DE69202807T2 - Flüssiges Geschirrspülmittel. - Google Patents
Flüssiges Geschirrspülmittel.Info
- Publication number
- DE69202807T2 DE69202807T2 DE69202807T DE69202807T DE69202807T2 DE 69202807 T2 DE69202807 T2 DE 69202807T2 DE 69202807 T DE69202807 T DE 69202807T DE 69202807 T DE69202807 T DE 69202807T DE 69202807 T2 DE69202807 T2 DE 69202807T2
- Authority
- DE
- Germany
- Prior art keywords
- group
- amphoteric
- compounds
- alkyl
- composition according
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Fee Related
Links
- 238000004851 dishwashing Methods 0.000 title claims abstract description 50
- 239000007788 liquid Substances 0.000 title claims abstract description 15
- 239000000203 mixture Substances 0.000 claims abstract description 86
- 150000001875 compounds Chemical class 0.000 claims abstract description 66
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 46
- 239000003945 anionic surfactant Substances 0.000 claims description 29
- 125000004432 carbon atom Chemical group C* 0.000 claims description 22
- 125000001183 hydrocarbyl group Chemical group 0.000 claims description 12
- 229910052739 hydrogen Inorganic materials 0.000 claims description 11
- 239000001257 hydrogen Substances 0.000 claims description 11
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 claims description 8
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 6
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 claims description 5
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical group [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 5
- 125000003342 alkenyl group Chemical group 0.000 claims description 5
- 239000002736 nonionic surfactant Substances 0.000 claims description 5
- 229910052783 alkali metal Inorganic materials 0.000 claims description 4
- 150000001340 alkali metals Chemical class 0.000 claims description 4
- 229910052784 alkaline earth metal Inorganic materials 0.000 claims description 4
- 150000001342 alkaline earth metals Chemical class 0.000 claims description 4
- 125000000837 carbohydrate group Chemical group 0.000 claims description 4
- FKNQFGJONOIPTF-UHFFFAOYSA-N Sodium cation Chemical group [Na+] FKNQFGJONOIPTF-UHFFFAOYSA-N 0.000 claims description 3
- 150000003863 ammonium salts Chemical class 0.000 claims description 3
- 150000002500 ions Chemical group 0.000 claims description 3
- 229910001415 sodium ion Chemical group 0.000 claims description 3
- BDHFUVZGWQCTTF-UHFFFAOYSA-M sulfonate Chemical compound [O-]S(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-M 0.000 claims description 3
- 125000002947 alkylene group Chemical group 0.000 claims description 2
- 125000002768 hydroxyalkyl group Chemical group 0.000 claims description 2
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 claims 1
- 239000004094 surface-active agent Substances 0.000 abstract description 10
- 125000000129 anionic group Chemical group 0.000 abstract description 3
- KWIUHFFTVRNATP-UHFFFAOYSA-N glycine betaine Chemical compound C[N+](C)(C)CC([O-])=O KWIUHFFTVRNATP-UHFFFAOYSA-N 0.000 description 12
- -1 alkyl ether sulfates Chemical class 0.000 description 11
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 10
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical group C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 7
- 229960003237 betaine Drugs 0.000 description 7
- SMVRDGHCVNAOIN-UHFFFAOYSA-L disodium;1-dodecoxydodecane;sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O.CCCCCCCCCCCCOCCCCCCCCCCCC SMVRDGHCVNAOIN-UHFFFAOYSA-L 0.000 description 7
- 239000006260 foam Substances 0.000 description 6
- 239000003760 tallow Substances 0.000 description 5
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 4
- 238000004140 cleaning Methods 0.000 description 4
- 230000000694 effects Effects 0.000 description 4
- 238000005187 foaming Methods 0.000 description 4
- 230000002209 hydrophobic effect Effects 0.000 description 4
- 239000002904 solvent Substances 0.000 description 4
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 3
- 150000001412 amines Chemical class 0.000 description 3
