DE2910739C2 - - Google Patents
Info
- Publication number
- DE2910739C2 DE2910739C2 DE2910739A DE2910739A DE2910739C2 DE 2910739 C2 DE2910739 C2 DE 2910739C2 DE 2910739 A DE2910739 A DE 2910739A DE 2910739 A DE2910739 A DE 2910739A DE 2910739 C2 DE2910739 C2 DE 2910739C2
- Authority
- DE
- Germany
- Prior art keywords
- parts
- weight
- organopolysiloxane
- mold
- mass
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 229920001296 polysiloxane Polymers 0.000 claims description 32
- 239000000203 mixture Substances 0.000 claims description 22
- 229920001971 elastomer Polymers 0.000 claims description 21
- 239000000806 elastomer Substances 0.000 claims description 19
- WJCNZQLZVWNLKY-UHFFFAOYSA-N thiabendazole Chemical compound S1C=NC(C=2NC3=CC=CC=C3N=2)=C1 WJCNZQLZVWNLKY-UHFFFAOYSA-N 0.000 claims description 18
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 17
- 239000004094 surface-active agent Substances 0.000 claims description 13
- 150000003961 organosilicon compounds Chemical class 0.000 claims description 10
- 239000000470 constituent Substances 0.000 claims 1
- 150000002430 hydrocarbons Chemical group 0.000 claims 1
- -1 hydrocarbon radical Chemical class 0.000 description 35
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 13
- BLRPTPMANUNPDV-UHFFFAOYSA-N Silane Chemical compound [SiH4] BLRPTPMANUNPDV-UHFFFAOYSA-N 0.000 description 8
- 229910000077 silane Inorganic materials 0.000 description 8
- 229910052782 aluminium Inorganic materials 0.000 description 6
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 6
- 239000000945 filler Substances 0.000 description 6
- 235000012239 silicon dioxide Nutrition 0.000 description 6
- 239000000126 substance Substances 0.000 description 6
- 239000004205 dimethyl polysiloxane Substances 0.000 description 5
- 235000013870 dimethyl polysiloxane Nutrition 0.000 description 5
- 239000001963 growth medium Substances 0.000 description 5
- 229920000435 poly(dimethylsiloxane) Polymers 0.000 description 5
- 125000005372 silanol group Chemical group 0.000 description 5
- 239000004215 Carbon black (E152) Substances 0.000 description 4
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical class OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 4
- 230000015572 biosynthetic process Effects 0.000 description 4
- 235000013305 food Nutrition 0.000 description 4
- 229910021485 fumed silica Inorganic materials 0.000 description 4
- 229930195733 hydrocarbon Natural products 0.000 description 4
- 230000007062 hydrolysis Effects 0.000 description 4
- 238000006460 hydrolysis reaction Methods 0.000 description 4
- 235000015097 nutrients Nutrition 0.000 description 4
- 125000000962 organic group Chemical group 0.000 description 4
- 150000003254 radicals Chemical class 0.000 description 4
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 3
- 235000002245 Penicillium camembertii Nutrition 0.000 description 3
- 229920003171 Poly (ethylene oxide) Polymers 0.000 description 3
- 239000002280 amphoteric surfactant Substances 0.000 description 3
- 229920001577 copolymer Polymers 0.000 description 3
- 235000014113 dietary fatty acids Nutrition 0.000 description 3
- 239000000194 fatty acid Substances 0.000 description 3
- 229930195729 fatty acid Natural products 0.000 description 3
