DE3152459T1 - Cyclohexadiene derivatives and process for their preparation - Google Patents
Cyclohexadiene derivatives and process for their preparationInfo
- Publication number
- DE3152459T1 DE3152459T1 DE813152459T DE3152459T DE3152459T1 DE 3152459 T1 DE3152459 T1 DE 3152459T1 DE 813152459 T DE813152459 T DE 813152459T DE 3152459 T DE3152459 T DE 3152459T DE 3152459 T1 DE3152459 T1 DE 3152459T1
- Authority
- DE
- Germany
- Prior art keywords
- formula
- acid
- compound
- alkali metal
- alcohol
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Granted
Links
- 238000000034 method Methods 0.000 title claims description 21
- MGNZXYYWBUKAII-UHFFFAOYSA-N cyclohexa-1,3-diene Chemical class C1CC=CC=C1 MGNZXYYWBUKAII-UHFFFAOYSA-N 0.000 title claims description 8
- 238000002360 preparation method Methods 0.000 title claims description 6
- 150000001875 compounds Chemical class 0.000 claims description 45
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 claims description 27
- 238000005868 electrolysis reaction Methods 0.000 claims description 23
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 claims description 21
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 18
- -1 p-toluenesulfonic acid tetraalkyl ammonium salt Chemical class 0.000 claims description 15
- 238000006243 chemical reaction Methods 0.000 claims description 14
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical class C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 claims description 12
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 claims description 12
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 claims description 12
- 239000003792 electrolyte Substances 0.000 claims description 12
- 230000007935 neutral effect Effects 0.000 claims description 9
- DNIAPMSPPWPWGF-GSVOUGTGSA-N (R)-(-)-Propylene glycol Chemical compound C[C@@H](O)CO DNIAPMSPPWPWGF-GSVOUGTGSA-N 0.000 claims description 8
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 claims description 8
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 claims description 8
- 229910052783 alkali metal Inorganic materials 0.000 claims description 7
- 239000002904 solvent Substances 0.000 claims description 7
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 claims description 6
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 claims description 6
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical class CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 claims description 6
- 125000000217 alkyl group Chemical group 0.000 claims description 6
- VLTRZXGMWDSKGL-UHFFFAOYSA-N perchloric acid Substances OCl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-N 0.000 claims description 6
- 239000002253 acid Substances 0.000 claims description 5
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 claims description 4
- OFBQJSOFQDEBGM-UHFFFAOYSA-N Pentane Chemical compound CCCCC OFBQJSOFQDEBGM-UHFFFAOYSA-N 0.000 claims description 4
- 239000003377 acid catalyst Substances 0.000 claims description 4
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 claims description 4
- JIAARYAFYJHUJI-UHFFFAOYSA-L zinc dichloride Chemical compound [Cl-].[Cl-].[Zn+2] JIAARYAFYJHUJI-UHFFFAOYSA-L 0.000 claims description 4
- 150000007933 aliphatic carboxylic acids Chemical class 0.000 claims description 3
- 229910001515 alkali metal fluoride Inorganic materials 0.000 claims description 3
- 150000001340 alkali metals Chemical class 0.000 claims description 3
