SHUOMIRTNDZIDH-UHFFFAOYSA-N 0.000 description 2
- 230000007935 neutral effect Effects 0.000 description 2
- 230000003287 optical effect Effects 0.000 description 2
- 238000006053 organic reaction Methods 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- 235000006408 oxalic acid Nutrition 0.000 description 2
- KJIFKLIQANRMOU-UHFFFAOYSA-N oxidanium;4-methylbenzenesulfonate Chemical compound O.CC1=CC=C(S(O)(=O)=O)C=C1 KJIFKLIQANRMOU-UHFFFAOYSA-N 0.000 description 2
- VLTRZXGMWDSKGL-UHFFFAOYSA-N perchloric acid Chemical compound OCl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-N 0.000 description 2
- 150000004031 phenylhydrazines Chemical class 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- 150000003140 primary amides Chemical class 0.000 description 2
- WGYKZJWCGVVSQN-UHFFFAOYSA-N propylamine Chemical group CCCN WGYKZJWCGVVSQN-UHFFFAOYSA-N 0.000 description 2
- 125000006239 protecting group Chemical group 0.000 description 2
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 2
- FPOLWERNILTNDK-UHFFFAOYSA-N pyruvamide Chemical compound CC(=O)C(N)=O FPOLWERNILTNDK-UHFFFAOYSA-N 0.000 description 2
- 229910000029 sodium carbonate Inorganic materials 0.000 description 2
- GEHJYWRUCIMESM-UHFFFAOYSA-L sodium sulfite Chemical compound [Na+].[Na+].[O-]S([O-])=O GEHJYWRUCIMESM-UHFFFAOYSA-L 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 238000003786 synthesis reaction Methods 0.000 description 2
- 150000003512 tertiary amines Chemical class 0.000 description 2
- 229910052727 yttrium Inorganic materials 0.000 description 2
- JIAARYAFYJHUJI-UHFFFAOYSA-L zinc dichloride Chemical compound [Cl-].[Cl-].[Zn+2] JIAARYAFYJHUJI-UHFFFAOYSA-L 0.000 description 2
- TXUICONDJPYNPY-UHFFFAOYSA-N (1,10,13-trimethyl-3-oxo-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl) heptanoate Chemical compound C1CC2CC(=O)C=C(C)C2(C)C2C1C1CCC(OC(=O)CCCCCC)C1(C)CC2 TXUICONDJPYNPY-UHFFFAOYSA-N 0.000 description 1
- BBWCAVWRHKHVCQ-UHFFFAOYSA-N (1-methyl-4,9-dihydro-3h-indeno[2,1-c]pyran-1-yl)methanol Chemical compound C1C2=CC=CC=C2C2=C1C(C)(CO)OCC2 BBWCAVWRHKHVCQ-UHFFFAOYSA-N 0.000 description 1
- JNUZADQZHYFJGW-JOCHJYFZSA-N (2R)-N-[3-[5-fluoro-2-(2-fluoro-3-methylsulfonylanilino)pyrimidin-4-yl]-1H-indol-7-yl]-3-methoxy-2-(4-methylpiperazin-1-yl)propanamide Chemical compound FC=1C(=NC(=NC=1)NC1=C(C(=CC=C1)S(=O)(=O)C)F)C1=CNC2=C(C=CC=C12)NC([C@@H](COC)N1CCN(CC1)C)=O JNUZADQZHYFJGW-JOCHJYFZSA-N 0.000 description 1
- MKDGKNQPZHELSR-UHFFFAOYSA-N 1,10-dimethyl-1-(2-morpholin-4-ylethyl)-3,4-dihydro-[1,4]oxazino[4,3-a]indole Chemical compound C12=CC=CC=C2C(C)=C2N1CCOC2(C)CCN1CCOCC1 MKDGKNQPZHELSR-UHFFFAOYSA-N 0.000 description 1
- GYNVMMXZHSRQIP-UHFFFAOYSA-N 1,10-dimethyl-1-(2-piperidin-1-ylethyl)-3,4-dihydro-[1,4]oxazino[4,3-a]indole Chemical compound C12=CC=CC=C2C(C)=C2N1CCOC2(C)CCN1CCCCC1 GYNVMMXZHSRQIP-UHFFFAOYSA-N 0.000 description 1
- GRXACLVKUNDTBZ-UHFFFAOYSA-N 1,10-dimethyl-1-(2-pyrrolidin-1-ylethyl)-3,4-dihydro-[1,4]oxazino[4,3-a]indole Chemical compound C12=CC=CC=C2C(C)=C2N1CCOC2(C)CCN1CCCC1 GRXACLVKUNDTBZ-UHFFFAOYSA-N 0.000 description 1
- HJPWWUZRYSJMCM-UHFFFAOYSA-N 1,10-dimethyl-1-(3-nitropropyl)-3,4-dihydro-[1,4]oxazino[4,3-a]indole Chemical compound CC1(OCCN2C1=C(C=1C=CC=CC21)C)CCC[N+](=O)[O-] HJPWWUZRYSJMCM-UHFFFAOYSA-N 0.000 description 1
- BNQYTYSXALJLPX-UHFFFAOYSA-N 1,10-dimethyl-1-[2-(4-methylpiperazin-1-yl)ethyl]-3,4-dihydro-[1,4]oxazino[4,3-a]indole Chemical compound C1CN(C)CCN1CCC1(C)C2=C(C)C3=CC=CC=C3N2CCO1 BNQYTYSXALJLPX-UHFFFAOYSA-N 0.000 description 1
- PSHZUXKEEICDIX-UHFFFAOYSA-N 1,10-dimethyl-3,4-dihydro-1h-[1,4]oxazino[4,3-a]indole;propyl 4-methylbenzenesulfonate Chemical compound CCCOS(=O)(=O)C1=CC=C(C)C=C1.C1=CC=C2N3CCOC(C)C3=C(C)C2=C1 PSHZUXKEEICDIX-UHFFFAOYSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- ULTHEAFYOOPTTB-UHFFFAOYSA-N 1,4-dibromobutane Chemical compound BrCCCCBr ULTHEAFYOOPTTB-UHFFFAOYSA-N 0.000 description 1
- IBODDUNKEPPBKW-UHFFFAOYSA-N 1,5-dibromopentane Chemical compound BrCCCCCBr IBODDUNKEPPBKW-UHFFFAOYSA-N 0.000 description 1
- PUPCSHUMKYQCRG-UHFFFAOYSA-N 1-(3-chloropropyl)-1-methyl-4,9-dihydro-3h-pyrano[3,4-b]indole Chemical compound N1C2=CC=CC=C2C2=C1C(C)(CCCCl)OCC2 PUPCSHUMKYQCRG-UHFFFAOYSA-N 0.000 description 1
- HNNCXPASEPVANQ-UHFFFAOYSA-N 1-(3-iodopropyl)-1,10-dimethyl-3,4-dihydro-[1,4]oxazino[4,3-a]indole Chemical compound C1=CC=C2C(C)=C3C(CCCI)(C)OCCN3C2=C1 HNNCXPASEPVANQ-UHFFFAOYSA-N 0.000 description 1
- PVOAHINGSUIXLS-UHFFFAOYSA-N 1-Methylpiperazine Chemical compound CN1CCNCC1 PVOAHINGSUIXLS-UHFFFAOYSA-N 0.000 description 1
- MXHZAYVEIKSPIA-ZHACJKMWSA-N 1-[(E)-4-[5-carbamoyl-7-[3-(dimethylamino)propoxy]-2-[(2-ethyl-5-methylpyrazole-3-carbonyl)amino]benzimidazol-1-yl]but-2-enyl]-2-[(2-ethyl-5-methylpyrazole-3-carbonyl)amino]-7-methoxybenzimidazole-5-carboxamide Chemical compound CCN1N=C(C)C=C1C(=O)NC1=NC2=CC(=CC(OC)=C2N1C\C=C\CN1C(NC(=O)C2=CC(C)=NN2CC)=NC2=CC(=CC(OCCCN(C)C)=C12)C(N)=O)C(N)=O MXHZAYVEIKSPIA-ZHACJKMWSA-N 0.000 description 1
- CIUVAVBRERZOQG-UHFFFAOYSA-N 1-[2-(dimethylamino)ethyl]-9-ethyl-1-methyl-3,4-dihydropyrano[3,4-b]indol-6-ol;hydrochloride Chemical compound Cl.C12=CC(O)=CC=C2N(CC)C2=C1CCOC2(C)CCN(C)C CIUVAVBRERZOQG-UHFFFAOYSA-N 0.000 description 1
- CYNYIHKIEHGYOZ-UHFFFAOYSA-N 1-bromopropane Chemical compound CCCBr CYNYIHKIEHGYOZ-UHFFFAOYSA-N 0.000 description 1
- WEFSXBPMNKAUDL-UHFFFAOYSA-N 1-iodopropan-2-one Chemical compound CC(=O)CI WEFSXBPMNKAUDL-UHFFFAOYSA-N 0.000 description 1
