DE3106892A1 - Leuchtstofflampenanordnung und verfahren zum herstellen derselben - Google Patents
Leuchtstofflampenanordnung und verfahren zum herstellen derselbenInfo
- Publication number
- DE3106892A1 DE3106892A1 DE19813106892 DE3106892A DE3106892A1 DE 3106892 A1 DE3106892 A1 DE 3106892A1 DE 19813106892 DE19813106892 DE 19813106892 DE 3106892 A DE3106892 A DE 3106892A DE 3106892 A1 DE3106892 A1 DE 3106892A1
- Authority
- DE
- Germany
- Prior art keywords
- lamp
- fluorescent lamp
- shaped
- arrangement according
- plane
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Withdrawn
Links
- 238000004519 manufacturing process Methods 0.000 title claims description 3
- 238000000034 method Methods 0.000 claims description 7
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 claims description 5
- 239000003990 capacitor Substances 0.000 claims description 3
- 239000011248 coating agent Substances 0.000 claims description 2
- 238000000576 coating method Methods 0.000 claims description 2
- 239000011521 glass Substances 0.000 claims description 2
- 230000027455 binding Effects 0.000 claims 1
- 238000009739 binding Methods 0.000 claims 1
- 238000005452 bending Methods 0.000 description 6
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 4
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 description 3
- 230000005855 radiation Effects 0.000 description 3
- 229910052786 argon Inorganic materials 0.000 description 2
- 238000010586 diagram Methods 0.000 description 2
- 238000005516 engineering process Methods 0.000 description 2
- 239000007789 gas Substances 0.000 description 2
- 229910052698 phosphorus Inorganic materials 0.000 description 2
- 239000011574 phosphorus Substances 0.000 description 2
- 238000007493 shaping process Methods 0.000 description 2
- BQCADISMDOOEFD-UHFFFAOYSA-N Silver Chemical compound [Ag] BQCADISMDOOEFD-UHFFFAOYSA-N 0.000 description 1
- LYKJEJVAXSGWAJ-UHFFFAOYSA-N compactone Natural products CC1(C)CCCC2(C)C1CC(=O)C3(O)CC(C)(CCC23)C=C LYKJEJVAXSGWAJ-UHFFFAOYSA-N 0.000 description 1
- 238000010276 construction Methods 0.000 description 1
- 239000012777 electrically insulating material Substances 0.000 description 1
- 238000005265 energy consumption Methods 0.000 description 1
- 239000011261 inert gas Substances 0.000 description 1
- 229910052743 krypton Inorganic materials 0.000 description 1
- DNNSSWSSYDEUBZ-UHFFFAOYSA-N krypton atom Chemical compound [Kr] DNNSSWSSYDEUBZ-UHFFFAOYSA-N 0.000 description 1
- 229910052753 mercury Inorganic materials 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 229910052709 silver Inorganic materials 0.000 description 1
- 239000004332 silver Substances 0.000 description 1
Classifications
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01J—ELECTRIC DISCHARGE TUBES OR DISCHARGE LAMPS
- H01J61/00—Gas-discharge or vapour-discharge lamps
- H01J61/02—Details
- H01J61/56—One or more circuit elements structurally associated with the lamp
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01J—ELECTRIC DISCHARGE TUBES OR DISCHARGE LAMPS
- H01J5/00—Details relating to vessels or to leading-in conductors common to two or more basic types of discharge tubes or lamps
- H01J5/50—Means forming part of the tube or lamps for the purpose of providing electrical connection to it
-
