DE3312284A1 - Verfahren zur herstellung von gegebenenfalls verzweigten polyarylensulfiden - Google Patents
Verfahren zur herstellung von gegebenenfalls verzweigten polyarylensulfidenInfo
- Publication number
- DE3312284A1 DE3312284A1 DE19833312284 DE3312284A DE3312284A1 DE 3312284 A1 DE3312284 A1 DE 3312284A1 DE 19833312284 DE19833312284 DE 19833312284 DE 3312284 A DE3312284 A DE 3312284A DE 3312284 A1 DE3312284 A1 DE 3312284A1
- Authority
- DE
- Germany
- Prior art keywords
- mol
- sulfide
- alkali
- sulfides
- formula
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Granted
Links
- 238000000034 method Methods 0.000 title claims description 16
- 238000004519 manufacturing process Methods 0.000 title claims description 7
- 150000003568 thioethers Chemical class 0.000 title claims 3
- 229920000412 polyarylene Polymers 0.000 claims description 44
- 239000003513 alkali Substances 0.000 claims description 26
- -1 alkali metal formates Chemical class 0.000 claims description 16
- 239000003054 catalyst Substances 0.000 claims description 13
- 239000003638 chemical reducing agent Substances 0.000 claims description 11
- 150000008044 alkali metal hydroxides Chemical class 0.000 claims description 9
- 229910001854 alkali hydroxide Inorganic materials 0.000 claims description 7
- 229910052783 alkali metal Inorganic materials 0.000 claims description 7
- 229910052757 nitrogen Inorganic materials 0.000 claims description 7
- 125000003118 aryl group Chemical group 0.000 claims description 6
- 229910052739 hydrogen Inorganic materials 0.000 claims description 6
- 239000001257 hydrogen Substances 0.000 claims description 6
- 239000002798 polar solvent Substances 0.000 claims description 6
- 125000004432 carbon atom Chemical group C* 0.000 claims description 5
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 4
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 4
- 229910052794 bromium Inorganic materials 0.000 claims description 4
- 239000003795 chemical substances by application Substances 0.000 claims description 4
- 239000000460 chlorine Substances 0.000 claims description 4
- 229910052801 chlorine Inorganic materials 0.000 claims description 4
- 125000005842 heteroatom Chemical group 0.000 claims description 4
- 230000001603 reducing effect Effects 0.000 claims description 4
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 3
- 150000002429 hydrazines Chemical class 0.000 claims description 3
- 239000006184 cosolvent Substances 0.000 claims description 2
- 125000000623 heterocyclic group Chemical group 0.000 claims description 2
- 125000004435 hydrogen atom Chemical class [H]* 0.000 claims 2
- 125000004070 6 membered heterocyclic group Chemical group 0.000 claims 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims 1
- 125000002877 alkyl aryl group Chemical group 0.000 claims 1
- 125000003710 aryl alkyl group Chemical group 0.000 claims 1
- UCKMPCXJQFINFW-UHFFFAOYSA-N Sulphide Chemical compound [S-2] UCKMPCXJQFINFW-UHFFFAOYSA-N 0.000 description 37
- HEMHJVSKTPXQMS-UHFFFAOYSA-M sodium hydroxide Inorganic materials [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 32
- 238000006243 chemical reaction Methods 0.000 description 27
- PBKONEOXTCPAFI-UHFFFAOYSA-N 1,2,4-trichlorobenzene Chemical compound ClC1=CC=C(Cl)C(Cl)=C1 PBKONEOXTCPAFI-UHFFFAOYSA-N 0.000 description 24
- 150000004763 sulfides Chemical class 0.000 description 23
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 16
- 239000000243 solution Substances 0.000 description 14
- 239000000203 mixture Substances 0.000 description 13
- 238000002360 preparation method Methods 0.000 description 11
- SECXISVLQFMRJM-UHFFFAOYSA-N N-Methylpyrrolidone Chemical compound CN1CCCC1=O SECXISVLQFMRJM-UHFFFAOYSA-N 0.000 description 10
- 239000004734 Polyphenylene sulfide Substances 0.000 description 10
- 239000000155 melt Substances 0.000 description 10
- 229920000069 polyphenylene sulfide Polymers 0.000 description 10
- 239000011541 reaction mixture Substances 0.000 description 9
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 8
- 229920000642 polymer Polymers 0.000 description 8
- 229910052979 sodium sulfide Inorganic materials 0.000 description 8
