DK139754B - Analogifremgangsmåde til fremstilling af heterocyclisk acyl-substituered ampicillin-derivater. - Google Patents
Analogifremgangsmåde til fremstilling af heterocyclisk acyl-substituered ampicillin-derivater.Info
- Publication number
- DK139754B DK139754B DK248973AA DK248973A DK139754B DK 139754 B DK139754 B DK 139754B DK 248973A A DK248973A A DK 248973AA DK 248973 A DK248973 A DK 248973A DK 139754 B DK139754 B DK 139754B
- Authority
- DK
- Denmark
- Prior art keywords
- substituted
- preparation
- analogous process
- heterocyclic acyl
- ampicillin
- Prior art date
Links
- AVKUERGKIZMTKX-NJBDSQKTSA-N ampicillin Chemical class C1([C@@H](N)C(=O)N[C@H]2[C@H]3SC([C@@H](N3C2=O)C(O)=O)(C)C)=CC=CC=C1 AVKUERGKIZMTKX-NJBDSQKTSA-N 0.000 title 1
- 125000000623 heterocyclic group Chemical group 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D499/00—Heterocyclic compounds containing 4-thia-1-azabicyclo [3.2.0] heptane ring systems, i.e. compounds containing a ring system of the formula:, e.g. penicillins, penems; Such ring systems being further condensed, e.g. 2,3-condensed with an oxygen-, nitrogen- or sulfur-containing hetero ring
- C07D499/21—Heterocyclic compounds containing 4-thia-1-azabicyclo [3.2.0] heptane ring systems, i.e. compounds containing a ring system of the formula:, e.g. penicillins, penems; Such ring systems being further condensed, e.g. 2,3-condensed with an oxygen-, nitrogen- or sulfur-containing hetero ring with a nitrogen atom directly attached in position 6 and a carbon atom having three bonds to hetero atoms with at the most one bond to halogen, e.g. an ester or nitrile radical, directly attached in position 2
- C07D499/44—Compounds with an amino radical acylated by carboxylic acids, attached in position 6
- C07D499/48—Compounds with an amino radical acylated by carboxylic acids, attached in position 6 with a carbon chain, substituted by hetero atoms or by carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, attached to the carboxamido radical
- C07D499/58—Compounds with an amino radical acylated by carboxylic acids, attached in position 6 with a carbon chain, substituted by hetero atoms or by carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, attached to the carboxamido radical substituted in alpha-position to the carboxamido radical
- C07D499/64—Compounds with an amino radical acylated by carboxylic acids, attached in position 6 with a carbon chain, substituted by hetero atoms or by carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, attached to the carboxamido radical substituted in alpha-position to the carboxamido radical by nitrogen atoms
- C07D499/68—Compounds with an amino radical acylated by carboxylic acids, attached in position 6 with a carbon chain, substituted by hetero atoms or by carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, attached to the carboxamido radical substituted in alpha-position to the carboxamido radical by nitrogen atoms with aromatic rings as additional substituents on the carbon chain
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (7)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP4511872A JPS5547036B2 (da) | 1972-05-08 | 1972-05-08 | |
| JP8342472A JPS4941396A (da) | 1972-08-21 | 1972-08-21 | |
| JP8510272A JPS4942692A (da) | 1972-08-25 | 1972-08-25 | |
| JP8510372A JPS4942693A (da) | 1972-08-25 | 1972-08-25 | |
| JP12595272A JPS4981388A (da) | 1972-12-15 | 1972-12-15 | |
| JP1991773A JPS49108092A (da) | 1973-02-18 | 1973-02-18 | |
| JP3813273A JPS49125386A (da) | 1973-04-04 | 1973-04-04 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DK139754B true DK139754B (da) | 1979-04-09 |
| DK139754C DK139754C (da) | 1979-09-24 |
Family
ID=27563884
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DK248973AA DK139754B (da) | 1972-05-08 | 1973-05-07 | Analogifremgangsmåde til fremstilling af heterocyclisk acyl-substituered ampicillin-derivater. |
Country Status (10)
| Country | Link |
|---|---|
| US (1) | US3953428A (da) |
| AR (2) | AR204162A1 (da) |
| AT (1) | AT331970B (da) |
| BE (1) | BE799202A (da) |
| CA (1) | CA1050971A (da) |
| DE (1) | DE2322750A1 (da) |
| DK (1) | DK139754B (da) |
| FI (1) | FI58131C (da) |
