DEST006287MA - - Google Patents
Info
- Publication number
- DEST006287MA DEST006287MA DEST006287MA DE ST006287M A DEST006287M A DE ST006287MA DE ST006287M A DEST006287M A DE ST006287MA
- Authority
- DE
- Germany
- Prior art keywords
- lead
- phosphorus
- halogen
- atom
- mixture according
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Active
Links
- 229910052736 halogen Inorganic materials 0.000 claims description 32
- 239000000446 fuel Substances 0.000 claims description 31
- 229910052698 phosphorus Inorganic materials 0.000 claims description 30
- 150000002367 halogens Chemical class 0.000 claims description 29
- 239000011574 phosphorus Substances 0.000 claims description 27
- 238000002485 combustion reaction Methods 0.000 claims description 24
- 239000000203 mixture Substances 0.000 claims description 24
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 claims description 23
- 239000000654 additive Substances 0.000 claims description 15
- -1 aliphatic phosphorus compound Chemical class 0.000 claims description 15
- 125000000217 alkyl group Chemical group 0.000 claims description 13
- MRMOZBOQVYRSEM-UHFFFAOYSA-N tetraethyllead Chemical compound CC[Pb](CC)(CC)CC MRMOZBOQVYRSEM-UHFFFAOYSA-N 0.000 claims description 12
- 230000000996 additive effect Effects 0.000 claims description 11
- 229910019142 PO4 Inorganic materials 0.000 claims description 9
- 239000010452 phosphate Substances 0.000 claims description 5
- 229910052801 chlorine Inorganic materials 0.000 claims description 4
- 239000000460 chlorine Substances 0.000 claims description 4
- 125000005843 halogen group Chemical group 0.000 claims description 4
- 239000000126 substance Substances 0.000 claims description 4
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 3
- 239000002253 acid Substances 0.000 claims description 2
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 2
- 229910052745 lead Inorganic materials 0.000 claims 5
- WABPQHHGFIMREM-UHFFFAOYSA-N lead(0) Chemical group [Pb] WABPQHHGFIMREM-UHFFFAOYSA-N 0.000 claims 5
- 125000004437 phosphorous atom Chemical group 0.000 claims 4
- 125000001246 bromo group Chemical group Br* 0.000 claims 1
- 150000002148 esters Chemical class 0.000 claims 1
- 150000001875 compounds Chemical class 0.000 description 17
- 125000004429 atom Chemical group 0.000 description 15
- TVMXDCGIABBOFY-UHFFFAOYSA-N octane Chemical compound CCCCCCCC TVMXDCGIABBOFY-UHFFFAOYSA-N 0.000 description 11
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 10
- XYFCBTPGUUZFHI-UHFFFAOYSA-N Phosphine Chemical compound P XYFCBTPGUUZFHI-UHFFFAOYSA-N 0.000 description 8
- 239000003795 chemical substances by application Substances 0.000 description 8
- 150000002903 organophosphorus compounds Chemical class 0.000 description 7
- 235000021317 phosphate Nutrition 0.000 description 7
- PAAZPARNPHGIKF-UHFFFAOYSA-N 1,2-dibromoethane Chemical compound BrCCBr PAAZPARNPHGIKF-UHFFFAOYSA-N 0.000 description 6
- 125000003342 alkenyl group Chemical group 0.000 description 6
- 150000004820 halides Chemical class 0.000 description 6
- 229910000073 phosphorus hydride Inorganic materials 0.000 description 6
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 5
- 230000015572 biosynthetic process Effects 0.000 description 5
- 230000000694 effects Effects 0.000 description 5
- 230000001976 improved effect Effects 0.000 description 5
- 229910000464 lead oxide Inorganic materials 0.000 description 5
- 238000000034 method Methods 0.000 description 5
- YEXPOXQUZXUXJW-UHFFFAOYSA-N oxolead Chemical compound [Pb]=O YEXPOXQUZXUXJW-UHFFFAOYSA-N 0.000 description 5
- 150000003003 phosphines Chemical class 0.000 description 5
- 230000006835 compression Effects 0.000 description 4
- 238000007906 compression Methods 0.000 description 4
- 230000007812 deficiency Effects 0.000 description 4
- 238000002474 experimental method Methods 0.000 description 4
- 239000007788 liquid Substances 0.000 description 4
- 150000003018 phosphorus compounds Chemical class 0.000 description 4
