DE922257C - Ferroelektrische Speichereinrichtung und Schaltung - Google Patents
Ferroelektrische Speichereinrichtung und SchaltungInfo
- Publication number
- DE922257C DE922257C DEW8873A DEW0008873A DE922257C DE 922257 C DE922257 C DE 922257C DE W8873 A DEW8873 A DE W8873A DE W0008873 A DEW0008873 A DE W0008873A DE 922257 C DE922257 C DE 922257C
- Authority
- DE
- Germany
- Prior art keywords
- pulse
- pulses
- crystal
- ferroelectric
- negative
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 230000010287 polarization Effects 0.000 claims description 48
- 238000006073 displacement reaction Methods 0.000 claims description 32
- 239000003990 capacitor Substances 0.000 claims description 26
- JRPBQTZRNDNNOP-UHFFFAOYSA-N barium titanate Chemical compound [Ba+2].[Ba+2].[O-][Ti]([O-])([O-])[O-] JRPBQTZRNDNNOP-UHFFFAOYSA-N 0.000 claims description 17
- 229910002113 barium titanate Inorganic materials 0.000 claims description 17
- 230000002441 reversible effect Effects 0.000 claims description 5
- 239000000463 material Substances 0.000 claims description 4
- 238000000576 coating method Methods 0.000 claims 6
- 239000011248 coating agent Substances 0.000 claims 2
- 239000013078 crystal Substances 0.000 description 132
- 230000008859 change Effects 0.000 description 9
- 238000010586 diagram Methods 0.000 description 8
- 230000000903 blocking effect Effects 0.000 description 7
- BQCADISMDOOEFD-UHFFFAOYSA-N Silver Chemical compound [Ag] BQCADISMDOOEFD-UHFFFAOYSA-N 0.000 description 5
- 229910052709 silver Inorganic materials 0.000 description 5
- 239000004332 silver Substances 0.000 description 5
- 239000000126 substance Substances 0.000 description 5
- 230000005294 ferromagnetic effect Effects 0.000 description 3
- GNPVGFCGXDBREM-UHFFFAOYSA-N germanium atom Chemical compound [Ge] GNPVGFCGXDBREM-UHFFFAOYSA-N 0.000 description 3
- QPLDLSVMHZLSFG-UHFFFAOYSA-N Copper oxide Chemical compound [Cu]=O QPLDLSVMHZLSFG-UHFFFAOYSA-N 0.000 description 2
- 239000005751 Copper oxide Substances 0.000 description 2
- 230000005540 biological transmission Effects 0.000 description 2
- 239000000919 ceramic Substances 0.000 description 2
- 238000010276 construction Methods 0.000 description 2
- 229910000431 copper oxide Inorganic materials 0.000 description 2
- 230000007423 decrease Effects 0.000 description 2
- 230000003247 decreasing effect Effects 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 230000005684 electric field Effects 0.000 description 2
- 239000003302 ferromagnetic material Substances 0.000 description 2
- 230000014509 gene expression Effects 0.000 description 2
- YBMRDBCBODYGJE-UHFFFAOYSA-N germanium oxide Inorganic materials O=[Ge]=O YBMRDBCBODYGJE-UHFFFAOYSA-N 0.000 description 2
- 150000002500 ions Chemical class 0.000 description 2
- 230000005291 magnetic effect Effects 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 238000005259 measurement Methods 0.000 description 2
- LJCNRYVRMXRIQR-OLXYHTOASA-L potassium sodium L-tartrate Chemical compound [Na+].[K+].[O-]C(=O)[C@H](O)[C@@H](O)C([O-])=O LJCNRYVRMXRIQR-OLXYHTOASA-L 0.000 description 2
- 235000011006 sodium potassium tartrate Nutrition 0.000 description 2
- 238000013459 approach Methods 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 230000001427 coherent effect Effects 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 230000008878 coupling Effects 0.000 description 1
- 238000010168 coupling process Methods 0.000 description 1
- 238000005859 coupling reaction Methods 0.000 description 1
- 238000009415 formwork Methods 0.000 description 1