- GRVFOGOEDUUMBP-UHFFFAOYSA-N sodium sulfide (anhydrous) Chemical compound [Na+].[Na+].[S-2] GRVFOGOEDUUMBP-UHFFFAOYSA-N 0.000 description 8
- OCJBOOLMMGQPQU-UHFFFAOYSA-N 1,4-dichlorobenzene Chemical compound ClC1=CC=C(Cl)C=C1 OCJBOOLMMGQPQU-UHFFFAOYSA-N 0.000 description 6
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 6
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 6
- 229910052977 alkali metal sulfide Inorganic materials 0.000 description 6
- 229910052744 lithium Inorganic materials 0.000 description 6
- HLBBKKJFGFRGMU-UHFFFAOYSA-M sodium formate Chemical compound [Na+].[O-]C=O HLBBKKJFGFRGMU-UHFFFAOYSA-M 0.000 description 6
- 235000019254 sodium formate Nutrition 0.000 description 6
- 239000002904 solvent Substances 0.000 description 6
- 239000004280 Sodium formate Substances 0.000 description 5
- 150000001875 compounds Chemical class 0.000 description 5
- XNFVGEUMTFIVHQ-UHFFFAOYSA-N disodium;sulfide;hydrate Chemical compound O.[Na+].[Na+].[S-2] XNFVGEUMTFIVHQ-UHFFFAOYSA-N 0.000 description 5
- 150000003951 lactams Chemical class 0.000 description 5
- 239000011734 sodium Substances 0.000 description 5
- HYHCSLBZRBJJCH-UHFFFAOYSA-M sodium hydrosulfide Chemical compound [Na+].[SH-] HYHCSLBZRBJJCH-UHFFFAOYSA-M 0.000 description 5
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 4
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 4
- 235000013877 carbamide Nutrition 0.000 description 4
- 239000000835 fiber Substances 0.000 description 4
- 238000001914 filtration Methods 0.000 description 4
- 238000010438 heat treatment Methods 0.000 description 4
- 239000000376 reactant Substances 0.000 description 4
- 239000012279 sodium borohydride Substances 0.000 description 4
- 229910000033 sodium borohydride Inorganic materials 0.000 description 4
- 229920001169 thermoplastic Polymers 0.000 description 4
- 239000004416 thermosoftening plastic Substances 0.000 description 4
- WMFOQBRAJBCJND-UHFFFAOYSA-M Lithium hydroxide Chemical compound [Li+].[OH-] WMFOQBRAJBCJND-UHFFFAOYSA-M 0.000 description 3
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 3
- 229910000831 Steel Inorganic materials 0.000 description 3
- 150000001491 aromatic compounds Chemical class 0.000 description 3
- 239000006085 branching agent Substances 0.000 description 3
- 150000007942 carboxylates Chemical class 0.000 description 3
- 230000007935 neutral effect Effects 0.000 description 3
- 239000000575 pesticide Substances 0.000 description 3
- 239000000843 powder Substances 0.000 description 3
- 230000035484 reaction time Effects 0.000 description 3
- 229910052708 sodium Inorganic materials 0.000 description 3
- 239000010959 steel Substances 0.000 description 3
- 229910052717 sulfur Inorganic materials 0.000 description 3
- BCNBMSZKALBQEF-UHFFFAOYSA-N 1,3-dimethylpyrrolidin-2-one Chemical compound CC1CCN(C)C1=O BCNBMSZKALBQEF-UHFFFAOYSA-N 0.000 description 2
- GWCFTYITFDWLAY-UHFFFAOYSA-N 1-ethylazepan-2-one Chemical compound CCN1CCCCCC1=O GWCFTYITFDWLAY-UHFFFAOYSA-N 0.000 description 2
- XWUCFAJNVTZRLE-UHFFFAOYSA-N 7-thiabicyclo[2.2.1]hepta-1,3,5-triene Chemical compound C1=C(S2)C=CC2=C1 XWUCFAJNVTZRLE-UHFFFAOYSA-N 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical group [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 2
- RWSOTUBLDIXVET-UHFFFAOYSA-N Dihydrogen sulfide Chemical compound S RWSOTUBLDIXVET-UHFFFAOYSA-N 0.000 description 2
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 2
- ZWXPDGCFMMFNRW-UHFFFAOYSA-N N-methylcaprolactam Chemical compound CN1CCCCCC1=O ZWXPDGCFMMFNRW-UHFFFAOYSA-N 0.000 description 2
- 229910019142 PO4 Inorganic materials 0.000 description 2
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 150000001408 amides Chemical class 0.000 description 2
- 230000000052 comparative effect Effects 0.000 description 2
- 230000018044 dehydration Effects 0.000 description 2
- 238000006297 dehydration reaction Methods 0.000 description 2
- JBKVHLHDHHXQEQ-UHFFFAOYSA-N epsilon-caprolactam Chemical compound O=C1CCCCCN1 JBKVHLHDHHXQEQ-UHFFFAOYSA-N 0.000 description 2
- 150000004677 hydrates Chemical class 0.000 description 2
- 230000036571 hydration Effects 0.000 description 2