- DGLOKROTZJLWTR-UHFFFAOYSA-N 1-methyl-1,3,4,9-tetrahydropyrano[3,4-b]indole Chemical compound N1C2=CC=CC=C2C2=C1C(C)OCC2 DGLOKROTZJLWTR-UHFFFAOYSA-N 0.000 description 1
- VJPQRFZFXDFLSW-UHFFFAOYSA-N 1-methyl-1-(2-morpholin-4-ylethyl)-4,9-dihydro-3h-pyrano[3,4-b]indole Chemical compound O1CCC(C2=CC=CC=C2N2)=C2C1(C)CCN1CCOCC1 VJPQRFZFXDFLSW-UHFFFAOYSA-N 0.000 description 1
- ALCYICNVHULKLN-UHFFFAOYSA-N 1-methyl-1-(2-piperidin-1-ylethyl)-4,9-dihydro-3h-pyrano[3,4-b]indole Chemical compound O1CCC(C2=CC=CC=C2N2)=C2C1(C)CCN1CCCCC1 ALCYICNVHULKLN-UHFFFAOYSA-N 0.000 description 1
- NHABBBWCJWONRV-UHFFFAOYSA-N 1-methyl-1-(2-pyrrolidin-1-ylethyl)-4,9-dihydro-3h-pyrano[3,4-b]indole Chemical compound O1CCC(C2=CC=CC=C2N2)=C2C1(C)CCN1CCCC1 NHABBBWCJWONRV-UHFFFAOYSA-N 0.000 description 1
- CRCWXIFFNOHZGO-UHFFFAOYSA-N 1-methyl-1-(3-nitropropyl)-4,9-dihydro-3h-indeno[2,1-c]pyran Chemical compound C1C2=CC=CC=C2C2=C1C(C)(CCC[N+]([O-])=O)OCC2 CRCWXIFFNOHZGO-UHFFFAOYSA-N 0.000 description 1
- ZWYZCWDQCLZVDM-UHFFFAOYSA-N 1-methyl-1-(3-pyrrolidin-1-ylpropyl)-4,9-dihydro-3H-pyrano[3,4-b]indole Chemical compound O1CCC(C2=CC=CC=C2N2)=C2C1(C)CCCN1CCCC1 ZWYZCWDQCLZVDM-UHFFFAOYSA-N 0.000 description 1
- DWXMSQLKSSBBMM-UHFFFAOYSA-N 1-methyl-1-(nitromethyl)-4,9-dihydro-3h-pyrano[3,4-b]indole Chemical compound N1C2=CC=CC=C2C2=C1C(C)(C[N+]([O-])=O)OCC2 DWXMSQLKSSBBMM-UHFFFAOYSA-N 0.000 description 1
- FJRUMAQHSUKYGG-UHFFFAOYSA-N 1-methyl-1-[2-(4-methylpiperazin-1-yl)ethyl]-4,9-dihydro-3h-pyrano[3,4-b]indole Chemical compound C1CN(C)CCN1CCC1(C)C(NC=2C3=CC=CC=2)=C3CCO1 FJRUMAQHSUKYGG-UHFFFAOYSA-N 0.000 description 1
- YBYIRNPNPLQARY-UHFFFAOYSA-N 1H-indene Natural products C1=CC=C2CC=CC2=C1 YBYIRNPNPLQARY-UHFFFAOYSA-N 0.000 description 1
- OVDHMWFWLZIBIY-UHFFFAOYSA-N 1h-[1,4]oxazino[4,3-a]indole Chemical compound C1=CC=C2N3C=COCC3=CC2=C1 OVDHMWFWLZIBIY-UHFFFAOYSA-N 0.000 description 1
- BWZVCCNYKMEVEX-UHFFFAOYSA-N 2,4,6-Trimethylpyridine Chemical compound CC1=CC(C)=NC(C)=C1 BWZVCCNYKMEVEX-UHFFFAOYSA-N 0.000 description 1
- DJPWWCVPNPVFOA-UHFFFAOYSA-N 2-(1,10-dimethyl-3,4-dihydro-[1,4]oxazino[4,3-a]indol-1-yl)-1-(4-methylpiperazin-1-yl)ethanone Chemical compound C1CN(C)CCN1C(=O)CC1(C)C2=C(C)C3=CC=CC=C3N2CCO1 DJPWWCVPNPVFOA-UHFFFAOYSA-N 0.000 description 1
- YCNFLKJYNWRSAM-UHFFFAOYSA-N 2-(1,10-dimethyl-3,4-dihydro-[1,4]oxazino[4,3-a]indol-1-yl)-1-morpholin-4-ylethanone Chemical compound C12=CC=CC=C2C(C)=C2N1CCOC2(C)CC(=O)N1CCOCC1 YCNFLKJYNWRSAM-UHFFFAOYSA-N 0.000 description 1
- LRINKVUJEXDMQD-UHFFFAOYSA-N 2-(1,10-dimethyl-3,4-dihydro-[1,4]oxazino[4,3-a]indol-1-yl)-1-piperidin-1-ylethanone Chemical compound C12=CC=CC=C2C(C)=C2N1CCOC2(C)CC(=O)N1CCCCC1 LRINKVUJEXDMQD-UHFFFAOYSA-N 0.000 description 1
- UAEZBPCTIFICDR-UHFFFAOYSA-N 2-(1,10-dimethyl-3,4-dihydro-[1,4]oxazino[4,3-a]indol-1-yl)-1-pyrrolidin-1-ylethanone Chemical compound C12=CC=CC=C2C(C)=C2N1CCOC2(C)CC(=O)N1CCCC1 UAEZBPCTIFICDR-UHFFFAOYSA-N 0.000 description 1
- KLAOZAWNQBURGT-UHFFFAOYSA-N 2-(1,10-dimethyl-3,4-dihydro-[1,4]oxazino[4,3-a]indol-1-yl)-n,n-diethylacetamide Chemical compound C1=CC=C2N3CCOC(CC(=O)N(CC)CC)(C)C3=C(C)C2=C1 KLAOZAWNQBURGT-UHFFFAOYSA-N 0.000 description 1
- VQOCGOITDGGAPS-UHFFFAOYSA-N 2-(1,10-dimethyl-3,4-dihydro-[1,4]oxazino[4,3-a]indol-1-yl)-n,n-diethylethanamine Chemical compound C1=CC=C2N3CCOC(CCN(CC)CC)(C)C3=C(C)C2=C1 VQOCGOITDGGAPS-UHFFFAOYSA-N 0.000 description 1
- PGVDVKDLPXJDGI-UHFFFAOYSA-N 2-(1,10-dimethyl-3,4-dihydro-[1,4]oxazino[4,3-a]indol-1-yl)-n-ethylacetamide Chemical compound C1=CC=C2N3CCOC(CC(=O)NCC)(C)C3=C(C)C2=C1 PGVDVKDLPXJDGI-UHFFFAOYSA-N 0.000 description 1
- LYJUUCMFKKEKQO-UHFFFAOYSA-N 2-(1,10-dimethyl-3,4-dihydro-[1,4]oxazino[4,3-a]indol-1-yl)-n-methylethanamine;hydrobromide Chemical compound Br.C1=CC=C2N3CCOC(CCNC)(C)C3=C(C)C2=C1 LYJUUCMFKKEKQO-UHFFFAOYSA-N 0.000 description 1
- MZBUWOBDRGRXBC-UHFFFAOYSA-N 2-(1,10-dimethyl-3,4-dihydro-[1,4]oxazino[4,3-a]indol-1-yl)ethanamine Chemical compound C1=CC=C2C(C)=C3C(CCN)(C)OCCN3C2=C1 MZBUWOBDRGRXBC-UHFFFAOYSA-N 0.000 description 1
- LTEYSFWXXLXCGA-UHFFFAOYSA-N 2-(1,9-dimethyl-3,4-dihydropyrano[3,4-b]indol-1-yl)-n,n-dimethylethanamine Chemical compound CN1C2=CC=CC=C2C2=C1C(CCN(C)C)(C)OCC2 LTEYSFWXXLXCGA-UHFFFAOYSA-N 0.000 description 1
- WQQIDXWJOXCFAH-UHFFFAOYSA-N 2-(1,9-dimethyl-3,4-dihydropyrano[3,4-b]indol-1-yl)-n,n-dimethylethanamine;hydrochloride Chemical compound Cl.CN1C2=CC=CC=C2C2=C1C(CCN(C)C)(C)OCC2 WQQIDXWJOXCFAH-UHFFFAOYSA-N 0.000 description 1
- INSNRUSOCORJBD-UHFFFAOYSA-N 2-(1,9-dimethyl-3,4-dihydrothiopyrano[3,4-b]indol-1-yl)-n,n-dimethylethanamine Chemical compound CN1C2=CC=CC=C2C2=C1C(CCN(C)C)(C)SCC2 INSNRUSOCORJBD-UHFFFAOYSA-N 0.000 description 1
- SHCWLDSZQHHHAN-UHFFFAOYSA-N 2-(1,9-dimethyl-6-phenylmethoxy-3,4-dihydropyrano[3,4-b]indol-1-yl)-n,n-dimethylethanamine Chemical compound CN(C)CCC1(C)OCCC(C2=C3)=C1N(C)C2=CC=C3OCC1=CC=CC=C1 SHCWLDSZQHHHAN-UHFFFAOYSA-N 0.000 description 1
- PFIKXVUVZVLBIC-UHFFFAOYSA-N 2-(1-ethylindol-3-yl)ethanol Chemical compound C1=CC=C2N(CC)C=C(CCO)C2=C1 PFIKXVUVZVLBIC-UHFFFAOYSA-N 0.000 description 1
- DFNVYVBZYJLMOK-UHFFFAOYSA-N 2-(1-methyl-4,9-dihydro-3h-indeno[2,1-c]pyran-1-yl)acetic acid Chemical compound C1C2=CC=CC=C2C2=C1C(C)(CC(O)=O)OCC2 DFNVYVBZYJLMOK-UHFFFAOYSA-N 0.000 description 1
- WDCIGLBXDWGCDW-UHFFFAOYSA-N 2-(1-methyl-4,9-dihydro-3h-indeno[2,1-c]thiopyran-1-yl)acetic acid Chemical compound C1C2=CC=CC=C2C2=C1C(C)(CC(O)=O)SCC2 WDCIGLBXDWGCDW-UHFFFAOYSA-N 0.000 description 1