- Y—GENERAL TAGGING OF NEW TECHNOLOGICAL DEVELOPMENTS; GENERAL TAGGING OF CROSS-SECTIONAL TECHNOLOGIES SPANNING OVER SEVERAL SECTIONS OF THE IPC; TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y02—TECHNOLOGIES OR APPLICATIONS FOR MITIGATION OR ADAPTATION AGAINST CLIMATE CHANGE
- Y02B—CLIMATE CHANGE MITIGATION TECHNOLOGIES RELATED TO BUILDINGS, e.g. HOUSING, HOUSE APPLIANCES OR RELATED END-USER APPLICATIONS
- Y02B20/00—Energy efficient lighting technologies, e.g. halogen lamps or gas discharge lamps
Landscapes
- Vessels And Coating Films For Discharge Lamps (AREA)
- Fastening Of Light Sources Or Lamp Holders (AREA)
- Arrangement Of Elements, Cooling, Sealing, Or The Like Of Lighting Devices (AREA)
- Discharge Lamps And Accessories Thereof (AREA)
- Non-Portable Lighting Devices Or Systems Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US06/126,818 US4347460A (en) | 1980-03-03 | 1980-03-03 | Compact fluorescent lamp assembly |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE3106892A1 true DE3106892A1 (de) | 1982-01-07 |
Family
ID=22426854
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19813106892 Withdrawn DE3106892A1 (de) | 1980-03-03 | 1981-02-24 | Leuchtstofflampenanordnung und verfahren zum herstellen derselben |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US4347460A (enExample) |
| JP (1) | JPS6140007Y2 (enExample) |
| CA (1) | CA1144976A (enExample) |
| DE (1) | DE3106892A1 (enExample) |
| FR (1) | FR2477318A1 (enExample) |
| GB (1) | GB2070854B (enExample) |
| NL (1) | NL8100995A (enExample) |
Cited By (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3141854A1 (de) * | 1980-10-29 | 1982-06-16 | Naamloze Vennootschap Philips' Gloeilampenfabrieken, 5621 Eindhoven | Niederdruckquecksilberdampfentladungslampe |
| DE3601725A1 (de) * | 1985-10-12 | 1987-04-16 | Andreas Heymann | Netzbetriebenes, schnellstartendes leuchtstofflampensystem |
| DE3638507A1 (de) * | 1986-11-11 | 1988-05-19 | Ceag Licht & Strom | Explosions- bzw. schlagwettergeschuetzte leuchtstofflampe |
| DE3644140A1 (de) * | 1986-12-23 | 1988-07-07 | Ceag Licht & Strom | Explosions- oder schlagwettergeschuetzte leuchte |
| DE4133077A1 (de) * | 1991-10-02 | 1993-04-15 | Narva Gluehlampen | Niederdruckgasentladungslampe |
| DE29500790U1 (de) * | 1995-01-19 | 1995-04-06 | Piruzram, Mansur, 95180 Berg | Energiesparlampe |
| DE4433806A1 (de) * | 1994-09-22 | 1996-03-28 | Holzer Walter | Spiralförmiges Gasentladungsgefäß für Leuchtstofflampen |
| DE19505476A1 (de) * | 1995-02-17 | 1996-08-22 | Walter Holzer | Kompaktleuchtstofflampe in Adapterausführung |
| DE19515380A1 (de) * | 1995-05-02 | 1996-11-07 | Walter Holzer | Gasentladungslampe |
Families Citing this family (61)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS5719959A (en) * | 1980-07-11 | 1982-02-02 | Toshiba Corp | Fluorescent lamp device |
| US4456854A (en) * | 1980-07-15 | 1984-06-26 | Tokyo Shibaura Denki Kabushiki Kaisha | Compact fluorescent lamp |
| JPS5727557A (en) * | 1980-07-28 | 1982-02-13 | Toshiba Corp | Fluorescent lamp device |
| FR2536563B1 (fr) * | 1982-11-23 | 1985-07-26 | Ssih Equipment Sa | Element emetteur de lumiere a tube a decharge pour tableau d'affichage matriciel |
| US4704664A (en) * | 1983-03-25 | 1987-11-03 | Scientific Component System, Inc. | Lamp apparatus |
| US4922393A (en) * | 1983-03-25 | 1990-05-01 | Scientific Component Systems, Inc. | Lamp apparatus |
