DK119208C - Analogifremgangsmåde til fremstilling af di- eller tri-phenylpropyl-piperazinderivater. - Google Patents
Analogifremgangsmåde til fremstilling af di- eller tri-phenylpropyl-piperazinderivater.Info
- Publication number
- DK119208C DK119208C DK106968AA DK106968A DK119208C DK 119208 C DK119208 C DK 119208C DK 106968A A DK106968A A DK 106968AA DK 106968 A DK106968 A DK 106968A DK 119208 C DK119208 C DK 119208C
- Authority
- DK
- Denmark
- Prior art keywords
- phenylpropyl
- tri
- preparation
- piperazine derivatives
- analogous process
- Prior art date
Links
- ARTJAHOMQQCUFB-UHFFFAOYSA-N 1-(3,3,3-triphenylpropyl)piperazine Chemical class C1CNCCN1CCC(C=1C=CC=CC=1)(C=1C=CC=CC=1)C1=CC=CC=C1 ARTJAHOMQQCUFB-UHFFFAOYSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D417/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00
- C07D417/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00 containing two hetero rings
- C07D417/04—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00 containing two hetero rings directly linked by a ring-member-to-ring-member bond
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D241/00—Heterocyclic compounds containing 1,4-diazine or hydrogenated 1,4-diazine rings
- C07D241/02—Heterocyclic compounds containing 1,4-diazine or hydrogenated 1,4-diazine rings not condensed with other rings
- C07D241/10—Heterocyclic compounds containing 1,4-diazine or hydrogenated 1,4-diazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members
- C07D241/14—Heterocyclic compounds containing 1,4-diazine or hydrogenated 1,4-diazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D241/20—Nitrogen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings
- C07D401/04—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings directly linked by a ring-member-to-ring-member bond
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D403/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00
- C07D403/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00 containing two hetero rings
- C07D403/04—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00 containing two hetero rings directly linked by a ring-member-to-ring-member bond
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D413/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms
- C07D413/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms containing two hetero rings
- C07D413/04—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms containing two hetero rings directly linked by a ring-member-to-ring-member bond
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB53477/65A GB1148378A (en) | 1965-12-16 | 1965-12-16 | Disubstituted piperazines and process for preparing them |
| GB01843/67A GB1184714A (en) | 1965-12-16 | 1967-03-14 | Di- and Tri-Phenylpropyl Piperazine Derivatives |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DK119208B DK119208B (member.php) | 1970-11-30 |
| DK119208C true DK119208C (da) | 1970-11-30 |
Family
ID=9993710
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DK106968AA DK119208C (da) | 1965-12-16 | 1968-03-14 | Analogifremgangsmåde til fremstilling af di- eller tri-phenylpropyl-piperazinderivater. |
Country Status (13)
| Country | Link |
|---|---|
| US (1) | US3631043A (member.php) |
| AT (1) | AT278014B (member.php) |
| BE (1) | BE712201A (member.php) |
| CH (1) | CH491940A (member.php) |
| CS (1) | CS157629B2 (member.php) |
