DE3314249A1 - Verfahren zur herstellung von fluorierten phenylessigsaeureestern und neue fluorierte trichlorethylbenzole - Google Patents
Verfahren zur herstellung von fluorierten phenylessigsaeureestern und neue fluorierte trichlorethylbenzoleInfo
- Publication number
- DE3314249A1 DE3314249A1 DE19833314249 DE3314249A DE3314249A1 DE 3314249 A1 DE3314249 A1 DE 3314249A1 DE 19833314249 DE19833314249 DE 19833314249 DE 3314249 A DE3314249 A DE 3314249A DE 3314249 A1 DE3314249 A1 DE 3314249A1
- Authority
- DE
- Germany
- Prior art keywords
- fluorinated
- acid
- process according
- reaction
- scf
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Withdrawn
Links
- WLJVXDMOQOGPHL-UHFFFAOYSA-N phenylacetic acid Chemical class OC(=O)CC1=CC=CC=C1 WLJVXDMOQOGPHL-UHFFFAOYSA-N 0.000 title claims description 14
- 238000004519 manufacturing process Methods 0.000 title description 5
- 238000006243 chemical reaction Methods 0.000 claims description 21
- 238000000034 method Methods 0.000 claims description 20
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 claims description 19
- 239000002253 acid Substances 0.000 claims description 16
- 125000003118 aryl group Chemical group 0.000 claims description 11
- 229910052739 hydrogen Inorganic materials 0.000 claims description 8
- 239000001257 hydrogen Substances 0.000 claims description 8
- 125000000217 alkyl group Chemical group 0.000 claims description 6
- 229910052736 halogen Inorganic materials 0.000 claims description 6
- 150000002367 halogens Chemical class 0.000 claims description 6
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 5
- 125000003545 alkoxy group Chemical group 0.000 claims description 5
- 239000000010 aprotic solvent Substances 0.000 claims description 3
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 3
- 125000004432 carbon atom Chemical group C* 0.000 claims description 2
- 150000001875 compounds Chemical class 0.000 claims description 2
- 150000007522 mineralic acids Chemical class 0.000 claims description 2
- 238000002360 preparation method Methods 0.000 claims description 2
- 229910052784 alkaline earth metal Inorganic materials 0.000 claims 2
- 125000004435 hydrogen atom Chemical class [H]* 0.000 claims 2
- DNIAPMSPPWPWGF-GSVOUGTGSA-N (R)-(-)-Propylene glycol Chemical compound C[C@@H](O)CO DNIAPMSPPWPWGF-GSVOUGTGSA-N 0.000 claims 1
- JCXJVPUVTGWSNB-UHFFFAOYSA-N Nitrogen dioxide Chemical class O=[N]=O JCXJVPUVTGWSNB-UHFFFAOYSA-N 0.000 claims 1
- 239000003513 alkali Substances 0.000 claims 1
- 150000001342 alkaline earth metals Chemical class 0.000 claims 1
- 150000004703 alkoxides Chemical class 0.000 claims 1
- 125000005055 alkyl alkoxy group Chemical group 0.000 claims 1
- 239000002904 solvent Substances 0.000 description 14
- 239000000460 chlorine Substances 0.000 description 11
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 9
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 9
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 8
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 8
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 8
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 7
- 238000004821 distillation Methods 0.000 description 7
- -1 fluorinated Phenylacetic acid ester Chemical class 0.000 description 7
- 229910052731 fluorine Inorganic materials 0.000 description 7
- 239000011737 fluorine Substances 0.000 description 7
