DE3011040C2 - - Google Patents
Info
- Publication number
- DE3011040C2 DE3011040C2 DE3011040A DE3011040A DE3011040C2 DE 3011040 C2 DE3011040 C2 DE 3011040C2 DE 3011040 A DE3011040 A DE 3011040A DE 3011040 A DE3011040 A DE 3011040A DE 3011040 C2 DE3011040 C2 DE 3011040C2
- Authority
- DE
- Germany
- Prior art keywords
- insulating liquid
- flame retardant
- liquid according
- retardant insulating
- chlorobenzene
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000000203 mixture Substances 0.000 claims description 66
- 239000007788 liquid Substances 0.000 claims description 53
- PBKONEOXTCPAFI-UHFFFAOYSA-N 1,2,4-trichlorobenzene Chemical compound ClC1=CC=C(Cl)C(Cl)=C1 PBKONEOXTCPAFI-UHFFFAOYSA-N 0.000 claims description 28
- RNFJDJUURJAICM-UHFFFAOYSA-N 2,2,4,4,6,6-hexaphenoxy-1,3,5-triaza-2$l^{5},4$l^{5},6$l^{5}-triphosphacyclohexa-1,3,5-triene Chemical compound N=1P(OC=2C=CC=CC=2)(OC=2C=CC=CC=2)=NP(OC=2C=CC=CC=2)(OC=2C=CC=CC=2)=NP=1(OC=1C=CC=CC=1)OC1=CC=CC=C1 RNFJDJUURJAICM-UHFFFAOYSA-N 0.000 claims description 26
- 239000003063 flame retardant Substances 0.000 claims description 26
- GBDZXPJXOMHESU-UHFFFAOYSA-N 1,2,3,4-tetrachlorobenzene Chemical compound ClC1=CC=C(Cl)C(Cl)=C1Cl GBDZXPJXOMHESU-UHFFFAOYSA-N 0.000 claims description 20
- RFFLAFLAYFXFSW-UHFFFAOYSA-N 1,2-dichlorobenzene Chemical compound ClC1=CC=CC=C1Cl RFFLAFLAYFXFSW-UHFFFAOYSA-N 0.000 claims description 17
- 239000003085 diluting agent Substances 0.000 claims description 16
- RELMFMZEBKVZJC-UHFFFAOYSA-N 1,2,3-trichlorobenzene Chemical compound ClC1=CC=CC(Cl)=C1Cl RELMFMZEBKVZJC-UHFFFAOYSA-N 0.000 claims description 15
- QBELEDRHMPMKHP-UHFFFAOYSA-N 1-bromo-2-chlorobenzene Chemical compound ClC1=CC=CC=C1Br QBELEDRHMPMKHP-UHFFFAOYSA-N 0.000 claims description 13
- 235000010290 biphenyl Nutrition 0.000 claims description 12
- 150000001911 terphenyls Chemical class 0.000 claims description 12
- 210000002196 fr. b Anatomy 0.000 claims description 10
- ZUOUZKKEUPVFJK-UHFFFAOYSA-N phenylbenzene Natural products C1=CC=CC=C1C1=CC=CC=C1 ZUOUZKKEUPVFJK-UHFFFAOYSA-N 0.000 claims description 10
- OCJBOOLMMGQPQU-UHFFFAOYSA-N 1,4-dichlorobenzene Chemical compound ClC1=CC=C(Cl)C=C1 OCJBOOLMMGQPQU-UHFFFAOYSA-N 0.000 claims description 9
- 238000005984 hydrogenation reaction Methods 0.000 claims description 9
- 230000029936 alkylation Effects 0.000 claims description 8
- 238000005804 alkylation reaction Methods 0.000 claims description 8
- NHDODQWIKUYWMW-UHFFFAOYSA-N 1-bromo-4-chlorobenzene Chemical compound ClC1=CC=C(Br)C=C1 NHDODQWIKUYWMW-UHFFFAOYSA-N 0.000 claims description 7
- 239000004305 biphenyl Substances 0.000 claims description 7
- BJQHLKABXJIVAM-UHFFFAOYSA-N bis(2-ethylhexyl) phthalate Chemical compound CCCCC(CC)COC(=O)C1=CC=CC=C1C(=O)OCC(CC)CCCC BJQHLKABXJIVAM-UHFFFAOYSA-N 0.000 claims description 7
- 125000004432 carbon atom Chemical group C* 0.000 claims description 7
- 239000000374 eutectic mixture Substances 0.000 claims description 7
- YJTKZCDBKVTVBY-UHFFFAOYSA-N 1,3-Diphenylbenzene Chemical group C1=CC=CC=C1C1=CC=CC(C=2C=CC=CC=2)=C1 YJTKZCDBKVTVBY-UHFFFAOYSA-N 0.000 claims description 6
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 claims description 6
- 125000006836 terphenylene group Chemical group 0.000 claims description 6