- LORXKXNYGMYFFV-UHFFFAOYSA-N 2-(1-methyl-4,9-dihydro-3h-pyrano[3,4-b]indol-1-yl)-1-pyrrolidin-1-ylethanone Chemical compound O1CCC(C2=CC=CC=C2N2)=C2C1(C)CC(=O)N1CCCC1 LORXKXNYGMYFFV-UHFFFAOYSA-N 0.000 description 1
- CKOKSOYFTIFGFK-UHFFFAOYSA-N 2-(1-methyl-4,9-dihydro-3h-pyrano[3,4-b]indol-1-yl)acetamide Chemical compound N1C2=CC=CC=C2C2=C1C(C)(CC(N)=O)OCC2 CKOKSOYFTIFGFK-UHFFFAOYSA-N 0.000 description 1
- OELXTDFMYNIVIM-UHFFFAOYSA-N 2-(1-methyl-4,9-dihydro-3h-pyrano[3,4-b]indol-1-yl)ethanamine Chemical compound N1C2=CC=CC=C2C2=C1C(C)(CCN)OCC2 OELXTDFMYNIVIM-UHFFFAOYSA-N 0.000 description 1
- ZEHPLOBPGDRTED-UHFFFAOYSA-N 2-(1-methyl-4,9-dihydro-3h-thiopyrano[3,4-b]indol-1-yl)acetic acid Chemical compound N1C2=CC=CC=C2C2=C1C(C)(CC(O)=O)SCC2 ZEHPLOBPGDRTED-UHFFFAOYSA-N 0.000 description 1
- MJVYHDUGSYYQBN-UHFFFAOYSA-N 2-(1-methyl-6-phenylmethoxy-4,9-dihydro-3h-pyrano[3,4-b]indol-1-yl)acetic acid Chemical compound OC(=O)CC1(C)OCCC(C2=C3)=C1NC2=CC=C3OCC1=CC=CC=C1 MJVYHDUGSYYQBN-UHFFFAOYSA-N 0.000 description 1
- YHTIQBDVQYVSGH-UHFFFAOYSA-N 2-(1-methyl-9-propyl-3,4-dihydropyrano[3,4-b]indol-1-yl)acetic acid Chemical compound C12=CC=CC=C2N(CCC)C2=C1CCOC2(C)CC(O)=O YHTIQBDVQYVSGH-UHFFFAOYSA-N 0.000 description 1
- QDBUVJRKWGMGTP-UHFFFAOYSA-N 2-(1-methylindol-3-yl)ethanethiol Chemical compound C1=CC=C2N(C)C=C(CCS)C2=C1 QDBUVJRKWGMGTP-UHFFFAOYSA-N 0.000 description 1
- POLWRCXHRFTJTO-UHFFFAOYSA-N 2-(3-methylindol-1-yl)acetic acid Chemical compound C1=CC=C2C(C)=CN(CC(O)=O)C2=C1 POLWRCXHRFTJTO-UHFFFAOYSA-N 0.000 description 1
- WVVRUNDGSUXGMQ-UHFFFAOYSA-N 2-(3h-inden-1-yl)ethanethiol Chemical compound C1=CC=C2C(CCS)=CCC2=C1 WVVRUNDGSUXGMQ-UHFFFAOYSA-N 0.000 description 1
- NPRWQLVMPPYXQB-UHFFFAOYSA-N 2-(6-hydroxy-1-methyl-4,9-dihydro-3h-pyrano[3,4-b]indol-1-yl)acetic acid Chemical compound N1C2=CC=C(O)C=C2C2=C1C(C)(CC(O)=O)OCC2 NPRWQLVMPPYXQB-UHFFFAOYSA-N 0.000 description 1
- BBRUFTDHWCPALK-UHFFFAOYSA-N 2-(6-hydroxy-1-methyl-4,9-dihydro-3h-pyrano[3,4-b]indol-1-yl)acetic acid;phenylmethanamine Chemical compound NCC1=CC=CC=C1.N1C2=CC=C(O)C=C2C2=C1C(C)(CC(O)=O)OCC2 BBRUFTDHWCPALK-UHFFFAOYSA-N 0.000 description 1
- KTPRQGOVNIOOOR-UHFFFAOYSA-N 2-(6-methoxy-3h-inden-1-yl)ethanethiol Chemical compound COC1=CC=C2CC=C(CCS)C2=C1 KTPRQGOVNIOOOR-UHFFFAOYSA-N 0.000 description 1
- OFWALHNIFZCEHM-UHFFFAOYSA-N 2-(9-ethyl-1-methyl-3,4-dihydropyrano[3,4-b]indol-1-yl)acetic acid Chemical compound C12=CC=CC=C2N(CC)C2=C1CCOC2(C)CC(O)=O OFWALHNIFZCEHM-UHFFFAOYSA-N 0.000 description 1
- 125000000022 2-aminoethyl group Chemical group [H]C([*])([H])C([H])([H])N([H])[H] 0.000 description 1
- 125000001340 2-chloroethyl group Chemical group [H]C([H])(Cl)C([H])([H])* 0.000 description 1
- MWUVMGYIPOWLAH-UHFFFAOYSA-N 2-indol-1-ylethanol Chemical compound C1=CC=C2N(CCO)C=CC2=C1 MWUVMGYIPOWLAH-UHFFFAOYSA-N 0.000 description 1
- HEAYDCIZOFDHRM-UHFFFAOYSA-N 2-tert-butyloxirane Chemical compound CC(C)(C)C1CO1 HEAYDCIZOFDHRM-UHFFFAOYSA-N 0.000 description 1
- BOBGJFFADWBUBA-UHFFFAOYSA-N 3,7-dimethyl-1h-indole Chemical compound C1=CC=C2C(C)=CNC2=C1C BOBGJFFADWBUBA-UHFFFAOYSA-N 0.000 description 1
- GHDNJUIPYGURPZ-UHFFFAOYSA-N 3-(1,10-dimethyl-3,4-dihydro-[1,4]oxazino[4,3-a]indol-1-yl)-n-methylpropan-1-amine;hydrochloride Chemical compound Cl.C1=CC=C2N3CCOC(CCCNC)(C)C3=C(C)C2=C1 GHDNJUIPYGURPZ-UHFFFAOYSA-N 0.000 description 1
- JTXYXHISBMKLKI-UHFFFAOYSA-N 3-(1,10-dimethyl-3,4-dihydro-[1,4]oxazino[4,3-a]indol-1-yl)propan-1-ol Chemical compound C1=CC=C2C(C)=C3C(CCCO)(C)OCCN3C2=C1 JTXYXHISBMKLKI-UHFFFAOYSA-N 0.000 description 1
- HOFUXAVDJWRFQZ-UHFFFAOYSA-N 3-(1,10-dimethyl-3,4-dihydro-[1,4]oxazino[4,3-a]indol-1-yl)propanoic acid Chemical compound C1=CC=C2C(C)=C3C(CCC(O)=O)(C)OCCN3C2=C1 HOFUXAVDJWRFQZ-UHFFFAOYSA-N 0.000 description 1
- IVUNZVNIYOXMMO-UHFFFAOYSA-N 3-(1-methyl-4,9-dihydro-3h-indeno[2,1-c]pyran-1-yl)propan-1-amine Chemical compound C1C2=CC=CC=C2C2=C1C(C)(CCCN)OCC2 IVUNZVNIYOXMMO-UHFFFAOYSA-N 0.000 description 1
- XTQDBFNNLLTHOP-UHFFFAOYSA-N 3-(1-methyl-4,9-dihydro-3h-pyrano[3,4-b]indol-1-yl)propanoic acid Chemical compound N1C2=CC=CC=C2C2=C1C(C)(CCC(O)=O)OCC2 XTQDBFNNLLTHOP-UHFFFAOYSA-N 0.000 description 1
- NTLAICDKHHQUGC-UHFFFAOYSA-N 3-(2-bromoethyl)-1h-indole Chemical class C1=CC=C2C(CCBr)=CNC2=C1 NTLAICDKHHQUGC-UHFFFAOYSA-N 0.000 description 1
- HSHUZTGTWABGBD-UHFFFAOYSA-N 3-(3-bromobutan-2-yl)-1h-indene Chemical compound C1=CC=C2C(C(C)C(Br)C)=CCC2=C1 HSHUZTGTWABGBD-UHFFFAOYSA-N 0.000 description 1
- GOVXKUCVZUROAN-UHFFFAOYSA-N 3-ethyl-1h-indole Chemical compound C1=CC=C2C(CC)=CNC2=C1 GOVXKUCVZUROAN-UHFFFAOYSA-N 0.000 description 1
- BOXDPPLUKGIQLV-UHFFFAOYSA-N 3-indol-1-ylpropan-1-ol Chemical compound C1=CC=C2N(CCCO)C=CC2=C1 BOXDPPLUKGIQLV-UHFFFAOYSA-N 0.000 description 1
- OSWNOVFZARRSKM-UHFFFAOYSA-N 3-indol-1-ylpropanoic acid Chemical compound C1=CC=C2N(CCC(=O)O)C=CC2=C1 OSWNOVFZARRSKM-UHFFFAOYSA-N 0.000 description 1
- FDWXBWXTQDHGAC-UHFFFAOYSA-N 4-(1,10-dimethyl-3,4-dihydro-[1,4]oxazino[4,3-a]indol-1-yl)-n-ethylbutan-1-amine Chemical compound C1=CC=C2N3CCOC(CCCCNCC)(C)C3=C(C)C2=C1 FDWXBWXTQDHGAC-UHFFFAOYSA-N 0.000 description 1
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 1
- MAGOYBJJLVSJIC-UHFFFAOYSA-N 4-chlorobutan-2-one Chemical compound CC(=O)CCCl MAGOYBJJLVSJIC-UHFFFAOYSA-N 0.000 description 1