| FR (1) | FR2183895B1 (da) |
| GB (1) | GB1407566A (da) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DK151338B (da) * | 1974-05-09 | 1987-11-23 | Toyama Chemical Co Ltd | Analogifremgangsmaade til fremstilling af racemiske eller optisk aktive penicilliner eller cephalosporiner |
Families Citing this family (27)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4202900A (en) * | 1972-09-27 | 1980-05-13 | Ciba-Geigy Corporation | Derivatives of penam-3-carboxylic acid and a pharmaceutical composition containing the same |
| JPS5751837B2 (da) * | 1973-04-05 | 1982-11-04 | ||
| US3994874A (en) * | 1973-11-07 | 1976-11-30 | Richardson-Merrell Inc. | 6-[(2-Oxo-1-pyridinyl)acylamino]penicillin derivatives |
| US3954734A (en) * | 1974-01-21 | 1976-05-04 | Parke, Davis & Company | Novel antibacterial amide compounds and process means for producing the same |
| US3989687A (en) * | 1974-09-27 | 1976-11-02 | Richardson-Merrell Inc. | 4-Oxo-1-pyridinyl penicillin derivatives |
| GB1568962A (en) * | 1975-10-31 | 1980-06-11 | Beecham Group Ltd | Reparation and compositions containing them (heterocyclic-carbonylamino)pencillins methods for their p |
| NZ184434A (en) * | 1976-06-30 | 1979-03-28 | Dainippon Pharmaceutical Co | Penicillins with a substituted p-hydroxy-benzyl side-chain, and injectable pharmaceutical compositions |
| GB1579362A (en) * | 1977-03-16 | 1980-11-19 | Beecham Group Ltd | 6-(a-heterocyclylcarbonyl amino-acetamido)-penicillins and compositions containing them |
| EP0001041A3 (en) * | 1977-07-27 | 1979-06-27 | Sandoz Ag | Alpha(pyridonecarboxylamino)-alpha substituted acetamido penicillins and -cephalosporins, process for their preparation, their use in pharmaceuticals; pyridones used in the process |
| GB2010250B (en) * | 1977-12-06 | 1982-07-14 | Nippon Chemiphar Co | Penicillin and cephalosporin derivatives and a process for producing the same |
| US4231928A (en) * | 1979-04-24 | 1980-11-04 | Bristol-Myers Company | Antibacterial agents |
| JPS5651488A (en) * | 1979-10-02 | 1981-05-09 | Meiji Seika Kaisha Ltd | Penicillin derivative and its preparation |
| US5281612A (en) * | 1982-09-09 | 1994-01-25 | Warner-Lambert Company | Naphthyridine antibacterial agents |
| IE55898B1 (en) * | 1982-09-09 | 1991-02-14 | Warner Lambert Co | Antibacterial agents |
| IT1215277B (it) * | 1985-05-27 | 1990-01-31 | Pomezia Roma A | Derivato chinolin-lattaminico ad attivita' antibatterica ed inibitrice delle b-lattamasi. |
| US5328908A (en) * | 1988-10-24 | 1994-07-12 | Procter & Gamble Pharmaceuticals, Inc. | Antimicrobial quinolone thioureas |
| US5180719A (en) * | 1988-10-24 | 1993-01-19 | Norwich Eaton Pharmaceuticals, Inc. | Antimicrobial quinolonyl lactam esters |
| EP0997466A1 (en) * | 1988-10-24 | 2000-05-03 | PROCTER & GAMBLE PHARMACEUTICALS, INC. | Novel antimicrobial lactam-quinolones |
| US5491139A (en) * | 1988-10-24 | 1996-02-13 | The Procter & Gamble Company | Antimicrobial quinolonyl lactams |
| US5273973A (en) * | 1988-10-24 | 1993-12-28 | Norwich Eaton Pharmaceuticals, Inc. | Antimicrobial quinolonyl esters |
| CA2001203C (en) * | 1988-10-24 | 2001-02-13 | Thomas P. Demuth, Jr. | Novel antimicrobial dithiocarbamoyl quinolones |
| EP0525057B1 (en) * | 1990-04-18 | 2000-06-14 | Procter & Gamble Pharmaceuticals, Inc. | Antimicrobial quinolonyl lactams |
| FR2713637B1 (fr) * | 1993-12-15 | 1996-01-05 | Cird Galderma | Nouveaux composés bi-aromatiques dérivés d'amide, compositions pharmaceutiques et cosmétiques les contenant et utilisations. |
| US6143760A (en) * | 1997-08-25 | 2000-11-07 | Neurogen Corporation | Substituted 4-oxo-napthyridine-3-carboxamides: GABA brain receptor ligands |
| BR9811362A (pt) * | 1997-08-25 | 2000-08-22 | Neurogen Corp | Composto |
| CA2569402A1 (en) * | 2004-06-04 | 2005-12-22 | The Regents Of The University Of California | Compounds having activity in increasing ion transport by mutant-cftr and uses thereof |
| AR085013A1 (es) | 2011-01-26 | 2013-08-07 | Sanofi Aventis | Derivados de acido 3-heteroaroilamino-propionico sustituidos y su uso como sustancias farmaceuticas |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1180745A (en) * | 1966-10-04 | 1970-02-11 | Beecham Group Ltd | Penicillins |