- 239000007970 homogeneous dispersion Substances 0.000 description 3
- 239000004615 ingredient Substances 0.000 description 3
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 3
- 239000002736 nonionic surfactant Substances 0.000 description 3
- 239000010453 quartz Substances 0.000 description 3
- 239000000377 silicon dioxide Substances 0.000 description 3
- 239000000344 soap Substances 0.000 description 3
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 2
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N Titan oxide Chemical compound O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 description 2
- XLOMVQKBTHCTTD-UHFFFAOYSA-N Zinc monoxide Chemical compound [Zn]=O XLOMVQKBTHCTTD-UHFFFAOYSA-N 0.000 description 2
- PXAJQJMDEXJWFB-UHFFFAOYSA-N acetone oxime Chemical compound CC(C)=NO PXAJQJMDEXJWFB-UHFFFAOYSA-N 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 125000005907 alkyl ester group Chemical group 0.000 description 2
- 125000000129 anionic group Chemical group 0.000 description 2
- 239000004566 building material Substances 0.000 description 2
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 2
- 239000003093 cationic surfactant Substances 0.000 description 2
- 150000001875 compounds Chemical class 0.000 description 2
- KPUWHANPEXNPJT-UHFFFAOYSA-N disiloxane Chemical class [SiH3]O[SiH3] KPUWHANPEXNPJT-UHFFFAOYSA-N 0.000 description 2
- 239000000975 dye Substances 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 230000007717 exclusion Effects 0.000 description 2
- 230000002349 favourable effect Effects 0.000 description 2
- 229920001519 homopolymer Polymers 0.000 description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 2
- 125000000963 oxybis(methylene) group Chemical group [H]C([H])(*)OC([H])([H])* 0.000 description 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 2
- 150000003014 phosphoric acid esters Chemical class 0.000 description 2
- 239000012763 reinforcing filler Substances 0.000 description 2
- 229920005989 resin Polymers 0.000 description 2
- 239000011347 resin Substances 0.000 description 2
- 150000003871 sulfonates Chemical class 0.000 description 2
- 238000009423 ventilation Methods 0.000 description 2
- 229920002554 vinyl polymer Polymers 0.000 description 2
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- 229920001817 Agar Polymers 0.000 description 1
- 239000004970 Chain extender Substances 0.000 description 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 1
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- 239000005909 Kieselgur Substances 0.000 description 1
- GXCLVBGFBYZDAG-UHFFFAOYSA-N N-[2-(1H-indol-3-yl)ethyl]-N-methylprop-2-en-1-amine Chemical compound CN(CCC1=CNC2=C1C=CC=C2)CC=C GXCLVBGFBYZDAG-UHFFFAOYSA-N 0.000 description 1
- UMSJNKQPDCTXOF-UHFFFAOYSA-N N-cyclohexylacetamide silane Chemical compound [SiH4].C1(CCCCC1)NC(C)=O UMSJNKQPDCTXOF-UHFFFAOYSA-N 0.000 description 1
- OHLUUHNLEMFGTQ-UHFFFAOYSA-N N-methylacetamide Chemical compound CNC(C)=O OHLUUHNLEMFGTQ-UHFFFAOYSA-N 0.000 description 1
- VISCLWKQWGKGDE-UHFFFAOYSA-N N-methylacetamide silane Chemical compound [SiH4].CNC(C)=O VISCLWKQWGKGDE-UHFFFAOYSA-N 0.000 description 1
- 229920001214 Polysorbate 60 Polymers 0.000 description 1
- XUIMIQQOPSSXEZ-UHFFFAOYSA-N Silicon Chemical group [Si] XUIMIQQOPSSXEZ-UHFFFAOYSA-N 0.000 description 1