- 229930195733 hydrocarbon Natural products 0.000 claims description 3
- JOXIMZWYDAKGHI-UHFFFAOYSA-N p-toluenesulfonic acid Substances CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 claims description 3
- DURPTKYDGMDSBL-UHFFFAOYSA-N 1-butoxybutane Chemical compound CCCCOCCCC DURPTKYDGMDSBL-UHFFFAOYSA-N 0.000 claims description 2
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 claims description 2
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 claims description 2
- 229910021578 Iron(III) chloride Inorganic materials 0.000 claims description 2
- 239000002841 Lewis acid Substances 0.000 claims description 2
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical class CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 claims description 2
- 150000008044 alkali metal hydroxides Chemical class 0.000 claims description 2
- 150000004945 aromatic hydrocarbons Chemical class 0.000 claims description 2
- VLKZOEOYAKHREP-UHFFFAOYSA-N hexane Substances CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 claims description 2
- RBTARNINKXHZNM-UHFFFAOYSA-K iron trichloride Chemical compound Cl[Fe](Cl)Cl RBTARNINKXHZNM-UHFFFAOYSA-K 0.000 claims description 2
- 150000007517 lewis acids Chemical class 0.000 claims description 2
- 238000004519 manufacturing process Methods 0.000 claims description 2
- 239000008096 xylene Chemical class 0.000 claims description 2
- 239000011592 zinc chloride Substances 0.000 claims description 2
- 235000005074 zinc chloride Nutrition 0.000 claims description 2
- KRHYYFGTRYWZRS-UHFFFAOYSA-M Fluoride anion Chemical compound [F-] KRHYYFGTRYWZRS-UHFFFAOYSA-M 0.000 claims 1
- WQPDQJCBHQPNCZ-UHFFFAOYSA-N cyclohexa-2,4-dien-1-one Chemical class O=C1CC=CC=C1 WQPDQJCBHQPNCZ-UHFFFAOYSA-N 0.000 claims 1
- 150000002430 hydrocarbons Chemical class 0.000 claims 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 claims 1
- 239000012043 crude product Substances 0.000 description 14
- 239000000203 mixture Substances 0.000 description 11
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 10
- RTEXIPZMMDUXMR-UHFFFAOYSA-N benzene;ethyl acetate Chemical compound CCOC(C)=O.C1=CC=CC=C1 RTEXIPZMMDUXMR-UHFFFAOYSA-N 0.000 description 8
- MDHYEMXUFSJLGV-UHFFFAOYSA-N beta-phenethyl acetate Natural products CC(=O)OCCC1=CC=CC=C1 MDHYEMXUFSJLGV-UHFFFAOYSA-N 0.000 description 8
- 238000004440 column chromatography Methods 0.000 description 7
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 6
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- 239000000741 silica gel Substances 0.000 description 6
- 229910002027 silica gel Inorganic materials 0.000 description 6
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 5
- 229910052799 carbon Inorganic materials 0.000 description 5
- 229910052697 platinum Inorganic materials 0.000 description 5
- 238000003756 stirring Methods 0.000 description 5
- ZFBNNSOJNZBLLS-UHFFFAOYSA-N 2,6-Dimethoxy-4-methylphenol Chemical compound COC1=CC(C)=CC(OC)=C1O ZFBNNSOJNZBLLS-UHFFFAOYSA-N 0.000 description 4
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 4
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 4
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 4
- 239000012295 chemical reaction liquid Substances 0.000 description 4
- 238000004587 chromatography analysis Methods 0.000 description 4
- 239000013078 crystal Substances 0.000 description 4
- XEKOWRVHYACXOJ-UHFFFAOYSA-N ethyl acetate Substances CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 4