- 150000001350 alkyl halides Chemical class 0.000 description 3
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 3
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 3
- 229910052794 bromium Inorganic materials 0.000 description 3
- 238000006243 chemical reaction Methods 0.000 description 3
- 150000002611 lead compounds Chemical class 0.000 description 3
- 229910052760 oxygen Inorganic materials 0.000 description 3
- 239000001301 oxygen Substances 0.000 description 3
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 3
- 238000001556 precipitation Methods 0.000 description 3
- DQWPFSLDHJDLRL-UHFFFAOYSA-N triethyl phosphate Chemical compound CCOP(=O)(OCC)OCC DQWPFSLDHJDLRL-UHFFFAOYSA-N 0.000 description 3
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 2
- ABLZXFCXXLZCGV-UHFFFAOYSA-N Phosphorous acid Chemical class OP(O)=O ABLZXFCXXLZCGV-UHFFFAOYSA-N 0.000 description 2
- 239000006079 antiknock agent Substances 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- 229930195733 hydrocarbon Natural products 0.000 description 2
- 150000002430 hydrocarbons Chemical class 0.000 description 2
- 239000003112 inhibitor Substances 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 230000003647 oxidation Effects 0.000 description 2
- 238000007254 oxidation reaction Methods 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 239000011347 resin Substances 0.000 description 2
- 229920005989 resin Polymers 0.000 description 2
- KJDRSWPQXHESDQ-UHFFFAOYSA-N 1,4-dichlorobutane Chemical compound ClCCCCCl KJDRSWPQXHESDQ-UHFFFAOYSA-N 0.000 description 1
- AJZYRHXRWZWBAH-UHFFFAOYSA-N 2,2-dichloroethylphosphane Chemical compound PCC(Cl)Cl AJZYRHXRWZWBAH-UHFFFAOYSA-N 0.000 description 1
- SYDHMMCGNIUUQG-UHFFFAOYSA-N 4,4,4-trichlorobutyl dihydrogen phosphate Chemical compound OP(O)(=O)OCCCC(Cl)(Cl)Cl SYDHMMCGNIUUQG-UHFFFAOYSA-N 0.000 description 1
- DSTNNXPLSDARII-UHFFFAOYSA-N BrC(CP)Br Chemical compound BrC(CP)Br DSTNNXPLSDARII-UHFFFAOYSA-N 0.000 description 1
- PQHIRGNTTWEDSF-UHFFFAOYSA-N BrC(C[PH2]=O)(Br)Br Chemical compound BrC(C[PH2]=O)(Br)Br PQHIRGNTTWEDSF-UHFFFAOYSA-N 0.000 description 1
- YNKHUKPVNOFPEX-UHFFFAOYSA-N ClC(C[PH2]=O)(Cl)Cl Chemical compound ClC(C[PH2]=O)(Cl)Cl YNKHUKPVNOFPEX-UHFFFAOYSA-N 0.000 description 1
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 1
- 239000005977 Ethylene Substances 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- YYQRGCZGSFRBAM-UHFFFAOYSA-N Triclofos Chemical compound OP(O)(=O)OCC(Cl)(Cl)Cl YYQRGCZGSFRBAM-UHFFFAOYSA-N 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 230000029936 alkylation Effects 0.000 description 1
- 238000005804 alkylation reaction Methods 0.000 description 1
- 230000002528 anti-freeze Effects 0.000 description 1
- 239000003963 antioxidant agent Substances 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- 239000012459 cleaning agent Substances 0.000 description 1
- 238000003776 cleavage reaction Methods 0.000 description 1
- 230000007797 corrosion Effects 0.000 description 1
- 238000005260 corrosion Methods 0.000 description 1
- 230000008021 deposition Effects 0.000 description 1
- 230000001627 detrimental effect Effects 0.000 description 1
- RHSLHTOQYGVTPU-UHFFFAOYSA-N dibromo(ethyl)phosphane Chemical compound CCP(Br)Br RHSLHTOQYGVTPU-UHFFFAOYSA-N 0.000 description 1
- RCJVRSBWZCNNQT-UHFFFAOYSA-N dichloridooxygen Chemical compound ClOCl RCJVRSBWZCNNQT-UHFFFAOYSA-N 0.000 description 1
- JHNJGLVSPIMBLD-UHFFFAOYSA-N dichloro(ethyl)phosphane Chemical compound CCP(Cl)Cl JHNJGLVSPIMBLD-UHFFFAOYSA-N 0.000 description 1
- 239000000975 dye Substances 0.000 description 1
- 210000003608 fece Anatomy 0.000 description 1
- 230000004907 flux Effects 0.000 description 1
- 239000002529 flux (metallurgy) Substances 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 239000003254 gasoline additive Substances 0.000 description 1
- 238000011086 high cleaning Methods 0.000 description 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- JEIPFZHSYJVQDO-UHFFFAOYSA-N iron(III) oxide Inorganic materials O=[Fe]O[Fe]=O JEIPFZHSYJVQDO-UHFFFAOYSA-N 0.000 description 1