- VHLFUSYZVNXKFT-UHFFFAOYSA-N 4-indol-1-ylbutan-1-ol Chemical compound C1=CC=C2N(CCCCO)C=CC2=C1 VHLFUSYZVNXKFT-UHFFFAOYSA-N 0.000 description 1
- MQLJZFAKVWTELE-UHFFFAOYSA-N 4-indol-1-ylbutanoic acid Chemical compound C1=CC=C2N(CCCC(=O)O)C=CC2=C1 MQLJZFAKVWTELE-UHFFFAOYSA-N 0.000 description 1
- QYAHGDMPUORRQD-UHFFFAOYSA-N 4-oxopentyl acetate Chemical compound CC(=O)CCCOC(C)=O QYAHGDMPUORRQD-UHFFFAOYSA-N 0.000 description 1
- YOFYTIAEHLUATG-UHFFFAOYSA-N 5-(methylamino)pentan-2-one Chemical compound CNCCCC(C)=O YOFYTIAEHLUATG-UHFFFAOYSA-N 0.000 description 1
- XVRIEWDDMODMGA-UHFFFAOYSA-N 5-chloropentan-2-one Chemical compound CC(=O)CCCCl XVRIEWDDMODMGA-UHFFFAOYSA-N 0.000 description 1
- RZXWNQYIRHMNTQ-UHFFFAOYSA-N 5-iodopentan-2-one Chemical compound CC(=O)CCCI RZXWNQYIRHMNTQ-UHFFFAOYSA-N 0.000 description 1
- JKICHRDQVIOLQW-UHFFFAOYSA-N 5-nitrohexan-2-one Chemical compound [O-][N+](=O)C(C)CCC(C)=O JKICHRDQVIOLQW-UHFFFAOYSA-N 0.000 description 1
- 241000208140 Acer Species 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical compound OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 1
- ZNSMNVMLTJELDZ-UHFFFAOYSA-N Bis(2-chloroethyl)ether Chemical compound ClCCOCCCl ZNSMNVMLTJELDZ-UHFFFAOYSA-N 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- 101100220616 Caenorhabditis elegans chk-2 gene Proteins 0.000 description 1
- 101100334117 Caenorhabditis elegans fah-1 gene Proteins 0.000 description 1
- 101100205030 Caenorhabditis elegans hars-1 gene Proteins 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- KRKNYBCHXYNGOX-UHFFFAOYSA-K Citrate Chemical compound [O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O KRKNYBCHXYNGOX-UHFFFAOYSA-K 0.000 description 1
- RWSOTUBLDIXVET-UHFFFAOYSA-N Dihydrogen sulfide Chemical compound S RWSOTUBLDIXVET-UHFFFAOYSA-N 0.000 description 1
- 238000006824 Eschweiler-Clarke methylation reaction Methods 0.000 description 1
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 1
- XXRCUYVCPSWGCC-UHFFFAOYSA-N Ethyl pyruvate Chemical compound CCOC(=O)C(C)=O XXRCUYVCPSWGCC-UHFFFAOYSA-N 0.000 description 1
- 239000005977 Ethylene Substances 0.000 description 1
- 238000006783 Fischer indole synthesis reaction Methods 0.000 description 1
- KRHYYFGTRYWZRS-UHFFFAOYSA-N Fluorane Chemical compound F KRHYYFGTRYWZRS-UHFFFAOYSA-N 0.000 description 1
- 238000005727 Friedel-Crafts reaction Methods 0.000 description 1
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 1
- JVTAAEKCZFNVCJ-UHFFFAOYSA-M Lactate Chemical compound CC(O)C([O-])=O JVTAAEKCZFNVCJ-UHFFFAOYSA-M 0.000 description 1
- 241000124008 Mammalia Species 0.000 description 1
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N N-phenyl amine Natural products NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 1
- UOPMIGZFKNWFJN-UHFFFAOYSA-O NC(C[S+]1C=CC=CC1)=O Chemical compound NC(C[S+]1C=CC=CC1)=O UOPMIGZFKNWFJN-UHFFFAOYSA-O 0.000 description 1
- 229910002651 NO3 Inorganic materials 0.000 description 1
- NHNBFGGVMKEFGY-UHFFFAOYSA-N Nitrate Chemical compound [O-][N+]([O-])=O NHNBFGGVMKEFGY-UHFFFAOYSA-N 0.000 description 1
- 102100026100 Nucleolar RNA helicase 2 Human genes 0.000 description 1
- 101710118021 Nucleolar RNA helicase 2 Proteins 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- TZRXHJWUDPFEEY-UHFFFAOYSA-N Pentaerythritol Tetranitrate Chemical compound [O-][N+](=O)OCC(CO[N+]([O-])=O)(CO[N+]([O-])=O)CO[N+]([O-])=O TZRXHJWUDPFEEY-UHFFFAOYSA-N 0.000 description 1
- XBDQKXXYIPTUBI-UHFFFAOYSA-N Propionic acid Substances CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 1
- 241000700157 Rattus norvegicus Species 0.000 description 1
- QEQITBGKBZIJOX-UHFFFAOYSA-M S(=S)(=O)(OCC)[O-].CC1=CNC2=CC=CC=C12.[K+] Chemical compound S(=S)(=O)(OCC)[O-].CC1=CNC2=CC=CC=C12.[K+] QEQITBGKBZIJOX-UHFFFAOYSA-M 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- 244000299461 Theobroma cacao Species 0.000 description 1
- 235000009470 Theobroma cacao Nutrition 0.000 description 1
- 229910021626 Tin(II) chloride Inorganic materials 0.000 description 1
- 208000025865 Ulcer Diseases 0.000 description 1
- MCRWZBYTLVCCJJ-DKALBXGISA-N [(1s,3r)-3-[[(3s,4s)-3-methoxyoxan-4-yl]amino]-1-propan-2-ylcyclopentyl]-[(1s,4s)-5-[6-(trifluoromethyl)pyrimidin-4-yl]-2,5-diazabicyclo[2.2.1]heptan-2-yl]methanone Chemical compound C([C@]1(N(C[C@]2([H])C1)C(=O)[C@@]1(C[C@@H](CC1)N[C@@H]1[C@@H](COCC1)OC)C(C)C)[H])N2C1=CC(C(F)(F)F)=NC=N1 MCRWZBYTLVCCJJ-DKALBXGISA-N 0.000 description 1
- FHKPLLOSJHHKNU-INIZCTEOSA-N [(3S)-3-[8-(1-ethyl-5-methylpyrazol-4-yl)-9-methylpurin-6-yl]oxypyrrolidin-1-yl]-(oxan-4-yl)methanone Chemical compound C(C)N1N=CC(=C1C)C=1N(C2=NC=NC(=C2N=1)O[C@@H]1CN(CC1)C(=O)C1CCOCC1)C FHKPLLOSJHHKNU-INIZCTEOSA-N 0.000 description 1
- JFBZPFYRPYOZCQ-UHFFFAOYSA-N [Li].[Al] Chemical compound [Li].[Al] JFBZPFYRPYOZCQ-UHFFFAOYSA-N 0.000 description 1
- LMQRHCUJKBNBSN-UHFFFAOYSA-N [O-]C(C[S+]1C=CC=CC1)=O Chemical compound [O-]C(C[S+]1C=CC=CC1)=O LMQRHCUJKBNBSN-UHFFFAOYSA-N 0.000 description 1
- 150000003973 alkyl amines Chemical group 0.000 description 1
- 150000001350 alkyl halides Chemical class 0.000 description 1
- 239000002168 alkylating agent Substances 0.000 description 1
- 229940100198 alkylating agent Drugs 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 1
- 230000000202 analgesic effect Effects 0.000 description 1
- 150000001448 anilines Chemical class 0.000 description 1
- 230000000844 anti-bacterial effect Effects 0.000 description 1