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 5
- 125000000217 alkyl group Chemical group 0.000 claims description 5
- 125000006267 biphenyl group Chemical group 0.000 claims description 5
- 229910052739 hydrogen Inorganic materials 0.000 claims description 5
- 239000001257 hydrogen Substances 0.000 claims description 5
- 239000003921 oil Substances 0.000 claims description 5
- ZPQOPVIELGIULI-UHFFFAOYSA-N 1,3-dichlorobenzene Chemical compound ClC1=CC=CC(Cl)=C1 ZPQOPVIELGIULI-UHFFFAOYSA-N 0.000 claims description 4
- JRGGUPZKKTVKOV-UHFFFAOYSA-N 1-bromo-3-chlorobenzene Chemical compound ClC1=CC=CC(Br)=C1 JRGGUPZKKTVKOV-UHFFFAOYSA-N 0.000 claims description 4
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 claims description 4
- 125000001931 aliphatic group Chemical group 0.000 claims description 3
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 3
- 210000003918 fraction a Anatomy 0.000 claims description 3
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 claims description 3
- BDMRCAWYRXJKLK-UHFFFAOYSA-N 1,2-dibromo-3-chlorobenzene Chemical compound ClC1=CC=CC(Br)=C1Br BDMRCAWYRXJKLK-UHFFFAOYSA-N 0.000 claims description 2
- MTMKNVKLWIJHFL-UHFFFAOYSA-N 1,2-dibromo-4-chlorobenzene Chemical compound ClC1=CC=C(Br)C(Br)=C1 MTMKNVKLWIJHFL-UHFFFAOYSA-N 0.000 claims description 2
- IRPWVEBIMPXCAZ-UHFFFAOYSA-N 1,3-dibromo-2-chlorobenzene Chemical compound ClC1=C(Br)C=CC=C1Br IRPWVEBIMPXCAZ-UHFFFAOYSA-N 0.000 claims description 2
- FNKCOUREFBNNHG-UHFFFAOYSA-N 1,3-dibromo-5-chlorobenzene Chemical compound ClC1=CC(Br)=CC(Br)=C1 FNKCOUREFBNNHG-UHFFFAOYSA-N 0.000 claims description 2
- UWOIDOQAQPUVOH-UHFFFAOYSA-N 2-bromo-1,3-dichlorobenzene Chemical compound ClC1=CC=CC(Cl)=C1Br UWOIDOQAQPUVOH-UHFFFAOYSA-N 0.000 claims description 2
- 125000004429 atom Chemical group 0.000 claims description 2
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 claims description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 2
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 claims description 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 2
- 150000003021 phthalic acid derivatives Chemical class 0.000 claims description 2
- 229920001083 polybutene Polymers 0.000 claims description 2
- 229940117389 dichlorobenzene Drugs 0.000 claims 3
- 239000003337 fertilizer Substances 0.000 claims 2
- 229930195733 hydrocarbon Natural products 0.000 claims 2
- 150000002430 hydrocarbons Chemical class 0.000 claims 2
- XNGIFLGASWRNHJ-UHFFFAOYSA-L phthalate(2-) Chemical compound [O-]C(=O)C1=CC=CC=C1C([O-])=O XNGIFLGASWRNHJ-UHFFFAOYSA-L 0.000 claims 2
- 239000005662 Paraffin oil Substances 0.000 claims 1
- CODNYICXDISAEA-UHFFFAOYSA-N bromine monochloride Chemical compound BrCl CODNYICXDISAEA-UHFFFAOYSA-N 0.000 claims 1
- 238000000034 method Methods 0.000 claims 1
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 claims 1
- -1 aromatic chlorinated hydrocarbons Chemical class 0.000 description 15
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 12
- 239000003989 dielectric material Substances 0.000 description 11
- 239000000047 product Substances 0.000 description 10
- 150000004816 dichlorobenzenes Chemical class 0.000 description 7
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 6
- 238000002425 crystallisation Methods 0.000 description 6