| US3668198A (en) * | 1970-06-01 | 1972-06-06 | Squibb & Sons Inc | {60 -ureido-2,4,6-cycloheptatrienylmethylpenicillins |
| US3711471A (en) * | 1971-02-03 | 1973-01-16 | Bristol Myers Co | Purification of 6-{8 d-{60 -(3-guanyl-1-ureido)phenylacetamido{9 {0 penicillanic acid |
-
1973
- 1973-01-01 AR AR251189A patent/AR204162A1/es active
- 1973-01-01 AR ARJA247904A patent/AR204813A1/es active
- 1973-04-30 CA CA169,846A patent/CA1050971A/en not_active Expired
- 1973-05-01 US US05/356,120 patent/US3953428A/en not_active Expired - Lifetime
- 1973-05-05 DE DE2322750A patent/DE2322750A1/de not_active Withdrawn
- 1973-05-07 FI FI1458/73A patent/FI58131C/fi active
- 1973-05-07 BE BE130836A patent/BE799202A/xx unknown
- 1973-05-07 AT AT399573A patent/AT331970B/de not_active IP Right Cessation
- 1973-05-07 DK DK248973AA patent/DK139754B/da not_active IP Right Cessation
- 1973-05-08 GB GB2195173A patent/GB1407566A/en not_active Expired
- 1973-05-08 FR FR7316416A patent/FR2183895B1/fr not_active Expired
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DK151338B (da) * | 1974-05-09 | 1987-11-23 | Toyama Chemical Co Ltd | Analogifremgangsmaade til fremstilling af racemiske eller optisk aktive penicilliner eller cephalosporiner |
Also Published As
| Publication number | Publication date |
|---|---|
| AR204162A1 (es) | 1975-11-28 |
| ATA399573A (de) | 1975-12-15 |
| FR2183895A1 (da) | 1973-12-21 |
| FI58131C (fi) | 1980-12-10 |
| DK139754C (da) | 1979-09-24 |
| FR2183895B1 (da) | 1976-07-02 |
| DE2322750A1 (de) | 1973-11-29 |
| GB1407566A (en) | 1975-09-24 |
| FI58131B (fi) | 1980-08-29 |
| AU5504573A (en) | 1974-11-07 |
| BE799202A (fr) | 1973-08-31 |
| US3953428A (en) | 1976-04-27 |
| AR204813A1 (es) | 1976-03-05 |
| AT331970B (de) | 1975-12-15 |
| CA1050971A (en) | 1979-03-20 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DK139754B (da) | Analogifremgangsmåde til fremstilling af heterocyclisk acyl-substituered ampicillin-derivater. | |
| DK137329B (da) | Analogifremgangsmåde til fremstilling af 2-karbalkoksyaminobenzimidazolderivater. | |
| DK134607B (da) | Fremgangsmåde til fremstilling af rapamycin. | |
| DK140340B (da) | Analogifremgangsmåde til fremstilling af benzoxazolderivater. | |
| DK136312B (da) | Analogifremgangsmåde til fremstilling af substituerede piperidinoalkanonoximderivater. | |
| DK138492B (da) | Fremgangsmåde til fremstilling af morphinanderivater. | |
| DK135505B (da) | Analogifremgangsmåde til fremstilling af morpholinderivater. | |
| DK134490B (da) | Analogifremgangsmåde til fremstilling af 2,6-diaminonebularin-derivater. | |
| DK135991B (da) | Analogifremgangsmåde til fremstilling af 2-oxazolinderivater. | |
| DK151628C (da) | Analogifremgangsmaade til fremstilling af benzimidazolderivater | |
| DK136360B (da) | Analogifremgangsmåde til fremstilling af isoindolinderivater. | |
| DK145878C (da) | Analogifremgangsmaade til fremstilling af alkylthiocyclopentanderivater | |
| DK134604B (da) | Fremgangsmåde til fremstilling af indenyl-3-acetoglucuronider. | |
| DK138796B (da) | Analogifremgangsmåde til fremstilling af 2-carboxypyrazin-4-oxidderivater. | |
| DK138230B (da) | Analogifremgangsmåde til fremstilling af vincanolsalte. | |
| DK140668B (da) | Analogifremgangsmåde til fremstilling af kondenserede pyriminderivater. | |
| DK131864B (da) | Fremgangsmåde til fremstilling af pregnan-21-syrederivater. | |
| FI52735C (fi) | Menetelmä uusien pregnadieeni-21-happojohdannaisten valmistamiseksi. | |
| DK135122B (da) | Analogifremgangsmåde til fremstilling af 4-aryl-5-aminoalkyl-4-oxazolin-2-onderivater. | |
| DK136361B (da) | Fremgangsmåde til fremstilling af quinolin-derivater. | |
| DK132430B (da) | Fremgangsmåde til fremstilling af quinazolinonderivater. | |
| DK133667B (da) | Fremgangsmåde til fremstilling af 5-cyklohexyl-6-halogenindan-1-karboxylsyrederivater. | |
| DK131575B (da) | Analogifremgangsmåde til fremstilling af 2beta-hydroxy-3alfa-aminosteroider. | |
| DK134183B (da) | Fremgangsmåde til fremstilling af cellulose-enzymkomplekser. | |
| DK129657B (da) | Analogifremgangsmåde til fremstilling af 3-methylpyrazol-5-carboxamider. |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PBP | Patent lapsed |