- 230000006870 function Effects 0.000 description 1
- 229910052732 germanium Inorganic materials 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 229910000402 monopotassium phosphate Inorganic materials 0.000 description 1
- 235000019796 monopotassium phosphate Nutrition 0.000 description 1
- GNSKLFRGEWLPPA-UHFFFAOYSA-M potassium dihydrogen phosphate Chemical compound [K+].OP(O)([O-])=O GNSKLFRGEWLPPA-UHFFFAOYSA-M 0.000 description 1
- LWIHDJKSTIGBAC-UHFFFAOYSA-K potassium phosphate Substances [K+].[K+].[K+].[O-]P([O-])([O-])=O LWIHDJKSTIGBAC-UHFFFAOYSA-K 0.000 description 1
- UKDIAJWKFXFVFG-UHFFFAOYSA-N potassium;oxido(dioxo)niobium Chemical compound [K+].[O-][Nb](=O)=O UKDIAJWKFXFVFG-UHFFFAOYSA-N 0.000 description 1
- 230000001681 protective effect Effects 0.000 description 1
- 238000012552 review Methods 0.000 description 1
- UYLYBEXRJGPQSH-UHFFFAOYSA-N sodium;oxido(dioxo)niobium Chemical compound [Na+].[O-][Nb](=O)=O UYLYBEXRJGPQSH-UHFFFAOYSA-N 0.000 description 1
- 230000007704 transition Effects 0.000 description 1
Classifications
-
- G—PHYSICS
- G11—INFORMATION STORAGE
- G11C—STATIC STORES
- G11C11/00—Digital stores characterised by the use of particular electric or magnetic storage elements; Storage elements therefor
- G11C11/21—Digital stores characterised by the use of particular electric or magnetic storage elements; Storage elements therefor using electric elements
- G11C11/22—Digital stores characterised by the use of particular electric or magnetic storage elements; Storage elements therefor using electric elements using ferroelectric elements
-
- G—PHYSICS
- G11—INFORMATION STORAGE
- G11C—STATIC STORES
- G11C19/00—Digital stores in which the information is moved stepwise, e.g. shift registers
- G11C19/005—Digital stores in which the information is moved stepwise, e.g. shift registers with ferro-electric elements (condensers)
-
- G—PHYSICS
- G11—INFORMATION STORAGE
- G11C—STATIC STORES
- G11C8/00—Arrangements for selecting an address in a digital store
- G11C8/005—Arrangements for selecting an address in a digital store with travelling wave access
Landscapes
- Engineering & Computer Science (AREA)
- Computer Hardware Design (AREA)
- Microelectronics & Electronic Packaging (AREA)
- Semiconductor Memories (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US254245A US2717372A (en) | 1951-11-01 | 1951-11-01 | Ferroelectric storage device and circuit |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE922257C true DE922257C (de) | 1955-01-13 |
Family
ID=22963509
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEW8873A Expired DE922257C (de) | 1951-11-01 | 1952-06-24 | Ferroelektrische Speichereinrichtung und Schaltung |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US2717372A (enExample) |
| BE (1) | BE514698A (enExample) |
| CH (1) | CH318886A (enExample) |
| DE (1) | DE922257C (enExample) |
| FR (1) | FR1059092A (enExample) |
| GB (1) | GB717104A (enExample) |
| NL (2) | NL80609C (enExample) |
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1044889B (de) * | 1955-11-08 | 1958-11-27 | Western Electric Co | Zwischen Elektroden angeordneter ferroelektrischer Kristall als Informationsspeicher |
| DE1091162B (de) * | 1956-08-09 | 1960-10-20 | Western Electric Co | Ferroelektrisch oder piezoelektrisch aktives Dielektrikum |
Families Citing this family (33)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB784127A (en) * | 1952-10-24 | 1957-10-02 | Elliott Brothers London Ltd | Improvements in or relating to apparatus for generating coded patterns of electric pulses |