- XFEKIQFBJSDMQB-UHFFFAOYSA-N 2,2,2-trichloroethylbenzene Chemical class ClC(Cl)(Cl)CC1=CC=CC=C1 XFEKIQFBJSDMQB-UHFFFAOYSA-N 0.000 description 6
- OEPOKWHJYJXUGD-UHFFFAOYSA-N 2-(3-phenylmethoxyphenyl)-1,3-thiazole-4-carbaldehyde Chemical compound O=CC1=CSC(C=2C=C(OCC=3C=CC=CC=3)C=CC=2)=N1 OEPOKWHJYJXUGD-UHFFFAOYSA-N 0.000 description 6
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 6
- 229910052801 chlorine Inorganic materials 0.000 description 6
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 6
- YCKRFDGAMUMZLT-UHFFFAOYSA-N Fluorine atom Chemical compound [F] YCKRFDGAMUMZLT-UHFFFAOYSA-N 0.000 description 5
- 239000011541 reaction mixture Substances 0.000 description 5
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 5
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 4
- 150000001448 anilines Chemical class 0.000 description 4
- 239000012954 diazonium Substances 0.000 description 4
- 150000002431 hydrogen Chemical class 0.000 description 4
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 3
- CRZQGDNQQAALAY-UHFFFAOYSA-N Methyl benzeneacetate Chemical class COC(=O)CC1=CC=CC=C1 CRZQGDNQQAALAY-UHFFFAOYSA-N 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- ORTQZVOHEJQUHG-UHFFFAOYSA-L copper(II) chloride Chemical class Cl[Cu]Cl ORTQZVOHEJQUHG-UHFFFAOYSA-L 0.000 description 3
- 150000001989 diazonium salts Chemical class 0.000 description 3
- 238000002955 isolation Methods 0.000 description 3
- KXKVLQRXCPHEJC-UHFFFAOYSA-N methyl acetate Chemical compound COC(C)=O KXKVLQRXCPHEJC-UHFFFAOYSA-N 0.000 description 3
- 239000000203 mixture Substances 0.000 description 3
- 239000012074 organic phase Substances 0.000 description 3
- 239000000047 product Substances 0.000 description 3
- 238000007127 saponification reaction Methods 0.000 description 3
- 235000010288 sodium nitrite Nutrition 0.000 description 3
- 125000001424 substituent group Chemical group 0.000 description 3
- VIUDTWATMPPKEL-UHFFFAOYSA-N 3-(trifluoromethyl)aniline Chemical compound NC1=CC=CC(C(F)(F)F)=C1 VIUDTWATMPPKEL-UHFFFAOYSA-N 0.000 description 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 2
- IOVCWXUNBOPUCH-UHFFFAOYSA-M Nitrite anion Chemical compound [O-]N=O IOVCWXUNBOPUCH-UHFFFAOYSA-M 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 2
- 229910052794 bromium Inorganic materials 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 238000000605 extraction Methods 0.000 description 2
- 125000001153 fluoro group Chemical group F* 0.000 description 2
- 239000000543 intermediate Substances 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- 239000012071 phase Substances 0.000 description 2
- 238000010992 reflux Methods 0.000 description 2
- 238000010626 work up procedure Methods 0.000 description 2
- XEMRAKSQROQPBR-UHFFFAOYSA-N (trichloromethyl)benzene Chemical compound ClC(Cl)(Cl)C1=CC=CC=C1 XEMRAKSQROQPBR-UHFFFAOYSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- QNUWEXSGZVBMDV-UHFFFAOYSA-N 3-(carboxymethyl)benzoic acid Chemical compound OC(=O)CC1=CC=CC(C(O)=O)=C1 QNUWEXSGZVBMDV-UHFFFAOYSA-N 0.000 description 1
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 1
- 238000006458 Meerwein arylation reaction Methods 0.000 description 1
- AFBPFSWMIHJQDM-UHFFFAOYSA-N N-methylaniline Chemical compound CNC1=CC=CC=C1 AFBPFSWMIHJQDM-UHFFFAOYSA-N 0.000 description 1