- PUZPDOWCWNUUKD-UHFFFAOYSA-M sodium fluoride Chemical compound [F-].[Na+] PUZPDOWCWNUUKD-UHFFFAOYSA-M 0.000 description 4
- OQLNIPQHMKAAFO-UHFFFAOYSA-N 2,4,6-trimethoxy-4-methylcyclohexa-2,5-dien-1-one Chemical compound COC1=CC(C)(OC)C=C(OC)C1=O OQLNIPQHMKAAFO-UHFFFAOYSA-N 0.000 description 3
- IMTWOBKKFHWPNA-UHFFFAOYSA-N 2,6-dibutoxy-4-methoxy-4-methylcyclohexa-2,5-dien-1-one Chemical compound CCCCOC1=CC(C)(OC)C=C(OCCCC)C1=O IMTWOBKKFHWPNA-UHFFFAOYSA-N 0.000 description 3
- WMFOQBRAJBCJND-UHFFFAOYSA-M Lithium hydroxide Chemical compound [Li+].[OH-] WMFOQBRAJBCJND-UHFFFAOYSA-M 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 3
- 239000001632 sodium acetate Substances 0.000 description 3
- 235000017281 sodium acetate Nutrition 0.000 description 3
- 229910001220 stainless steel Inorganic materials 0.000 description 3
- 239000010935 stainless steel Substances 0.000 description 3
- 239000007858 starting material Substances 0.000 description 3
- VQSGYAPECYJBPG-UHFFFAOYSA-N 1,2,3-triethoxy-5-methylbenzene Chemical compound CCOC1=CC(C)=CC(OCC)=C1OCC VQSGYAPECYJBPG-UHFFFAOYSA-N 0.000 description 2
- UPYZVCJEJPOBLP-UHFFFAOYSA-N 1,3,5,6,6-pentaethoxy-3-methylcyclohexa-1,4-diene Chemical compound CCOC1=CC(C)(OCC)C=C(OCC)C1(OCC)OCC UPYZVCJEJPOBLP-UHFFFAOYSA-N 0.000 description 2
- QTRKTCRJMGRIHU-UHFFFAOYSA-N 2,6-dibutoxy-4-methylphenol Chemical compound CCCCOC1=CC(C)=CC(OCCCC)=C1O QTRKTCRJMGRIHU-UHFFFAOYSA-N 0.000 description 2
- GZJCVPKMBKGCPD-UHFFFAOYSA-N 2,6-diethoxy-4-methylidenecyclohexa-2,5-dien-1-one Chemical compound CCOC1=CC(=C)C=C(OCC)C1=O GZJCVPKMBKGCPD-UHFFFAOYSA-N 0.000 description 2
- DOHBOMUAJSYBTA-UHFFFAOYSA-N 2,6-dimethoxy-4-methylidenecyclohexa-2,5-dien-1-one Chemical compound COC1=CC(=C)C=C(OC)C1=O DOHBOMUAJSYBTA-UHFFFAOYSA-N 0.000 description 2
- KCIZTNZGSBSSRM-UHFFFAOYSA-N 3,4,5-Trimethoxytoluene Chemical compound COC1=CC(C)=CC(OC)=C1OC KCIZTNZGSBSSRM-UHFFFAOYSA-N 0.000 description 2
- NVFKIXOFMRPANZ-UHFFFAOYSA-N 4-methyl-2,6-di(propan-2-yloxy)phenol Chemical compound CC(C)OC1=CC(C)=CC(OC(C)C)=C1O NVFKIXOFMRPANZ-UHFFFAOYSA-N 0.000 description 2
- XOUSBEKUMOSQRO-UHFFFAOYSA-N 6-ethoxy-1,5,6-trimethoxy-3-methylidenecyclohexa-1,4-diene Chemical compound CCOC1(OC)C(OC)=CC(=C)C=C1OC XOUSBEKUMOSQRO-UHFFFAOYSA-N 0.000 description 2
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical compound [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-MICDWDOJSA-N Trichloro(2H)methane Chemical compound [2H]C(Cl)(Cl)Cl HEDRZPFGACZZDS-MICDWDOJSA-N 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- YADSGOSSYOOKMP-UHFFFAOYSA-N dioxolead Chemical compound O=[Pb]=O YADSGOSSYOOKMP-UHFFFAOYSA-N 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- 229910052759 nickel Inorganic materials 0.000 description 2
- NROKBHXJSPEDAR-UHFFFAOYSA-M potassium fluoride Chemical compound [F-].[K+] NROKBHXJSPEDAR-UHFFFAOYSA-M 0.000 description 2
- 150000003839 salts Chemical class 0.000 description 2
- 235000017557 sodium bicarbonate Nutrition 0.000 description 2
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 2
- 239000011775 sodium fluoride Substances 0.000 description 2
- 235000013024 sodium fluoride Nutrition 0.000 description 2
- 238000003786 synthesis reaction Methods 0.000 description 2
- VDZOOKBUILJEDG-UHFFFAOYSA-M tetrabutylammonium hydroxide Chemical compound [OH-].CCCC[N+](CCCC)(CCCC)CCCC VDZOOKBUILJEDG-UHFFFAOYSA-M 0.000 description 2