- 238000006703 hydration reaction Methods 0.000 description 2
- 229910000037 hydrogen sulfide Inorganic materials 0.000 description 2
- XIXADJRWDQXREU-UHFFFAOYSA-M lithium acetate Chemical compound [Li+].CC([O-])=O XIXADJRWDQXREU-UHFFFAOYSA-M 0.000 description 2
- KWGKDLIKAYFUFQ-UHFFFAOYSA-M lithium chloride Chemical compound [Li+].[Cl-] KWGKDLIKAYFUFQ-UHFFFAOYSA-M 0.000 description 2
- PZYDAVFRVJXFHS-UHFFFAOYSA-N n-cyclohexyl-2-pyrrolidone Chemical compound O=C1CCCN1C1CCCCC1 PZYDAVFRVJXFHS-UHFFFAOYSA-N 0.000 description 2
- 238000006386 neutralization reaction Methods 0.000 description 2
- 229910052760 oxygen Inorganic materials 0.000 description 2
- 235000021317 phosphate Nutrition 0.000 description 2
- 229910052700 potassium Inorganic materials 0.000 description 2
- 239000011591 potassium Substances 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 150000003672 ureas Chemical class 0.000 description 2
- 238000005406 washing Methods 0.000 description 2
- AVQQQNCBBIEMEU-UHFFFAOYSA-N 1,1,3,3-tetramethylurea Chemical compound CN(C)C(=O)N(C)C AVQQQNCBBIEMEU-UHFFFAOYSA-N 0.000 description 1
- NAQWICRLNQSPPW-UHFFFAOYSA-N 1,2,3,4-tetrachloronaphthalene Chemical compound C1=CC=CC2=C(Cl)C(Cl)=C(Cl)C(Cl)=C21 NAQWICRLNQSPPW-UHFFFAOYSA-N 0.000 description 1
- LHOGNQZQKDZOBP-UHFFFAOYSA-N 1,2,3-trichloro-4-methylbenzene Chemical compound CC1=CC=C(Cl)C(Cl)=C1Cl LHOGNQZQKDZOBP-UHFFFAOYSA-N 0.000 description 1
- RELMFMZEBKVZJC-UHFFFAOYSA-N 1,2,3-trichlorobenzene Chemical compound ClC1=CC=CC(Cl)=C1Cl RELMFMZEBKVZJC-UHFFFAOYSA-N 0.000 description 1
- QEPTXDCPBXMWJC-UHFFFAOYSA-N 1,2,3-trichloronaphthalene Chemical compound C1=CC=C2C(Cl)=C(Cl)C(Cl)=CC2=C1 QEPTXDCPBXMWJC-UHFFFAOYSA-N 0.000 description 1
- JHBKHLUZVFWLAG-UHFFFAOYSA-N 1,2,4,5-tetrachlorobenzene Chemical compound ClC1=CC(Cl)=C(Cl)C=C1Cl JHBKHLUZVFWLAG-UHFFFAOYSA-N 0.000 description 1
- FWAJPSIPOULHHH-UHFFFAOYSA-N 1,2,4-tribromobenzene Chemical compound BrC1=CC=C(Br)C(Br)=C1 FWAJPSIPOULHHH-UHFFFAOYSA-N 0.000 description 1
- MRJBOPVWPORBKZ-UHFFFAOYSA-N 1,2,4-trichloronaphthalene Chemical compound C1=CC=CC2=C(Cl)C(Cl)=CC(Cl)=C21 MRJBOPVWPORBKZ-UHFFFAOYSA-N 0.000 description 1
- AAUJSCRITBXDJH-UHFFFAOYSA-N 1,2,6-trichloronaphthalene Chemical compound ClC1=C(Cl)C=CC2=CC(Cl)=CC=C21 AAUJSCRITBXDJH-UHFFFAOYSA-N 0.000 description 1
- BSJWDQYZFBYNIM-UHFFFAOYSA-N 1,3,4,5-tetramethylpyrrolidin-2-one Chemical compound CC1C(C)N(C)C(=O)C1C BSJWDQYZFBYNIM-UHFFFAOYSA-N 0.000 description 1
- VMNISWKTOHUZQN-UHFFFAOYSA-N 1,3,5-trichloro-2,4,6-trimethylbenzene Chemical compound CC1=C(Cl)C(C)=C(Cl)C(C)=C1Cl VMNISWKTOHUZQN-UHFFFAOYSA-N 0.000 description 1
- PNHUHPSIWGBXDF-UHFFFAOYSA-N 1,3,5-trichloro-2,4-dihydrotriazine Chemical compound ClN1CC(Cl)=CN(Cl)N1 PNHUHPSIWGBXDF-UHFFFAOYSA-N 0.000 description 1
- RCTKUIOMKBEGTG-UHFFFAOYSA-N 1,3,5-trichloro-2-methylbenzene Chemical compound CC1=C(Cl)C=C(Cl)C=C1Cl RCTKUIOMKBEGTG-UHFFFAOYSA-N 0.000 description 1
- XKEFYDZQGKAQCN-UHFFFAOYSA-N 1,3,5-trichlorobenzene Chemical compound ClC1=CC(Cl)=CC(Cl)=C1 XKEFYDZQGKAQCN-UHFFFAOYSA-N 0.000 description 1
- CYSGHNMQYZDMIA-UHFFFAOYSA-N 1,3-Dimethyl-2-imidazolidinon Chemical compound CN1CCN(C)C1=O CYSGHNMQYZDMIA-UHFFFAOYSA-N 0.000 description 1
- JSRLURSZEMLAFO-UHFFFAOYSA-N 1,3-dibromobenzene Chemical compound BrC1=CC=CC(Br)=C1 JSRLURSZEMLAFO-UHFFFAOYSA-N 0.000 description 1
- ZPQOPVIELGIULI-UHFFFAOYSA-N 1,3-dichlorobenzene Chemical compound ClC1=CC=CC(Cl)=C1 ZPQOPVIELGIULI-UHFFFAOYSA-N 0.000 description 1
- OFHDZEYCBJGZEF-UHFFFAOYSA-N 1,4-dibromo-2-(4-methylphenyl)benzene Chemical compound C1=CC(C)=CC=C1C1=CC(Br)=CC=C1Br OFHDZEYCBJGZEF-UHFFFAOYSA-N 0.000 description 1
- OMHJVVBCCMLFMY-UHFFFAOYSA-N 1,4-dibromo-2-ethylbenzene Chemical compound CCC1=CC(Br)=CC=C1Br OMHJVVBCCMLFMY-UHFFFAOYSA-N 0.000 description 1
- MHQCPXUMZCNOSF-UHFFFAOYSA-N 1,4-dibromo-2-phenylbenzene Chemical compound BrC1=CC=C(Br)C(C=2C=CC=CC=2)=C1 MHQCPXUMZCNOSF-UHFFFAOYSA-N 0.000 description 1
- SWJPEBQEEAHIGZ-UHFFFAOYSA-N 1,4-dibromobenzene Chemical compound BrC1=CC=C(Br)C=C1 SWJPEBQEEAHIGZ-UHFFFAOYSA-N 0.000 description 1
- PTIQIITULDNGAF-UHFFFAOYSA-N 1,4-dichloro-2,3,5,6-tetramethylbenzene Chemical compound CC1=C(C)C(Cl)=C(C)C(C)=C1Cl PTIQIITULDNGAF-UHFFFAOYSA-N 0.000 description 1