- XBDQKXXYIPTUBI-UHFFFAOYSA-M Propionate Chemical compound CCC([O-])=O XBDQKXXYIPTUBI-UHFFFAOYSA-M 0.000 description 1
- 230000001476 alcoholic effect Effects 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 229910001413 alkali metal ion Inorganic materials 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 229910001420 alkaline earth metal ion Inorganic materials 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 150000001555 benzenes Chemical class 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- WXDLQDKCNPOVNA-UHFFFAOYSA-N butyl 2-[3-(trifluoromethyl)phenyl]acetate Chemical compound CCCCOC(=O)CC1=CC=CC(C(F)(F)F)=C1 WXDLQDKCNPOVNA-UHFFFAOYSA-N 0.000 description 1
- 150000003857 carboxamides Chemical class 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- IJGRMHOSHXDMSA-UHFFFAOYSA-O diazynium Chemical compound [NH+]#N IJGRMHOSHXDMSA-UHFFFAOYSA-O 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 125000004494 ethyl ester group Chemical group 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 239000004009 herbicide Substances 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- 239000013067 intermediate product Substances 0.000 description 1
- GMEBDKGPPKAPEM-UHFFFAOYSA-N methyl 2-[3-(trifluoromethyl)phenyl]acetate Chemical compound COC(=O)CC1=CC=CC(C(F)(F)F)=C1 GMEBDKGPPKAPEM-UHFFFAOYSA-N 0.000 description 1
- LNOPIUAQISRISI-UHFFFAOYSA-N n'-hydroxy-2-propan-2-ylsulfonylethanimidamide Chemical compound CC(C)S(=O)(=O)CC(N)=NO LNOPIUAQISRISI-UHFFFAOYSA-N 0.000 description 1
- AJFDBNQQDYLMJN-UHFFFAOYSA-N n,n-diethylacetamide Chemical compound CCN(CC)C(C)=O AJFDBNQQDYLMJN-UHFFFAOYSA-N 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 229960003424 phenylacetic acid Drugs 0.000 description 1
- 239000003279 phenylacetic acid Substances 0.000 description 1
- MKNZKCSKEUHUPM-UHFFFAOYSA-N potassium;butan-1-ol Chemical compound [K+].CCCCO MKNZKCSKEUHUPM-UHFFFAOYSA-N 0.000 description 1
- 238000007086 side reaction Methods 0.000 description 1
- SUBJHSREKVAVAR-UHFFFAOYSA-N sodium;methanol;methanolate Chemical compound [Na+].OC.[O-]C SUBJHSREKVAVAR-UHFFFAOYSA-N 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- HXJUTPCZVOIRIF-UHFFFAOYSA-N sulfolane Chemical compound O=S1(=O)CCCC1 HXJUTPCZVOIRIF-UHFFFAOYSA-N 0.000 description 1
- 150000003457 sulfones Chemical class 0.000 description 1
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C67/00—Preparation of carboxylic acid esters
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C17/00—Preparation of halogenated hydrocarbons
- C07C17/26—Preparation of halogenated hydrocarbons by reactions involving an increase in the number of carbon atoms in the skeleton
- C07C17/32—Preparation of halogenated hydrocarbons by reactions involving an increase in the number of carbon atoms in the skeleton by introduction of halogenated alkyl groups into ring compounds
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C323/00—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C43/00—Ethers; Compounds having groups, groups or groups
- C07C43/02—Ethers
- C07C43/20—Ethers having an ether-oxygen atom bound to a carbon atom of a six-membered aromatic ring
- C07C43/225—Ethers having an ether-oxygen atom bound to a carbon atom of a six-membered aromatic ring containing halogen
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C67/00—Preparation of carboxylic acid esters
- C07C67/27—Preparation of carboxylic acid esters from ortho-esters