- WGTYBPLFGIVFAS-UHFFFAOYSA-M tetramethylammonium hydroxide Chemical compound [OH-].C[N+](C)(C)C WGTYBPLFGIVFAS-UHFFFAOYSA-M 0.000 description 2
- 229910052719 titanium Inorganic materials 0.000 description 2
- 239000010936 titanium Substances 0.000 description 2
- KTIXOQCHPJCHEA-UHFFFAOYSA-N 1,3,5,6,6-pentamethoxy-3-methylcyclohexa-1,4-diene Chemical compound COC1=CC(C)(OC)C=C(OC)C1(OC)OC KTIXOQCHPJCHEA-UHFFFAOYSA-N 0.000 description 1
- XWFLZQQHARQIKD-UHFFFAOYSA-N 1,5,6,6-tetraethoxy-3-methylidenecyclohexa-1,4-diene Chemical compound CCOC1=CC(=C)C=C(OCC)C1(OCC)OCC XWFLZQQHARQIKD-UHFFFAOYSA-N 0.000 description 1
- MSKKDGNGCDTSJT-UHFFFAOYSA-N 1,5,6,6-tetramethoxy-3-methylidenecyclohexa-1,4-diene Chemical compound COC1=CC(=C)C=C(OC)C1(OC)OC MSKKDGNGCDTSJT-UHFFFAOYSA-N 0.000 description 1
- OOMDUPVEAPYOFS-UHFFFAOYSA-N 1,5,6-tributoxy-3,6-diethoxy-3-methylcyclohexa-1,4-diene Chemical compound CCCCOC1=CC(C)(OCC)C=C(OCCCC)C1(OCC)OCCCC OOMDUPVEAPYOFS-UHFFFAOYSA-N 0.000 description 1
- BHUJWHYSQWADJK-UHFFFAOYSA-N 1,5,6-tributoxy-3,6-dimethoxy-3-methylcyclohexa-1,4-diene Chemical compound CCCCOC1=CC(C)(OC)C=C(OCCCC)C1(OC)OCCCC BHUJWHYSQWADJK-UHFFFAOYSA-N 0.000 description 1
- WBUZNJFUZOQENT-UHFFFAOYSA-N 1,5,6-triethoxy-6-methoxy-3-methylidenecyclohexa-1,4-diene Chemical compound CCOC1=CC(=C)C=C(OCC)C1(OC)OCC WBUZNJFUZOQENT-UHFFFAOYSA-N 0.000 description 1
- QSVINKAURJHPPB-UHFFFAOYSA-N 2,4,6-tributoxy-4-methylcyclohexa-2,5-dien-1-one Chemical compound CCCCOC1=CC(C)(OCCCC)C=C(OCCCC)C1=O QSVINKAURJHPPB-UHFFFAOYSA-N 0.000 description 1
- JABFMZKEZLNFNY-UHFFFAOYSA-N 2,4,6-triethoxy-4-methylcyclohexa-2,5-dien-1-one Chemical compound CCOC1=CC(C)(OCC)C=C(OCC)C1=O JABFMZKEZLNFNY-UHFFFAOYSA-N 0.000 description 1
- VCNVSUFOKYRQQZ-UHFFFAOYSA-N 2,6-dibutoxy-4-ethoxy-4-methylcyclohexa-2,5-dien-1-one Chemical compound CCCCOC1=CC(C)(OCC)C=C(OCCCC)C1=O VCNVSUFOKYRQQZ-UHFFFAOYSA-N 0.000 description 1
- JWEGGJAJWLZSHT-UHFFFAOYSA-N 2,6-dibutoxy-4-methylidenecyclohexa-2,5-dien-1-one Chemical compound CCCCOC1=CC(=C)C=C(OCCCC)C1=O JWEGGJAJWLZSHT-UHFFFAOYSA-N 0.000 description 1
- WDUWSFJISJMFJV-UHFFFAOYSA-N 2,6-diethoxy-4-methoxy-4-methylcyclohexa-2,5-dien-1-one Chemical compound CCOC1=CC(C)(OC)C=C(OCC)C1=O WDUWSFJISJMFJV-UHFFFAOYSA-N 0.000 description 1
- NVMXMHDEFRSANN-UHFFFAOYSA-N 2,6-diethoxy-4-methyl-4-propoxycyclohexa-2,5-dien-1-one Chemical compound CCCOC1(C)C=C(OCC)C(=O)C(OCC)=C1 NVMXMHDEFRSANN-UHFFFAOYSA-N 0.000 description 1
- JPGUMQIMOOHVOL-UHFFFAOYSA-N 2,6-diethoxy-4-methylphenol Chemical compound CCOC1=CC(C)=CC(OCC)=C1O JPGUMQIMOOHVOL-UHFFFAOYSA-N 0.000 description 1
- XSSYMGSEFTVTBG-UHFFFAOYSA-N 3,6-diethoxy-1,5,6-trimethoxy-3-methylcyclohexa-1,4-diene Chemical compound CCOC1(C)C=C(OC)C(OC)(OCC)C(OC)=C1 XSSYMGSEFTVTBG-UHFFFAOYSA-N 0.000 description 1
- XCDGHOSZCIWEGN-UHFFFAOYSA-N 4-butoxy-2,6-diethoxy-4-methylcyclohexa-2,5-dien-1-one Chemical compound CCCCOC1(C)C=C(OCC)C(=O)C(OCC)=C1 XCDGHOSZCIWEGN-UHFFFAOYSA-N 0.000 description 1
- JOKUBPDQACIRLU-UHFFFAOYSA-N 4-butoxy-2,6-dimethoxy-4-methylcyclohexa-2,5-dien-1-one Chemical compound CCCCOC1(C)C=C(OC)C(=O)C(OC)=C1 JOKUBPDQACIRLU-UHFFFAOYSA-N 0.000 description 1
- UNAVUMKHKMTXBT-UHFFFAOYSA-N 4-ethoxy-2,6-dimethoxy-4-methylcyclohexa-2,5-dien-1-one Chemical compound CCOC1(C)C=C(OC)C(=O)C(OC)=C1 UNAVUMKHKMTXBT-UHFFFAOYSA-N 0.000 description 1
- WKSYNYCTULFLGK-UHFFFAOYSA-N 4-ethoxy-4-methyl-2,6-dipropoxycyclohexa-2,5-dien-1-one Chemical compound CCCOC1=CC(C)(OCC)C=C(OCCC)C1=O WKSYNYCTULFLGK-UHFFFAOYSA-N 0.000 description 1
