DEI0008099MA - - Google Patents
Info
- Publication number
- DEI0008099MA DEI0008099MA DEI0008099MA DE I0008099M A DEI0008099M A DE I0008099MA DE I0008099M A DEI0008099M A DE I0008099MA
- Authority
- DE
- Germany
- Prior art keywords
- percent
- heating
- weight
- ignition
- closed
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Active
Links
- 238000010438 heat treatment Methods 0.000 claims description 26
- 239000002360 explosive Substances 0.000 claims description 16
- 239000000203 mixture Substances 0.000 claims description 12
- NDEMNVPZDAFUKN-UHFFFAOYSA-N guanidine;nitric acid Chemical compound NC(N)=N.O[N+]([O-])=O.O[N+]([O-])=O NDEMNVPZDAFUKN-UHFFFAOYSA-N 0.000 claims description 7
- USHAGKDGDHPEEY-UHFFFAOYSA-L potassium persulfate Chemical compound [K+].[K+].[O-]S(=O)(=O)OOS([O-])(=O)=O USHAGKDGDHPEEY-UHFFFAOYSA-L 0.000 claims description 6
- 229910021591 Copper(I) chloride Inorganic materials 0.000 claims description 5
- OXBLHERUFWYNTN-UHFFFAOYSA-M copper(I) chloride Chemical compound [Cu]Cl OXBLHERUFWYNTN-UHFFFAOYSA-M 0.000 claims description 5
- 229940045803 cuprous chloride Drugs 0.000 claims description 5
- 235000019271 petrolatum Nutrition 0.000 claims description 4
- 239000004159 Potassium persulphate Substances 0.000 claims description 2
- 239000007799 cork Substances 0.000 claims description 2
- 235000019394 potassium persulphate Nutrition 0.000 claims description 2
- 238000005979 thermal decomposition reaction Methods 0.000 claims description 2
- 238000000354 decomposition reaction Methods 0.000 description 9
- 239000007789 gas Substances 0.000 description 7
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 6
- PAWQVTBBRAZDMG-UHFFFAOYSA-N 2-(3-bromo-2-fluorophenyl)acetic acid Chemical compound OC(=O)CC1=CC=CC(Br)=C1F PAWQVTBBRAZDMG-UHFFFAOYSA-N 0.000 description 5
- 238000005422 blasting Methods 0.000 description 5
- 230000000694 effects Effects 0.000 description 5
- 239000000843 powder Substances 0.000 description 5
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 4
- 235000019270 ammonium chloride Nutrition 0.000 description 3
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Chemical compound C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 description 3
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- CBOCVOKPQGJKKJ-UHFFFAOYSA-L Calcium formate Chemical compound [Ca+2].[O-]C=O.[O-]C=O CBOCVOKPQGJKKJ-UHFFFAOYSA-L 0.000 description 2
- 229910002651 NO3 Inorganic materials 0.000 description 2
- NHNBFGGVMKEFGY-UHFFFAOYSA-N Nitrate Chemical compound [O-][N+]([O-])=O NHNBFGGVMKEFGY-UHFFFAOYSA-N 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- ZZCONUBOESKGOK-UHFFFAOYSA-N aluminum;trinitrate;hydrate Chemical compound O.[Al+3].[O-][N+]([O-])=O.[O-][N+]([O-])=O.[O-][N+]([O-])=O ZZCONUBOESKGOK-UHFFFAOYSA-N 0.000 description 2
- WKWYPZOBBMTLRI-UHFFFAOYSA-M azanium sodium chloride nitrite Chemical compound [NH4+].[Na+].[Cl-].[O-]N=O WKWYPZOBBMTLRI-UHFFFAOYSA-M 0.000 description 2
- 229940044172 calcium formate Drugs 0.000 description 2
- 235000019255 calcium formate Nutrition 0.000 description 2
- 239000004281 calcium formate Substances 0.000 description 2
- 239000003245 coal Substances 0.000 description 2
- 230000005611 electricity Effects 0.000 description 2
- 239000000395 magnesium oxide Substances 0.000 description 2
- CPLXHLVBOLITMK-UHFFFAOYSA-N magnesium oxide Inorganic materials [Mg]=O CPLXHLVBOLITMK-UHFFFAOYSA-N 0.000 description 2
