DK115111B - Fremgangsmåde til fremstilling af 2-anilinonikotinsyrederivater eller salte heraf. - Google Patents
Fremgangsmåde til fremstilling af 2-anilinonikotinsyrederivater eller salte heraf.Info
- Publication number
- DK115111B DK115111B DK624264AA DK624264A DK115111B DK 115111 B DK115111 B DK 115111B DK 624264A A DK624264A A DK 624264AA DK 624264 A DK624264 A DK 624264A DK 115111 B DK115111 B DK 115111B
- Authority
- DK
- Denmark
- Prior art keywords
- salts
- preparation
- acid derivatives
- anilinonicotinic
- anilinonicotinic acid
- Prior art date
Links
- UUMMTMQODCACRH-UHFFFAOYSA-N 2-anilinopyridine-3-carboxylic acid Chemical class OC(=O)C1=CC=CN=C1NC1=CC=CC=C1 UUMMTMQODCACRH-UHFFFAOYSA-N 0.000 title 1
- 150000003839 salts Chemical class 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/78—Carbon atoms having three bonds to hetero atoms, with at the most one bond to halogen, e.g. ester or nitrile radicals
- C07D213/79—Acids; Esters
- C07D213/80—Acids; Esters in position 3
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D471/00—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00
- C07D471/02—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00 in which the condensed system contains two hetero rings
- C07D471/04—Ortho-condensed systems
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pyridine Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB50274/63A GB1064259A (en) | 1963-12-19 | 1963-12-19 | New derivatives of 2-anilino-nicotinic acid and process for their preparation |
| GB1272364 | 1964-03-25 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DK115111B true DK115111B (da) | 1969-09-08 |
Family
ID=26249222
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DK624264AA DK115111B (da) | 1963-12-19 | 1964-12-18 | Fremgangsmåde til fremstilling af 2-anilinonikotinsyrederivater eller salte heraf. |
Country Status (11)
| Country | Link |
|---|---|
| US (1) | US3415834A (enExample) |
| BE (1) | BE657266A (enExample) |
| CH (1) | CH421105A (enExample) |
| DE (1) | DE1470014C3 (enExample) |
| DK (1) | DK115111B (enExample) |
| ES (1) | ES307328A1 (enExample) |
| FR (1) | FR4267M (enExample) |
| GB (1) | GB1064259A (enExample) |
| NL (1) | NL6414717A (enExample) |
| NO (1) | NO122370B (enExample) |
| SE (1) | SE327199B (enExample) |
Families Citing this family (14)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3686406A (en) * | 1970-09-18 | 1972-08-22 | Schering Corp | Process for alleviating pain |
| US3697533A (en) * | 1971-03-26 | 1972-10-10 | Schering Corp | 2-(2-methylan ilino)-nicotinic acid |
| JPS53141275A (en) * | 1977-05-17 | 1978-12-08 | Kowa Co | Anthranilic acid derivative and method for its production |
| DE2735919A1 (de) * | 1977-08-10 | 1979-02-22 | Boehringer Sohn Ingelheim | Neue 2-pyridyl- und 2-pyrimidylaminobenzoesaeuren |
| US4348396A (en) | 1978-01-23 | 1982-09-07 | Hoffmann-La Roche Inc. | Substituted 11-oxo-11H-pyrido[2,1-b]quinazolines and method of inhibiting allergic reactions with them |
| DE2845766A1 (de) * | 1978-10-18 | 1980-04-30 | Schering Ag | Pyrido eckige klammer auf 2,1-b eckige klammer zu -chinazolinon-derivate, ihre herstellung und verwendung |
| GB8320699D0 (en) * | 1983-08-01 | 1983-09-01 | Wellcome Found | Ethylenediamines |
| AT394193B (de) * | 1985-01-23 | 1992-02-10 | Toyama Chemical Co Ltd | Verfahren zur herstellung von neuen 5fluornicotins|uren oder von deren derivaten und salzen |
| EP0254259A3 (en) * | 1986-07-21 | 1989-11-23 | Otsuka Pharmaceutical Factory, Inc. | P-aminophenol derivatives |
| EP0260817B1 (en) * | 1986-08-21 | 1991-05-15 | Pfizer Inc. | Quinazolinediones and pyridopyrimidinediones |
| AU659106B2 (en) * | 1990-11-06 | 1995-05-11 | Fgn, Inc. | Method for treating colonic polyps by the use of esters and amides of substituted phenyl and pyridyl amino carboxylates |
| IT1288123B1 (it) * | 1996-09-04 | 1998-09-10 | Nicox Sa | Uso di nitroderivati per l'incontinenza urinaria |
| JP4693247B2 (ja) * | 1999-04-28 | 2011-06-01 | 有限会社ケムフィズ | 複素環カルボン酸誘導体 |
| US20230346765A1 (en) * | 2020-03-19 | 2023-11-02 | Baylor College Of Medicine | Methods of treating xanthine oxidase-related diseases with niflumic acid and derivatives thereof |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3337570A (en) * | 1965-10-23 | 1967-08-22 | Schering Corp | Substituted nicotinic acids and method for the manufacture thereof |