- 230000000843 anti-fungal effect Effects 0.000 description 1
- 230000003110 anti-inflammatory effect Effects 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- 235000013405 beer Nutrition 0.000 description 1
- 230000008901 benefit Effects 0.000 description 1
- 150000001555 benzenes Chemical class 0.000 description 1
- 150000003939 benzylamines Chemical class 0.000 description 1
- WQZGKKKJIJFFOK-VFUOTHLCSA-N beta-D-glucose Chemical compound OC[C@H]1O[C@@H](O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-VFUOTHLCSA-N 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- SIPUZPBQZHNSDW-UHFFFAOYSA-N bis(2-methylpropyl)aluminum Chemical compound CC(C)C[Al]CC(C)C SIPUZPBQZHNSDW-UHFFFAOYSA-N 0.000 description 1
- VHAXQSFPTJUMLT-UHFFFAOYSA-N bis(3-methylbutan-2-yl)boron Chemical compound CC(C)C(C)[B]C(C)C(C)C VHAXQSFPTJUMLT-UHFFFAOYSA-N 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 235000014633 carbohydrates Nutrition 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 210000004027 cell Anatomy 0.000 description 1
- 230000008859 change Effects 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 239000004927 clay Substances 0.000 description 1
- 239000013256 coordination polymer Substances 0.000 description 1
- 150000004292 cyclic ethers Chemical class 0.000 description 1
- 125000004122 cyclic group Chemical group 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 230000018044 dehydration Effects 0.000 description 1
- 238000006297 dehydration reaction Methods 0.000 description 1
- 230000001419 dependent effect Effects 0.000 description 1
- 230000000994 depressogenic effect Effects 0.000 description 1
- 125000000664 diazo group Chemical group [N-]=[N+]=[*] 0.000 description 1
- GLUUGHFHXGJENI-UHFFFAOYSA-N diethylenediamine Natural products C1CNCCN1 GLUUGHFHXGJENI-UHFFFAOYSA-N 0.000 description 1
- UTCFREZFQSHYLP-UHFFFAOYSA-N dimethyl(3-oxobutyl)azanium;chloride Chemical compound Cl.CN(C)CCC(C)=O UTCFREZFQSHYLP-UHFFFAOYSA-N 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 239000003480 eluent Substances 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- WUBUHPZTDFJNDA-UHFFFAOYSA-N ethoxy-hydroxy-oxo-sulfanylidene-$l^{6}-sulfane Chemical class CCOS(O)(=O)=S WUBUHPZTDFJNDA-UHFFFAOYSA-N 0.000 description 1
- ZKQFHRVKCYFVCN-UHFFFAOYSA-N ethoxyethane;hexane Chemical compound CCOCC.CCCCCC ZKQFHRVKCYFVCN-UHFFFAOYSA-N 0.000 description 1
- WVNRFZNIVDFLFZ-UHFFFAOYSA-N ethyl 2-(1,10-dimethyl-3,4-dihydro-[1,4]oxazino[4,3-a]indol-1-yl)acetate Chemical compound C1=CC=C2N3CCOC(CC(=O)OCC)(C)C3=C(C)C2=C1 WVNRFZNIVDFLFZ-UHFFFAOYSA-N 0.000 description 1
- CCQGLFFEFDEDJR-UHFFFAOYSA-N ethyl 2-(1-methyl-4,9-dihydro-3h-pyrano[3,4-b]indol-1-yl)acetate Chemical compound N1C2=CC=CC=C2C2=C1C(CC(=O)OCC)(C)OCC2 CCQGLFFEFDEDJR-UHFFFAOYSA-N 0.000 description 1
- FVHZAUFNFDXHTQ-UHFFFAOYSA-N ethyl 2-(3-methylindol-1-yl)acetate Chemical compound C1=CC=C2N(CC(=O)OCC)C=C(C)C2=C1 FVHZAUFNFDXHTQ-UHFFFAOYSA-N 0.000 description 1
- OSTWGXIRILCGNK-UHFFFAOYSA-N ethyl 3-(1-methyl-4,9-dihydro-3h-pyrano[3,4-b]indol-1-yl)propanoate Chemical compound N1C2=CC=CC=C2C2=C1C(CCC(=O)OCC)(C)OCC2 OSTWGXIRILCGNK-UHFFFAOYSA-N 0.000 description 1
- VGFGMNSKSUCONE-UHFFFAOYSA-N ethyl 3-indol-1-ylpropanoate Chemical compound C1=CC=C2N(CCC(=O)OCC)C=CC2=C1 VGFGMNSKSUCONE-UHFFFAOYSA-N 0.000 description 1
- PQJJJMRNHATNKG-UHFFFAOYSA-N ethyl bromoacetate Chemical compound CCOC(=O)CBr PQJJJMRNHATNKG-UHFFFAOYSA-N 0.000 description 1
- 235000019253 formic acid Nutrition 0.000 description 1
- 238000001640 fractional crystallisation Methods 0.000 description 1
- 239000000295 fuel oil Substances 0.000 description 1
- 229940083124 ganglion-blocking antiadrenergic secondary and tertiary amines Drugs 0.000 description 1
- 239000008103 glucose Substances 0.000 description 1
- 150000008282 halocarbons Chemical class 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 239000001307 helium Substances 0.000 description 1
- 229910052734 helium Inorganic materials 0.000 description 1
- SWQJXJOGLNCZEY-UHFFFAOYSA-N helium atom Chemical compound [He] SWQJXJOGLNCZEY-UHFFFAOYSA-N 0.000 description 1
- 150000002391 heterocyclic compounds Chemical class 0.000 description 1
- YPGCWEMNNLXISK-UHFFFAOYSA-N hydratropic acid Chemical class OC(=O)C(C)C1=CC=CC=C1 YPGCWEMNNLXISK-UHFFFAOYSA-N 0.000 description 1
- 229960002050 hydrofluoric acid Drugs 0.000 description 1
- 229910000037 hydrogen sulfide Inorganic materials 0.000 description 1
- QNXSIUBBGPHDDE-UHFFFAOYSA-N indan-1-one Chemical compound C1=CC=C2C(=O)CCC2=C1 QNXSIUBBGPHDDE-UHFFFAOYSA-N 0.000 description 1
- SXTIMGKLZDIKTK-UHFFFAOYSA-N indeno[2,1-c]pyran Chemical class C1=COC=C2C=C(C=CC=C3)C3=C21 SXTIMGKLZDIKTK-UHFFFAOYSA-N 0.000 description 1
- 125000003454 indenyl group Chemical group C1(C=CC2=CC=CC=C12)* 0.000 description 1
- 125000001041 indolyl group Chemical group 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- HVTICUPFWKNHNG-UHFFFAOYSA-N iodoethane Chemical compound CCI HVTICUPFWKNHNG-UHFFFAOYSA-N 0.000 description 1
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 231100000053 low toxicity Toxicity 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- KEBJNFBBNGKUMX-UHFFFAOYSA-N methyl 2-(1,10-dimethyl-3,4-dihydro-[1,4]oxazino[4,3-a]indol-1-yl)acetate Chemical compound C1=CC=C2N3CCOC(CC(=O)OC)(C)C3=C(C)C2=C1 KEBJNFBBNGKUMX-UHFFFAOYSA-N 0.000 description 1