- FIHVNWNZXRMAAI-UHFFFAOYSA-N 1,4-dichloro-2-(4-methylphenyl)benzene Chemical compound C1=CC(C)=CC=C1C1=CC(Cl)=CC=C1Cl FIHVNWNZXRMAAI-UHFFFAOYSA-N 0.000 description 1
- BFGDCPOTPZOVHM-UHFFFAOYSA-N 1,4-dichloro-2-cyclohexylbenzene Chemical compound ClC1=CC=C(Cl)C(C2CCCCC2)=C1 BFGDCPOTPZOVHM-UHFFFAOYSA-N 0.000 description 1
- PZPSDDYNMXBZOA-UHFFFAOYSA-N 1,4-dichloro-2-ethylbenzene Chemical compound CCC1=CC(Cl)=CC=C1Cl PZPSDDYNMXBZOA-UHFFFAOYSA-N 0.000 description 1
- GAHDDNITQFTXQC-UHFFFAOYSA-N 1,4-dichloro-2-hexylbenzene Chemical compound CCCCCCC1=CC(Cl)=CC=C1Cl GAHDDNITQFTXQC-UHFFFAOYSA-N 0.000 description 1
- KFAKZJUYBOYVKA-UHFFFAOYSA-N 1,4-dichloro-2-methylbenzene Chemical compound CC1=CC(Cl)=CC=C1Cl KFAKZJUYBOYVKA-UHFFFAOYSA-N 0.000 description 1
- NCNWTBAWLAFYDR-UHFFFAOYSA-N 1,6-dimethylpiperidin-2-one Chemical compound CC1CCCC(=O)N1C NCNWTBAWLAFYDR-UHFFFAOYSA-N 0.000 description 1
- SZMLDVKZMIXAJF-UHFFFAOYSA-N 1-(2-methylpropyl)azepan-2-one Chemical compound CC(C)CN1CCCCCC1=O SZMLDVKZMIXAJF-UHFFFAOYSA-N 0.000 description 1
- IOOXDDQLNSTLNL-UHFFFAOYSA-N 1-(2-methylpropyl)piperidin-2-one Chemical compound CC(C)CN1CCCCC1=O IOOXDDQLNSTLNL-UHFFFAOYSA-N 0.000 description 1
- IVUYGANTXQVDDG-UHFFFAOYSA-N 1-(2-methylpropyl)pyrrolidin-2-one Chemical compound CC(C)CN1CCCC1=O IVUYGANTXQVDDG-UHFFFAOYSA-N 0.000 description 1
- ZFPGARUNNKGOBB-UHFFFAOYSA-N 1-Ethyl-2-pyrrolidinone Chemical compound CCN1CCCC1=O ZFPGARUNNKGOBB-UHFFFAOYSA-N 0.000 description 1
- NHDODQWIKUYWMW-UHFFFAOYSA-N 1-bromo-4-chlorobenzene Chemical compound ClC1=CC=C(Br)C=C1 NHDODQWIKUYWMW-UHFFFAOYSA-N 0.000 description 1
- VGZOTUWVGXUNRC-UHFFFAOYSA-N 1-butylazepan-2-one Chemical compound CCCCN1CCCCCC1=O VGZOTUWVGXUNRC-UHFFFAOYSA-N 0.000 description 1
- BNXZHVUCNYMNOS-UHFFFAOYSA-N 1-butylpyrrolidin-2-one Chemical compound CCCCN1CCCC1=O BNXZHVUCNYMNOS-UHFFFAOYSA-N 0.000 description 1
- MXEOFTCIEDUHCX-UHFFFAOYSA-N 1-cyclohexylazepan-2-one Chemical compound O=C1CCCCCN1C1CCCCC1 MXEOFTCIEDUHCX-UHFFFAOYSA-N 0.000 description 1
- VUQMOERHEHTWPE-UHFFFAOYSA-N 1-ethylpiperidin-2-one Chemical compound CCN1CCCCC1=O VUQMOERHEHTWPE-UHFFFAOYSA-N 0.000 description 1
- GGYVTHJIUNGKFZ-UHFFFAOYSA-N 1-methylpiperidin-2-one Chemical compound CN1CCCCC1=O GGYVTHJIUNGKFZ-UHFFFAOYSA-N 0.000 description 1
- BWIRRVWVFWVVSG-UHFFFAOYSA-N 1-propan-2-ylazepan-2-one Chemical compound CC(C)N1CCCCCC1=O BWIRRVWVFWVVSG-UHFFFAOYSA-N 0.000 description 1
- GVDQKJQFVPXADH-UHFFFAOYSA-N 1-propan-2-ylpiperidin-2-one Chemical compound CC(C)N1CCCCC1=O GVDQKJQFVPXADH-UHFFFAOYSA-N 0.000 description 1
- GHELJWBGTIKZQW-UHFFFAOYSA-N 1-propan-2-ylpyrrolidin-2-one Chemical compound CC(C)N1CCCC1=O GHELJWBGTIKZQW-UHFFFAOYSA-N 0.000 description 1
- BWISIXSYQURMMY-UHFFFAOYSA-N 1-propylazepan-2-one Chemical compound CCCN1CCCCCC1=O BWISIXSYQURMMY-UHFFFAOYSA-N 0.000 description 1
- DCALJVULAGICIX-UHFFFAOYSA-N 1-propylpyrrolidin-2-one Chemical compound CCCN1CCCC1=O DCALJVULAGICIX-UHFFFAOYSA-N 0.000 description 1
- UADLUJIUAQAUHR-UHFFFAOYSA-N 2,5-dichloro-5,6-dimethylcyclohexa-1,3-diene Chemical group CC1C=C(Cl)C=CC1(C)Cl UADLUJIUAQAUHR-UHFFFAOYSA-N 0.000 description 1
- KKQWHYGECTYFIA-UHFFFAOYSA-N 2,5-dichlorobiphenyl Chemical compound ClC1=CC=C(Cl)C(C=2C=CC=CC=2)=C1 KKQWHYGECTYFIA-UHFFFAOYSA-N 0.000 description 1
- ZXONXKTYRSSVKY-UHFFFAOYSA-N 2-benzyl-1,4-dichlorobenzene Chemical compound ClC1=CC=C(Cl)C(CC=2C=CC=CC=2)=C1 ZXONXKTYRSSVKY-UHFFFAOYSA-N 0.000 description 1
- DRYYJQYUHPRVBN-UHFFFAOYSA-N 3-ethyl-1-methylpiperidin-2-one Chemical compound CCC1CCCN(C)C1=O DRYYJQYUHPRVBN-UHFFFAOYSA-N 0.000 description 1
- WBNUVPGJLHTDTD-UHFFFAOYSA-N 4-ethyl-5-methylimidazolidin-2-one Chemical compound CCC1NC(=O)NC1C WBNUVPGJLHTDTD-UHFFFAOYSA-N 0.000 description 1
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical group C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 1
- 239000005977 Ethylene Substances 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 229910000288 alkali metal carbonate Inorganic materials 0.000 description 1
- 150000008041 alkali metal carbonates Chemical class 0.000 description 1