- 230000008025 crystallization Effects 0.000 description 6
- 150000001875 compounds Chemical class 0.000 description 5
- 150000005671 trienes Chemical class 0.000 description 5
- 150000008422 chlorobenzenes Chemical class 0.000 description 3
- 238000000354 decomposition reaction Methods 0.000 description 3
- OIAQMFOKAXHPNH-UHFFFAOYSA-N 1,2-diphenylbenzene Chemical group C1=CC=CC=C1C1=CC=CC=C1C1=CC=CC=C1 OIAQMFOKAXHPNH-UHFFFAOYSA-N 0.000 description 2
- 150000004821 1,3-dichlorobenzenes Chemical class 0.000 description 2
- XJKSTNDFUHDPQJ-UHFFFAOYSA-N 1,4-diphenylbenzene Chemical group C1=CC=CC=C1C1=CC=C(C=2C=CC=CC=2)C=C1 XJKSTNDFUHDPQJ-UHFFFAOYSA-N 0.000 description 2
- 239000004593 Epoxy Substances 0.000 description 2
- RWNKSTSCBHKHTB-UHFFFAOYSA-N Hexachloro-1,3-butadiene Chemical compound ClC(Cl)=C(Cl)C(Cl)=C(Cl)Cl RWNKSTSCBHKHTB-UHFFFAOYSA-N 0.000 description 2
- 150000004996 alkyl benzenes Chemical class 0.000 description 2
- 150000001350 alkyl halides Chemical class 0.000 description 2
- 125000003118 aryl group Chemical group 0.000 description 2
- 239000003990 capacitor Substances 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- 125000001309 chloro group Chemical group Cl* 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- DOIRQSBPFJWKBE-UHFFFAOYSA-N dibutyl phthalate Chemical compound CCCCOC(=O)C1=CC=CC=C1C(=O)OCCCC DOIRQSBPFJWKBE-UHFFFAOYSA-N 0.000 description 2
- MQHNKCZKNAJROC-UHFFFAOYSA-N dipropyl phthalate Chemical compound CCCOC(=O)C1=CC=CC=C1C(=O)OCCC MQHNKCZKNAJROC-UHFFFAOYSA-N 0.000 description 2
- 150000002148 esters Chemical class 0.000 description 2
- 239000007789 gas Substances 0.000 description 2
- 125000005843 halogen group Chemical group 0.000 description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 2
- 125000000740 n-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- 125000005498 phthalate group Chemical class 0.000 description 2
- 239000003352 sequestering agent Substances 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- XLWCIHPMASUXPI-UHFFFAOYSA-N 1,1'-(propane-1,2-diyl)dibenzene Chemical compound C=1C=CC=CC=1C(C)CC1=CC=CC=C1 XLWCIHPMASUXPI-UHFFFAOYSA-N 0.000 description 1
- QTKIQLNGOKOPOE-UHFFFAOYSA-N 1,1'-biphenyl;propane Chemical group CCC.C1=CC=CC=C1C1=CC=CC=C1 QTKIQLNGOKOPOE-UHFFFAOYSA-N 0.000 description 1
- 150000004818 1,2-dichlorobenzenes Chemical class 0.000 description 1
- QWUWMCYKGHVNAV-UHFFFAOYSA-N 1,2-dihydrostilbene Chemical compound C=1C=CC=CC=1CCC1=CC=CC=C1 QWUWMCYKGHVNAV-UHFFFAOYSA-N 0.000 description 1
- SVNDLFBDMWWQIM-UHFFFAOYSA-N 1,3,5-tritert-butyl-2-phenylbenzene Chemical group CC(C)(C)C1=CC(C(C)(C)C)=CC(C(C)(C)C)=C1C1=CC=CC=C1 SVNDLFBDMWWQIM-UHFFFAOYSA-N 0.000 description 1
- WWWOOGRNVFNGSO-UHFFFAOYSA-N 1,3-bis(4-ethylphenyl)benzene Chemical group C1=CC(CC)=CC=C1C1=CC=CC(C=2C=CC(CC)=CC=2)=C1 WWWOOGRNVFNGSO-UHFFFAOYSA-N 0.000 description 1
- 150000004822 1,4-dichlorobenzenes Chemical class 0.000 description 1
- WCAAXQAPVWGQIZ-UHFFFAOYSA-N 1-(3-phenylphenyl)-2,3,4-tri(propan-2-yl)benzene Chemical group CC(C)C1=C(C(C)C)C(C(C)C)=CC=C1C1=CC=CC(C=2C=CC=CC=2)=C1 WCAAXQAPVWGQIZ-UHFFFAOYSA-N 0.000 description 1
- OFUQWBZSKSLMJX-UHFFFAOYSA-N 1-(3-phenylphenyl)-2,3-di(propan-2-yl)benzene Chemical group CC(C)C1=CC=CC(C=2C=C(C=CC=2)C=2C=CC=CC=2)=C1C(C)C OFUQWBZSKSLMJX-UHFFFAOYSA-N 0.000 description 1