- VUFGBBBKZZPLKV-UHFFFAOYSA-N 4-methoxy-4-methyl-2,6-dipropoxycyclohexa-2,5-dien-1-one Chemical compound CCCOC1=CC(C)(OC)C=C(OCCC)C1=O VUFGBBBKZZPLKV-UHFFFAOYSA-N 0.000 description 1
- ALGMNKPNZXANDI-UHFFFAOYSA-N 4-methyl-2,4,6-tripropoxycyclohexa-2,5-dien-1-one Chemical compound CCCOC1=CC(C)(OCCC)C=C(OCCC)C1=O ALGMNKPNZXANDI-UHFFFAOYSA-N 0.000 description 1
- REAVCZWUMGIGSW-UHFFFAOYSA-M 4-methylbenzenesulfonate;tetrabutylazanium Chemical compound CC1=CC=C(S([O-])(=O)=O)C=C1.CCCC[N+](CCCC)(CCCC)CCCC REAVCZWUMGIGSW-UHFFFAOYSA-M 0.000 description 1
- QKFFSWPNFCXGIQ-UHFFFAOYSA-M 4-methylbenzenesulfonate;tetraethylazanium Chemical compound CC[N+](CC)(CC)CC.CC1=CC=C(S([O-])(=O)=O)C=C1 QKFFSWPNFCXGIQ-UHFFFAOYSA-M 0.000 description 1
- FHVCZJGBXWNGIZ-UHFFFAOYSA-M 4-methylbenzenesulfonate;tetramethylazanium Chemical compound C[N+](C)(C)C.CC1=CC=C(S([O-])(=O)=O)C=C1 FHVCZJGBXWNGIZ-UHFFFAOYSA-M 0.000 description 1
- IGOWLGAXJASRRI-UHFFFAOYSA-N 4-methylidene-2,6-dipropoxycyclohexa-2,5-dien-1-one Chemical compound CCCOC1=CC(=C)C=C(OCCC)C1=O IGOWLGAXJASRRI-UHFFFAOYSA-N 0.000 description 1
- 239000004215 Carbon black (E152) Substances 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- CYTYCFOTNPOANT-UHFFFAOYSA-N Perchloroethylene Chemical compound ClC(Cl)=C(Cl)Cl CYTYCFOTNPOANT-UHFFFAOYSA-N 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 239000004280 Sodium formate Substances 0.000 description 1
- 125000003668 acetyloxy group Chemical group [H]C([H])([H])C(=O)O[*] 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- UVJHQYIOXKWHFD-UHFFFAOYSA-N cyclohexa-1,4-diene Chemical compound C1C=CCC=C1 UVJHQYIOXKWHFD-UHFFFAOYSA-N 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- 239000007772 electrode material Substances 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 150000004679 hydroxides Chemical class 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 239000011698 potassium fluoride Substances 0.000 description 1
- 235000003270 potassium fluoride Nutrition 0.000 description 1
- 150000003242 quaternary ammonium salts Chemical class 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- HLBBKKJFGFRGMU-UHFFFAOYSA-M sodium formate Chemical compound [Na+].[O-]C=O HLBBKKJFGFRGMU-UHFFFAOYSA-M 0.000 description 1
- 235000019254 sodium formate Nutrition 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 239000003115 supporting electrolyte Substances 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- KBLZDCFTQSIIOH-UHFFFAOYSA-M tetrabutylazanium;perchlorate Chemical compound [O-]Cl(=O)(=O)=O.CCCC[N+](CCCC)(CCCC)CCCC KBLZDCFTQSIIOH-UHFFFAOYSA-M 0.000 description 1
- 229940073455 tetraethylammonium hydroxide Drugs 0.000 description 1
- LRGJRHZIDJQFCL-UHFFFAOYSA-M tetraethylazanium;hydroxide Chemical compound [OH-].CC[N+](CC)(CC)CC LRGJRHZIDJQFCL-UHFFFAOYSA-M 0.000 description 1
- LPSKDVINWQNWFE-UHFFFAOYSA-M tetrapropylazanium;hydroxide Chemical compound [OH-].CCC[N+](CCC)(CCC)CCC LPSKDVINWQNWFE-UHFFFAOYSA-M 0.000 description 1
- 229910052720 vanadium Inorganic materials 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C25—ELECTROLYTIC OR ELECTROPHORETIC PROCESSES; APPARATUS THEREFOR
- C25B—ELECTROLYTIC OR ELECTROPHORETIC PROCESSES FOR THE PRODUCTION OF COMPOUNDS OR NON-METALS; APPARATUS THEREFOR
- C25B3/00—Electrolytic production of organic compounds
- C25B3/20—Processes
- C25B3/23—Oxidation