- 150000001413 amino acids Chemical class 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 239000001569 carbon dioxide Substances 0.000 description 1
- 229910002092 carbon dioxide Inorganic materials 0.000 description 1
- 238000005119 centrifugation Methods 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Substances ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 1
- 230000006835 compression Effects 0.000 description 1
- 238000007906 compression Methods 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 239000000470 constituent Substances 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 150000001923 cyclic compounds Chemical class 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- ZMXDDKWLCZADIW-UHFFFAOYSA-N dimethylformamide Substances CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 1
- 229940016681 dipropylacetamide Drugs 0.000 description 1
- TWKKUWBBCHHMLT-UHFFFAOYSA-N disodium;sulfide;trihydrate Chemical compound O.O.O.[Na+].[Na+].[S-2] TWKKUWBBCHHMLT-UHFFFAOYSA-N 0.000 description 1
- 238000005530 etching Methods 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 238000001125 extrusion Methods 0.000 description 1
- 238000010101 extrusion blow moulding Methods 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 150000002222 fluorine compounds Chemical class 0.000 description 1
- 150000004675 formic acid derivatives Chemical class 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 239000003365 glass fiber Substances 0.000 description 1
- 229910002804 graphite Inorganic materials 0.000 description 1
- 239000010439 graphite Substances 0.000 description 1
- 150000005171 halobenzenes Chemical class 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- 238000001746 injection moulding Methods 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 230000007775 late Effects 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- XGZVUEUWXADBQD-UHFFFAOYSA-L lithium carbonate Chemical compound [Li+].[Li+].[O-]C([O-])=O XGZVUEUWXADBQD-UHFFFAOYSA-L 0.000 description 1
- 229910052808 lithium carbonate Inorganic materials 0.000 description 1
- IAQLJCYTGRMXMA-UHFFFAOYSA-M lithium;acetate;dihydrate Chemical compound [Li+].O.O.CC([O-])=O IAQLJCYTGRMXMA-UHFFFAOYSA-M 0.000 description 1
- 238000005259 measurement Methods 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 239000006082 mold release agent Substances 0.000 description 1
- 238000000465 moulding Methods 0.000 description 1
- AJFDBNQQDYLMJN-UHFFFAOYSA-N n,n-diethylacetamide Chemical compound CCN(CC)C(C)=O AJFDBNQQDYLMJN-UHFFFAOYSA-N 0.000 description 1
- 125000004433 nitrogen atom Chemical group N* 0.000 description 1
- 230000020477 pH reduction Effects 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- 239000010452 phosphate Substances 0.000 description 1
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 1
- 239000000049 pigment Substances 0.000 description 1
- WFIZEGIEIOHZCP-UHFFFAOYSA-M potassium formate Chemical compound [K+].[O-]C=O WFIZEGIEIOHZCP-UHFFFAOYSA-M 0.000 description 1
- DPLVEEXVKBWGHE-UHFFFAOYSA-N potassium sulfide Chemical compound [S-2].[K+].[K+] DPLVEEXVKBWGHE-UHFFFAOYSA-N 0.000 description 1
- QQONPFPTGQHPMA-UHFFFAOYSA-N propylene Natural products CC=C QQONPFPTGQHPMA-UHFFFAOYSA-N 0.000 description 1
- HNJBEVLQSNELDL-UHFFFAOYSA-N pyrrolidin-2-one Chemical compound O=C1CCCN1 HNJBEVLQSNELDL-UHFFFAOYSA-N 0.000 description 1
- 239000010453 quartz Substances 0.000 description 1
- 230000008929 regeneration Effects 0.000 description 1
- 238000011069 regeneration method Methods 0.000 description 1
- 125000006413 ring segment Chemical group 0.000 description 1
- 238000007789 sealing Methods 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N silicon dioxide Inorganic materials O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 125000000446 sulfanediyl group Chemical group *S* 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- RIUWBIIVUYSTCN-UHFFFAOYSA-N trilithium borate Chemical compound [Li+].[Li+].[Li+].[O-]B([O-])[O-] RIUWBIIVUYSTCN-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G75/00—Macromolecular compounds obtained by reactions forming a linkage containing sulfur with or without nitrogen, oxygen, or carbon in the main chain of the macromolecule