- KJSIZEXXLJSLSJ-UHFFFAOYSA-N 1-(4-phenylphenyl)-2,3,4-tri(propan-2-yl)benzene Chemical group CC(C)C1=C(C(C)C)C(C(C)C)=CC=C1C1=CC=C(C=2C=CC=CC=2)C=C1 KJSIZEXXLJSLSJ-UHFFFAOYSA-N 0.000 description 1
- HVKCZUVMQPUWSX-UHFFFAOYSA-N 1-bromo-2,3-dichlorobenzene Chemical class ClC1=CC=CC(Br)=C1Cl HVKCZUVMQPUWSX-UHFFFAOYSA-N 0.000 description 1
- ISHYFWKKWKXXPL-UHFFFAOYSA-N 1-bromo-2,4-dichlorobenzene Chemical compound ClC1=CC=C(Br)C(Cl)=C1 ISHYFWKKWKXXPL-UHFFFAOYSA-N 0.000 description 1
- DZHFFMWJXJBBRG-UHFFFAOYSA-N 1-bromo-3,5-dichlorobenzene Chemical compound ClC1=CC(Cl)=CC(Br)=C1 DZHFFMWJXJBBRG-UHFFFAOYSA-N 0.000 description 1
- XRJACSVNXOPVSM-UHFFFAOYSA-N 1-butyl-2,4-diphenylbenzene Chemical group CCCCC1=CC=C(C=2C=CC=CC=2)C=C1C1=CC=CC=C1 XRJACSVNXOPVSM-UHFFFAOYSA-N 0.000 description 1
- RMSGQZDGSZOJMU-UHFFFAOYSA-N 1-butyl-2-phenylbenzene Chemical group CCCCC1=CC=CC=C1C1=CC=CC=C1 RMSGQZDGSZOJMU-UHFFFAOYSA-N 0.000 description 1
- VXPNMCXWGITZEG-UHFFFAOYSA-N 1-butyl-4-(2-phenylphenyl)benzene Chemical group C(CCC)C1=CC=C(C=C1)C=1C(=CC=CC=1)C1=CC=CC=C1 VXPNMCXWGITZEG-UHFFFAOYSA-N 0.000 description 1
- SVNCWYGQVOXZNH-UHFFFAOYSA-N 1-butyl-4-(4-butyl-4-phenylcyclohexa-1,5-dien-1-yl)benzene Chemical group C(CCC)C1=CC=C(C=C1)C1=CCC(C=C1)(C1=CC=CC=C1)CCCC SVNCWYGQVOXZNH-UHFFFAOYSA-N 0.000 description 1
- DLMYHUARHITGIJ-UHFFFAOYSA-N 1-ethyl-2-phenylbenzene Chemical group CCC1=CC=CC=C1C1=CC=CC=C1 DLMYHUARHITGIJ-UHFFFAOYSA-N 0.000 description 1
- UMSGIWAAMHRVQI-UHFFFAOYSA-N 1-ethyl-4-(4-ethylphenyl)benzene Chemical group C1=CC(CC)=CC=C1C1=CC=C(CC)C=C1 UMSGIWAAMHRVQI-UHFFFAOYSA-N 0.000 description 1
- SRQOBNUBCLPPPH-UHFFFAOYSA-N 1-ethyl-4-phenylbenzene Chemical group C1=CC(CC)=CC=C1C1=CC=CC=C1 SRQOBNUBCLPPPH-UHFFFAOYSA-N 0.000 description 1
- PKIPFTRLYALSMP-UHFFFAOYSA-N 1-phenyl-2-(2-propan-2-ylphenyl)benzene Chemical group CC(C)C1=CC=CC=C1C1=CC=CC=C1C1=CC=CC=C1 PKIPFTRLYALSMP-UHFFFAOYSA-N 0.000 description 1
- DHGLJZBRWQXIKR-UHFFFAOYSA-N 1-phenyl-2-(4-propan-2-ylphenyl)benzene Chemical group C1=CC(C(C)C)=CC=C1C1=CC=CC=C1C1=CC=CC=C1 DHGLJZBRWQXIKR-UHFFFAOYSA-N 0.000 description 1
- ZZRGDSMZKOGYPC-UHFFFAOYSA-N 1-phenyl-2-propylbenzene Chemical group CCCC1=CC=CC=C1C1=CC=CC=C1 ZZRGDSMZKOGYPC-UHFFFAOYSA-N 0.000 description 1
- KWSHGRJUSUJPQD-UHFFFAOYSA-N 1-phenyl-4-propan-2-ylbenzene Chemical group C1=CC(C(C)C)=CC=C1C1=CC=CC=C1 KWSHGRJUSUJPQD-UHFFFAOYSA-N 0.000 description 1
- NAYIXKXYHOLMRC-UHFFFAOYSA-N 1-phenyl-4-propylbenzene Chemical group C1=CC(CCC)=CC=C1C1=CC=CC=C1 NAYIXKXYHOLMRC-UHFFFAOYSA-N 0.000 description 1
- BSZXAFXFTLXUFV-UHFFFAOYSA-N 1-phenylethylbenzene Chemical compound C=1C=CC=CC=1C(C)C1=CC=CC=C1 BSZXAFXFTLXUFV-UHFFFAOYSA-N 0.000 description 1
- CQGQGUJHGHXQHF-UHFFFAOYSA-N 1-propyl-3-(3-propylphenyl)benzene Chemical group CCCC1=CC=CC(C=2C=C(CCC)C=CC=2)=C1 CQGQGUJHGHXQHF-UHFFFAOYSA-N 0.000 description 1
- HJEKLLNLASXOFE-UHFFFAOYSA-N 1-propyl-4-(4-propylphenyl)benzene Chemical group C1=CC(CCC)=CC=C1C1=CC=C(CCC)C=C1 HJEKLLNLASXOFE-UHFFFAOYSA-N 0.000 description 1
- WZUKFZYAMYMVJQ-UHFFFAOYSA-N 1-tert-butyl-2-(2-tert-butylphenyl)benzene Chemical group CC(C)(C)C1=CC=CC=C1C1=CC=CC=C1C(C)(C)C WZUKFZYAMYMVJQ-UHFFFAOYSA-N 0.000 description 1