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D317/00—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms
- C07D317/08—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3
- C07D317/44—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3 ortho- or peri-condensed with carbocyclic rings or ring systems
- C07D317/46—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3 ortho- or peri-condensed with carbocyclic rings or ring systems condensed with one six-membered ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D319/00—Heterocyclic compounds containing six-membered rings having two oxygen atoms as the only ring hetero atoms
- C07D319/10—1,4-Dioxanes; Hydrogenated 1,4-dioxanes
- C07D319/14—1,4-Dioxanes; Hydrogenated 1,4-dioxanes condensed with carbocyclic rings or ring systems
- C07D319/16—1,4-Dioxanes; Hydrogenated 1,4-dioxanes condensed with carbocyclic rings or ring systems condensed with one six-membered ring
- C07D319/20—1,4-Dioxanes; Hydrogenated 1,4-dioxanes condensed with carbocyclic rings or ring systems condensed with one six-membered ring with substituents attached to the hetero ring
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Heterocyclic Compounds That Contain Two Or More Ring Oxygen Atoms (AREA)
Priority Applications (4)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19833314249 DE3314249A1 (de) | 1983-04-20 | 1983-04-20 | Verfahren zur herstellung von fluorierten phenylessigsaeureestern und neue fluorierte trichlorethylbenzole |
| EP84103868A EP0123187B1 (de) | 1983-04-20 | 1984-04-07 | Verfahren zur Herstellung von fluorierten Phenylessigsäureestern und neue fluorierte Trichlorethylbenzole |
| DE8484103868T DE3470529D1 (en) | 1983-04-20 | 1984-04-07 | Process for the preparation of fluorinated phenylacetic-acid esters and fluorinated trichloroethyl benzenes |
| JP59075901A JPS59199654A (ja) | 1983-04-20 | 1984-04-17 | 弗素化されたフエニル酢酸エステルの製造方法 |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19833314249 DE3314249A1 (de) | 1983-04-20 | 1983-04-20 | Verfahren zur herstellung von fluorierten phenylessigsaeureestern und neue fluorierte trichlorethylbenzole |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE3314249A1 true DE3314249A1 (de) | 1984-10-25 |
Family
ID=6196838
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19833314249 Withdrawn DE3314249A1 (de) | 1983-04-20 | 1983-04-20 | Verfahren zur herstellung von fluorierten phenylessigsaeureestern und neue fluorierte trichlorethylbenzole |
| DE8484103868T Expired DE3470529D1 (en) | 1983-04-20 | 1984-04-07 | Process for the preparation of fluorinated phenylacetic-acid esters and fluorinated trichloroethyl benzenes |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE8484103868T Expired DE3470529D1 (en) | 1983-04-20 | 1984-04-07 | Process for the preparation of fluorinated phenylacetic-acid esters and fluorinated trichloroethyl benzenes |
Country Status (3)
| Country | Link |
|---|---|
| EP (1) | EP0123187B1 (enExample) |
| JP (1) | JPS59199654A (enExample) |
| DE (2) | DE3314249A1 (enExample) |
Cited By (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4927844A (en) * | 1987-11-13 | 1990-05-22 | Bayer Aktiengesellschaft | N-Substituted dichloromaleimides, and anti-bacterial and fungicidal use thereof |
| WO1998005638A3 (de) * | 1996-08-05 | 1998-03-19 | Bayer Ag | 2- und 2,5-substituierte phenylketoenole |