- C08G75/02—Polythioethers
- C08G75/0204—Polyarylenethioethers
- C08G75/0231—Polyarylenethioethers containing chain-terminating or chain-branching agents
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G75/00—Macromolecular compounds obtained by reactions forming a linkage containing sulfur with or without nitrogen, oxygen, or carbon in the main chain of the macromolecule
- C08G75/02—Polythioethers
- C08G75/0204—Polyarylenethioethers
- C08G75/025—Preparatory processes
- C08G75/0254—Preparatory processes using metal sulfides
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Polymers With Sulfur, Phosphorus Or Metals In The Main Chain (AREA)
Priority Applications (6)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19833312284 DE3312284A1 (de) | 1983-04-05 | 1983-04-05 | Verfahren zur herstellung von gegebenenfalls verzweigten polyarylensulfiden |
| US06/592,698 US4537951A (en) | 1983-04-05 | 1984-03-23 | Process for the production of optionally branched polyarylene sulfides |
| DE8484103297T DE3480932D1 (de) | 1983-04-05 | 1984-03-26 | Verfahren zur hestellung von gegebenenfalls verzweigten polyarylensulfiden. |
| EP84103297A EP0121205B1 (de) | 1983-04-05 | 1984-03-26 | Verfahren zur Hestellung von gegebenenfalls verzweigten Polyarylensulfiden |
| JP59063436A JPS59197430A (ja) | 1983-04-05 | 1984-04-02 | ポリアリ−レンスルフイド類の製造法 |
| CA000451157A CA1223690A (en) | 1983-04-05 | 1984-04-03 | Process for the production of optionally branched polyarylene sulfides |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19833312284 DE3312284A1 (de) | 1983-04-05 | 1983-04-05 | Verfahren zur herstellung von gegebenenfalls verzweigten polyarylensulfiden |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE3312284A1 true DE3312284A1 (de) | 1984-10-11 |
| DE3312284C2 DE3312284C2 (enExample) | 1990-12-13 |
Family
ID=6195530
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19833312284 Granted DE3312284A1 (de) | 1983-04-05 | 1983-04-05 | Verfahren zur herstellung von gegebenenfalls verzweigten polyarylensulfiden |
| DE8484103297T Expired - Lifetime DE3480932D1 (de) | 1983-04-05 | 1984-03-26 | Verfahren zur hestellung von gegebenenfalls verzweigten polyarylensulfiden. |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE8484103297T Expired - Lifetime DE3480932D1 (de) | 1983-04-05 | 1984-03-26 | Verfahren zur hestellung von gegebenenfalls verzweigten polyarylensulfiden. |
Country Status (5)
| Country | Link |
|---|---|
| US (1) | US4537951A (enExample) |
| EP (1) | EP0121205B1 (enExample) |
| JP (1) | JPS59197430A (enExample) |
| CA (1) | CA1223690A (enExample) |
| DE (2) | DE3312284A1 (enExample) |
Families Citing this family (12)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3317820A1 (de) * | 1983-05-17 | 1984-11-22 | Bayer Ag, 5090 Leverkusen | Verfahren zur herstellung von polyarylensulfiden |
| DE3421608A1 (de) * | 1984-06-09 | 1985-12-12 | Bayer Ag, 5090 Leverkusen | Verfahren zur herstellung von polyarylensulfiden mit funktionellen endgruppen |
| US4605733A (en) * | 1984-08-31 | 1986-08-12 | Phillips Petroleum Company | Polyarylene sulfide preparation method with dithionite |
| JPS6295320A (ja) * | 1985-10-21 | 1987-05-01 | Idemitsu Petrochem Co Ltd | ポリアリ−レンスルフイドの製造方法 |
| JPH0621168B2 (ja) * | 1985-08-27 | 1994-03-23 | 呉羽化学工業株式会社 | 溶融結晶化温度の高いポリアリ−レンチオエ−テルの製造法 |
| JPS62185716A (ja) * | 1986-02-12 | 1987-08-14 | Idemitsu Petrochem Co Ltd | ポリアリ−レンスルフイドの製造方法 |
| EP0296250A4 (en) * | 1986-12-26 | 1991-03-13 | Idemitsu Petrochemical Company Limited | Polyarylene sulfide and process for its production |
| US4910294A (en) * | 1988-06-20 | 1990-03-20 | Idemitsu Petrochemical Company Limited | Two-stage process for production of polyarylene sulfides with lithium compound |
| USD334247S (en) | 1990-07-20 | 1993-03-23 | Scianna Chris C | Hair frosting cap for the head |
| BE1006058A3 (fr) * | 1992-07-14 | 1994-05-03 | Solvay | Procede pour la fabrication de poly(sulfure d'arylene). |
| US5277863A (en) * | 1993-02-26 | 1994-01-11 | The United States Of America As Represented By The Secretary Of The Army | Method of preparing non-composite, thermoplastic, high-temperature-resistant rocket motor cases |