| US4520436A (en) * | 1983-03-25 | 1985-05-28 | Nrg Inc. Mn | Lamp apparatus |
| USD284757S (en) | 1983-07-07 | 1986-07-22 | Engel Herman J | Adapter base for electric lamp |
| USD284793S (en) | 1983-07-07 | 1986-07-22 | Engel Herman J | Combined fluorescent lamp and electrical adapter therefor |
| USD284652S (en) | 1983-07-07 | 1986-07-15 | Engel Herman J | Adapter base for electric lamp |
| USD285007S (en) | 1983-07-07 | 1986-08-05 | Engel Herman J | Combined fluorescent lamp and electrical adapter therefor |
| USD283504S (en) | 1983-07-11 | 1986-04-22 | Leis Harvey M | Lamp base |
| USD282062S (en) | 1983-08-01 | 1986-01-07 | Luma Lighting Industries, Inc. | Fluorescent lamp adapter |
| US4570105A (en) | 1983-09-20 | 1986-02-11 | Engel Herman J | Electrical adapter for use in connection with fluorescent lamps |
| KR850003187Y1 (ko) * | 1983-12-05 | 1985-12-24 | 신광기업주식회사 | 형광등 |
| USD287286S (en) | 1984-01-18 | 1986-12-16 | Mitsubishi Denki Kabushiki Kaisha | Fluorescent lamp |
| US4495443A (en) * | 1984-01-27 | 1985-01-22 | Cummings John H | Compact fluorescent lamp combination, and method of making it |
| USD291556S (en) | 1984-09-26 | 1987-08-25 | Engel Herman J | Adapter base for fluorescent lamp |
| USD291557S (en) | 1984-09-26 | 1987-08-25 | Engel Herman J | Adapter base for fluorescent lamp |
| USD290110S (en) | 1985-04-12 | 1987-06-02 | Gte Products Corporation | Adaptor base for fluorescent lamp or the like |
| USD291124S (en) | 1985-04-12 | 1987-07-28 | Gte Products Corporation | Fluorescent lamp or the like |
| US4624513A (en) * | 1985-04-12 | 1986-11-25 | Gte Products Corporation | Lamp holder assembly having rotatable base shell |
| US4660906A (en) * | 1985-04-12 | 1987-04-28 | Gte Products Corporation | Lamp holder assembly having rotatable base shell |
| US4654557A (en) * | 1985-04-12 | 1987-03-31 | Gte Products Corporation | Lamp holder assembly having rotatable base |
| USD290513S (en) | 1985-04-12 | 1987-06-23 | Gte Products Corporation | Fluorescent lamp |
| US4683402A (en) * | 1985-04-25 | 1987-07-28 | Truman Aubrey | Adaptors for fluorescent lamps |
| US4855635A (en) * | 1986-02-18 | 1989-08-08 | Gte Products Corporation | Fluorescent lamp unit with magnetic field generating means |
| US4754197A (en) * | 1986-10-14 | 1988-06-28 | Gte Products Corporation | Arc discharge lamp assembly simulating gaslight |
| JPS63105403A (ja) * | 1986-10-21 | 1988-05-10 | 神保電器株式会社 | 照明器具 |
| DE3638508A1 (de) * | 1986-11-11 | 1988-05-19 | Ceag Licht & Strom | Explosions- bzw. schlagwettergeschuetzte leuchtstofflampe |
| US4879494A (en) * | 1987-02-26 | 1989-11-07 | Gte Products Corporation | Fluorescent lamp starter assembly |
| US5043627A (en) * | 1988-03-01 | 1991-08-27 | Fox Leslie Z | High-frequency fluorescent lamp |
| EP0447957A3 (en) * | 1990-03-19 | 1992-04-29 | Walter Holzer | Compact fluorescent lamp |
| RU2108637C1 (ru) * | 1990-03-19 | 1998-04-10 | Сенатор х.ц.Др.х.ц.Инж. Вальтер Хольцер | Компактная люминесцентная лампа |
| DE4027783A1 (de) * | 1990-09-03 | 1992-04-30 | Holzer Walter | Gasentladungsgeraet fuer kompaktlampen |
| USRE36414E (en) * | 1992-04-03 | 1999-11-30 | Sportlite, Inc. | Lighting apparatus |
| US5390096A (en) * | 1992-10-22 | 1995-02-14 | Progressive Technology In Lighting, Inc. | Replacement compact fluorescent lamp assembly |