| US6133296A (en) * | 1996-05-10 | 2000-10-17 | Bayer Aktiengesellschaft | Substituted pyridyl keto enols |
| US6391912B1 (en) | 1996-12-12 | 2002-05-21 | Bayer Aktiengesellschaft | Substituted phenylketoenols |
| US6395921B1 (en) | 1999-08-16 | 2002-05-28 | Bayer Aktiengesellschaft | Process for preparing [bis-(trifluoromethyl)-phenyl]-acetic acids and alkyl esters thereof and dialkyl [bis-(trifluoromethyl)-phenyl]-malonates |
| EP1277733A1 (de) * | 1996-08-05 | 2003-01-22 | Bayer CropScience AG | 2- und 2,5-substituierte Phenylketoenole |
| US6608211B1 (en) | 1997-11-11 | 2003-08-19 | Bayer Aktiengesellschaft | Substituted phenyl ketoenols |
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB8822793D0 (en) * | 1988-09-28 | 1988-11-02 | Ici Plc | Insecticidal compounds |
| WO2010105739A1 (de) | 2009-03-16 | 2010-09-23 | Bayer Cropscience Ag | 2-brom-2,2-dichlorethyl-aromaten und verfahren zu ihrer herstellung |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE760968A (en) * | 1970-12-29 | 1971-06-29 | P R B En Neerlandais P R B N V | Opt 2,3-subst phenyl acetic acid and derivpl |
| FR2435464A1 (fr) * | 1978-07-25 | 1980-04-04 | Rhone Poulenc Agrochimie | Nouvelle phenyluree substituee herbicide |
| US4426536A (en) * | 1982-06-14 | 1984-01-17 | Eli Lilly And Company | Synthesis of phenylacetic acid esters |
-
1983
- 1983-04-20 DE DE19833314249 patent/DE3314249A1/de not_active Withdrawn
-
1984
- 1984-04-07 EP EP84103868A patent/EP0123187B1/de not_active Expired
- 1984-04-07 DE DE8484103868T patent/DE3470529D1/de not_active Expired
- 1984-04-17 JP JP59075901A patent/JPS59199654A/ja active Granted
Cited By (18)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4927844A (en) * | 1987-11-13 | 1990-05-22 | Bayer Aktiengesellschaft | N-Substituted dichloromaleimides, and anti-bacterial and fungicidal use thereof |
| US6133296A (en) * | 1996-05-10 | 2000-10-17 | Bayer Aktiengesellschaft | Substituted pyridyl keto enols |
| US6504036B1 (en) | 1996-08-05 | 2003-01-07 | Bayer Aktiengesellschaft | 2- and 2.5-substituted phenylketoenols |
| US6596873B1 (en) | 1996-08-05 | 2003-07-22 | Bayer Aktiengesellschaft | 2-and 2,5-substituted phenylketoenols |
| US6255342B1 (en) | 1996-08-05 | 2001-07-03 | Bayer Aktiengesellschaft | 2-and 2,5-substituted phenylketoenols |
| US6359151B2 (en) | 1996-08-05 | 2002-03-19 | Bayer Aktiengesellschaft | 2- and 2,5-substituted phenylketoenols |
| AU726090B2 (en) * | 1996-08-05 | 2000-11-02 | Bayer Intellectual Property Gmbh | 2- and 2,5-substituted phenylketoenols |
| EP1277734A1 (de) * | 1996-08-05 | 2003-01-22 | Bayer CropScience AG | 2- und 2,5-substituierte Phenylketoenole |
| WO1998005638A3 (de) * | 1996-08-05 | 1998-03-19 | Bayer Ag | 2- und 2,5-substituierte phenylketoenole |
| EP1277733A1 (de) * | 1996-08-05 | 2003-01-22 | Bayer CropScience AG | 2- und 2,5-substituierte Phenylketoenole |
| EP1277735A1 (de) * | 1996-08-05 | 2003-01-22 | Bayer CropScience AG | 2- und 2,5-substituierte Phenylketoenole |
| US6391912B1 (en) | 1996-12-12 | 2002-05-21 | Bayer Aktiengesellschaft | Substituted phenylketoenols |
| US6630594B2 (en) | 1996-12-12 | 2003-10-07 | Bayer Aktiengesellschaft | Methods of making substituted phenylketoenols |
| US6608211B1 (en) | 1997-11-11 | 2003-08-19 | Bayer Aktiengesellschaft | Substituted phenyl ketoenols |
| US6670488B1 (en) | 1997-11-11 | 2003-12-30 | Bayer Aktiengesellschaft | Substituted phenylketoenols |