| US7745357B2 (en) * | 2004-03-12 | 2010-06-29 | Georgia-Pacific Gypsum Llc | Use of pre-coated mat for preparing gypsum board |
Citations (16)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2513188A (en) * | 1948-09-10 | 1950-06-27 | Macallum Alexander Douglas | Mixed phenylene sulfide resins |
| US2538941A (en) * | 1948-01-29 | 1951-01-23 | Macallum Alexander Douglas | Process for producing aromatic sulfide and the resultant products |
| US3354129A (en) * | 1963-11-27 | 1967-11-21 | Phillips Petroleum Co | Production of polymers from aromatic compounds |
| US3919177A (en) * | 1973-11-19 | 1975-11-11 | Phillips Petroleum Co | P-phenylene sulfide polymers |
| DE2623363A1 (de) * | 1975-05-27 | 1976-12-09 | Phillips Petroleum Co | Verfahren zum herstellen von verzweigten arylensulfidpolymeren |
| DE2623362A1 (de) * | 1975-05-27 | 1976-12-09 | Phillips Petroleum Co | Verfahren zur herstellung von arylensulfidpolymeren |
| DE2623333A1 (de) * | 1975-05-27 | 1976-12-09 | Phillips Petroleum Co | Verfahren zur herstellung von arylensulfidpolymeren |
| US4032263A (en) * | 1975-09-25 | 1977-06-28 | Lear Siegler, Inc. | Pump with coaxial inlet and outlet valve arrangement |
| US4038260A (en) * | 1975-05-27 | 1977-07-26 | Phillips Petroleum Company | Production of p-phenylene sulfide polymers |
| US4038259A (en) * | 1975-05-27 | 1977-07-26 | Phillips Petroleum Company | Production of p-phenylene sulfide polymers |
| US4039518A (en) * | 1975-05-27 | 1977-08-02 | Phillips Petroleum Company | Production of p-phenylene sulfide polymers |
| US4096132A (en) * | 1975-05-27 | 1978-06-20 | Phillips Petroleum Company | Production of p-phenylene sulfide polymers |
| DE2817731A1 (de) * | 1977-04-29 | 1978-11-02 | Phillips Petroleum Co | Verfahren zur herstellung von verzweigten arylensulfidpolymeren |
| US4178433A (en) * | 1978-05-11 | 1979-12-11 | The Dow Chemical Company | Process for making arylene sulfide polymers |
| DE2930797A1 (de) * | 1979-07-28 | 1981-02-12 | Bayer Ag | Verfahren zur herstellung von polyarylensulfiden |
| DE2930710A1 (de) * | 1979-07-28 | 1981-02-19 | Bayer Ag | Verfahren zur herstellung von polyarylensulfiden |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3120538A1 (de) * | 1981-05-22 | 1982-12-09 | Bayer Ag, 5090 Leverkusen | Verfahren zur herstellung von polyarylensulfiden |
| EP0075769B1 (de) * | 1981-09-25 | 1986-02-26 | Bayer Ag | Verfahren zur Herstellung von Polyarylensulfiden |
| US4373090A (en) * | 1982-02-16 | 1983-02-08 | Phillips Petroleum Company | Arylene sulfide polymer preparation |
| US4393197A (en) * | 1982-02-16 | 1983-07-12 | Phillips Petroleum Company | Arylene sulfide polymer preparation |
-
1983
- 1983-04-05 DE DE19833312284 patent/DE3312284A1/de active Granted
-
1984
- 1984-03-23 US US06/592,698 patent/US4537951A/en not_active Expired - Fee Related
- 1984-03-26 DE DE8484103297T patent/DE3480932D1/de not_active Expired - Lifetime
- 1984-03-26 EP EP84103297A patent/EP0121205B1/de not_active Expired - Lifetime
- 1984-04-02 JP JP59063436A patent/JPS59197430A/ja active Pending
- 1984-04-03 CA CA000451157A patent/CA1223690A/en not_active Expired
Patent Citations (18)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2538941A (en) * | 1948-01-29 | 1951-01-23 | Macallum Alexander Douglas | Process for producing aromatic sulfide and the resultant products |
| US2513188A (en) * | 1948-09-10 | 1950-06-27 | Macallum Alexander Douglas | Mixed phenylene sulfide resins |
| US3354129A (en) * | 1963-11-27 | 1967-11-21 | Phillips Petroleum Co | Production of polymers from aromatic compounds |
| US3919177A (en) * | 1973-11-19 | 1975-11-11 | Phillips Petroleum Co | P-phenylene sulfide polymers |
| DE2453749B2 (de) * | 1973-11-19 | 1979-09-06 | Phillips Petroleum Co., Bartlesville, Okla. (V.St.A.) | Verfahren zur Herstellung eines P-Phenylensulfidpolymeren und dessen Verwendung |
| US4038262A (en) * | 1975-05-27 | 1977-07-26 | Phillips Petroleum Company | Production of arylene sulfide polymers |
| DE2623333A1 (de) * | 1975-05-27 | 1976-12-09 | Phillips Petroleum Co | Verfahren zur herstellung von arylensulfidpolymeren |