- NOZAQBYNLKNDRT-UHFFFAOYSA-N [diacetyloxy(ethenyl)silyl] acetate Chemical compound CC(=O)O[Si](OC(C)=O)(OC(C)=O)C=C NOZAQBYNLKNDRT-UHFFFAOYSA-N 0.000 description 1
- KXJLGCBCRCSXQF-UHFFFAOYSA-N [diacetyloxy(ethyl)silyl] acetate Chemical compound CC(=O)O[Si](CC)(OC(C)=O)OC(C)=O KXJLGCBCRCSXQF-UHFFFAOYSA-N 0.000 description 1
- TVJPBVNWVPUZBM-UHFFFAOYSA-N [diacetyloxy(methyl)silyl] acetate Chemical compound CC(=O)O[Si](C)(OC(C)=O)OC(C)=O TVJPBVNWVPUZBM-UHFFFAOYSA-N 0.000 description 1
- NBJODVYWAQLZOC-UHFFFAOYSA-L [dibutyl(octanoyloxy)stannyl] octanoate Chemical compound CCCCCCCC(=O)O[Sn](CCCC)(CCCC)OC(=O)CCCCCCC NBJODVYWAQLZOC-UHFFFAOYSA-L 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 230000004913 activation Effects 0.000 description 1
- 125000002252 acyl group Chemical group 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 239000008272 agar Substances 0.000 description 1
- 230000001476 alcoholic effect Effects 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 150000008431 aliphatic amides Chemical class 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- 125000005083 alkoxyalkoxy group Chemical group 0.000 description 1
- 150000008055 alkyl aryl sulfonates Chemical class 0.000 description 1
- 150000005215 alkyl ethers Chemical class 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- 239000003945 anionic surfactant Substances 0.000 description 1
- 150000001450 anions Chemical class 0.000 description 1
- 150000005840 aryl radicals Chemical class 0.000 description 1
- 239000010425 asbestos Substances 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- 239000000440 bentonite Substances 0.000 description 1
- 229910000278 bentonite Inorganic materials 0.000 description 1
- SVPXDRXYRYOSEX-UHFFFAOYSA-N bentoquatam Chemical compound O.O=[Si]=O.O=[Al]O[Al]=O SVPXDRXYRYOSEX-UHFFFAOYSA-N 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 125000006267 biphenyl group Chemical group 0.000 description 1
- 229920001400 block copolymer Polymers 0.000 description 1
- 239000000378 calcium silicate Substances 0.000 description 1
- 229910052918 calcium silicate Inorganic materials 0.000 description 1
- OYACROKNLOSFPA-UHFFFAOYSA-N calcium;dioxido(oxo)silane Chemical compound [Ca+2].[O-][Si]([O-])=O OYACROKNLOSFPA-UHFFFAOYSA-N 0.000 description 1
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 description 1
- 239000006229 carbon black Substances 0.000 description 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 1
- 150000001734 carboxylic acid salts Chemical class 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 125000002091 cationic group Chemical group 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 125000000068 chlorophenyl group Chemical group 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 239000007822 coupling agent Substances 0.000 description 1
- 125000000596 cyclohexenyl group Chemical group C1(=CCCCC1)* 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 239000003599 detergent Substances 0.000 description 1
- ZBCBWPMODOFKDW-UHFFFAOYSA-N diethanolamine Chemical class OCCNCCO ZBCBWPMODOFKDW-UHFFFAOYSA-N 0.000 description 1
- 230000003292 diminished effect Effects 0.000 description 1