| DE (1) | DE1695837C3 (member.php) |
| DK (1) | DK119208C (member.php) |
| FR (2) | FR95039E (member.php) |
| GB (1) | GB1184714A (member.php) |
| NL (1) | NL6803680A (member.php) |
| NO (1) | NO122594B (member.php) |
| OA (1) | OA124E (member.php) |
| SE (1) | SE340459B (member.php) |
Families Citing this family (18)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2246279A1 (de) * | 1972-09-21 | 1974-05-22 | Goedecke Ag | Neue 1-aryl-2-arylalkyl-3-(4)-eckige klammer auf 4'-(subst.-alkyl)-piperazino1' eckige klammer zu -butanole-2 bzw. butene-1 und verfahren zu ihrer herstellung |
| US4163849A (en) * | 1978-03-17 | 1979-08-07 | Merck & Co., Inc. | Piperazinylpyrazines |
| US4411900A (en) * | 1980-01-03 | 1983-10-25 | Fujisawa Pharmaceutical Co., Ltd. | Benzhydrylpiperozinyl thiazole derivatives and pharmaceutical composition comprising the same |
| US4421753A (en) * | 1982-01-15 | 1983-12-20 | American Cyanamid Company | 1-(5-Amino-4H-1,2,4-triazol-3-yl)-4-substituted-piperazines |
| JPS59118765A (ja) * | 1982-12-24 | 1984-07-09 | Fujisawa Pharmaceut Co Ltd | ピペラジン誘導体 |
| US5001125A (en) * | 1984-03-26 | 1991-03-19 | Janssen Pharmaceutica N.V. | Anti-virally active pyridazinamines |
| US5091428A (en) * | 1987-04-24 | 1992-02-25 | Syntex Pharmaceuticals, Ltd. | Substituted imidazolyl-alkyl-piperazine and -diazepine derivatives |
| US5010075A (en) * | 1987-04-24 | 1991-04-23 | Syntex Pharmaceuticals Ltd. | Substituted imidazolyl-alkyl-piperazine and -diazepine derivatives |
| US4935417A (en) * | 1987-04-24 | 1990-06-19 | Syntex Pharmaceuticals Ltd. | Sustituted imidazolyl-alkyl-piperazine and -diazepine derivatives for treating cerebrovascular disease |
| US5043447A (en) * | 1987-04-24 | 1991-08-27 | Syntex Pharmaceuticals, Ltd. | Substituted imidazolyl-alkyl-piperazine and -diazepine derivatives |
| US4829065A (en) * | 1987-04-24 | 1989-05-09 | Syntex Pharmaceuticals, Ltd. | Substituted imidazolyl-alkyl-piperazine and -diazepine derivatives |
| US5252736A (en) * | 1987-04-24 | 1993-10-12 | Syntex Pharmaceuticals, Ltd. | Substituted imidazolyl-alkyl-piperazine and -diazepine derivatives |
| US5142052A (en) * | 1988-04-22 | 1992-08-25 | Laboratoires Syntex | Cationic effect-driven carbinol/amine reaction |
| US4973591A (en) * | 1988-10-21 | 1990-11-27 | Syntex Pharmaceuticals, Ltd. | Parenteral formulations of 1-diphenylmethyl-4-((2-(4-methylphenyl)-5-methyl-1H-imidazol-4-yl)methyl)piperazine |
| US5063220A (en) * | 1988-10-21 | 1991-11-05 | Syntex Pharmaceuticals, Ltd. | Parenteral formulations of 1-diphenylmethyl-4-((2-(4-methylphenyl)-5-methyl-1H-imidazol-4-yl)methyl)piperazine |
| US5070090A (en) * | 1989-05-15 | 1991-12-03 | Janssen Pharmaceutica N.V. | Antipicorpaviral herterocyclic-substituted morpholinyl alkylphenol ethers |
| GB8911158D0 (en) * | 1989-05-16 | 1989-07-05 | Janssen Pharmaceutica Nv | Antiviral pyridazinamines |
| FR2665160A1 (fr) * | 1990-07-26 | 1992-01-31 | Esteve Labor Dr | Nouveaux derives de 1-diphenylmethylpiperazine, leur preparation et leur application en tant que medicaments. |
-
1967
- 1967-03-14 GB GB01843/67A patent/GB1184714A/en not_active Expired
-
1968
- 1968-03-05 DE DE1695837A patent/DE1695837C3/de not_active Expired
- 1968-03-05 OA OA53193A patent/OA124E/xx unknown
- 1968-03-07 SE SE03056/68A patent/SE340459B/xx unknown
- 1968-03-08 US US711496A patent/US3631043A/en not_active Expired - Lifetime
- 1968-03-12 CS CS192868A patent/CS157629B2/cs unknown