- YISKQXFNIWWETM-UHFFFAOYSA-N magnesium;dinitrate;hydrate Chemical compound O.[Mg+2].[O-][N+]([O-])=O.[O-][N+]([O-])=O YISKQXFNIWWETM-UHFFFAOYSA-N 0.000 description 2
- AXZKOIWUVFPNLO-UHFFFAOYSA-N magnesium;oxygen(2-) Chemical compound [O-2].[Mg+2] AXZKOIWUVFPNLO-UHFFFAOYSA-N 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- 229910052751 metal Inorganic materials 0.000 description 2
- 239000002184 metal Substances 0.000 description 2
- 235000010288 sodium nitrite Nutrition 0.000 description 2
- 229940099259 vaseline Drugs 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- IOVCWXUNBOPUCH-UHFFFAOYSA-M Nitrite anion Chemical compound [O-]N=O IOVCWXUNBOPUCH-UHFFFAOYSA-M 0.000 description 1
- 239000004264 Petrolatum Substances 0.000 description 1
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 1
- 229910000831 Steel Inorganic materials 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 230000009172 bursting Effects 0.000 description 1
- 238000002485 combustion reaction Methods 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 239000000428 dust Substances 0.000 description 1
- 239000003721 gunpowder Substances 0.000 description 1
- 230000000977 initiatory effect Effects 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 229940066842 petrolatum Drugs 0.000 description 1
- 229920005989 resin Polymers 0.000 description 1
- 239000011347 resin Substances 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 239000010959 steel Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 229920002994 synthetic fiber Polymers 0.000 description 1
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE3326884C2 (de) | Verfahren zum Verdecken sichtbarer und infraroter Strahlung und Nebelmunition zur Durchführung dieses Verfahrens | |
| DE952234C (de) | Gasdruck erzeugende Ladung | |
| DE19717044A1 (de) | Vorrichtung zum Feuerlöschen in Räumen und aerosolbildende Zusammensetzung dafür | |
| DE957288C (de) | Zuendpatrone | |
| DE1047092B (de) | Verfahren und Vorrichtung zum Ausloesen von Gasdruck-Sprengpatronen | |
| DE942319C (de) | Blaslochfreie elektrische Sprengkapsel mit kurzer Verzoegerung | |
| DE932596C (de) | Druckgas erzeugende Sprengpatrone | |
| DEI0008099MA (enrdf_load_stackoverflow) | ||
| DE2530209A1 (de) | Brandmittel-zusammensetzung | |
| DE953506C (de) | Heizmasse zur Einleitung der thermischen Zersetzung von nicht detonierenden Sicherheitssprengladungen | |
| DE945011C (de) | Ammonnitratwettersprengstoffpulver | |
| DE946879C (de) | Druckgas erzeugende Ladung fuer wiederholt verwendbare Sprengeinrichtungen | |
| DE1906487C3 (de) | Verfahren zum Sprengen von Beton | |
| DE942012C (de) | Sprengvorrichtung | |
| US1909776A (en) | Fog gas cartridge | |
| DE1008634B (de) | Gasdrucksprengpatrone | |
| DE2553055C3 (de) | Sicherheitssprengstoff | |
| DEI0008362MA (enrdf_load_stackoverflow) | ||
| DE803645C (de) | Schagwettersichere Sprengkapsel in Verbindung mit elektrischen Zuendern | |
| DE1036139B (de) | Heizmasse zur Einleitung der thermischen Zersetzung von nicht detonierenden Sicherheitssprengladungen | |
| DE651832C (de) | Sicherheitspatrone | |
| DE1909744C3 (de) | Salzpaar-Wetter-Sprengstoff | |
| DE881018C (de) | Verfahren zur Erhoehung der Schlagwettersicherheit und Verbesserung der Sprengwirkung bei der Schiessarbeit | |
| DE945496C (de) | Sicherheits-Knallzuendschnur | |
| DE1035033B (de) | Heizmasse zur Einleitung der thermischen Zersetzung von nicht detonierenden Sicherheitssprengladungen |