| WO1994029895A1 (en) * | 1993-02-24 | 1994-12-22 | Lee, Ok, Yun | Double spiral coil-type tube for fluorescent discharge lamp and bulb-type fluorescent lamp demountably having the tube |
| EP0700134B1 (de) * | 1994-08-30 | 1998-04-01 | Daniel Muessli | Stromsparlampe |
| US5739633A (en) * | 1995-08-14 | 1998-04-14 | General Electric Company | Amalgam containing compact fluorescent lamp with improved warm-up |
| US5720548A (en) * | 1995-11-14 | 1998-02-24 | Progressive Technology In Lighting, Inc. | High luminance fluorescent lamp assembly |
| US6793381B2 (en) * | 1996-04-10 | 2004-09-21 | Bji Energy Solutions, Llc | CCFL illuminated device and method of use |
| US20050184667A1 (en) * | 1996-04-10 | 2005-08-25 | Sturman Bruce D. | CCFL illuminated device and method of use |
| US5731659A (en) * | 1996-05-13 | 1998-03-24 | General Electric Company | Fluorescent lamp with phosphor coating of multiple layers |
| US5852344A (en) * | 1996-07-26 | 1998-12-22 | Magnetek, Inc. | Enclosure for glow bulb starter used with gas discharge lamps |
| GB2359659A (en) * | 2000-02-28 | 2001-08-29 | William Alan Glasson | Separate enclosure fluorescent lighting fitting |
| RU2195744C2 (ru) * | 2000-04-07 | 2002-12-27 | Государственное предприятие "Особое конструкторское бюро "МЭЛЗ" | Малогабаритная люминесцентная лампа |
| US20040208799A1 (en) * | 2003-04-21 | 2004-10-21 | Steril-Aire Usa, Inc. | Germicidal lamp assembly |
| US20040213703A1 (en) * | 2003-04-24 | 2004-10-28 | Steril-Aire Usa, Inc. | Multi-lamp germicidal treatment system with interlock |
| US7459694B2 (en) * | 2005-06-21 | 2008-12-02 | Steril-Aire, Inc. | Mobile germicidal system |
| US7597575B2 (en) * | 2005-09-13 | 2009-10-06 | Leviton Manufacturing Co., Inc. | Fluorescent lampholder |
| US7513646B2 (en) * | 2007-02-16 | 2009-04-07 | Jji Lighting Group, Inc. | Luminaire optical system |
| GB2457436A (en) * | 2008-02-08 | 2009-08-19 | Anthony James Doyle | Detachably mounting fluorescent tube lighting apparatus |
| US8113684B2 (en) * | 2008-07-15 | 2012-02-14 | Leviton Manufacturing Co., Inc. | Fluorescent lamp support |
| US20110164414A1 (en) * | 2008-07-15 | 2011-07-07 | Robert Quercia | Fluorescent lamp support |
| US20100265700A1 (en) * | 2008-07-15 | 2010-10-21 | Leviton Manufacturing Corporation | Flourescent lamp support |
| US20100081339A1 (en) * | 2008-10-01 | 2010-04-01 | Leviton Manufacturing Company, Inc. | Lamp socket having a rotor assembly |
| US8333602B2 (en) | 2011-01-06 | 2012-12-18 | Leviton Manufacturing Co., Inc. | Lamp socket having a rotor |
| US8444426B1 (en) * | 2012-01-06 | 2013-05-21 | Proconn Technology Co., Ltd. | Lamp holder connector |
| USD715220S1 (en) * | 2014-01-22 | 2014-10-14 | Westport International Co., Ltd. | Adapter for tracklight |
| USD715221S1 (en) * | 2014-01-22 | 2014-10-14 | Westport International Co., Ltd. | Adapter for tracklight |
Citations (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2366252A (en) * | 1941-10-18 | 1945-01-02 | Gen Electric | Circular electric lamp |
| DE1611961U (de) * | 1950-07-01 | 1950-08-17 | Fritz Zoerner | Leuchtstoffspiralroehre mit schraubfassung fuer jede lampenfassung. |
| DE1868390U (de) * | 1962-10-11 | 1963-03-07 | Schanzenbach & Co Gmbh | Explosionsgeschutzte leuchte mit u-foermiger leuchtstofflampe. |