- 239000002280 amphoteric surfactant Substances 0.000 description 3
- 239000003599 detergent Substances 0.000 description 3
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 3
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 3
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 3
- 235000013162 Cocos nucifera Nutrition 0.000 description 2
- 244000060011 Cocos nucifera Species 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- 150000001335 aliphatic alkanes Chemical class 0.000 description 2
- 229940045714 alkyl sulfonate alkylating agent Drugs 0.000 description 2
- 150000008052 alkyl sulfonates Chemical class 0.000 description 2
- 235000015278 beef Nutrition 0.000 description 2
- 235000014113 dietary fatty acids Nutrition 0.000 description 2
- 239000000194 fatty acid Substances 0.000 description 2
- 229930195729 fatty acid Natural products 0.000 description 2
- 125000004395 glucoside group Chemical group 0.000 description 2
- 150000002334 glycols Chemical class 0.000 description 2
- 229930182470 glycoside Natural products 0.000 description 2
- 125000001570 methylene group Chemical group [H]C([H])([*:1])[*:2] 0.000 description 2
- 239000000693 micelle Substances 0.000 description 2
- ZBJVLWIYKOAYQH-UHFFFAOYSA-N naphthalen-2-yl 2-hydroxybenzoate Chemical compound OC1=CC=CC=C1C(=O)OC1=CC=C(C=CC=C2)C2=C1 ZBJVLWIYKOAYQH-UHFFFAOYSA-N 0.000 description 2
- 230000002335 preservative effect Effects 0.000 description 2
- 229920006395 saturated elastomer Polymers 0.000 description 2
- 235000015067 sauces Nutrition 0.000 description 2
- 239000002453 shampoo Substances 0.000 description 2
- 159000000000 sodium salts Chemical class 0.000 description 2
- 150000003871 sulfonates Chemical class 0.000 description 2
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 2
- FKKAGFLIPSSCHT-UHFFFAOYSA-N 1-dodecoxydodecane;sulfuric acid Chemical compound OS(O)(=O)=O.CCCCCCCCCCCCOCCCCCCCCCCCC FKKAGFLIPSSCHT-UHFFFAOYSA-N 0.000 description 1
- HKLYDUXIXBVZOQ-UHFFFAOYSA-N 2-aminoethane-1,1,1-triol Chemical compound NCC(O)(O)O HKLYDUXIXBVZOQ-UHFFFAOYSA-N 0.000 description 1
- WBIQQQGBSDOWNP-UHFFFAOYSA-N 2-dodecylbenzenesulfonic acid Chemical compound CCCCCCCCCCCCC1=CC=CC=C1S(O)(=O)=O WBIQQQGBSDOWNP-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- 206010020751 Hypersensitivity Diseases 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- AOMUHOFOVNGZAN-UHFFFAOYSA-N N,N-bis(2-hydroxyethyl)dodecanamide Chemical compound CCCCCCCCCCCC(=O)N(CCO)CCO AOMUHOFOVNGZAN-UHFFFAOYSA-N 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 239000013543 active substance Substances 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 150000008055 alkyl aryl sulfonates Chemical class 0.000 description 1
- 150000005215 alkyl ethers Chemical class 0.000 description 1
- 150000008051 alkyl sulfates Chemical class 0.000 description 1
- 208000026935 allergic disease Diseases 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 239000003242 anti bacterial agent Substances 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 125000003710 aryl alkyl group Chemical group 0.000 description 1
- 125000004106 butoxy group Chemical group [*]OC([H])([H])C([H])([H])C(C([H])([H])[H])([H])[H] 0.000 description 1
- TVFDJXOCXUVLDH-UHFFFAOYSA-N caesium atom Chemical compound [Cs] TVFDJXOCXUVLDH-UHFFFAOYSA-N 0.000 description 1
- 239000003093 cationic surfactant Substances 0.000 description 1
- 150000001768 cations Chemical class 0.000 description 1
- MRUAUOIMASANKQ-UHFFFAOYSA-N cocamidopropyl betaine Chemical compound CCCCCCCCCCCC(=O)NCCC[N+](C)(C)CC([O-])=O MRUAUOIMASANKQ-UHFFFAOYSA-N 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- 125000001316 cycloalkyl alkyl group Chemical group 0.000 description 1
- 238000001784 detoxification Methods 0.000 description 1
- 229940060296 dodecylbenzenesulfonic acid Drugs 0.000 description 1
- 239000003623 enhancer Substances 0.000 description 1
- 150000002169 ethanolamines Chemical class 0.000 description 1
- 125000001033 ether group Chemical group 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 125000000816 ethylene group Chemical group [H]C([H])([*:1])C([H])([H])[*:2] 0.000 description 1