- IJZDMPWKIBVVCQ-UHFFFAOYSA-N 2,4-dibromo-1-chlorobenzene Chemical compound ClC1=CC=C(Br)C=C1Br IJZDMPWKIBVVCQ-UHFFFAOYSA-N 0.000 description 1
- UFUNWXCNKJCKHT-UHFFFAOYSA-N 2,4-diphenyl-1-propan-2-ylbenzene Chemical group CC(C)C1=CC=C(C=2C=CC=CC=2)C=C1C1=CC=CC=C1 UFUNWXCNKJCKHT-UHFFFAOYSA-N 0.000 description 1
- OVXVQBCRONSPDC-UHFFFAOYSA-N 2-bromo-1,4-dichlorobenzene Chemical compound ClC1=CC=C(Cl)C(Br)=C1 OVXVQBCRONSPDC-UHFFFAOYSA-N 0.000 description 1
- 125000006176 2-ethylbutyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(C([H])([H])*)C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000004493 2-methylbut-1-yl group Chemical group CC(C*)CC 0.000 description 1
- GEWZPNMYMLQKGF-UHFFFAOYSA-N 2-o-(2-ethylhexyl) 1-o-(2-methylpropyl) benzene-1,2-dicarboxylate Chemical compound CCCCC(CC)COC(=O)C1=CC=CC=C1C(=O)OCC(C)C GEWZPNMYMLQKGF-UHFFFAOYSA-N 0.000 description 1
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 1
- CFPZDVAZISWERM-UHFFFAOYSA-N 4-bromo-1,2-dichlorobenzene Chemical compound ClC1=CC=C(Br)C=C1Cl CFPZDVAZISWERM-UHFFFAOYSA-N 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- MQIUGAXCHLFZKX-UHFFFAOYSA-N Di-n-octyl phthalate Natural products CCCCCCCCOC(=O)C1=CC=CC=C1C(=O)OCCCCCCCC MQIUGAXCHLFZKX-UHFFFAOYSA-N 0.000 description 1
- QWDBCIAVABMJPP-UHFFFAOYSA-N Diisopropyl phthalate Chemical compound CC(C)OC(=O)C1=CC=CC=C1C(=O)OC(C)C QWDBCIAVABMJPP-UHFFFAOYSA-N 0.000 description 1
- SNRUBQQJIBEYMU-UHFFFAOYSA-N Dodecane Natural products CCCCCCCCCCCC SNRUBQQJIBEYMU-UHFFFAOYSA-N 0.000 description 1
- YNQLUTRBYVCPMQ-UHFFFAOYSA-N Ethylbenzene Chemical compound CCC1=CC=CC=C1 YNQLUTRBYVCPMQ-UHFFFAOYSA-N 0.000 description 1
- 238000005727 Friedel-Crafts reaction Methods 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- 241000475481 Nebula Species 0.000 description 1
- GOOHAUXETOMSMM-UHFFFAOYSA-N Propylene oxide Chemical compound CC1CO1 GOOHAUXETOMSMM-UHFFFAOYSA-N 0.000 description 1
- AWMVMTVKBNGEAK-UHFFFAOYSA-N Styrene oxide Chemical compound C1OC1C1=CC=CC=C1 AWMVMTVKBNGEAK-UHFFFAOYSA-N 0.000 description 1
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 1
- XSTXAVWGXDQKEL-UHFFFAOYSA-N Trichloroethylene Chemical compound ClC=C(Cl)Cl XSTXAVWGXDQKEL-UHFFFAOYSA-N 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 230000000996 additive effect Effects 0.000 description 1
- 150000001335 aliphatic alkanes Chemical class 0.000 description 1
- 150000001336 alkenes Chemical class 0.000 description 1
- 229940100198 alkylating agent Drugs 0.000 description 1
- 239000002168 alkylating agent Substances 0.000 description 1
- 230000002152 alkylating effect Effects 0.000 description 1
- 239000003963 antioxidant agent Substances 0.000 description 1
- 150000001555 benzenes Chemical class 0.000 description 1
- 150000004074 biphenyls Chemical class 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- MTAZNLWOLGHBHU-UHFFFAOYSA-N butadiene-styrene rubber Chemical compound C=CC=C.C=CC1=CC=CC=C1 MTAZNLWOLGHBHU-UHFFFAOYSA-N 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 230000015556 catabolic process Effects 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 238000005660 chlorination reaction Methods 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 238000002485 combustion reaction Methods 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 239000002826 coolant Substances 0.000 description 1
