DK138495B - Analogifremgangsmåde til fremstilling af phenylbutazonderivater. - Google Patents
Analogifremgangsmåde til fremstilling af phenylbutazonderivater.Info
- Publication number
- DK138495B DK138495B DK381075AA DK381075A DK138495B DK 138495 B DK138495 B DK 138495B DK 381075A A DK381075A A DK 381075AA DK 381075 A DK381075 A DK 381075A DK 138495 B DK138495 B DK 138495B
- Authority
- DK
- Denmark
- Prior art keywords
- preparation
- analogous process
- phenylbutazone
- derivatives
- phenylbutazone derivatives
- Prior art date
Links
- VYMDGNCVAMGZFE-UHFFFAOYSA-N phenylbutazonum Chemical class O=C1C(CCCC)C(=O)N(C=2C=CC=CC=2)N1C1=CC=CC=C1 VYMDGNCVAMGZFE-UHFFFAOYSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/14—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing three or more hetero rings
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| FR7429109A FR2282884A1 (fr) | 1974-08-26 | 1974-08-26 | Nouveaux derives de la phenylbutazone |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DK381075A DK381075A (enExample) | 1976-02-27 |
| DK138495B true DK138495B (da) | 1978-09-18 |
| DK138495C DK138495C (enExample) | 1979-03-05 |
Family
ID=9142574
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DK381075AA DK138495B (da) | 1974-08-26 | 1975-08-25 | Analogifremgangsmåde til fremstilling af phenylbutazonderivater. |
Country Status (13)
| Country | Link |
|---|---|
| AT (1) | AT343111B (enExample) |
| BE (1) | BE832722A (enExample) |
| CH (1) | CH615434A5 (enExample) |
| DE (1) | DE2537590A1 (enExample) |
| DK (1) | DK138495B (enExample) |
| FI (1) | FI61893C (enExample) |
| FR (1) | FR2282884A1 (enExample) |
| GB (1) | GB1482380A (enExample) |
| IE (1) | IE41788B1 (enExample) |
| LU (1) | LU73250A1 (enExample) |
| NL (1) | NL7509999A (enExample) |
| NO (1) | NO142220C (enExample) |
| SE (1) | SE421618B (enExample) |
Families Citing this family (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1604045A (en) * | 1977-06-01 | 1981-12-02 | Sterwin Ag | -(2-methyl-indol-3-yl)-acetic acid esters processes for its prepartion and pharmaceutical compositions incorporating the same |
-
1974
- 1974-08-26 FR FR7429109A patent/FR2282884A1/fr active Granted
-
1975
- 1975-08-22 AT AT650175A patent/AT343111B/de not_active IP Right Cessation
- 1975-08-23 DE DE19752537590 patent/DE2537590A1/de not_active Ceased
- 1975-08-25 SE SE7509449A patent/SE421618B/xx unknown
- 1975-08-25 NL NL7509999A patent/NL7509999A/xx unknown
- 1975-08-25 NO NO752923A patent/NO142220C/no unknown
- 1975-08-25 BE BE159444A patent/BE832722A/xx not_active IP Right Cessation
- 1975-08-25 FI FI752387A patent/FI61893C/fi not_active IP Right Cessation
- 1975-08-25 IE IE1861/75A patent/IE41788B1/en unknown
- 1975-08-25 LU LU73250A patent/LU73250A1/xx unknown
- 1975-08-25 DK DK381075AA patent/DK138495B/da unknown
- 1975-08-26 GB GB35252/75A patent/GB1482380A/en not_active Expired
- 1975-08-26 CH CH1107275A patent/CH615434A5/de not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| NO752923L (enExample) | 1976-02-27 |
| LU73250A1 (enExample) | 1977-01-07 |
| NO142220B (no) | 1980-04-08 |
| GB1482380A (en) | 1977-08-10 |