- 229920005645 diorganopolysiloxane polymer Polymers 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 239000000428 dust Substances 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 150000004665 fatty acids Chemical class 0.000 description 1
- 239000010685 fatty oil Substances 0.000 description 1
- 239000000835 fiber Substances 0.000 description 1
- 239000012765 fibrous filler Substances 0.000 description 1
- 239000003063 flame retardant Substances 0.000 description 1
- 239000003365 glass fiber Substances 0.000 description 1
- 239000012760 heat stabilizer Substances 0.000 description 1
- ALBYIUDWACNRRB-UHFFFAOYSA-N hexanamide Chemical compound CCCCCC(N)=O ALBYIUDWACNRRB-UHFFFAOYSA-N 0.000 description 1
- 125000001183 hydrocarbyl group Chemical group 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 238000009434 installation Methods 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 229920000126 latex Polymers 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 239000002609 medium Substances 0.000 description 1
- 229910044991 metal oxide Inorganic materials 0.000 description 1
- 150000004706 metal oxides Chemical class 0.000 description 1
- 238000000034 method Methods 0.000 description 1
- RJMRIDVWCWSWFR-UHFFFAOYSA-N methyl(tripropoxy)silane Chemical compound CCCO[Si](C)(OCCC)OCCC RJMRIDVWCWSWFR-UHFFFAOYSA-N 0.000 description 1
- BFXIKLCIZHOAAZ-UHFFFAOYSA-N methyltrimethoxysilane Chemical compound CO[Si](C)(OC)OC BFXIKLCIZHOAAZ-UHFFFAOYSA-N 0.000 description 1
- INJVFBCDVXYHGQ-UHFFFAOYSA-N n'-(3-triethoxysilylpropyl)ethane-1,2-diamine Chemical compound CCO[Si](OCC)(OCC)CCCNCCN INJVFBCDVXYHGQ-UHFFFAOYSA-N 0.000 description 1
- PULCKIYKBGOTTG-UHFFFAOYSA-N n-(2,4-dimethylpentan-3-ylidene)hydroxylamine Chemical compound CC(C)C(=NO)C(C)C PULCKIYKBGOTTG-UHFFFAOYSA-N 0.000 description 1
- GJQSLHYMHWQOQY-UHFFFAOYSA-N n-[bis(butylamino)-methylsilyl]butan-1-amine Chemical compound CCCCN[Si](C)(NCCCC)NCCCC GJQSLHYMHWQOQY-UHFFFAOYSA-N 0.000 description 1
- WOFLNHIWMZYCJH-UHFFFAOYSA-N n-[bis(diethylaminooxy)-methylsilyl]oxy-n-ethylethanamine Chemical compound CCN(CC)O[Si](C)(ON(CC)CC)ON(CC)CC WOFLNHIWMZYCJH-UHFFFAOYSA-N 0.000 description 1
- AHKKZIUZTWZKDR-UHFFFAOYSA-N n-[bis(dimethylamino)-methylsilyl]-n-methylmethanamine Chemical compound CN(C)[Si](C)(N(C)C)N(C)C AHKKZIUZTWZKDR-UHFFFAOYSA-N 0.000 description 1
- WHIVNJATOVLWBW-UHFFFAOYSA-N n-butan-2-ylidenehydroxylamine Chemical compound CCC(C)=NO WHIVNJATOVLWBW-UHFFFAOYSA-N 0.000 description 1
- PSZYNBSKGUBXEH-UHFFFAOYSA-N naphthalene-1-sulfonic acid Chemical class C1=CC=C2C(S(=O)(=O)O)=CC=CC2=C1 PSZYNBSKGUBXEH-UHFFFAOYSA-N 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- TWNQGVIAIRXVLR-UHFFFAOYSA-N oxo(oxoalumanyloxy)alumane Chemical compound O=[Al]O[Al]=O TWNQGVIAIRXVLR-UHFFFAOYSA-N 0.000 description 1
- 239000000049 pigment Substances 0.000 description 1
- 239000004033 plastic Substances 0.000 description 1
- 229920003023 plastic Polymers 0.000 description 1
- 239000004014 plasticizer Substances 0.000 description 1
- 238000006116 polymerization reaction Methods 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 230000002265 prevention Effects 0.000 description 1
- 230000001698 pyrogenic effect Effects 0.000 description 1
- 150000003242 quaternary ammonium salts Chemical class 0.000 description 1