- 125000005313 fatty acid group Chemical group 0.000 description 1
- 150000004665 fatty acids Chemical class 0.000 description 1
- 239000004088 foaming agent Substances 0.000 description 1
- 238000009472 formulation Methods 0.000 description 1
- 229930182479 fructoside Natural products 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 150000004676 glycans Polymers 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- 239000003921 oil Substances 0.000 description 1
- 239000002304 perfume Substances 0.000 description 1
- 239000000049 pigment Substances 0.000 description 1
- 150000004804 polysaccharides Polymers 0.000 description 1
- 229910052573 porcelain Inorganic materials 0.000 description 1
- 239000003755 preservative agent Substances 0.000 description 1
- 125000002572 propoxy group Chemical group [*]OC([H])([H])C(C([H])([H])[H])([H])[H] 0.000 description 1
- 239000002994 raw material Substances 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- DAJSVUQLFFJUSX-UHFFFAOYSA-M sodium;dodecane-1-sulfonate Chemical compound [Na+].CCCCCCCCCCCCS([O-])(=O)=O DAJSVUQLFFJUSX-UHFFFAOYSA-M 0.000 description 1
- 239000000243 solution Substances 0.000 description 1
- 230000000087 stabilizing effect Effects 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 239000002562 thickening agent Substances 0.000 description 1
- 239000004034 viscosity adjusting agent Substances 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C11—ANIMAL OR VEGETABLE OILS, FATS, FATTY SUBSTANCES OR WAXES; FATTY ACIDS THEREFROM; DETERGENTS; CANDLES
- C11D—DETERGENT COMPOSITIONS; USE OF SINGLE SUBSTANCES AS DETERGENTS; SOAP OR SOAP-MAKING; RESIN SOAPS; RECOVERY OF GLYCEROL
- C11D1/00—Detergent compositions based essentially on surface-active compounds; Use of these compounds as a detergent
- C11D1/88—Ampholytes; Electroneutral compounds
- C11D1/94—Mixtures with anionic, cationic or non-ionic compounds
Landscapes
- Chemical & Material Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Engineering & Computer Science (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Oil, Petroleum & Natural Gas (AREA)
- Wood Science & Technology (AREA)
- Organic Chemistry (AREA)
- Detergent Compositions (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| SE9101058A SE468252B (sv) | 1991-04-09 | 1991-04-09 | Flytande diskmedelskomposition innehaallande ett anjoniskt ytaktivt medel och en kombination av amfotaera foereningar |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE69202807D1 DE69202807D1 (de) | 1995-07-13 |
| DE69202807T2 true DE69202807T2 (de) | 1995-10-19 |
Family
ID=20382404
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE69202807T Expired - Fee Related DE69202807T2 (de) | 1991-04-09 | 1992-03-11 | Flüssiges Geschirrspülmittel. |
Country Status (8)
| Country | Link |
|---|---|
| EP (1) | EP0508507B1 (no) |
| JP (1) | JPH0765071B2 (no) |
| AT (1) | ATE123519T1 (no) |
| DE (1) | DE69202807T2 (no) |
| DK (1) | DK0508507T3 (no) |
| ES (1) | ES2073238T3 (no) |
| NO (1) | NO178898C (no) |
| SE (1) | SE468252B (no) |
Families Citing this family (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| SE469428B (sv) * | 1991-11-21 | 1993-07-05 | Berol Nobel Ab | Flytande diskmedelskomposition innehaallande anjonisk tensid och en kombination av tre typer av amfotaera foereningar |
| DE4435495C2 (de) * | 1994-10-04 | 1997-08-14 | Henkel Kgaa | Pumpfähige wäßrige Tensidkonzentrate |
| DE4435387C2 (de) * | 1994-10-04 | 1997-08-14 | Henkel Kgaa | Pumpfähige wäßrige Tensidkonzentrate |
| DE19506207A1 (de) * | 1995-02-23 | 1996-08-29 | Goldschmidt Ag Th | Lagerstabile, konzentrierte Tensidzusammensetzung auf der Basis von Alkylglucosiden |
| US5932535A (en) * | 1995-12-21 | 1999-08-03 | Henkel Kommanditgesellschaft Auf Aktien | Process for the production of light-colored, low-viscosity surfactant concentrates |
| DE19548068C1 (de) | 1995-12-21 | 1997-06-19 | Henkel Kgaa | Verfahren zur Herstellung hellfarbiger, niedrigviskoser Tensidkonzentrate |
| WO1998056496A1 (en) * | 1997-06-12 | 1998-12-17 | Henkel Corporation | Use of alkyl polyglycosides to improve foam stabilization of amphoacetates |
