DE3601307A1 - Sicherungssystem gegen uebertemperaturen von stromfuehrenden elektrischen leitern - Google Patents
Sicherungssystem gegen uebertemperaturen von stromfuehrenden elektrischen leiternInfo
- Publication number
- DE3601307A1 DE3601307A1 DE19863601307 DE3601307A DE3601307A1 DE 3601307 A1 DE3601307 A1 DE 3601307A1 DE 19863601307 DE19863601307 DE 19863601307 DE 3601307 A DE3601307 A DE 3601307A DE 3601307 A1 DE3601307 A1 DE 3601307A1
- Authority
- DE
- Germany
- Prior art keywords
- substance
- current
- security system
- sensor
- temperature
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Granted
Links
- 238000010438 heat treatment Methods 0.000 claims abstract description 65
- 150000003839 salts Chemical class 0.000 claims abstract description 44
- 239000000126 substance Substances 0.000 claims abstract description 43
- 239000004020 conductor Substances 0.000 claims abstract description 37
- 238000002844 melting Methods 0.000 claims abstract description 19
- 230000008018 melting Effects 0.000 claims abstract description 19
- 239000002253 acid Substances 0.000 claims abstract description 9
- 230000008859 change Effects 0.000 claims abstract description 8
- 230000002441 reversible effect Effects 0.000 claims abstract description 4
- 238000012544 monitoring process Methods 0.000 claims description 10
- 239000000203 mixture Substances 0.000 claims description 9
- 150000007513 acids Chemical class 0.000 claims description 5
- 230000008878 coupling Effects 0.000 claims description 4
- 238000010168 coupling process Methods 0.000 claims description 4
- 238000005859 coupling reaction Methods 0.000 claims description 4
- 239000011521 glass Substances 0.000 claims description 4
- 230000001960 triggered effect Effects 0.000 claims 1
- 230000001419 dependent effect Effects 0.000 abstract description 3
- 235000000396 iron Nutrition 0.000 abstract description 3
- 238000005406 washing Methods 0.000 abstract description 3
- 229910052751 metal Inorganic materials 0.000 description 9
- 239000002184 metal Substances 0.000 description 9
- 239000007787 solid Substances 0.000 description 8
- 230000004044 response Effects 0.000 description 7
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- WABPQHHGFIMREM-UHFFFAOYSA-N lead(0) Chemical compound [Pb] WABPQHHGFIMREM-UHFFFAOYSA-N 0.000 description 6
- 239000000463 material Substances 0.000 description 6
- 239000000155 melt Substances 0.000 description 6
- 238000013021 overheating Methods 0.000 description 6
- 239000000919 ceramic Substances 0.000 description 5
- 239000004033 plastic Substances 0.000 description 5
- 229920003023 plastic Polymers 0.000 description 5
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 4
- 238000009413 insulation Methods 0.000 description 4
- 238000002156 mixing Methods 0.000 description 4
- 238000010586 diagram Methods 0.000 description 3
- 239000007789 gas Substances 0.000 description 3
- 238000004519 manufacturing process Methods 0.000 description 3
- 210000002445 nipple Anatomy 0.000 description 3
- 239000012774 insulation material Substances 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 230000007246 mechanism Effects 0.000 description 2
- 238000012806 monitoring device Methods 0.000 description 2
- TWNQGVIAIRXVLR-UHFFFAOYSA-N oxo(oxoalumanyloxy)alumane Chemical compound O=[Al]O[Al]=O TWNQGVIAIRXVLR-UHFFFAOYSA-N 0.000 description 2
- FGIUAXJPYTZDNR-UHFFFAOYSA-N potassium nitrate Chemical compound [K+].[O-][N+]([O-])=O FGIUAXJPYTZDNR-UHFFFAOYSA-N 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- 239000004065 semiconductor Substances 0.000 description 2
- 229910000029 sodium carbonate Inorganic materials 0.000 description 2
- 238000004804 winding Methods 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- 241000723377 Coffea Species 0.000 description 1