| US4173730A (en) * | 1978-07-11 | 1979-11-06 | Westinghouse Electric Corp. | Compact fluorescent lamp unit having integral circuit means for DC operation |
Family Cites Families (20)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2349255A (en) * | 1941-11-10 | 1944-05-23 | Epstein Hirsch | Glow discharge tubing and means for mounting the same |
| US2278079A (en) * | 1941-11-18 | 1942-03-31 | Bruce A Coffin | Lag voltage controller and discharge lamp circuit |
| US2298961A (en) * | 1941-11-22 | 1942-10-13 | Earl F Miller | Fluorescent lamp |
| US3551736A (en) * | 1968-04-02 | 1970-12-29 | Gunther Anthony Doehner | Fluorescent lamps constructed for use in conventional light fixtures |
| US3568132A (en) * | 1968-11-13 | 1971-03-02 | Leviton Manufacturing Co | Self-adjusting lampholder for u-shaped fluorescent lamp |
| NL7017065A (enExample) * | 1970-11-21 | 1972-05-24 | ||
| US3752977A (en) * | 1972-04-20 | 1973-08-14 | Sola Basic Ind Inc | Adjustable fluorescent lamp mounting means |
| JPS4928295A (enExample) * | 1972-07-08 | 1974-03-13 | ||
| JPS535038B2 (enExample) * | 1972-07-11 | 1978-02-23 | ||
| US3914646A (en) * | 1974-06-17 | 1975-10-21 | Philips Corp | Starter for an electric discharge lamp |
| JPS5410590A (en) * | 1977-06-27 | 1979-01-26 | Moriyama Sangyo Kk | Illuminator |
| NL7709266A (nl) * | 1977-08-23 | 1979-02-27 | Koninkl Philips Electronics Nv | Lagedrukkwikdampontladingslamp. |
| NL7812539A (nl) * | 1978-02-14 | 1979-08-16 | Philips Nv | Lagedrukkwikdampontladingslamp. |
| JPS54155675A (en) * | 1978-05-30 | 1979-12-07 | Matsushita Electronics Corp | Small-sized fluorescent lamp |
| JPS54161766A (en) * | 1978-06-09 | 1979-12-21 | Matsushita Electronics Corp | Base for bulb or tube |
| JPS54182578U (enExample) * | 1978-06-15 | 1979-12-24 | ||
| JPS5520135U (enExample) * | 1978-07-26 | 1980-02-08 | ||
| US4300073A (en) * | 1979-02-13 | 1981-11-10 | Westinghouse Electric Corp. | Screw-in type lighting unit having a convoluted tridimensional fluorescent lamp |
| US4278911A (en) * | 1979-06-13 | 1981-07-14 | General Electric Company | Circular fluorescent lamp unit |
| US4258287A (en) * | 1979-06-13 | 1981-03-24 | General Electric Company | Circular fluorescent lamp unit |
-
1980
- 1980-03-03 US US06/126,818 patent/US4347460A/en not_active Expired - Lifetime
-
1981
- 1981-02-24 DE DE19813106892 patent/DE3106892A1/de not_active Withdrawn
- 1981-02-26 CA CA000371832A patent/CA1144976A/en not_active Expired
- 1981-03-02 GB GB8106496A patent/GB2070854B/en not_active Expired
- 1981-03-02 NL NL8100995A patent/NL8100995A/nl not_active Application Discontinuation
- 1981-03-02 FR FR8104115A patent/FR2477318A1/fr active Granted
- 1981-03-03 JP JP1981030233U patent/JPS6140007Y2/ja not_active Expired
Patent Citations (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2366252A (en) * | 1941-10-18 | 1945-01-02 | Gen Electric | Circular electric lamp |
| DE1611961U (de) * | 1950-07-01 | 1950-08-17 | Fritz Zoerner | Leuchtstoffspiralroehre mit schraubfassung fuer jede lampenfassung. |
| DE1868390U (de) * | 1962-10-11 | 1963-03-07 | Schanzenbach & Co Gmbh | Explosionsgeschutzte leuchte mit u-foermiger leuchtstofflampe. |
| US4173730A (en) * | 1978-07-11 | 1979-11-06 | Westinghouse Electric Corp. | Compact fluorescent lamp unit having integral circuit means for DC operation |