| DE19960766A1 (de) * | 1999-12-16 | 2001-06-21 | Beiersdorf Ag | Verfahren zur Herstellung besonders hautverträglicher kosmetischer oder dermatologischer Reinigungszubereitungen |
| DE19960767A1 (de) | 1999-12-16 | 2001-06-21 | Beiersdorf Ag | Verfahren zur Herstellung besonders hautverträglicher kosmetischer oder dermatologischer Reinigungszubereitungen |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| AU596187B2 (en) * | 1986-06-16 | 1990-04-26 | Helene Curtis, Inc. | Mild detergent compositions |
| DE3706015A1 (de) * | 1987-02-25 | 1988-11-17 | Henkel Kgaa | Fluessiges reinigungsmittel |
| GB8810820D0 (en) * | 1988-05-06 | 1988-06-08 | Unilever Plc | Detergent compositions |
| JP2526105B2 (ja) * | 1988-09-20 | 1996-08-21 | 花王株式会社 | 洗浄剤組成物 |
| JP2745071B2 (ja) * | 1989-09-29 | 1998-04-28 | 川研ファインケミカル株式会社 | 液体洗浄剤組成物 |
-
1991
- 1991-04-09 SE SE9101058A patent/SE468252B/sv not_active IP Right Cessation
-
1992
- 1992-03-11 AT AT92200679T patent/ATE123519T1/de not_active IP Right Cessation
- 1992-03-11 EP EP92200679A patent/EP0508507B1/en not_active Expired - Lifetime
- 1992-03-11 ES ES92200679T patent/ES2073238T3/es not_active Expired - Lifetime
- 1992-03-11 DK DK92200679.6T patent/DK0508507T3/da active
- 1992-03-11 DE DE69202807T patent/DE69202807T2/de not_active Expired - Fee Related
- 1992-04-06 JP JP4112337A patent/JPH0765071B2/ja not_active Expired - Lifetime
- 1992-04-08 NO NO921369A patent/NO178898C/no unknown
Also Published As
| Publication number | Publication date |
|---|---|
| NO178898B (no) | 1996-03-18 |
| SE9101058D0 (sv) | 1991-04-09 |
| EP0508507B1 (en) | 1995-06-07 |
| SE9101058L (sv) | 1992-10-10 |
| JPH05140587A (ja) | 1993-06-08 |
| EP0508507A1 (en) | 1992-10-14 |
| NO921369D0 (no) | 1992-04-08 |
| ATE123519T1 (de) | 1995-06-15 |
| JPH0765071B2 (ja) | 1995-07-12 |
| NO921369L (no) | 1992-10-12 |
| DK0508507T3 (da) | 1995-10-09 |
| DE69202807D1 (de) | 1995-07-13 |
| SE468252B (sv) | 1992-11-30 |
| NO178898C (no) | 1996-06-26 |
| ES2073238T3 (es) | 1995-08-01 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE68921688T3 (de) | Wenig reizendes Reinigungsmittel. | |
| DE3533977C2 (de) | Stark schäumendes, auf nichtionischen Tensiden basierendes flüssiges Feinreinigungsmittel | |
| DE69300878T2 (de) | Reinigungsmittel. | |
| WO1990007323A2 (de) | Fliessfähiges perlglanzkonzentrat | |
| WO1992013512A1 (de) | Fliessfähiges perlglanzkonzentrat | |
| EP0719324A1 (de) | Stückseifen | |
| DE69111436T2 (de) | Zusammensetzungen von flüssigen, milden geschirrspülmitteln. | |
| DE19714369A1 (de) | Mittel für die Reinigung harter Oberflächen | |
| DE3788480T2 (de) | Wasserlösliches, die Viskosität erhöhendes Mittel und dieses enthaltende Detergenszusammensetzung. | |
| EP0664830B1 (de) | Wässrige detergensgemische | |
| EP0693114B1 (de) | Handgeschirrspülmittel | |
| DE69202807T2 (de) | Flüssiges Geschirrspülmittel. | |
| EP0513138B2 (de) | Wässriges flüssiges reinigungsmittel | |
| DE69311854T2 (de) | Flüssiges Reinigungsmittel auf der Basis von starkschäumenden, nichtionischen, oberflächenaktiven Mitteln | |
| EP0574448A1 (de) | Flüssige reinigungsmittel mit einem gehalt an sulfoölsauren disalzen | |
| DE3726911A1 (de) | Waessrige zubereitungen ionischer tenside mit erhoehter viskositaet | |
| WO1996029981A1 (de) | Perlglanzkonzentrat mit newton'schem viskositätsverhalten | |
| DE69203214T2 (de) | Flüssige Geschirrspülzusammensetzung. | |
| DE69117726T2 (de) | Zusammensetzung flüssiger geschirspülmittel | |
| EP0641377B1 (de) | Milde tensidgemische | |
| EP0553099A1 (de) | Flüssiges waschmittel mit erhöhter viskosität. | |
| EP0912671A1 (de) | Hautfreundliche geschirrspülmittel | |
| WO1992001772A1 (de) | Flüssiges, fliess- und pumpfähiges tensidkonzentrat | |
| DE60034215T2 (de) | Oberflaechenaktive zusammensetzung | |
| DE69401066T2 (de) | Flüssiges reinigungsmittel auf der basis von starkschäumenden, nichtionischen, oberflächenaktiven mitteln |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8364 | No opposition during term of opposition | ||
| 8339 | Ceased/non-payment of the annual fee |