- 241001572165 Coffea benghalensis Species 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- 230000009471 action Effects 0.000 description 1
- AZDRQVAHHNSJOQ-UHFFFAOYSA-N alumane Chemical group [AlH3] AZDRQVAHHNSJOQ-UHFFFAOYSA-N 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 229910021538 borax Inorganic materials 0.000 description 1
- 230000002308 calcification Effects 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 230000006835 compression Effects 0.000 description 1
- 238000007906 compression Methods 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- UQGFMSUEHSUPRD-UHFFFAOYSA-N disodium;3,7-dioxido-2,4,6,8,9-pentaoxa-1,3,5,7-tetraborabicyclo[3.3.1]nonane Chemical compound [Na+].[Na+].O1B([O-])OB2OB([O-])OB1O2 UQGFMSUEHSUPRD-UHFFFAOYSA-N 0.000 description 1
- 239000003792 electrolyte Substances 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 150000004673 fluoride salts Chemical class 0.000 description 1
- 239000003365 glass fiber Substances 0.000 description 1
- 238000005470 impregnation Methods 0.000 description 1
- 230000002427 irreversible effect Effects 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 238000010309 melting process Methods 0.000 description 1
- 238000000034 method Methods 0.000 description 1
- GQPLMRYTRLFLPF-UHFFFAOYSA-N nitrous oxide Inorganic materials [O-][N+]#N GQPLMRYTRLFLPF-UHFFFAOYSA-N 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 235000010333 potassium nitrate Nutrition 0.000 description 1
- 239000004323 potassium nitrate Substances 0.000 description 1
- 108090000623 proteins and genes Proteins 0.000 description 1
- 239000011347 resin Substances 0.000 description 1
- 229920005989 resin Polymers 0.000 description 1
- 230000000284 resting effect Effects 0.000 description 1
- 239000011833 salt mixture Substances 0.000 description 1
- 238000007493 shaping process Methods 0.000 description 1
- 238000005245 sintering Methods 0.000 description 1
- 235000010344 sodium nitrate Nutrition 0.000 description 1
- 239000004317 sodium nitrate Substances 0.000 description 1
- VWDWKYIASSYTQR-UHFFFAOYSA-N sodium nitrate Inorganic materials [Na+].[O-][N+]([O-])=O VWDWKYIASSYTQR-UHFFFAOYSA-N 0.000 description 1
- 235000010339 sodium tetraborate Nutrition 0.000 description 1
- 239000004328 sodium tetraborate Substances 0.000 description 1
- 229910000679 solder Inorganic materials 0.000 description 1
- 238000011144 upstream manufacturing Methods 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- H—ELECTRICITY
- H05—ELECTRIC TECHNIQUES NOT OTHERWISE PROVIDED FOR
- H05B—ELECTRIC HEATING; ELECTRIC LIGHT SOURCES NOT OTHERWISE PROVIDED FOR; CIRCUIT ARRANGEMENTS FOR ELECTRIC LIGHT SOURCES, IN GENERAL
- H05B1/00—Details of electric heating devices
- H05B1/02—Automatic switching arrangements specially adapted to apparatus ; Control of heating devices
- H05B1/0202—Switches
- H05B1/0205—Switches using a fusible material
-
- H—ELECTRICITY
- H05—ELECTRIC TECHNIQUES NOT OTHERWISE PROVIDED FOR
- H05B—ELECTRIC HEATING; ELECTRIC LIGHT SOURCES NOT OTHERWISE PROVIDED FOR; CIRCUIT ARRANGEMENTS FOR ELECTRIC LIGHT SOURCES, IN GENERAL
- H05B3/00—Ohmic-resistance heating
- H05B3/40—Heating elements having the shape of rods or tubes
- H05B3/42—Heating elements having the shape of rods or tubes non-flexible
- H05B3/48—Heating elements having the shape of rods or tubes non-flexible heating conductor embedded in insulating material
Landscapes
- Resistance Heating (AREA)
- Control Of Resistance Heating (AREA)
Priority Applications (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19863601307 DE3601307A1 (de) | 1986-01-17 | 1986-01-17 | Sicherungssystem gegen uebertemperaturen von stromfuehrenden elektrischen leitern |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19863601307 DE3601307A1 (de) | 1986-01-17 | 1986-01-17 | Sicherungssystem gegen uebertemperaturen von stromfuehrenden elektrischen leitern |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE3601307A1 true DE3601307A1 (de) | 1987-07-23 |