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C41/00—Preparation of ethers; Preparation of compounds having groups, groups or groups
- C07C41/48—Preparation of compounds having groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C45/00—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds
- C07C45/61—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C45/00—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds
- C07C45/61—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups
- C07C45/65—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by splitting-off hydrogen atoms or functional groups; by hydrogenolysis of functional groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C45/00—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds
- C07C45/61—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups
- C07C45/67—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by isomerisation; by change of size of the carbon skeleton
- C07C45/673—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by isomerisation; by change of size of the carbon skeleton by change of size of the carbon skeleton
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C49/00—Ketones; Ketenes; Dimeric ketenes; Ketonic chelates
- C07C49/587—Unsaturated compounds containing a keto groups being part of a ring
- C07C49/753—Unsaturated compounds containing a keto groups being part of a ring containing ether groups, groups, groups, or groups
-
- C—CHEMISTRY; METALLURGY
- C25—ELECTROLYTIC OR ELECTROPHORETIC PROCESSES; APPARATUS THEREFOR
- C25B—ELECTROLYTIC OR ELECTROPHORETIC PROCESSES FOR THE PRODUCTION OF COMPOUNDS OR NON-METALS; APPARATUS THEREFOR
- C25B3/00—Electrolytic production of organic compounds
- C25B3/01—Products
- C25B3/07—Oxygen containing compounds
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C2601/00—Systems containing only non-condensed rings
- C07C2601/12—Systems containing only non-condensed rings with a six-membered ring
- C07C2601/16—Systems containing only non-condensed rings with a six-membered ring the ring being unsaturated
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Engineering & Computer Science (AREA)
- Electrochemistry (AREA)
- Materials Engineering (AREA)
- Metallurgy (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (4)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP55152632A JPS5775944A (en) | 1980-10-29 | 1980-10-29 | Cyclohexadiene derivative |
| JP56027474A JPS57140741A (en) | 1981-02-25 | 1981-02-25 | Cyclohexadienone derivative and its preparation |
| JP56027475A JPS57140738A (en) | 1981-02-25 | 1981-02-25 | Cyclohexadiene derivative and its preparation |
| PCT/JP1981/000300 WO1982001547A1 (fr) | 1980-10-29 | 1981-10-28 | Derives de cyclohexadienne et procede de preparation |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE3152459T1 true DE3152459T1 (de) | 1982-12-02 |
| DE3152459C2 DE3152459C2 (enExample) | 1987-09-17 |
Family
ID=27285809
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE813152459T Granted DE3152459T1 (de) | 1980-10-29 | 1981-10-28 | Cyclohexadiene derivatives and process for their preparation |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US4475992A (enExample) |
| EP (1) | EP0063608B1 (enExample) |
| CH (1) | CH651285A5 (enExample) |
| DE (1) | DE3152459T1 (enExample) |
| GB (1) | GB2097399B (enExample) |
| WO (1) | WO1982001547A1 (enExample) |
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3438568A1 (de) * | 1984-10-20 | 1986-04-30 | Basf Ag, 6700 Ludwigshafen | Verfahren zur herstellung von 1-alkoxyisochromanen und neue 1-alkoxy-alkylisochromane |