- 239000011150 reinforced concrete Substances 0.000 description 1
- 229910052895 riebeckite Inorganic materials 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 238000007789 sealing Methods 0.000 description 1
- 239000003566 sealing material Substances 0.000 description 1
- 150000004756 silanes Chemical class 0.000 description 1
- 229910052710 silicon Inorganic materials 0.000 description 1
- 150000003377 silicon compounds Chemical class 0.000 description 1
- APSBXTVYXVQYAB-UHFFFAOYSA-M sodium docusate Chemical compound [Na+].CCCCC(CC)COC(=O)CC(S([O-])(=O)=O)C(=O)OCC(CC)CCCC APSBXTVYXVQYAB-UHFFFAOYSA-M 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 125000004079 stearyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 1
- 239000000271 synthetic detergent Substances 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 239000004408 titanium dioxide Substances 0.000 description 1
- 125000005425 toluyl group Chemical group 0.000 description 1
- 239000011787 zinc oxide Substances 0.000 description 1
- GFQYVLUOOAAOGM-UHFFFAOYSA-N zirconium(iv) silicate Chemical compound [Zr+4].[O-][Si]([O-])([O-])[O-] GFQYVLUOOAAOGM-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08K—Use of inorganic or non-macromolecular organic substances as compounding ingredients
- C08K5/00—Use of organic ingredients
- C08K5/36—Sulfur-, selenium-, or tellurium-containing compounds
- C08K5/45—Heterocyclic compounds having sulfur in the ring
- C08K5/46—Heterocyclic compounds having sulfur in the ring with oxygen or nitrogen in the ring
- C08K5/47—Thiazoles
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08K—Use of inorganic or non-macromolecular organic substances as compounding ingredients
- C08K5/00—Use of organic ingredients
- C08K5/16—Nitrogen-containing compounds
- C08K5/34—Heterocyclic compounds having nitrogen in the ring
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Compositions Of Macromolecular Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP3543978A JPS54127960A (en) | 1978-03-29 | 1978-03-29 | Organopolysiloxane composition |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE2910739A1 DE2910739A1 (de) | 1979-10-04 |
| DE2910739C2 true DE2910739C2 (cg-RX-API-DMAC7.html) | 1987-06-11 |
Family
ID=12441872
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19792910739 Granted DE2910739A1 (de) | 1978-03-29 | 1979-03-19 | Schimmel- und meltaufeste organopolysiloxanmassen |
Country Status (8)
| Country | Link |
|---|---|
| US (1) | US4247442A (cg-RX-API-DMAC7.html) |
| JP (1) | JPS54127960A (cg-RX-API-DMAC7.html) |
| AU (1) | AU531494B2 (cg-RX-API-DMAC7.html) |
| BE (1) | BE875149A (cg-RX-API-DMAC7.html) |
| CA (1) | CA1141053A (cg-RX-API-DMAC7.html) |
| DE (1) | DE2910739A1 (cg-RX-API-DMAC7.html) |
| FR (1) | FR2421195A1 (cg-RX-API-DMAC7.html) |
| GB (1) | GB2018270B (cg-RX-API-DMAC7.html) |
Families Citing this family (17)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0034877A3 (en) * | 1980-01-28 | 1981-09-09 | General Electric Company | Mildew resistant rtv silicone compositions |
| JPS6045031A (ja) * | 1983-08-22 | 1985-03-11 | Tomuko:Kk | 自動ウェ−ハ移換機 |
| EP0229862A3 (en) * | 1986-01-24 | 1987-09-30 | TERUMO KABUSHIKI KAISHA trading as TERUMO CORPORATION | Medical instrument |