| US2884617A (en) * | 1953-09-21 | 1959-04-28 | Charles F Pulvari | Methods and apparatus for recording and reproducing intelligence |
| NL99558C (enExample) * | 1953-10-01 | |||
| NL192333A (enExample) * | 1953-11-17 | |||
| NL194985A (enExample) * | 1954-02-24 | |||
| GB788353A (en) * | 1954-07-26 | 1958-01-02 | Plessey Co Ltd | Improvements in and relating to storage devices |
| NL201407A (enExample) * | 1955-02-18 | |||
| US2928075A (en) * | 1955-04-14 | 1960-03-08 | Bell Telephone Labor Inc | Ferroelectric storage circuits |
| US2972734A (en) * | 1955-06-23 | 1961-02-21 | Bell Telephone Labor Inc | Electrical circuits employing ferroelectric condensers |
| US3030527A (en) * | 1955-08-08 | 1962-04-17 | Stewart Warner Corp | Piezo-electric power source assembly |
| BE550048A (enExample) * | 1955-11-21 | |||
| BE553183A (enExample) * | 1955-12-07 | |||
| US2854590A (en) * | 1955-12-12 | 1958-09-30 | Bell Telephone Labor Inc | Counting circuits employing ferroelectric capacitors |
| NL213762A (enExample) * | 1956-01-17 | |||
| US2907823A (en) * | 1956-01-25 | 1959-10-06 | Siemens Ag | Start-stop teleprinter |
| US2912598A (en) * | 1956-03-29 | 1959-11-10 | Shockley Transistor Corp | Shifting register |
| US2860322A (en) * | 1956-05-25 | 1958-11-11 | Bell Telephone Labor Inc | Barium titanate memory device |
| US3126509A (en) * | 1956-07-27 | 1964-03-24 | Electrical condenser having two electrically | |
| BE559868A (enExample) * | 1956-08-07 | |||
| US2986681A (en) * | 1956-10-31 | 1961-05-30 | Bell Telephone Labor Inc | Monoclinic glycine sulfate and isomorphs |
| US2842313A (en) * | 1956-12-28 | 1958-07-08 | Ibm | Ferroelectric accumulator |
| US2960691A (en) * | 1957-06-10 | 1960-11-15 | Bell Telephone Labor Inc | Pulse signaling circuit |
| US2930906A (en) * | 1957-08-08 | 1960-03-29 | Bell Telephone Labor Inc | Ferroelectric counting circuit |
| NL230574A (enExample) * | 1957-08-27 | |||
| NL241706A (enExample) * | 1958-08-04 | |||
| US3082409A (en) * | 1958-11-13 | 1963-03-19 | Bell Telephone Labor Inc | Ferroelectric counting circuit |
| US3089132A (en) * | 1958-12-30 | 1963-05-07 | Bell Telephone Labor Inc | Ferroelectric code translator |
| US3112371A (en) * | 1959-05-21 | 1963-11-26 | Gen Dynamics Corp | Automatic communication system |
| US3142044A (en) * | 1961-05-17 | 1964-07-21 | Litton Systems Inc | Ceramic memory element |
| US3287600A (en) * | 1962-11-19 | 1966-11-22 | Jr Henry L Cox | Storage circuit for ferroelectric display screen |
| US3662194A (en) * | 1970-07-08 | 1972-05-09 | Juichi Moriki | High-voltage piezoelectric transformer housed with diodes |
| US5434811A (en) * | 1987-11-19 | 1995-07-18 | National Semiconductor Corporation | Non-destructive read ferroelectric based memory circuit |
| DE102008011414A1 (de) * | 2008-02-27 | 2009-09-10 | Continental Automotive Gmbh | Verfahren zum Polarisieren einer Piezokeramik |
Family Cites Families (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2519513A (en) * | 1948-09-09 | 1950-08-22 | Ralph L Thompson | Binary counting circuit |
| US2306555A (en) * | 1940-05-23 | 1942-12-29 | Research Corp | Method for frequency control |
| US2473556A (en) * | 1943-03-15 | 1949-06-21 | Carl A Wiley | Device for controlling oscillating circuits |
| US2430457A (en) * | 1945-09-20 | 1947-11-11 | Bell Telephone Labor Inc | Key control sender |
| US2526207A (en) * | 1946-04-27 | 1950-10-17 | Rca Corp | Capacitor for frequency modulation |
| US2486560A (en) * | 1946-09-20 | 1949-11-01 | Erie Resistor Corp | Transducer and method of making the same |