- 229920001577 copolymer Polymers 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- RWGFKTVRMDUZSP-UHFFFAOYSA-N cumene Chemical compound CC(C)C1=CC=CC=C1 RWGFKTVRMDUZSP-UHFFFAOYSA-N 0.000 description 1
- 230000006378 damage Effects 0.000 description 1
- 125000002704 decyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 238000006731 degradation reaction Methods 0.000 description 1
- GYZLOYUZLJXAJU-UHFFFAOYSA-N diglycidyl ether Chemical compound C1OC1COCC1CO1 GYZLOYUZLJXAJU-UHFFFAOYSA-N 0.000 description 1
- MGWAVDBGNNKXQV-UHFFFAOYSA-N diisobutyl phthalate Chemical compound CC(C)COC(=O)C1=CC=CC=C1C(=O)OCC(C)C MGWAVDBGNNKXQV-UHFFFAOYSA-N 0.000 description 1
- 125000003438 dodecyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 230000009977 dual effect Effects 0.000 description 1
- 238000010891 electric arc Methods 0.000 description 1
- 238000005516 engineering process Methods 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 238000009413 insulation Methods 0.000 description 1
- 230000007257 malfunction Effects 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- SYSQUGFVNFXIIT-UHFFFAOYSA-N n-[4-(1,3-benzoxazol-2-yl)phenyl]-4-nitrobenzenesulfonamide Chemical class C1=CC([N+](=O)[O-])=CC=C1S(=O)(=O)NC1=CC=C(C=2OC3=CC=CC=C3N=2)C=C1 SYSQUGFVNFXIIT-UHFFFAOYSA-N 0.000 description 1
- 125000003136 n-heptyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000001280 n-hexyl group Chemical group C(CCCCC)* 0.000 description 1
- 125000001971 neopentyl group Chemical group [H]C([*])([H])C(C([H])([H])[H])(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 125000001400 nonyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 229930184652 p-Terphenyl Natural products 0.000 description 1
- 239000012188 paraffin wax Substances 0.000 description 1
- 125000002958 pentadecyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000000843 phenylene group Chemical group C1(=C(C=CC=C1)*)* 0.000 description 1
- 238000006116 polymerization reaction Methods 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- QQONPFPTGQHPMA-UHFFFAOYSA-N propylene Natural products CC=C QQONPFPTGQHPMA-UHFFFAOYSA-N 0.000 description 1
- 125000004805 propylene group Chemical group [H]C([H])([H])C([H])([*:1])C([H])([H])[*:2] 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 230000006209 tert-butylation Effects 0.000 description 1
- 125000000383 tetramethylene group Chemical group [H]C([H])([*:1])C([H])([H])C([H])([H])C([H])([H])[*:2] 0.000 description 1
- 239000002562 thickening agent Substances 0.000 description 1
- 239000012749 thinning agent Substances 0.000 description 1
- 229940035339 tri-chlor Drugs 0.000 description 1
Classifications
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01B—CABLES; CONDUCTORS; INSULATORS; SELECTION OF MATERIALS FOR THEIR CONDUCTIVE, INSULATING OR DIELECTRIC PROPERTIES
- H01B3/00—Insulators or insulating bodies characterised by the insulating materials; Selection of materials for their insulating or dielectric properties
- H01B3/18—Insulators or insulating bodies characterised by the insulating materials; Selection of materials for their insulating or dielectric properties mainly consisting of organic substances