| DE69213076T2 (de) * | 1991-04-10 | 1997-01-16 | Shinetsu Chemical Co | Schimmelbeständige, bei Umgebungstemperatur härtbare Organopolysiloxan-Zusammensetzung |
| US5534563A (en) * | 1994-01-31 | 1996-07-09 | General Electric Company | Silicone sealants |
| US5744703A (en) * | 1997-02-26 | 1998-04-28 | General Electric Company | Process to measure the stringiness of room temperature vulcanizable silicone sealant compositions |
| JP3511936B2 (ja) * | 1999-03-10 | 2004-03-29 | 信越化学工業株式会社 | 抗菌・防カビ性オルガノポリシロキサン組成物 |
| FR2823505B1 (fr) * | 2001-04-13 | 2005-10-07 | Rhodia Chimie Sa | Composition polyorganosiloxane (pos) monocomposante reticulant et durcissant en elastomere non jaunissant, a temperature ambiante et en presence d'eau, et elastomere ainsi obtenu |
| DE102004056362A1 (de) * | 2004-11-22 | 2006-06-01 | Henkel Kgaa | Schimmel-beständige Baustoffe |
| EP1894975A1 (de) * | 2006-08-30 | 2008-03-05 | Sika Technology AG | Siliconzusammensetzung |
| DE102006056770B4 (de) | 2006-12-01 | 2009-07-30 | Bostik Gmbh | Einkomponentiger schimmelpilzwuchshemmender Sanitärfugendichtstoff |
| JP5843613B2 (ja) * | 2009-01-20 | 2016-01-13 | キャボット コーポレイションCabot Corporation | シラン変性金属酸化物を含む組成物 |
| WO2014095889A1 (de) | 2012-12-17 | 2014-06-26 | Lanxess Deutschland Gmbh | Fungizide silikon-dichtungsmassen |
| GB201520461D0 (en) * | 2015-11-20 | 2016-01-06 | Dow Corning | Water pick up sealant |
| US11512237B2 (en) | 2015-11-20 | 2022-11-29 | Dow Silicones Corporation | Room temperature curable compositions |
| EP3727597A1 (en) | 2017-12-21 | 2020-10-28 | Dow Silicones Corporation | Cosmetic composition comprising silicone materials |
| CN111417705B (zh) | 2017-12-21 | 2022-01-25 | 美国陶氏有机硅公司 | 包含硅酮材料的织物护理组合物 |
Family Cites Families (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE599143A (cg-RX-API-DMAC7.html) * | 1960-01-18 | |||
| NL134354C (cg-RX-API-DMAC7.html) * | 1963-05-23 | |||
| US3410819A (en) * | 1963-06-28 | 1968-11-12 | American Cyanamid Co | Addition of insoluble additives to fibers during manufacture |
| GB1394990A (en) * | 1971-08-12 | 1975-05-21 | Hydrophilics Int Inc | Copolymers and compositions containing copolymers |
| US3845212A (en) * | 1972-03-17 | 1974-10-29 | Kankakee Paint Mfg Co Inc | Biostat and paint composition |
| US3817894A (en) * | 1972-08-10 | 1974-06-18 | Dow Corning | Silicone latex caulk |
| CA1010782A (en) * | 1973-02-20 | 1977-05-24 | Charles A. Roth | Articles exhibiting antimicrobial properties |
| DE2333966C3 (de) * | 1973-07-04 | 1979-10-11 | Bayer Ag, 5090 Leverkusen | Unter Wasserausschluß lagerfähige plastische fungicid wirkende Organopolysiloxanformmassen |
| JPS5319345B2 (cg-RX-API-DMAC7.html) * | 1974-05-17 | 1978-06-20 | ||
| US3998785A (en) * | 1974-06-13 | 1976-12-21 | International Business Machines Corporation | Anti-fungal and/or anti-bacterial hardware for ink printing apparatus |
| US4154718A (en) * | 1976-09-02 | 1979-05-15 | Kyowa Chemical Industry Co. Ltd. | Fire-retardant thermoplastic resin composition |
-
1978
- 1978-03-29 JP JP3543978A patent/JPS54127960A/ja active Granted
-
1979
- 1979-02-02 US US06/008,666 patent/US4247442A/en not_active Expired - Lifetime
- 1979-02-06 CA CA000320972A patent/CA1141053A/en not_active Expired
- 1979-02-16 GB GB7905518A patent/GB2018270B/en not_active Expired