| US2521329A (en) * | 1947-08-15 | 1950-09-05 | Brush Dev Co | Repolarized transducer system |
| NL81373C (enExample) * | 1947-12-26 | |||
| US2614167A (en) * | 1949-12-28 | 1952-10-14 | Teleregister Corp | Static electromagnetic memory device |
-
0
- NL NLAANVRAGE7711972,A patent/NL172335B/xx unknown
- BE BE514698D patent/BE514698A/xx unknown
- NL NL80609D patent/NL80609C/xx active
-
1951
- 1951-11-01 US US254245A patent/US2717372A/en not_active Expired - Lifetime
-
1952
- 1952-04-23 FR FR1059092D patent/FR1059092A/fr not_active Expired
- 1952-06-24 DE DEW8873A patent/DE922257C/de not_active Expired
- 1952-09-26 CH CH318886D patent/CH318886A/fr unknown
- 1952-10-24 GB GB26741/52A patent/GB717104A/en not_active Expired
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1044889B (de) * | 1955-11-08 | 1958-11-27 | Western Electric Co | Zwischen Elektroden angeordneter ferroelektrischer Kristall als Informationsspeicher |
| DE1091162B (de) * | 1956-08-09 | 1960-10-20 | Western Electric Co | Ferroelektrisch oder piezoelektrisch aktives Dielektrikum |
Also Published As
| Publication number | Publication date |
|---|---|
| GB717104A (en) | 1954-10-20 |
| US2717372A (en) | 1955-09-06 |
| NL172335B (nl) | |
| BE514698A (enExample) | |
| FR1059092A (fr) | 1954-03-22 |
| CH318886A (fr) | 1957-01-31 |
| NL80609C (enExample) |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE922257C (de) | Ferroelektrische Speichereinrichtung und Schaltung | |
| DE830353C (de) | Elektronischer Schalter | |
| DE2633512C3 (de) | Spannungsvervielfacher für elektronische Zeitmeßgeräte | |
| DE2037676B2 (de) | Anzeigeschirm mit einer fluessigkeristallschicht sowie verfahren zu dessen herstellung | |
| DE2643704A1 (de) | Transversalfilter mit mindestens einem analogen schieberegister und verfahren zu dessen betrieb | |
| DE2546163C2 (de) | Elektronische Schaltungsanordnung zur Temperaturmessung | |
| DE1474510B2 (de) | Durch schiebeimpulse gesteuerte schieberegister insbesondere fuer zeitmultiplex systeme | |
| DE1131268B (de) | Ferroelektrischer Speicher | |
| DE1022263B (de) | System zur Steuerung und/oder Speicherung elektrischer Signale | |
| DE1264508B (de) | Magnetisches Schieberegister | |
| DE1260530B (de) | Zaehlschaltung zur Zaehlung jedes von einer Vielzahl von angelegten Eingangsimpulsen | |
| DE1044167B (de) | Schaltungsanordnung mit einem ferroelektrischen Kondensator | |
| DE1040596B (de) | Magnetkernschalter mit Magnetkernen geringer Remanenz zum Betreiben von Magnetkernspeichern | |
| DE2061990B2 (de) | Schaltungsanordnung für einen elektronischen Koppelpunkt in Fernmelde-, insbesondere Fernsprechvermittlungsanlagen | |
| DE1119568B (de) | Bistabile Speichereinheit mit zwei ferroelektrischen Elementen | |
| DE2108589A1 (de) | Spannungsgenerator | |
| DE972688C (de) | Einrichtung mit einem geschlossenen, ferromagnetischen Kern mit hoher Remanenz und einer annaehernd rechteckfoermigen Hystereseschleife | |
| DE1042641B (de) | Astabiler Multivibrator | |
| DE1034687B (de) | Zaehl- und Speicheranordnung mit einem ferroelektrischen Kondensator | |
| DE1077702B (de) | Aus einem Kondensator mit ferroelektrischem Dielektrikum bestehendes Speicherelement | |
| DE1037181B (de) | Speicher fuer binaere Nachrichten | |
| DE2126182A1 (de) | Vorrichtung zum Einstellen der Größe eines Widerstandes | |
| DE3014274C2 (enExample) | ||
| DE1474510C (de) | Durch Schiebeimpulse gesteuerte Schieberegister, insbesondere für Zeitmultiplex-Systeme | |
| AT242986B (de) | Matrixzuordner mit kapazitiver Kopplung zwischen Zeilen- und Spaltendrähten |