| JPH062957B2 (ja) * | 1987-01-12 | 1994-01-12 | 日東化学工業株式会社 | 7,7,8,8−テトラシアノキノジメタンの製造方法 |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2547383A1 (de) * | 1975-10-23 | 1977-04-28 | Hoechst Ag | Verfahren zur herstellung von p-benzochinondiketalen |
| DE2739316A1 (de) * | 1977-09-01 | 1979-03-15 | Hoechst Ag | Verfahren zur herstellung von p-benzochinondiketalen |
-
1981
- 1981-10-28 EP EP81902955A patent/EP0063608B1/en not_active Expired
- 1981-10-28 DE DE813152459T patent/DE3152459T1/de active Granted
- 1981-10-28 GB GB8218154A patent/GB2097399B/en not_active Expired
- 1981-10-28 WO PCT/JP1981/000300 patent/WO1982001547A1/ja not_active Ceased
- 1981-10-28 CH CH3963/82A patent/CH651285A5/de not_active IP Right Cessation
-
1983
- 1983-06-03 US US06/500,949 patent/US4475992A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| WO1982001547A1 (fr) | 1982-05-13 |
| GB2097399A (en) | 1982-11-03 |
| CH651285A5 (de) | 1985-09-13 |
| EP0063608A1 (en) | 1982-11-03 |
| US4475992A (en) | 1984-10-09 |
| EP0063608A4 (en) | 1983-02-09 |
| DE3152459C2 (enExample) | 1987-09-17 |
| EP0063608B1 (en) | 1985-04-24 |
| GB2097399B (en) | 1984-12-12 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0011712B1 (de) | Verfahren zur Herstellung von in 4-Stellung substituierten Benzaldehyddialkylacetalen | |
| EP0293739B1 (de) | Verfahren zur Herstellung von 4-Isopropyl-cyclohexylmethanol bzw. dessen Alkylethern | |
| EP2041336B1 (de) | Elektrochemische herstellung sterisch gehinderter amine | |
| DE2739316A1 (de) | Verfahren zur herstellung von p-benzochinondiketalen | |
| DE3152459T1 (de) | Cyclohexadiene derivatives and process for their preparation | |
| DE2855508A1 (de) | Verfahren zur herstellung von benzaldehyden | |
| DE3725481C2 (enExample) | ||
| WO2008145627A1 (de) | Elektrochemische oxidation an allylgruppen | |
| EP0087585A1 (de) | Verfahren zur Herstellung von 3-Alkoxi-acrylnitrilen | |
| DE848501C (de) | Verfahren zur Herstellung von 2, 5-substituierten 2, 5-Dihydrofuranderivaten | |
| DE2443142C2 (de) | Verfahren zur Herstellung von Cyclopropancarbonsäurenitril | |
| DE2547383A1 (de) | Verfahren zur herstellung von p-benzochinondiketalen | |
| DE3048992A1 (de) | 4,4'-diphenylether-dialdehyd-bis-dimethylacetal und ein verfahren zu seiner herstellung | |
| EP2534281B1 (de) | Verfahren zur herstellung von 4-isopropylcyclohexylmethanol | |
| DE2737299C2 (de) | Verfahren zur Gewinnung von reinem 3-Phenoxybenzaldehyd | |
| EP0003052B1 (de) | Verfahren zur Herstellung von 4-Methyl-5-chlormethylimidazol | |
| DE2331712A1 (de) | Verfahren zur herstellung von 2methoxy-3,6-dichlorbenzoesaeure | |
| US4429164A (en) | Cyclohexadiene derivatives and process for preparing the same | |
| WO2004085710A2 (de) | Verfahren zur anodischen alkoxylierung von organischen substraten | |
| EP0053261B1 (de) | Verfahren zur Herstellung eines Gemisches von Ketalen des Trimethyl-p-benzochinons | |
| EP0237769B1 (de) | Benzaldehyd-dialkylacetale | |
| CH622761A5 (enExample) | ||
| JPS6130648B2 (enExample) | ||
| DE2709995A1 (de) | Verfahren zur herstellung von omega,omega -dialkoxycarbonsaeurederivaten | |
| DE961538C (de) | Verfahren zur Herstellung neuer Abkoemmlinge von 1-Alkyl-4-phenyl-piperidyl-(4)-alkyl-ketonen |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| D2 | Grant after examination | ||
| 8364 | No opposition during term of opposition |