- 1979-03-19 DE DE19792910739 patent/DE2910739A1/de active Granted
- 1979-03-27 AU AU45431/79A patent/AU531494B2/en not_active Ceased
- 1979-03-28 BE BE0/194260A patent/BE875149A/xx not_active IP Right Cessation
- 1979-03-28 FR FR7907781A patent/FR2421195A1/fr active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| AU531494B2 (en) | 1983-08-25 |
| US4247442A (en) | 1981-01-27 |
| AU4543179A (en) | 1979-10-04 |
| CA1141053A (en) | 1983-02-08 |
| FR2421195B1 (cg-RX-API-DMAC7.html) | 1981-08-14 |
| JPS54127960A (en) | 1979-10-04 |
| GB2018270A (en) | 1979-10-17 |
| JPS5541703B2 (cg-RX-API-DMAC7.html) | 1980-10-25 |
| GB2018270B (en) | 1982-07-28 |
| BE875149A (fr) | 1979-09-28 |
| FR2421195A1 (fr) | 1979-10-26 |
| DE2910739A1 (de) | 1979-10-04 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2910739C2 (cg-RX-API-DMAC7.html) | ||
| DE3500979C2 (de) | Organopolysiloxanmasse und ihre Verwendung | |
| DE69408551T2 (de) | Verfahren zur Herstellung von bemaltem Silikon-Elastomer | |
| DD158923A5 (de) | Verfahren zur wasserfestausruestung von mauerwerk | |
| DE2339178A1 (de) | Zusammensetzung eines siloxancopolymeren | |
| DE2018071B2 (de) | Verfahren zur herstellung von organopolysiloxanformkoerpern | |
| DE4033096A1 (de) | Feuchtigkeitshaertende einkomponenten-polysiloxanmasse | |
| EP0224112B1 (de) | Verwendung von Siliconmassen zur Verhinderung der Vereisung auf Substraten | |
| DE69310594T2 (de) | Bei Raumtemperatur härtende Polysiloxanzusammensetzung und daraus gehärteter Gegenstand | |
| DE2754795A1 (de) | Bei raumtemperatur haertende silikon-zusammensetzungen mit guter waermedaemmung | |
| DE69700611T2 (de) | Verfahren zur Erhöhung der Langlebigkeit eines trockenem Ölfilms auf eine mit Zinkoxyd modifizierten Polysiloxanoberfläche | |
| DE3687320T2 (de) | Wasser enthaltender kitt auf basis von organopolysiloxanen. | |
| DE1519151A1 (de) | Verfahren zum Herstellen wasserfester,stabilisierter Siliconfette | |
| DE19501817A1 (de) | Silicon-Dichtungsmittel | |
| EP0000892B1 (de) | Unter Ausschluss von Wasser lagerfähige, mikrobicid wirkende Organopolysiloxanformmassen | |
| EP0050359B1 (de) | Verfahren zur Herstellung von Überzügen | |
| DE69426271T2 (de) | Geruchsbeständige Beschichtungszusammensetzung | |
| DE3207336A1 (de) | Silikonzusammensetzung | |
| DE102006056770B4 (de) | Einkomponentiger schimmelpilzwuchshemmender Sanitärfugendichtstoff | |
| DE1694841A1 (de) | Neue Haftmittel fuer kautschukartige Organopolysiloxanmaterialien an festen Oberflaechen | |
| DE69213076T2 (de) | Schimmelbeständige, bei Umgebungstemperatur härtbare Organopolysiloxan-Zusammensetzung | |
| DE1669940A1 (de) | Verfahren zur Herstellung von Organopolysiloxanelastomeren | |
| DE2823011A1 (de) | Zu elastomeren vernetzbare massen | |
| DE102021124578B4 (de) | Imprägniercreme, Verwendung und Verfahren zur Herstellung der Imprägniercreme | |
| WO2013132080A1 (de) | Glasbauelement und verfahren zu dessen herstellung |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8128 | New person/name/address of the agent |
Representative=s name: SPOTT, G., DIPL.-CHEM. DR.RER.NAT., PAT.-ANW., 800 |
|
| 8110 | Request for examination paragraph 44 | ||
| D2 | Grant after examination | ||
| 8364 | No opposition during term of opposition | ||
| 8339 | Ceased/non-payment of the annual fee |