- AFOFTSBHECYADG-UHFFFAOYSA-N methyl 2-(1-methyl-4,9-dihydro-3h-indeno[2,1-c]pyran-1-yl)acetate Chemical compound C1C2=CC=CC=C2C2=C1C(CC(=O)OC)(C)OCC2 AFOFTSBHECYADG-UHFFFAOYSA-N 0.000 description 1
- URXFAMDQERDBFY-UHFFFAOYSA-N methyl 4-methylbenzenesulfonate;1-methyl-1,3,4,9-tetrahydroindeno[2,1-c]pyran Chemical compound COS(=O)(=O)C1=CC=C(C)C=C1.C1C2=CC=CC=C2C2=C1C(C)OCC2 URXFAMDQERDBFY-UHFFFAOYSA-N 0.000 description 1
- 229940102396 methyl bromide Drugs 0.000 description 1
- 150000004702 methyl esters Chemical class 0.000 description 1
- JZMJDSHXVKJFKW-UHFFFAOYSA-N methyl sulfate Chemical class COS(O)(=O)=O JZMJDSHXVKJFKW-UHFFFAOYSA-N 0.000 description 1
- 239000002480 mineral oil Substances 0.000 description 1
- 235000010446 mineral oil Nutrition 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 125000000896 monocarboxylic acid group Chemical group 0.000 description 1
- GHFIYNHDQCRRFT-UHFFFAOYSA-N n,n-diethyl-2-(1-methyl-4,9-dihydro-3h-pyrano[3,4-b]indol-1-yl)acetamide Chemical compound N1C2=CC=CC=C2C2=C1C(CC(=O)N(CC)CC)(C)OCC2 GHFIYNHDQCRRFT-UHFFFAOYSA-N 0.000 description 1
- CBCFMMAHHIFBRZ-UHFFFAOYSA-N n,n-diethyl-2-(10-methyl-1-propyl-3,4-dihydro-[1,4]oxazino[4,3-a]indol-1-yl)acetamide Chemical compound C1=CC=C2N3CCOC(CCC)(CC(=O)N(CC)CC)C3=C(C)C2=C1 CBCFMMAHHIFBRZ-UHFFFAOYSA-N 0.000 description 1
- RWJJJPHJIPSNSZ-UHFFFAOYSA-N n,n-dimethyl-2-(1-methyl-4,9-dihydro-3h-indeno[2,1-c]pyran-1-yl)acetamide Chemical compound C1C2=CC=CC=C2C2=C1C(CC(=O)N(C)C)(C)OCC2 RWJJJPHJIPSNSZ-UHFFFAOYSA-N 0.000 description 1
- LDOPKXRVZCACGO-UHFFFAOYSA-N n,n-dimethyl-2-(1-methyl-4,9-dihydro-3h-indeno[2,1-c]thiopyran-1-yl)acetamide Chemical compound C1C2=CC=CC=C2C2=C1C(CC(=O)N(C)C)(C)SCC2 LDOPKXRVZCACGO-UHFFFAOYSA-N 0.000 description 1
- OVTMPEOMIAZTTB-UHFFFAOYSA-N n,n-dimethyl-2-(1-methyl-4,9-dihydro-3h-pyrano[3,4-b]indol-1-yl)ethanamine;oxalic acid Chemical compound OC(=O)C(O)=O.N1C2=CC=CC=C2C2=C1C(CCN(C)C)(C)OCC2 OVTMPEOMIAZTTB-UHFFFAOYSA-N 0.000 description 1
- QHVDLKNOBGXAJZ-UHFFFAOYSA-N n,n-dimethyl-2-(1-methyl-4,9-dihydro-3h-thiopyrano[3,4-b]indol-1-yl)ethanamine Chemical compound N1C2=CC=CC=C2C2=C1C(CCN(C)C)(C)SCC2 QHVDLKNOBGXAJZ-UHFFFAOYSA-N 0.000 description 1
- JKKHZEVHQJZTNQ-UHFFFAOYSA-N n,n-dimethyl-2-oxopropanamide Chemical compound CN(C)C(=O)C(C)=O JKKHZEVHQJZTNQ-UHFFFAOYSA-N 0.000 description 1
- YPEWWOUWRRQBAX-UHFFFAOYSA-N n,n-dimethyl-3-oxobutanamide Chemical compound CN(C)C(=O)CC(C)=O YPEWWOUWRRQBAX-UHFFFAOYSA-N 0.000 description 1
- SICIPBMLFSQZEQ-UHFFFAOYSA-N n-(2-oxopropyl)acetamide Chemical compound CC(=O)CNC(C)=O SICIPBMLFSQZEQ-UHFFFAOYSA-N 0.000 description 1
- CAQXYVTYTTXGKW-UHFFFAOYSA-N n-(2-oxopropyl)formamide Chemical compound CC(=O)CNC=O CAQXYVTYTTXGKW-UHFFFAOYSA-N 0.000 description 1
- HJSYCVYFTIIOPM-UHFFFAOYSA-N n-(4-oxopentyl)acetamide Chemical compound CC(=O)CCCNC(C)=O HJSYCVYFTIIOPM-UHFFFAOYSA-N 0.000 description 1
- OYMZZUUNRPGOFF-UHFFFAOYSA-N n-[(1-methyl-4,9-dihydro-3h-pyrano[3,4-b]indol-1-yl)methyl]acetamide Chemical compound N1C2=CC=CC=C2C2=C1C(CNC(=O)C)(C)OCC2 OYMZZUUNRPGOFF-UHFFFAOYSA-N 0.000 description 1
- HORVOSLOFGUWNL-UHFFFAOYSA-N n-[(1-methyl-4,9-dihydro-3h-pyrano[3,4-b]indol-1-yl)methyl]ethanamine;hydrochloride Chemical compound Cl.N1C2=CC=CC=C2C2=C1C(CNCC)(C)OCC2 HORVOSLOFGUWNL-UHFFFAOYSA-N 0.000 description 1
- SYHNWOQQLOJFSF-UHFFFAOYSA-N n-[3-(1,10-dimethyl-3,4-dihydro-[1,4]oxazino[4,3-a]indol-1-yl)propyl]acetamide Chemical compound C1=CC=C2N3CCOC(CCCNC(=O)C)(C)C3=C(C)C2=C1 SYHNWOQQLOJFSF-UHFFFAOYSA-N 0.000 description 1
- FETIGWPQKYLRIY-UHFFFAOYSA-N n-[3-(1-methyl-4,9-dihydro-3h-indeno[2,1-c]pyran-1-yl)propyl]acetamide Chemical compound C1C2=CC=CC=C2C2=C1C(CCCNC(=O)C)(C)OCC2 FETIGWPQKYLRIY-UHFFFAOYSA-N 0.000 description 1
- VLWJKVNMRMHPCC-UHFFFAOYSA-N n-benzyl-2-chloro-n-(2-chloroethyl)ethanamine Chemical compound ClCCN(CCCl)CC1=CC=CC=C1 VLWJKVNMRMHPCC-UHFFFAOYSA-N 0.000 description 1
- FMHUDZWSUHQHLW-UHFFFAOYSA-N n-ethyl-2-(1-methyl-4,9-dihydro-3h-pyrano[3,4-b]indol-1-yl)acetamide Chemical compound N1C2=CC=CC=C2C2=C1C(CC(=O)NCC)(C)OCC2 FMHUDZWSUHQHLW-UHFFFAOYSA-N 0.000 description 1
- MRWYYQKCLOSRMI-UHFFFAOYSA-N n-methyl-2-(1-methyl-4,9-dihydro-3h-pyrano[3,4-b]indol-1-yl)ethanamine Chemical compound N1C2=CC=CC=C2C2=C1C(CCNC)(C)OCC2 MRWYYQKCLOSRMI-UHFFFAOYSA-N 0.000 description 1
- PVWOIHVRPOBWPI-UHFFFAOYSA-N n-propyl iodide Chemical compound CCCI PVWOIHVRPOBWPI-UHFFFAOYSA-N 0.000 description 1
- ODUCDPQEXGNKDN-UHFFFAOYSA-N nitroxyl Chemical class O=N ODUCDPQEXGNKDN-UHFFFAOYSA-N 0.000 description 1
- 229940078552 o-xylene Drugs 0.000 description 1
- 239000004533 oil dispersion Substances 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- 230000020477 pH reduction Effects 0.000 description 1
- 238000007911 parenteral administration Methods 0.000 description 1
- PGMYKACGEOXYJE-UHFFFAOYSA-N pentyl acetate Chemical compound CCCCCOC(C)=O PGMYKACGEOXYJE-UHFFFAOYSA-N 0.000 description 1
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 1
- 239000000546 pharmaceutical excipient Substances 0.000 description 1
- HKOOXMFOFWEVGF-UHFFFAOYSA-N phenylhydrazine Chemical compound NNC1=CC=CC=C1 HKOOXMFOFWEVGF-UHFFFAOYSA-N 0.000 description 1
- 229940067157 phenylhydrazine Drugs 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- 239000010452 phosphate Substances 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- 230000001376 precipitating effect Effects 0.000 description 1
- 230000002265 prevention Effects 0.000 description 1