| FR2282884B1 (enExample) | 1978-07-21 |
| DE2537590A1 (de) | 1976-03-11 |
| DK138495C (enExample) | 1979-03-05 |
| CH615434A5 (en) | 1980-01-31 |
| FR2282884A1 (fr) | 1976-03-26 |
| SE421618B (sv) | 1982-01-18 |
| FI752387A7 (enExample) | 1976-02-27 |
| NO142220C (no) | 1980-07-16 |
| SE7509449L (sv) | 1976-02-27 |
| BE832722A (fr) | 1976-02-25 |
| ATA650175A (de) | 1977-09-15 |
| FI61893C (fi) | 1982-10-11 |
| NL7509999A (nl) | 1976-03-01 |
| IE41788L (en) | 1976-02-26 |
| AT343111B (de) | 1978-05-10 |
| DK381075A (enExample) | 1976-02-27 |
| IE41788B1 (en) | 1980-03-26 |
| FI61893B (fi) | 1982-06-30 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DK138800B (da) | Analogifremgangsmåde til fremstilling af 4-aminoquinazolinderivater. | |
| DK134345B (da) | Analogifremgangsmåde til fremstilling af 4-hydroxymethyl-1-phthalazonderivater. | |
| DK136075B (da) | Analogifremgangsmåde til fremstilling af 11beta-hydroxy-16-methyl-3-oxo-17alfa-acyloxyandrosta-1,4,15-trien-17beta-carboxylater. | |
| DK135711B (da) | Analogifremgangsmåde til fremstilling af hidtil ukendte, hjerteaktive substituerede fenoxyisopropanolaminer. | |
| DK137835B (da) | Analogifremgangsmåde til fremstilling af thienothiazinderivater. | |
| DK179675A (da) | Fremgangsmade til fremstilling af 6-amino-5-r3-2,4-diaminopyrimidin-3-oxider | |
| DK135796B (da) | Fremgangsmåde til fremstilling af alkyl-tert-alkylethere. | |
| DK140634B (da) | Analogifremgangsmåde til fremstilling af benzimidazolderivater. | |
| DK139580B (da) | Analogifremgangsmåde til fremstilling af additionssalte af piperidylindolderivater. | |
| DK139846B (da) | Analogifremgangsmåde til fremstilling af 3-alkoxypyrazin-2-carboxamider. | |
| DK138321B (da) | Analogifremgangsmåde til fremstilling af 5-halogen-2,3-kresotinsyrederivater. | |
| DK356375A (da) | Fremgangsmade til fremstilling af 2-thiol-4,5-diphenyloxazol-s-derivater | |
| DK140012B (da) | Fremgangsmåde til fremstilling af substituerede indoleniner. | |
| DK136529B (da) | Analogifremgangsmåde til fremstilling af benzofuranderivater. | |
| DK390975A (da) | Fremgangsmade til fremstilling af omega-nor-cycloalkyl-13,14-dehydroprostaglandiner | |
| DK153479C (da) | Analogifremgangsmaade til fremstilling af 1,4-benzodiazepin-2-on-derivater | |
| DK139682B (da) | Analogifremgangsmåde til fremstilling af eburnameninderivater. | |
| DK135167B (da) | Analogifremgangsmåde til fremstilling af 7,7'-ditheophyllinderivater. | |
| DK140670B (da) | Analogifremgangsmåde til fremstilling af ergopeptinderivater. | |
| DK140557B (da) | Analogifremgangsmåde til fremstilling af sultiner af 17-hydroxy-3-oxo-17alfa-pregn-4-en-21-sulfinsyrer. | |
| DK506075A (da) | Fremgangsmade til fremstilling af ostren-3,17-dionderivater | |
| DK136313B (da) | Analogifremgangsmåde til fremstilling af N-substituerede m-trifluormethylbenzylaminer. | |
| DK139716B (da) | Analogifremgangsmåde til fremstilling af 4-aminoamfetaminderivater. | |
| DK137646B (da) | Fremgangsmåde til fremstilling af 6-chlor-2-chlormethyl-4-phenylquinazolin-3-oxid. | |
| DK138694B (da) | Fremgangsmåde til fremstilling af phenylphosphonothiodichlorid. |