| DE3601307C2 DE3601307C2 (enExample) | 1992-06-11 |
Family
ID=6292078
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19863601307 Granted DE3601307A1 (de) | 1986-01-17 | 1986-01-17 | Sicherungssystem gegen uebertemperaturen von stromfuehrenden elektrischen leitern |
Country Status (1)
| Country | Link |
|---|---|
| DE (1) | DE3601307A1 (enExample) |
Cited By (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0318895A3 (en) * | 1987-11-30 | 1990-08-08 | Elpag Ag Chur | Tubular heating element |
| DE4014753A1 (de) * | 1990-05-08 | 1991-11-14 | Elpag Ag Chur | Rohrheizkoerper mit sicherung |
| GB2431517A (en) * | 2005-10-19 | 2007-04-25 | Kidde Ip Holdings Ltd | Temperature switch |
| CN110491725A (zh) * | 2019-09-26 | 2019-11-22 | 佛山市通宝华龙控制器有限公司 | 一种防浪涌电流的突跳式温控器 |
Families Citing this family (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE4404669A1 (de) * | 1994-02-15 | 1994-09-08 | Tech In Gmbh | Thermisch schaltbare elektrische Kurzschlußbrücke und Verfahren zu deren Herstellung |
Citations (12)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE590714C (de) * | 1934-01-09 | Voigt & Haeffner Akt Ges | Temperatur-Schutz und -Regelung fuer einen einzelnen elektrischen Heizkoerper | |
| CH180337A (de) * | 1935-01-23 | 1935-10-31 | Kummler & Matter Ag | Sicherungsvorrichtung zum Schutz elektrischer Einrichtungen und Apparate. |
| US2316872A (en) * | 1941-04-10 | 1943-04-20 | Robert R Kernen | Thermal control for electric circuit |
| US2413125A (en) * | 1943-12-31 | 1946-12-24 | Fenwal Inc | Fire detector cable |
| DE958945C (de) * | 1949-05-04 | 1957-02-28 | Gen Electric | Biegsames, drahtartiges, temperaturempfindliches Element mit einer Vorrichtung zur fortlaufenden UEberwachung oder Regelung eines Stromkreises |
| DE1929855A1 (de) * | 1966-10-10 | 1970-12-23 | Dreamland Electrical Appliance | Schutzstromkreis fuer eine elektrisch beheizte Decke oder ein Kissen |
| DE2124028A1 (de) * | 1970-05-21 | 1971-12-02 | Elpag Ag Chur | Elektrischer Rohrheizkörper |
| DE2413571A1 (de) * | 1973-03-23 | 1974-10-03 | M O Valve Co Ltd | Waermebetaetigte kurzschlussvorrichtung |
| DE2426348A1 (de) * | 1973-05-30 | 1974-12-12 | Matsushita Electric Ind Co Ltd | Uebertemperatur und ueberstromwiderstandssicherung |
| DE2012426B2 (de) * | 1969-03-18 | 1975-12-04 | Micro Devices Corp., Dayton, Ohio (V.St.A.) | Elektrischer Schalter |
| US4044224A (en) * | 1976-03-01 | 1977-08-23 | General Electric Company | Protective circuit for dishwasher heating element |
| DE3204875C2 (de) * | 1982-02-12 | 1985-02-07 | Elpag Ag Chur, Chur | Rohrheizkörper mit einer Überlastungssicherung |
-
1986
- 1986-01-17 DE DE19863601307 patent/DE3601307A1/de active Granted
Patent Citations (12)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE590714C (de) * | 1934-01-09 | Voigt & Haeffner Akt Ges | Temperatur-Schutz und -Regelung fuer einen einzelnen elektrischen Heizkoerper | |
| CH180337A (de) * | 1935-01-23 | 1935-10-31 | Kummler & Matter Ag | Sicherungsvorrichtung zum Schutz elektrischer Einrichtungen und Apparate. |
| US2316872A (en) * | 1941-04-10 | 1943-04-20 | Robert R Kernen | Thermal control for electric circuit |
| US2413125A (en) * | 1943-12-31 | 1946-12-24 | Fenwal Inc | Fire detector cable |
| DE958945C (de) * | 1949-05-04 | 1957-02-28 | Gen Electric | Biegsames, drahtartiges, temperaturempfindliches Element mit einer Vorrichtung zur fortlaufenden UEberwachung oder Regelung eines Stromkreises |
| DE1929855A1 (de) * | 1966-10-10 | 1970-12-23 | Dreamland Electrical Appliance | Schutzstromkreis fuer eine elektrisch beheizte Decke oder ein Kissen |
| DE2012426B2 (de) * | 1969-03-18 | 1975-12-04 | Micro Devices Corp., Dayton, Ohio (V.St.A.) | Elektrischer Schalter |
| DE2124028A1 (de) * | 1970-05-21 | 1971-12-02 | Elpag Ag Chur | Elektrischer Rohrheizkörper |