| DE2623362A1 (de) * | 1975-05-27 | 1976-12-09 | Phillips Petroleum Co | Verfahren zur herstellung von arylensulfidpolymeren |
| US4038260A (en) * | 1975-05-27 | 1977-07-26 | Phillips Petroleum Company | Production of p-phenylene sulfide polymers |
| US4038259A (en) * | 1975-05-27 | 1977-07-26 | Phillips Petroleum Company | Production of p-phenylene sulfide polymers |
| US4039518A (en) * | 1975-05-27 | 1977-08-02 | Phillips Petroleum Company | Production of p-phenylene sulfide polymers |
| US4096132A (en) * | 1975-05-27 | 1978-06-20 | Phillips Petroleum Company | Production of p-phenylene sulfide polymers |
| DE2623363A1 (de) * | 1975-05-27 | 1976-12-09 | Phillips Petroleum Co | Verfahren zum herstellen von verzweigten arylensulfidpolymeren |
| US4032263A (en) * | 1975-09-25 | 1977-06-28 | Lear Siegler, Inc. | Pump with coaxial inlet and outlet valve arrangement |
| DE2817731A1 (de) * | 1977-04-29 | 1978-11-02 | Phillips Petroleum Co | Verfahren zur herstellung von verzweigten arylensulfidpolymeren |
| US4178433A (en) * | 1978-05-11 | 1979-12-11 | The Dow Chemical Company | Process for making arylene sulfide polymers |
| DE2930797A1 (de) * | 1979-07-28 | 1981-02-12 | Bayer Ag | Verfahren zur herstellung von polyarylensulfiden |
| DE2930710A1 (de) * | 1979-07-28 | 1981-02-19 | Bayer Ag | Verfahren zur herstellung von polyarylensulfiden |
Also Published As
| Publication number | Publication date |
|---|---|
| EP0121205B1 (de) | 1990-01-03 |
| EP0121205A3 (en) | 1987-08-26 |
| DE3480932D1 (de) | 1990-02-08 |
| DE3312284C2 (enExample) | 1990-12-13 |
| CA1223690A (en) | 1987-06-30 |
| EP0121205A2 (de) | 1984-10-10 |
| JPS59197430A (ja) | 1984-11-09 |
| US4537951A (en) | 1985-08-27 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0040747B1 (de) | Verfahren zur Herstellung von Polyarylensulfiden | |
| EP0065689B1 (de) | Verfahren zur Herstellung von Polyarylensulfiden | |
| EP0023313B1 (de) | Verfahren zur Herstellung von Polyarylensulfiden | |
| EP0075769B1 (de) | Verfahren zur Herstellung von Polyarylensulfiden | |
| EP0109637B1 (de) | Verfahren zur Herstellung von hochmolekularen gegebenenfalls verzweigten Polyarylensulfiden | |
| EP0023314B1 (de) | Verfahren zur Herstellung von Polyarylensulfiden | |
| EP0121206B1 (de) | Verfahren zur Herstellung von gegebenenfalls verzweigten Polyarylensulfiden | |
| EP0125600B1 (de) | Verfahren zur Herstellung von Polyarylensulfiden | |
| DE3312284C2 (enExample) | ||
| DE3428984C2 (enExample) | ||
| DE3428986C2 (enExample) | ||
| EP0108978B1 (de) | Verfahren zur Herstellung von gegebenenfalls verzweigten Polyarylensulfiden | |
| EP0087045B1 (de) | Verfahren zur Herstellung von Polyarylensulfiden mit erhöhter thermischer und chemischer Belastbarkeit und verbesserter Farbqualität | |
| EP0279217B1 (de) | Verfahren zur Herstellung von Polyarylensulfiden mit regelbaren Schmelzviskositäten | |
| EP0275007A2 (de) | Verfahren zur Herstellung von hochmolekularen, gegebenenfalls verzweigten Polyarylensulfiden | |
| DE3205996A1 (de) | Verfahren zur herstellung von polyarylensulfiden | |
| EP0087046A1 (de) | Verfahren zur Herstellung von Polyarylensulfiden mit erhöhter thermischer und chemischer Belastbarkeit | |
| DE3215259A1 (de) | Verfahren zur herstellung von hochmolekularen, gegebenenfalls verzweigten polyarylensulfiden | |
| DE3738142A1 (de) | Verfahren zur herstellung von polyarylensulfiden mit definiert einstellbaren schmelzviskositaeten | |
| EP0125601B1 (de) | Verfahren zur Herstellung von Polyarylensulfiden | |
| DE3428985C2 (enExample) | ||
| DE3828057A1 (de) | Hochmolekulare, gegebenenfalls verzweigte co-polyarylensulfide, verfahren zu deren herstellung und deren verwendung | |
| DE3808496A1 (de) | Neue hochmolekulare, gegebenenfalls verzweigte co-polyarylensulfide, verfahren zu deren herstellung und deren verwendung | |
| DE4311139A1 (de) | Verfahren zur Herstellung von hochmolekularen, gegebenenfalls verzweigten Polyarylensulfiden |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8110 | Request for examination paragraph 44 | ||
| D2 | Grant after examination | ||
| 8330 | Complete disclaimer | ||
| 8361 | Publication of patent cancelled |