DEG0016892MA - - Google Patents
Info
- Publication number
- DEG0016892MA DEG0016892MA DEG0016892MA DE G0016892M A DEG0016892M A DE G0016892MA DE G0016892M A DEG0016892M A DE G0016892MA
- Authority
- DE
- Germany
- Prior art keywords
- steels
- hardening
- over
- temperature
- manganese
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Active
Links
- 229910000831 Steel Inorganic materials 0.000 claims description 17
- 239000010959 steel Substances 0.000 claims description 17
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 claims description 4
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 claims description 4
- 239000011651 chromium Substances 0.000 claims description 4
- 238000010276 construction Methods 0.000 claims description 4
- 239000000463 material Substances 0.000 claims description 4
- 238000010791 quenching Methods 0.000 claims description 4
- 230000000171 quenching effect Effects 0.000 claims description 4
- 239000010936 titanium Substances 0.000 claims description 4
- 229910052719 titanium Inorganic materials 0.000 claims description 4
- 229910052720 vanadium Inorganic materials 0.000 claims description 4
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical compound [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 claims description 3
- 229910052799 carbon Inorganic materials 0.000 claims description 3
- 229910052804 chromium Inorganic materials 0.000 claims description 3
- PMHQVHHXPFUNSP-UHFFFAOYSA-M copper(1+);methylsulfanylmethane;bromide Chemical compound Br[Cu].CSC PMHQVHHXPFUNSP-UHFFFAOYSA-M 0.000 claims description 3
- 239000012535 impurity Substances 0.000 claims description 3
- 239000011572 manganese Substances 0.000 claims description 3
- LEONUFNNVUYDNQ-UHFFFAOYSA-N vanadium atom Chemical compound [V] LEONUFNNVUYDNQ-UHFFFAOYSA-N 0.000 claims description 3
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims description 2
- ZOKXTWBITQBERF-UHFFFAOYSA-N Molybdenum Chemical compound [Mo] ZOKXTWBITQBERF-UHFFFAOYSA-N 0.000 claims description 2
- 229910052742 iron Inorganic materials 0.000 claims description 2
- 229910052748 manganese Inorganic materials 0.000 claims description 2
- WPBNNNQJVZRUHP-UHFFFAOYSA-L manganese(2+);methyl n-[[2-(methoxycarbonylcarbamothioylamino)phenyl]carbamothioyl]carbamate;n-[2-(sulfidocarbothioylamino)ethyl]carbamodithioate Chemical compound [Mn+2].[S-]C(=S)NCCNC([S-])=S.COC(=O)NC(=S)NC1=CC=CC=C1NC(=S)NC(=O)OC WPBNNNQJVZRUHP-UHFFFAOYSA-L 0.000 claims description 2
- 229910052750 molybdenum Inorganic materials 0.000 claims description 2
- 239000011733 molybdenum Substances 0.000 claims description 2
- 229910052710 silicon Inorganic materials 0.000 claims description 2
- 239000010703 silicon Substances 0.000 claims description 2
- 239000000203 mixture Substances 0.000 claims 3
- 238000001816 cooling Methods 0.000 claims 1
- 229910052845 zircon Inorganic materials 0.000 claims 1
- GFQYVLUOOAAOGM-UHFFFAOYSA-N zirconium(iv) silicate Chemical compound [Zr+4].[O-][Si]([O-])([O-])[O-] GFQYVLUOOAAOGM-UHFFFAOYSA-N 0.000 claims 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 4
- 229910052782 aluminium Inorganic materials 0.000 description 3
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- 229910045601 alloy Inorganic materials 0.000 description 2
- 239000000956 alloy Substances 0.000 description 2
- 229910002065 alloy metal Inorganic materials 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 208000001848 dysentery Diseases 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 229910000838 Al alloy Inorganic materials 0.000 description 1
- 229910000599 Cr alloy Inorganic materials 0.000 description 1
- 229910001208 Crucible steel Inorganic materials 0.000 description 1
- PWHULOQIROXLJO-UHFFFAOYSA-N Manganese Chemical compound [Mn] PWHULOQIROXLJO-UHFFFAOYSA-N 0.000 description 1
- 229910000914 Mn alloy Inorganic materials 0.000 description 1
- QCWXUUIWCKQGHC-UHFFFAOYSA-N Zirconium Chemical compound [Zr] QCWXUUIWCKQGHC-UHFFFAOYSA-N 0.000 description 1
- 230000005540 biological transmission Effects 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 150000001247 metal acetylides Chemical class 0.000 description 1
- 150000004767 nitrides Chemical class 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 1
- 238000013021 overheating Methods 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 229910052726 zirconium Inorganic materials 0.000 description 1
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE3686121T2 (de) | Hochfester hitzebestaendiger ferritischer stahl mit hohem chromgehalt und verfahren zu seiner herstellung. | |
| DE69018658T2 (de) | Hochfester hitzebeständiger Stahl mit verbesserter Bearbeitbarkeit. | |
| SE1650850A1 (en) | Steel suitable for plastic molding tools | |
| DE3426882A1 (de) | Hitzebestaendiger, martensitischer, rostfreier stahl mit 12% chrom | |
| DE69508876T2 (de) | Temperaturbeständiger ferritischer Stahl mit hohem Chromgehalt | |
| KR20140123111A (ko) | 내지연파괴성이 우수한 보론 첨가 고강도 볼트용 강 및 고강도 볼트 | |
| KR102285860B1 (ko) | 고인성 주조용 알루미늄 합금 및 그 제조방법 | |
| EP3899065B1 (de) | Bohrstrangkomponente mit hoher korrosionsbeständigkeit und verfahren zu ihrer herstellung | |
| JPS6144121A (ja) | 高強度、高靭性圧力容器用鋼の製造方法 | |
| EP1430161B1 (de) | Hochfester duplex-/triplex-leichtbaustahl und seine verwendung | |
| US20240141465A1 (en) | Martensittc steel and method of manufacturing a martensitic steel | |
| CN109790602B (zh) | 钢 | |
| DE1483218B2 (de) | Verfahren zum Herstellen eines warmfesten, ferritischen Cr-Mo-V-Stahles mit hoher Zeitstandfestigkeit und verbesserter Zeitbruchdehnung | |
| DE2800444A1 (de) | Legierter stahl | |
| DE2421680B2 (de) | Aushärtbare Nickel-Kobalt-Eisen-Gußlegierung mit niedrigem Ausdehnungskoeffizienten und hoher Streckbarkeit | |
| EP2662461A1 (de) | Eisen-Chrom-Mangan-Nickel-Legierung | |
| DE2421656A1 (de) | Aushaertbare nickel-eisen-gusslegierung mit niedrigem ausdehnungskoeffizienten | |
| EP0897018B1 (de) | Duplexstahl mit hoher Festigkeit und Korrosionsbeständigkeit | |
| DEG0016892MA (OSRAM) | ||
| DE3401769A1 (de) | Kugelpraphit-gusseisen und verfahren zu seiner herstellung | |
| EP0733719B1 (de) | Eisenbasislegierung zur Verwendung bei erhöhter Temperatur | |
| DE69708574T2 (de) | Verwendung eines schweissbaren ferritischen Gussstahls mit niedrigem Chromgehalt und mit sehr gute Warmfestigkeit | |
| EP3225702B1 (de) | Stahl mit reduzierter dichte und verfahren zur herstellung eines stahlflach- oder -langprodukts aus einem solchen stahl | |
| DE60304052T2 (de) | Gegossenes Abgassystem | |
| US3783040A (en) | Low carbon high strength steel |