Cited By (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3141854A1 (de) * | 1980-10-29 | 1982-06-16 | Naamloze Vennootschap Philips' Gloeilampenfabrieken, 5621 Eindhoven | Niederdruckquecksilberdampfentladungslampe |
| DE3601725A1 (de) * | 1985-10-12 | 1987-04-16 | Andreas Heymann | Netzbetriebenes, schnellstartendes leuchtstofflampensystem |
| DE3638507A1 (de) * | 1986-11-11 | 1988-05-19 | Ceag Licht & Strom | Explosions- bzw. schlagwettergeschuetzte leuchtstofflampe |
| DE3644140A1 (de) * | 1986-12-23 | 1988-07-07 | Ceag Licht & Strom | Explosions- oder schlagwettergeschuetzte leuchte |
| DE4133077A1 (de) * | 1991-10-02 | 1993-04-15 | Narva Gluehlampen | Niederdruckgasentladungslampe |
| DE4433806A1 (de) * | 1994-09-22 | 1996-03-28 | Holzer Walter | Spiralförmiges Gasentladungsgefäß für Leuchtstofflampen |
| DE29500790U1 (de) * | 1995-01-19 | 1995-04-06 | Piruzram, Mansur, 95180 Berg | Energiesparlampe |
| DE19505476A1 (de) * | 1995-02-17 | 1996-08-22 | Walter Holzer | Kompaktleuchtstofflampe in Adapterausführung |
| DE19515380A1 (de) * | 1995-05-02 | 1996-11-07 | Walter Holzer | Gasentladungslampe |
Also Published As
| Publication number | Publication date |
|---|---|
| GB2070854A (en) | 1981-09-09 |
| FR2477318B3 (enExample) | 1983-01-14 |
| US4347460A (en) | 1982-08-31 |
| CA1144976A (en) | 1983-04-19 |
| NL8100995A (nl) | 1981-10-01 |
| JPS6140007Y2 (enExample) | 1986-11-15 |
| JPS56153006U (enExample) | 1981-11-16 |
| GB2070854B (en) | 1984-08-08 |
| FR2477318A1 (fr) | 1981-09-04 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE3106892A1 (de) | Leuchtstofflampenanordnung und verfahren zum herstellen derselben | |
| DE3121077C2 (enExample) | ||
| DE69820992T2 (de) | Hochdruckentladungslampe | |
| DE3425931C2 (enExample) | ||
| DE68915022T2 (de) | Entladungslampe. | |
| EP0393449B1 (de) | Leuchtstofflampe | |
| DE2725412C2 (de) | Leuchtstofflampe | |
| DE2845890B2 (de) | Quecksilber-Edelgas-Entladungslampe | |
| DE2264005B2 (de) | Gasentladungsröhre | |
| DE68915506T2 (de) | Hochdrucknatriumentladungslampe. | |
| DE2422576A1 (de) | Entladungslampe | |
| DE3723435C2 (enExample) | ||
| DE2118828A1 (de) | Hochdruck-Natriumdampf-Entladungslampe | |
| DE1287214B (de) | Leuchtstofflampe und Verfahren zu ihrer Herstellung | |
| DE3110818A1 (de) | Bogenentladungslampe | |
| DE10133326A1 (de) | Dielektrische Barrieren-Entladungslampe mit Zündhilfe | |
| DE2729052A1 (de) | Verfahren zum betreiben von gasentladungslampen | |
| EP0118100B1 (de) | Einseitig gesockelte Niederdruckentladungslampe | |
| DE3119223C2 (de) | Entladungslampenvorrichtung | |
| DE3632430A1 (de) | Magnesiumdampf-entladungslampe | |
| DE1044274B (de) | Niederdruck-Gasentladungslampe | |
| DE3233000A1 (de) | Lampenanordnung mit einer einseitig gesockelten leuchtstofflampe | |
| DE612050C (de) | Schaltung in elektrischen Gasentladungslampen mit Elektroden, von denen mindestens eine als indirket beheizte Gluehelektrode ausgebildet ist | |
| DE2722694A1 (de) | Quecksilberdampf-niederdruckentladungslampe | |
| DE29814795U1 (de) | Piezoelektrische Porzellan-Verstärker-Entladungsröhre |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8110 | Request for examination paragraph 44 | ||
| 8128 | New person/name/address of the agent |
Representative=s name: LEMKE, J., DIPL.-ING., PAT.-ANW., 8900 AUGSBURG |
|
| 8130 | Withdrawal |