- H01B3/20—Insulators or insulating bodies characterised by the insulating materials; Selection of materials for their insulating or dielectric properties mainly consisting of organic substances liquids, e.g. oils
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01B—CABLES; CONDUCTORS; INSULATORS; SELECTION OF MATERIALS FOR THEIR CONDUCTIVE, INSULATING OR DIELECTRIC PROPERTIES
- H01B3/00—Insulators or insulating bodies characterised by the insulating materials; Selection of materials for their insulating or dielectric properties
- H01B3/18—Insulators or insulating bodies characterised by the insulating materials; Selection of materials for their insulating or dielectric properties mainly consisting of organic substances
- H01B3/20—Insulators or insulating bodies characterised by the insulating materials; Selection of materials for their insulating or dielectric properties mainly consisting of organic substances liquids, e.g. oils
- H01B3/24—Insulators or insulating bodies characterised by the insulating materials; Selection of materials for their insulating or dielectric properties mainly consisting of organic substances liquids, e.g. oils containing halogen in the molecules, e.g. halogenated oils
Landscapes
- Chemical & Material Sciences (AREA)
- Oil, Petroleum & Natural Gas (AREA)
- Physics & Mathematics (AREA)
- Spectroscopy & Molecular Physics (AREA)
- Organic Insulating Materials (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| FR7907713A FR2452163A1 (fr) | 1979-03-21 | 1979-03-21 | Nouveaux dielectriques liquides |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE3011040A1 DE3011040A1 (de) | 1980-10-02 |
| DE3011040C2 true DE3011040C2 (enExample) | 1988-12-15 |
Family
ID=9223625
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19803011040 Granted DE3011040A1 (de) | 1979-03-21 | 1980-03-21 | Neue fluessige dielektrika |
Country Status (8)
| Country | Link |
|---|---|
| US (1) | US4292462A (enExample) |
| JP (1) | JPS55128208A (enExample) |
| BE (1) | BE882337A (enExample) |
| BR (1) | BR8001675A (enExample) |
| CA (1) | CA1132789A (enExample) |
| DE (1) | DE3011040A1 (enExample) |
| FR (1) | FR2452163A1 (enExample) |
| IT (1) | IT1130068B (enExample) |
Families Citing this family (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4420791A (en) * | 1981-12-28 | 1983-12-13 | Emhart Industries, Inc. | Dielectric fluid |
| JPS6436569A (en) * | 1987-07-31 | 1989-02-07 | Koyo Seiko Co | Power steering device |
| JPH02120178A (ja) * | 1988-10-31 | 1990-05-08 | Jidosha Kiki Co Ltd | 電動式動力舵取装置 |
| US5349493A (en) * | 1992-12-18 | 1994-09-20 | Aerovox Incorporated | Electrical capacitor |
Family Cites Families (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2229407A (en) * | 1938-11-12 | 1941-01-21 | Dow Chemical Co | Liquid dielectric composition |
| US2257903A (en) * | 1940-02-21 | 1941-10-07 | Dow Chemical Co | Mixture of isomeric ethyl dibromobenzenes |
| GB544890A (en) * | 1940-10-30 | 1942-05-01 | Du Pont | Halogenated organic compounds and compositions containing the same |
| DE909110C (de) * | 1941-09-03 | 1954-04-12 | Siemens Ag | Isolieroel fuer elektrotechnische Zwecke, insbesondere fuer Transformatoren und Kondensatoren |
| AR205218A1 (es) * | 1975-01-20 | 1976-04-12 | Mc Graw Edison Co | Capacitor electrico mejorado y metodo de fabricacion |