- 1968-03-13 NO NO0974/68A patent/NO122594B/no unknown
- 1968-03-13 FR FR143561A patent/FR95039E/fr not_active Expired
- 1968-03-14 AT AT252568A patent/AT278014B/de not_active IP Right Cessation
- 1968-03-14 DK DK106968AA patent/DK119208C/da active
- 1968-03-14 BE BE712201D patent/BE712201A/xx unknown
- 1968-03-14 CH CH377768A patent/CH491940A/fr unknown
- 1968-03-14 NL NL6803680A patent/NL6803680A/xx unknown
- 1968-06-11 FR FR154552A patent/FR356F/fr not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| CH491940A (fr) | 1970-06-15 |
| FR356F (member.php) | 1973-07-27 |
| US3631043A (en) | 1971-12-28 |
| FR95039E (fr) | 1970-03-27 |
| AT278014B (de) | 1970-01-26 |
| DK119208B (member.php) | 1970-11-30 |
| DE1695837B2 (de) | 1978-10-12 |
| NL6803680A (member.php) | 1968-09-16 |
| SE340459B (member.php) | 1971-11-22 |
| NO122594B (member.php) | 1971-07-19 |
| DE1695837A1 (de) | 1972-05-04 |
| DE1695837C3 (de) | 1979-06-07 |
| CS157629B2 (member.php) | 1974-09-16 |
| GB1184714A (en) | 1970-03-18 |
| OA124E (member.php) | 1970-12-15 |
| BE712201A (member.php) | 1968-09-16 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DK112733B (da) | Fremgangsmåde til fremstilling af thiazolderivater. | |
| DK118769B (da) | Fremgangsmåde til fremstilling af O-methyl-S-methyl-phosphoroamidothioat. | |
| DK115474B (da) | Analogifremgangsmåde til fremstilling af N-p-chlorbenzoyl-5-fluorcytosin. | |
| DK119208C (da) | Analogifremgangsmåde til fremstilling af di- eller tri-phenylpropyl-piperazinderivater. | |
| DK118505B (da) | Fremgangsmåde til fremstilling af isoindolin-2-sulfonylurinstoffer. | |
| DK111892B (da) | Fremgangsmåde til fremstilling af pyrazinimidoyl-guanidinforbindelser. | |
| DK118239B (da) | Fremgangsmåde til fremstilling af substituerede 4-hydroxykinoliner. | |
| DK126655B (da) | Fremgangsmåde til fremstilling af isoxazolderivater. | |
| DK118395B (da) | Analogifremgangsmåde til fremstilling af aminophenolderivater. | |
| DK135234B (da) | Analogifremgangsmåde til fremstilling af piperazin-phenylethanolforbindelser. | |
| DK126584B (da) | Fremgangsmåde til fremstilling af D-2-phenoxypropionsyrer. | |
| DK120193B (da) | Fremgangsmåde til fremstilling af 3-amino-isoxazolderivater. | |
| DK115348B (da) | Fremgangsmåde til fremstilling af adrenocorticotropt virksomme præparater med forlænget virkning. | |
| DK128004B (da) | Fremgangsmåde til fremstilling af chromanderivater. | |
| DK122078B (da) | Fremgangsmåde til fremstilling af pyridazonderivater. | |
| DK118132B (da) | Fremgangsmåde til fremstilling af derivater af 5-nitro-2-furyl-isoxazoler. | |
| DK118458B (da) | Fremgangsmåde til fremstilling af 5-halogen-2-amino-benzophenoniminer. | |
| DK118670B (da) | Fremgangsmåde til fremstilling af cyanphenoler. | |
| DK117705B (da) | Fremgangsmåde til fremstilling af indolderivater. | |
| DK122761B (da) | Analogifremgangsmåde til fremstilling af arylsulfonylurinstofderivater. | |
| DK119980B (da) | Fremgangsmåde til fremstilling af 2-alkoxy-4-sulfanilamido-quinazolinderivater. | |
| DK117704B (da) | Analogifremgangsmåde til fremstilling af tetrahydroisoquinolinderivater. | |
| DK122527B (da) | Fremgangsmåde til fremstilling af 3-nitro-2-oxo-tetrahydro-imidazoler. | |
| DK120895B (da) | Analogifremgangsmåde til fremstilling af benzensulfonylurinstoffer. | |
| DK119058B (da) | Analogifremgangsmåde til fremstilling af 7-ethylaminopropyl-theophyllinderivater. |