- PIJPYDMVFNTHIP-UHFFFAOYSA-L lead sulfate Chemical compound [PbH4+2].[O-]S([O-])(=O)=O PIJPYDMVFNTHIP-UHFFFAOYSA-L 0.000 description 1
- 239000010871 livestock manure Substances 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 239000006078 metal deactivator Substances 0.000 description 1
- 125000000962 organic group Chemical group 0.000 description 1
- MPQXHAGKBWFSNV-UHFFFAOYSA-N oxidophosphanium Chemical class [PH3]=O MPQXHAGKBWFSNV-UHFFFAOYSA-N 0.000 description 1
- AUONHKJOIZSQGR-UHFFFAOYSA-N oxophosphane Chemical compound P=O AUONHKJOIZSQGR-UHFFFAOYSA-N 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- 125000005538 phosphinite group Chemical group 0.000 description 1
- AQSJGOWTSHOLKH-UHFFFAOYSA-N phosphite(3-) Chemical class [O-]P([O-])[O-] AQSJGOWTSHOLKH-UHFFFAOYSA-N 0.000 description 1
- 150000004714 phosphonium salts Chemical class 0.000 description 1
- XRBCRPZXSCBRTK-UHFFFAOYSA-N phosphonous acid Chemical class OPO XRBCRPZXSCBRTK-UHFFFAOYSA-N 0.000 description 1
- 238000006116 polymerization reaction Methods 0.000 description 1
- 239000002516 radical scavenger Substances 0.000 description 1
- 239000013074 reference sample Substances 0.000 description 1
- 230000007017 scission Effects 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 235000015096 spirit Nutrition 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- 150000003464 sulfur compounds Chemical class 0.000 description 1
- XOOGZRUBTYCLHG-UHFFFAOYSA-N tetramethyllead Chemical compound C[Pb](C)(C)C XOOGZRUBTYCLHG-UHFFFAOYSA-N 0.000 description 1
- 231100000331 toxic Toxicity 0.000 description 1
- 230000002588 toxic effect Effects 0.000 description 1
- 230000001988 toxicity Effects 0.000 description 1
- 231100000419 toxicity Toxicity 0.000 description 1
- 229960001147 triclofos Drugs 0.000 description 1
- WKZSIFJHJCVUPZ-UHFFFAOYSA-N trimethyllead Chemical compound C[Pb](C)C WKZSIFJHJCVUPZ-UHFFFAOYSA-N 0.000 description 1
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE966643C (de) | Zusatzmischung fuer Motortreibstoffe | |
| DE1817812A1 (de) | Komplexbildner | |
| DE1545502B2 (de) | Neue Salze von sauren Alkylphos phaten mit Alkanolamines deren Her stellung und deren Verwendung als Kraft stoffadditive | |
| DE1244466B (de) | Klopffeste Motorantreibstoffe fuer Ottomotoren | |
| DE2555920C2 (de) | Mehrzweckzusatz für Benzin und eine ihn enthaltende Kraftstoffmischung | |
| DE1217950B (de) | Verfahren zur Herstellung neuer Perhydrate von Aminoalkylphosphonsaeuren | |
| DEST006287MA (enrdf_load_stackoverflow) | ||
| US2794719A (en) | Fuel antiknock | |
| DE1100374B (de) | Antiklopfmittelgemisch | |
| DE970656C (de) | Verfahren zur Herstellung von phosphorhaltigen, organischen Verbindungen | |
| DE1231058B (de) | Motorentreibstoffe vom Benzinsiedebereich mit einem Gehalt an einer zyklischen Mangantricarbonylverbindung | |
| DE2636270A1 (de) | Verfahren zur herstellung von phosphorigsaeureesterchloriden und phosphonigsaeureesterchloriden | |
| DE1115520B (de) | Motorenbenzin und Zusatzgemisch fuer Motorenbenzin | |
| DE2156203C3 (enrdf_load_stackoverflow) | ||
| DE1127141B (de) | Treibstoff | |
| DE1227440B (de) | Stabilisierung von Trimethylphosphat | |
| DE1065216B (de) | Vergaserkraftstoff | |
| DE2840930A1 (de) | Kraftstoff- bzw. schmieroelzusammensetzung | |
| DE974603C (de) | Treibstoff fuer Verbrennungskraftmaschinen und Zusatzmittel zu Kohlenwasserstofftreibstoffen | |
| DE1220196B (de) | Treibstoffe fuer Ottomotoren | |
| DE1168162B (de) | Motorenbenzin | |
| DE1221488B (de) | Treibstoffe fuer Verbrennungskraftmaschinen mit Funkenzuendung | |
| EP0537197B1 (de) | Verfahren zur herstellung von phosphonigsäure-arylester- halogeniden | |
| DE3537808A1 (de) | Verfahren zur herstellung von mischungen methylenphosphonsaeure-substituierter hydroxyethlethylendiamine und verwendung der mischungen | |
| DE3013068C2 (enrdf_load_stackoverflow) |