| BR7703653A (pt) * | 1976-06-08 | 1978-04-04 | Rhone Poulenc Ind | Novos liquidos dieletricos |
| FR2354613A1 (fr) * | 1976-06-08 | 1978-01-06 | Rhone Poulenc Ind | Nouveaux dielectriques liquides pour transformateurs |
| FR2383227A1 (fr) * | 1977-03-10 | 1978-10-06 | Rhone Poulenc Ind | Nouveaux dielectriques liquides pour transformateurs |
-
1979
- 1979-03-21 FR FR7907713A patent/FR2452163A1/fr active Granted
-
1980
- 1980-03-18 US US06/131,488 patent/US4292462A/en not_active Expired - Lifetime
- 1980-03-19 IT IT20775/80A patent/IT1130068B/it active
- 1980-03-19 JP JP3418980A patent/JPS55128208A/ja active Granted
- 1980-03-20 CA CA348,052A patent/CA1132789A/fr not_active Expired
- 1980-03-20 BE BE0/199875A patent/BE882337A/fr not_active IP Right Cessation
- 1980-03-20 BR BR8001675A patent/BR8001675A/pt unknown
- 1980-03-21 DE DE19803011040 patent/DE3011040A1/de active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| DE3011040A1 (de) | 1980-10-02 |
| FR2452163A1 (fr) | 1980-10-17 |
| FR2452163B1 (enExample) | 1981-04-17 |
| JPS55128208A (en) | 1980-10-03 |
| IT8020775A0 (it) | 1980-03-19 |
| CA1132789A (fr) | 1982-10-05 |
| BE882337A (fr) | 1980-09-22 |
| JPS6213764B2 (enExample) | 1987-03-28 |
| US4292462A (en) | 1981-09-29 |
| IT1130068B (it) | 1986-06-11 |
| BR8001675A (pt) | 1980-11-18 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2726015C2 (de) | Flammfeste flüssige Dielektrika | |
| DE3011040C2 (enExample) | ||
| DE2527069A1 (de) | Oelgetraenkte elektrische vorrichtung | |
| US2033612A (en) | Chlorine derivatives of dibenzyl and process of preparing them | |
| US4177156A (en) | Dielectric compositions comprising mixtures of polychlorinated benzenes and alkylaromatic hydrocarbons | |
| DD153266A5 (de) | Dielektrische fluessigkeiten | |
| DE3789344T2 (de) | Dielektrische Isolierflüssigkeit, die Perchloräthylen und einen aliphatischen Kohlenwasserstoff enthält. | |
| US6391228B1 (en) | Dielectric composition having an improved gas absorption | |
| DE2222699B2 (de) | Regenerierfaehiger elektrischer kondensator | |
| DE2429294A1 (de) | Arbeitsfluessigkeit | |
| US2171855A (en) | Dielectric composition | |
| DE2920027C2 (enExample) | ||
| DE3217262C2 (de) | Feuerhemmendes Isolieröl | |
| US2139948A (en) | Dielectric liquid for electrical apparatus | |
| DE2406540C3 (de) | Hochspannungsisolation auf Polyolefinbasis mit einem Stabilisatorzusatz | |
| DE710583C (de) | Dielektrische Fluessigkeiten | |
| DE2656842A1 (de) | Elektrische isolieroele | |
| EP0150826B1 (de) | Schwerentflammbare, biologisch abbaubare funktionelle Flüssigkeit | |
| US1944730A (en) | Composition for dielectric use | |
| DE2838482C2 (de) | Mit einer Flüssigkeit isolierte elektrische Vorrichtung | |
| CH634946A5 (de) | Fluessigkeiten mit dielektrischen eigenschaften und deren verwendung als dielektrikum, insbesondere in einer elektrischen vorrichtung. | |
| DE2531392C3 (de) | Elektrische Isolierflüssigkeit | |
| US2140784A (en) | Dielectric compositions | |
| US2139964A (en) | Dielectric liquids | |
| DE2446591C3 (enExample) |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8110 | Request for examination paragraph 44 | ||
| D2 | Grant after examination | ||
| 8364 | No opposition during term of opposition | ||
| 8339 | Ceased/non-payment of the annual fee |