| US6900341B2 (en) | 1997-11-11 | 2005-05-31 | Bayer Aktiengesellschaft | Substituted phenylketoenols |
| US7109370B2 (en) | 1997-11-11 | 2006-09-19 | Bayer Aktiengesellschaft | Substituted phenylketoenols |
| US6395921B1 (en) | 1999-08-16 | 2002-05-28 | Bayer Aktiengesellschaft | Process for preparing [bis-(trifluoromethyl)-phenyl]-acetic acids and alkyl esters thereof and dialkyl [bis-(trifluoromethyl)-phenyl]-malonates |
Also Published As
| Publication number | Publication date |
|---|---|
| EP0123187B1 (de) | 1988-04-20 |
| EP0123187A2 (de) | 1984-10-31 |
| DE3470529D1 (en) | 1988-05-26 |
| JPH0430387B2 (enExample) | 1992-05-21 |
| JPS59199654A (ja) | 1984-11-12 |
| EP0123187A3 (en) | 1986-04-16 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0123187B1 (de) | Verfahren zur Herstellung von fluorierten Phenylessigsäureestern und neue fluorierte Trichlorethylbenzole | |
| EP0008734B1 (de) | Verfahren zur Herstellung von 4-Fluoro-3-phenoxy-toluol | |
| EP0463464A1 (de) | Verfahren zur Herstellung von 2-Chlor-5-methyl-pyridin | |
| EP1247792B1 (de) | Verfahren zur Herstellung von halogensubstituierten Dibenzylalkoholen | |
| DE2710174A1 (de) | Verfahren zur herstellung von dihalogenvinyl-cyclopropancarbonsaeuren und deren ester | |
| DE2652810C3 (de) | Verfahren zur Herstellung von aromatischen Fluorverbindungen | |
| EP0034723B1 (de) | Verfahren zur Herstellung von 4-Phenoxyphenolen | |
| DD239591A5 (de) | Verfahren zur herstellung von 2,4-dichlor-5-fluor-benzoesaeure | |
| EP0368008A1 (de) | Fluor enthaltende Phenole | |
| EP1001929B1 (de) | Verfahren zur herstellung von 3-cyano-2,4-dihalogen-5-fluor-benzoesäuren | |
| EP0061113B1 (de) | Verfahren zur Herstellung von gegebenenfalls substituierten Fluor-nitro-benzaldehyden | |
| DD152537A5 (de) | Verfahren zur herstellung von 4-fluor-3-phenoxy-toluol | |
| EP0089485B1 (de) | Verfahren zur Herstellung von 5-Chlor-1H-tetrazol-1-carbonsäureestern sowie Verfahren zur Herstellung der erforderlichen Dichlorisonitril-carbonsäureester | |
| EP0056933B1 (de) | Verfahren zur Herstellung von 1-Aryloxy-methylketonen | |
| EP0103749B1 (de) | Dialkoxymethyl-butyrolactone, Verfahren zu ihrer Herstellung, Zwischenprodukte dafür und ihre Verwendung | |
| EP0084128B1 (de) | Verfahren zur Herstellung von teilweise neuen Alkylbenzolen, die durch Fluor enthaltende Reste substituiert sind | |
| EP0173153B1 (de) | Neue benzokondensierte, fluorierte, heterocyclische Verbindungen, ein Verfahren zu ihrer Herstellung und ihre Verwendung | |
| DE3909213A1 (de) | Halogenbenzolderivate | |
| DE3035394A1 (de) | Verfahren zur herstellung von pyrazol | |
| DE2848197A1 (de) | Verfahren zur herstellung von perfluorcarbonsaeuren und addukte aus einer perfluorcarbonsaeure und einem carbonsaeureamid | |
| DE10126432A1 (de) | Fluor enthaltende Bisphenole, deren Herstellung, deren Vor- und Zwischenprodukte sowie die Verwendung der Fluor enthaltenden Bisphenole | |
| EP0045414B1 (de) | Verfahren zur Herstellung von 3-Amino-1-phenylpyrazol-5-on | |
| DE907414C (de) | Verfahren zur Herstellung von 2-(2-Methyl-5-halogen-phenyl-1-mercapto)-benzoesaeuren | |
| AT163637B (de) | Verfahren zur Herstellung von 2,4-Dichlorphenoxyverbindungen | |
| DD232484A5 (de) | Verfahren zur herstellung von monoethern von dihydroxylbenzolen |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8130 | Withdrawal |