| DE2413571A1 (de) * | 1973-03-23 | 1974-10-03 | M O Valve Co Ltd | Waermebetaetigte kurzschlussvorrichtung |
| DE2426348A1 (de) * | 1973-05-30 | 1974-12-12 | Matsushita Electric Ind Co Ltd | Uebertemperatur und ueberstromwiderstandssicherung |
| US4044224A (en) * | 1976-03-01 | 1977-08-23 | General Electric Company | Protective circuit for dishwasher heating element |
| DE3204875C2 (de) * | 1982-02-12 | 1985-02-07 | Elpag Ag Chur, Chur | Rohrheizkörper mit einer Überlastungssicherung |
Cited By (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0318895A3 (en) * | 1987-11-30 | 1990-08-08 | Elpag Ag Chur | Tubular heating element |
| DE4014753A1 (de) * | 1990-05-08 | 1991-11-14 | Elpag Ag Chur | Rohrheizkoerper mit sicherung |
| GB2431517A (en) * | 2005-10-19 | 2007-04-25 | Kidde Ip Holdings Ltd | Temperature switch |
| GB2431517B (en) * | 2005-10-19 | 2008-08-27 | Kidde Ip Holdings Ltd | Temperature switch |
| US7857996B2 (en) | 2005-10-19 | 2010-12-28 | Kidde Ip Holdings Limited | Temperature switch |
| US7947200B2 (en) | 2005-10-19 | 2011-05-24 | Kidde Ip Holdings Limited | Method of detecting a threshold temperature |
| US8349218B2 (en) | 2005-10-19 | 2013-01-08 | Kidde Ip Holdings Limited | Temperature switch |
| CN110491725A (zh) * | 2019-09-26 | 2019-11-22 | 佛山市通宝华龙控制器有限公司 | 一种防浪涌电流的突跳式温控器 |
Also Published As
| Publication number | Publication date |
|---|---|
| DE3601307C2 (enExample) | 1992-06-11 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE3242733C2 (enExample) | ||
| EP0342441B1 (de) | Temperaturschalteinrichtung | |
| EP0086465B2 (de) | Rohrheizkörper mit einer Überlastungssicherung | |
| DE958945C (de) | Biegsames, drahtartiges, temperaturempfindliches Element mit einer Vorrichtung zur fortlaufenden UEberwachung oder Regelung eines Stromkreises | |
| DE3786897T2 (de) | Elektrische Heizgeräte. | |
| DE19704653C2 (de) | Anlasser | |
| DE2948281A1 (de) | Elektrische schaltung und schaltungsschutzeinrichtung | |
| DE8715851U1 (de) | Rohrheizkörper mit einer Überlastungssicherung | |
| DE2903418A1 (de) | Heizstromkreis | |
| DE2124028B2 (de) | Elektrischer Rohrheizkörper | |
| DE1540765B2 (de) | Elektrische heizdecke oder heizkissen | |
| DE69512836T2 (de) | Verbesserte Spritzgiessheizvorrichtung | |
| DE3601307A1 (de) | Sicherungssystem gegen uebertemperaturen von stromfuehrenden elektrischen leitern | |
| EP0660644B1 (de) | Rohrheizkörper mit Überlastsicherung und Temperaturfühler | |
| DE2412688C3 (de) | Strombegrenzende sandgefüllte elektrische Sicherung | |
| DE3111911A1 (de) | Sicherheitsschaltung fuer eine elektrische heizdecke | |
| EP0420078A1 (de) | Elektrischer Zigarrenanzünder mit Überlastschutzvorrichtung | |
| DE2927475A1 (de) | Waermeschutzelement | |
| DE3249500C2 (de) | Rohrheizkörper mit einer Überlastsicherung | |
| DE2743325C2 (de) | Elektrische Luftheizungsanlage | |
| EP0621738B1 (de) | Sicherungseinrichtung eines Elektro-Heizelementes gegen unzulässige Verringerung der Wärmeabnahme | |
| DE69129468T2 (de) | Elektrischer rohrheizkörper mit einer temperaturkontrolleinrichtung | |
| EP4386805B1 (de) | Sicherungsvorrichtung, akkupack mit einer sicherungsvorrichtung und verfahren zur herstellung einer sicherungsvorrichtung | |
| DE3441870A1 (de) | Einrichtung zur erfassung und beseitigung von stoerlichtboegen | |
| EP0103075B1 (de) | Muffe aus thermoplastischem Material zum Verbinden von Leitungselementen |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8110 | Request for examination paragraph 44 | ||
| 8125 | Change of the main classification |
Ipc: H01H 37/76 |
|
| 8127 | New person/name/address of the applicant |
Owner name: CONTI ELEKTRA HEIZELEMENTE GMBH, 6483 BAD SODEN-SA |
|
| D2 | Grant after examination | ||
| 8364 | No opposition during term of opposition | ||
| 8320 | Willingness to grant licenses declared (paragraph 23) | ||
| 8339 | Ceased/non-payment of the annual fee |