- SSOLNOMRVKKSON-UHFFFAOYSA-N proguanil Chemical compound CC(C)\N=C(/N)N=C(N)NC1=CC=C(Cl)C=C1 SSOLNOMRVKKSON-UHFFFAOYSA-N 0.000 description 1
- OVZJDIHKFDBWJQ-UHFFFAOYSA-N propyl 2-(1,10-dimethyl-3,4-dihydro-[1,4]oxazino[4,3-a]indol-1-yl)acetate Chemical compound C1=CC=C2N3CCOC(CC(=O)OCCC)(C)C3=C(C)C2=C1 OVZJDIHKFDBWJQ-UHFFFAOYSA-N 0.000 description 1
- UVLZNQQORZJXKO-UHFFFAOYSA-N propyl 2-(1-methyl-4,9-dihydro-3h-pyrano[3,4-b]indol-1-yl)acetate Chemical compound N1C2=CC=CC=C2C2=C1C(CC(=O)OCCC)(C)OCC2 UVLZNQQORZJXKO-UHFFFAOYSA-N 0.000 description 1
- 230000001681 protective effect Effects 0.000 description 1
- 230000001003 psychopharmacologic effect Effects 0.000 description 1
- DULBEIKUQPJAST-UHFFFAOYSA-N pyrano[3,4-b]indole Chemical compound O1C=CC2=C3C=CC=CC3=NC2=C1 DULBEIKUQPJAST-UHFFFAOYSA-N 0.000 description 1
- 125000004309 pyranyl group Chemical group O1C(C=CC=C1)* 0.000 description 1
- 150000003254 radicals Chemical class 0.000 description 1
- 239000012429 reaction media Substances 0.000 description 1
- 239000012048 reactive intermediate Substances 0.000 description 1
- 238000011946 reduction process Methods 0.000 description 1
- 238000007363 ring formation reaction Methods 0.000 description 1
- 235000010265 sodium sulphite Nutrition 0.000 description 1
- 239000001119 stannous chloride Substances 0.000 description 1
- 235000011150 stannous chloride Nutrition 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 239000008174 sterile solution Substances 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- PXQLVRUNWNTZOS-UHFFFAOYSA-N sulfanyl Chemical class [SH] PXQLVRUNWNTZOS-UHFFFAOYSA-N 0.000 description 1
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 1
- BRPOADLGOFPKKJ-UHFFFAOYSA-N tandamine Chemical compound C12=CC=CC=C2N(CC)C2=C1CCSC2(C)CCN(C)C BRPOADLGOFPKKJ-UHFFFAOYSA-N 0.000 description 1
- 229940095064 tartrate Drugs 0.000 description 1
- 150000003511 tertiary amides Chemical class 0.000 description 1
- 238000012360 testing method Methods 0.000 description 1
- 229940124597 therapeutic agent Drugs 0.000 description 1
- 150000004882 thiopyrans Chemical class 0.000 description 1
- 231100000419 toxicity Toxicity 0.000 description 1
- 230000001988 toxicity Effects 0.000 description 1
- 230000009466 transformation Effects 0.000 description 1
- 231100000397 ulcer Toxicity 0.000 description 1
- 239000002699 waste material Substances 0.000 description 1
- 239000011592 zinc chloride Substances 0.000 description 1
- 235000005074 zinc chloride Nutrition 0.000 description 1
- 150000004798 β-ketoamides Chemical class 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D495/00—Heterocyclic compounds containing in the condensed system at least one hetero ring having sulfur atoms as the only ring hetero atoms
- C07D495/02—Heterocyclic compounds containing in the condensed system at least one hetero ring having sulfur atoms as the only ring hetero atoms in which the condensed system contains two hetero rings
- C07D495/04—Ortho-condensed systems
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C321/00—Thiols, sulfides, hydropolysulfides or polysulfides
- C07C321/02—Thiols having mercapto groups bound to acyclic carbon atoms
- C07C321/10—Thiols having mercapto groups bound to acyclic carbon atoms of an unsaturated carbon skeleton containing rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D209/00—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D209/02—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom condensed with one carbocyclic ring
- C07D209/04—Indoles; Hydrogenated indoles
- C07D209/08—Indoles; Hydrogenated indoles with only hydrogen atoms or radicals containing only hydrogen and carbon atoms, directly attached to carbon atoms of the hetero ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D311/00—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only hetero atom, condensed with other rings
- C07D311/02—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only hetero atom, condensed with other rings ortho- or peri-condensed with carbocyclic rings or ring systems
- C07D311/94—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only hetero atom, condensed with other rings ortho- or peri-condensed with carbocyclic rings or ring systems condensed with rings other than six-membered or with ring systems containing such rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D513/00—Heterocyclic compounds containing in the condensed system at least one hetero ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for in groups C07D463/00, C07D477/00 or C07D499/00 - C07D507/00
- C07D513/02—Heterocyclic compounds containing in the condensed system at least one hetero ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for in groups C07D463/00, C07D477/00 or C07D499/00 - C07D507/00 in which the condensed system contains two hetero rings
- C07D513/04—Ortho-condensed systems
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C2602/00—Systems containing two condensed rings
- C07C2602/02—Systems containing two condensed rings the rings having only two atoms in common
- C07C2602/04—One of the condensed rings being a six-membered aromatic ring
- C07C2602/08—One of the condensed rings being a six-membered aromatic ring the other ring being five-membered, e.g. indane
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Indole Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (8)
Application Number | Priority Date | Filing Date | Title |
