DES0033842MA - - Google Patents
Info
- Publication number
- DES0033842MA DES0033842MA DES0033842MA DE S0033842M A DES0033842M A DE S0033842MA DE S0033842M A DES0033842M A DE S0033842MA
- Authority
- DE
- Germany
- Prior art keywords
- parts
- hydroquinone
- benzene
- acid
- oxy
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Active
Links
- QIGBRXMKCJKVMJ-UHFFFAOYSA-N Hydroquinone Chemical compound OC1=CC=C(O)C=C1 QIGBRXMKCJKVMJ-UHFFFAOYSA-N 0.000 claims description 20
- UHOVQNZJYSORNB-UHFFFAOYSA-N benzene Substances C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 claims description 17
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 claims description 16
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 claims description 8
- 239000003054 catalyst Substances 0.000 claims description 6
- 238000004519 manufacturing process Methods 0.000 claims description 3
- 238000000034 method Methods 0.000 claims description 3
- 239000012442 inert solvent Substances 0.000 claims description 2
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 13
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 6
- 229960000583 acetic acid Drugs 0.000 description 6
- VLTRZXGMWDSKGL-UHFFFAOYSA-N perchloric acid Chemical compound OCl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-N 0.000 description 6
- 238000006243 chemical reaction Methods 0.000 description 5
- 239000012362 glacial acetic acid Substances 0.000 description 5
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 4
- 239000003085 diluting agent Substances 0.000 description 3
- 239000000203 mixture Substances 0.000 description 3
- 239000002904 solvent Substances 0.000 description 3
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- CGFYHILWFSGVJS-UHFFFAOYSA-N silicic acid;trioxotungsten Chemical compound O[Si](O)(O)O.O=[W]1(=O)O[W](=O)(=O)O[W](=O)(=O)O1.O=[W]1(=O)O[W](=O)(=O)O[W](=O)(=O)O1.O=[W]1(=O)O[W](=O)(=O)O[W](=O)(=O)O1.O=[W]1(=O)O[W](=O)(=O)O[W](=O)(=O)O1 CGFYHILWFSGVJS-UHFFFAOYSA-N 0.000 description 2
- JIAARYAFYJHUJI-UHFFFAOYSA-L zinc dichloride Chemical compound [Cl-].[Cl-].[Zn+2] JIAARYAFYJHUJI-UHFFFAOYSA-L 0.000 description 2
- REGMWDPZVFOJLY-UHFFFAOYSA-N 1,4-bis(2-hydroperoxypropan-2-yl)benzene Chemical compound OOC(C)(C)C1=CC=C(C(C)(C)OO)C=C1 REGMWDPZVFOJLY-UHFFFAOYSA-N 0.000 description 1
- RILZRCJGXSFXNE-UHFFFAOYSA-N 2-[4-(trifluoromethoxy)phenyl]ethanol Chemical compound OCCC1=CC=C(OC(F)(F)F)C=C1 RILZRCJGXSFXNE-UHFFFAOYSA-N 0.000 description 1
- 229910015900 BF3 Inorganic materials 0.000 description 1
- KZMGYPLQYOPHEL-UHFFFAOYSA-N Boron trifluoride etherate Chemical compound FB(F)F.CCOCC KZMGYPLQYOPHEL-UHFFFAOYSA-N 0.000 description 1
- 238000005727 Friedel-Crafts reaction Methods 0.000 description 1
- 238000010306 acid treatment Methods 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- WTEOIRVLGSZEPR-UHFFFAOYSA-N boron trifluoride Chemical compound FB(F)F WTEOIRVLGSZEPR-UHFFFAOYSA-N 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 239000012429 reaction media Substances 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 235000005074 zinc chloride Nutrition 0.000 description 1
- 239000011592 zinc chloride Substances 0.000 description 1
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CH642344A5 (de) | Verfahren zur herstellung von p-n-alkylbenzoesaeure. | |
| EP0099516A1 (de) | Verfahren zur Herstellung von Bis(aminocyclohexyl)dialkylmethanen | |
| DE1188069B (de) | Verfahren zur Herstellung von Hydroxybenzaldehyden | |
| DE1229102B (de) | Verfahren zur Herstellung von Monochlor-9-thiabicyclo-2-nonenen sowie deren 9-Oxyden und 9, 9-Dioxyden | |
| DE2548384C3 (de) | Verfahren zur Herstellung von Hydroxyphenyläthern | |
| EP0061015B1 (de) | Verfahren zur Herstellung eines 2-Alkylphenols | |
| DES0033842MA (OSRAM) | ||
| CH630590A5 (de) | Verfahren zur herstellung eines gemisches von brenzcatechin und hydrochinon. | |
| DE2208970C3 (de) | Verfahren zur Herstellung von 2,4-Dihydroxybenzophenon | |
| DE947309C (de) | Verfahren zur Herstellung von Hydrochinon | |
| DE1493431A1 (de) | Verfahren zur Herstellung von Bis-(aminoaryl)-methanen und Methylen-bis | |
| EP0021374B1 (de) | Verfahren zur Herstellung von 4-Amino-diphenylaminen | |
| EP0230625B1 (de) | Verfahren zur Herstellung von Brenzkatechin und Hydrochinon | |
| DE2654852C3 (de) | Verfahren zur Herstellung aromatischer Amine aus a, ß-ungesättigten cycloaliphatischen Ketoximen | |
| DE947308C (de) | Verfahren zur Herstellung von Hydrochinon | |
| EP0017832B1 (de) | Verfahren zur Herstellung von 5-Brom-5-nitro-1,3-dioxan | |
| EP0307777B1 (de) | Neue 2-Methyl-4-fluor- phenole und deren Herstellung | |
| DE2502332A1 (de) | Verfahren zur herstellung von trimethylbenzochinon | |
| DE1150077B (de) | Verfahren zur Herstellung von Mono- und Diacylferrocenen | |
| DES0033841MA (OSRAM) | ||
| DE3202687A1 (de) | Verfahren zur herstellung von methylen-bis-phenylcarbaminsaeureestern und polymethylenpolyphenylcarbaminsaeureestern | |
| EP0069907B1 (de) | Verfahren zur Herstellung von m-chlorsubstituierten Anilinen | |
| DE2212848C3 (de) | Verfahren zur Herstellung von Dinitrophenolen durch direkte Nitrierung | |
| DE2321122C3 (de) | Verfahren zur Herstellung von Carbonsäurechloriden | |
| DE3234036A1 (de) | Verfahren zur herstellung von o-benzylphenol |