-
1963
- 1963-12-19 GB GB50274/63A patent/GB1064259A/en not_active Expired
-
1964
- 1964-12-09 FR FR997934A patent/FR4267M/fr not_active Expired
- 1964-12-10 DE DE1470014A patent/DE1470014C3/de not_active Expired
- 1964-12-15 US US418539A patent/US3415834A/en not_active Expired - Lifetime
- 1964-12-17 BE BE657266D patent/BE657266A/xx unknown
- 1964-12-17 NL NL6414717A patent/NL6414717A/xx unknown
- 1964-12-18 NO NO156027A patent/NO122370B/no unknown
- 1964-12-18 DK DK624264AA patent/DK115111B/da unknown
- 1964-12-18 SE SE15362/64A patent/SE327199B/xx unknown
- 1964-12-18 CH CH1634864A patent/CH421105A/fr unknown
- 1964-12-19 ES ES0307328A patent/ES307328A1/es not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| NL6414717A (enExample) | 1965-06-21 |
| NO122370B (enExample) | 1971-06-21 |
| SE327199B (enExample) | 1970-08-17 |
| DE1470014C3 (de) | 1976-01-08 |
| FR4267M (enExample) | 1966-07-04 |
| DE1470014A1 (de) | 1969-04-03 |
| US3415834A (en) | 1968-12-10 |
| GB1064259A (en) | 1967-04-05 |
| DE1470014B2 (de) | 1975-05-15 |
| BE657266A (enExample) | 1965-04-16 |
| CH421105A (fr) | 1966-09-30 |
| ES307328A1 (es) | 1965-04-01 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DK118133B (da) | Fremgangsmåde til fremstilling af α-carboxy-6-aminopenicillansyrederivater eller salte deraf. | |
| DK106796C (da) | Fremgangsmåde til fremstilling af 3-hydroxy-5-aminomethyl-isoxazol eller syreadditionssalte deraf. | |
| DK115111B (da) | Fremgangsmåde til fremstilling af 2-anilinonikotinsyrederivater eller salte heraf. | |
| DK121365B (da) | Analogifremgangsmåde til fremstilling af 4-chlor-5-sulfamylsalicylsyrederivater eller salte deraf. | |
| DK106735C (da) | Fremgangsmåde til fremstilling af benzensulfonylsemicarbazider eller salte deraf. | |
| DK117963B (da) | Fremgangsmåde til fremstilling af aryloxyalkanolaminderivater eller salte deraf. | |
| DK114779B (da) | Fremgangsmåde til fremstilling af triarylalkanderivater eller salte heraf. | |
| DK108309C (da) | Fremgangsmåde til fremstilling af 3-sulfanilamido-isoxazoler eller salte deraf. | |
| DK103831C (da) | Fremgangsmåde til fremstilling af 4-azathioxanthenderivater eller syreadditionssalte deraf. | |
| DK106335C (da) | Fremgangsmåde til fremstilling af derivater af 16-hydroxymethylenyohimbanforbindelser eller syreadditionssalte deraf. | |
| DK113077B (da) | Fremgangsmåde til fremstilling af basiske ethano-anthracenderivater eller syreadditionssalte deraf. | |
| DK105922C (da) | Fremgangsmåde til fremstilling af pyridyl-2-methylen-aminoguanidiner eller salte heraf. | |
| DK117494B (da) | Fremgangsmåde til fremstilling af 4-aminoantipyriderivater eller salte deraf. | |
| DK121604B (da) | Fremgangsmåde til fremstilling af substituerede iminocycloheptatrienderivater eller syreadditionssalte heraf. | |
| DK105591C (da) | Fremgangsmåde til fremstilling af 4-karboxyalkylmerkapto-5-aryl-pyrimidiner eller salte deraf. | |
| DK114347B (da) | Fremgangsmåde til fremstilling af (4-alkanoyl-phenoxy)-eddikesyrederivater eller salte deraf. | |
| DK107098C (da) | Fremgangsmåde til fremstilling af 5-hydrazino-pyrazol-derivater eller syreadditionssalte deraf. | |
| DK112030B (da) | Fremgangsmåde til fremstilling af 3-amino-1-adamantancarboxylsyre eller salte deraf. | |
| DK115553B (da) | Fremgangsmåde til fremstilling af 4-aminoantipyrinderivater eller salte heraf. | |
| DK108365C (da) | Fremgangsmåde til fremstilling af tetrahydrothiapyranylbenzensulfonylurinstoffer eller salte deraf. | |
| DK106850C (da) | Fremgangsmåde til fremstilling af azepinderivater eller salte deraf. | |
| DK109927C (da) | Fremgangsmåde til fremstilling af substituerede malonsyre-monohydrazider eller salte deraf. | |
| DK105649C (da) | Fremgangsmåde til fremstilling af 2-dimethylaminopyrazin eller syreadditionssalte deraf. | |
| DK108722C (da) | Fremgangsmåde til fremstilling af piperrideinoalkylguanidinderivater eller salte deraf. | |
| DK107748C (da) | Fremgangsmåde til fremstilling af 5-nitropyrrolderivater eller syreadditionssalte deraf. |