---|---|---|---|
US21762772 | 1972-01-13 | ||
US00217627A US3852285A (en) | 1972-01-13 | 1972-01-13 | Pyrano- and thiopyranoindole derivatives |
US00226287A US3833575A (en) | 1972-02-14 | 1972-02-14 | Oxazinoindole-and thiazinoindole derivatives |
US22628772 | 1972-02-14 | ||
US29712972A | 1972-10-12 | 1972-10-12 | |
US297130A US3904617A (en) | 1972-10-12 | 1972-10-12 | Process for preparing new heterocyclic derivatives |
US29712972 | 1972-10-12 | ||
US29713072 | 1972-10-12 |
Publications (2)
Publication Number | Publication Date |
---|---|
DK141201B true DK141201B (da) | 1980-02-04 |
DK141201C DK141201C (enrdf_load_stackoverflow) | 1980-07-28 |
Family
ID=27499082
Family Applications (1)
Application Number | Title | Priority Date | Filing Date |
---|---|---|---|
DK20973AA DK141201B (da) | 1972-01-13 | 1973-01-12 | Analogifremgangsmåde til fremstilling af derivater af pyranoindol, oxazinoindol og indenopyran samt deres thioanaloge eller syreadditionssalte deraf. |
Country Status (7)
Country | Link |
---|---|
BE (1) | BE793978A (enrdf_load_stackoverflow) |
CH (3) | CH606030A5 (enrdf_load_stackoverflow) |
DK (1) | DK141201B (enrdf_load_stackoverflow) |
IL (1) | IL41130A (enrdf_load_stackoverflow) |
NL (1) | NL7300518A (enrdf_load_stackoverflow) |
SE (1) | SE392274B (enrdf_load_stackoverflow) |
SU (1) | SU728716A3 (enrdf_load_stackoverflow) |
Cited By (1)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
EP1683521A1 (en) * | 2005-01-21 | 2006-07-26 | Centre National De La Recherche Scientifique (Cnrs) | Peptide deformylase inhibitors, their use, and pharmaceutical compositions containing the same |
-
0
- BE BE793978D patent/BE793978A/xx not_active IP Right Cessation
-
1972
- 1972-12-20 IL IL41130A patent/IL41130A/en unknown
-
1973
- 1973-01-12 CH CH1530677A patent/CH606030A5/xx not_active IP Right Cessation
- 1973-01-12 DK DK20973AA patent/DK141201B/da unknown
- 1973-01-12 CH CH48773A patent/CH605959A5/de not_active IP Right Cessation
- 1973-01-12 SE SE7300471A patent/SE392274B/xx unknown
- 1973-01-12 NL NL7300518A patent/NL7300518A/xx not_active Application Discontinuation
- 1973-01-12 SU SU731873352A patent/SU728716A3/ru active
- 1973-01-12 CH CH1530777A patent/CH606031A5/xx not_active IP Right Cessation
Cited By (3)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
EP1683521A1 (en) * | 2005-01-21 | 2006-07-26 | Centre National De La Recherche Scientifique (Cnrs) | Peptide deformylase inhibitors, their use, and pharmaceutical compositions containing the same |
WO2006077139A3 (en) * | 2005-01-21 | 2006-09-14 | Centre Nat Rech Scient | Peptide deformylase inhibitors, their use, and pharmaceutical compositions containing the same |
JP2008528455A (ja) * | 2005-01-21 | 2008-07-31 | サントル ナシオナル ドゥ ラ ルシェルシェ シアンティフィク | ペプチドデホルミラーゼ阻害物質、その使用、及びそれを含む医薬組成物 |
Also Published As
Publication number | Publication date |
---|---|
IL41130A (en) | 1976-05-31 |
SU728716A3 (ru) | 1980-04-15 |
BE793978A (fr) | 1973-07-12 |
DK141201C (enrdf_load_stackoverflow) | 1980-07-28 |
CH606030A5 (enrdf_load_stackoverflow) | 1978-10-13 |
CH605959A5 (en) | 1978-10-13 |
IL41130A0 (en) | 1973-02-28 |
CH606031A5 (enrdf_load_stackoverflow) | 1978-10-13 |
NL7300518A (enrdf_load_stackoverflow) | 1973-07-17 |
SE392274B (sv) | 1977-03-21 |
Similar Documents
Publication | Publication Date | Title |
---|---|---|
PT89264B (pt) | Processo para a preparacao de compostos azabiciclicos | |
US3192204A (en) | Trifluoromethylthiaxanthene and -xanthene derivatives | |
US4041169A (en) | Pharmaceutical method for using pyrano-and thiopyranoindole derivatives | |
NZ250682A (en) | Heterotricyclyloxoalkyl substituted piperidine, piperazine and 4-benzylpiperidine derivatives, their preparation and pharmaceutical compositions | |
US3880853A (en) | Pyrano-and thiopyranoindole | |
DK141201B (da) | Analogifremgangsmåde til fremstilling af derivater af pyranoindol, oxazinoindol og indenopyran samt deres thioanaloge eller syreadditionssalte deraf. | |
US3478051A (en) | Azecino- and azonino(5,4-b)indoles | |
KR100433609B1 (ko) | 트리사이클릭 벤조[e]이소인돌 및 벤조[h]이소퀴놀린 | |
US3833575A (en) | Oxazinoindole-and thiazinoindole derivatives | |
US4085210A (en) | Novel morpholine derivatives and the treatment of mental depression | |
US3641056A (en) | 10-(aminomethyl)- and (aminoethyl)-dibenz (b f)oxepins | |
US4003913A (en) | Pyrano- and thiopyranoindole derivatives, compositions and methods of use | |
JP3286056B2 (ja) | 三環式縮合複素環誘導体、その製造法および用途 | |
US4987137A (en) | Certain 6,7,8,9-tetrahydropyrido[1,2-α]indoles and their use for the treatment of cerebrovascular disorders | |
US4118394A (en) | Pyrano- and thiopyranoindole derivatives | |
US3852285A (en) | Pyrano- and thiopyranoindole derivatives | |
CA1321197C (en) | 2,3-dihydro-1h-phenalene-2-amino compounds as anti-psychotic drugs | |
US3910901A (en) | Oxazinoindole- and thiazinoindole derivatives | |
US3700691A (en) | 3,3-disubstituted-3,4-dihydrobenzodioxepins | |
CA1036596A (en) | Oxazinoindole-and thiazinoindole derivatives | |
US4066763A (en) | Thiazinoindoles useful as antidepressants | |
US3995052A (en) | Indenopyran- and indenothiopyranalkylamines III in the treatment of depression | |
US3800044A (en) | Pharmaceutical methods using a substituted 10-aminoalkyl-9,10-dihydroanthracene | |
US3952017A (en) | Tricyclic compounds | |
US4056537A (en) | Process for making pyrano- and thiopyranoindole derivatives |