DE2842715A1 - 3-chlor-3-methyl-butan- bzw. 3-methyl- 2-buten-1,4-dial-bis-acetale, ein verfahren zur herstellung dieser verbindungen sowie deren verwendung - Google Patents
3-chlor-3-methyl-butan- bzw. 3-methyl- 2-buten-1,4-dial-bis-acetale, ein verfahren zur herstellung dieser verbindungen sowie deren verwendungInfo
- Publication number
- DE2842715A1 DE2842715A1 DE19782842715 DE2842715A DE2842715A1 DE 2842715 A1 DE2842715 A1 DE 2842715A1 DE 19782842715 DE19782842715 DE 19782842715 DE 2842715 A DE2842715 A DE 2842715A DE 2842715 A1 DE2842715 A1 DE 2842715A1
- Authority
- DE
- Germany
- Prior art keywords
- methyl
- general formula
- basf aktiengesellschaft
- buten
- acetals
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 238000000034 method Methods 0.000 title claims description 17
- 150000001875 compounds Chemical class 0.000 title description 9
- CRNIHJHMEQZAAS-UHFFFAOYSA-N tert-amyl chloride Chemical compound CCC(C)(C)Cl CRNIHJHMEQZAAS-UHFFFAOYSA-N 0.000 title 1
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 claims description 42
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 claims description 23
- 150000001241 acetals Chemical class 0.000 claims description 21
- 238000006243 chemical reaction Methods 0.000 claims description 17
- DHKHKXVYLBGOIT-UHFFFAOYSA-N acetaldehyde Diethyl Acetal Natural products CCOC(C)OCC DHKHKXVYLBGOIT-UHFFFAOYSA-N 0.000 claims description 16
- 239000002904 solvent Substances 0.000 claims description 16
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 claims description 15
- 229910000041 hydrogen chloride Inorganic materials 0.000 claims description 15
- 238000002360 preparation method Methods 0.000 claims description 11
- -1 nitrous acid ester Chemical class 0.000 claims description 10
- VFWCMGCRMGJXDK-UHFFFAOYSA-N 1-chlorobutane Chemical compound CCCCCl VFWCMGCRMGJXDK-UHFFFAOYSA-N 0.000 claims description 7
- 125000004432 carbon atom Chemical group C* 0.000 claims description 7
- 239000004157 Nitrosyl chloride Substances 0.000 claims description 6
- 238000004519 manufacturing process Methods 0.000 claims description 6
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 6
- VPCDQGACGWYTMC-UHFFFAOYSA-N nitrosyl chloride Chemical compound ClN=O VPCDQGACGWYTMC-UHFFFAOYSA-N 0.000 claims description 6
- 125000000217 alkyl group Chemical group 0.000 claims description 5
- 235000019392 nitrosyl chloride Nutrition 0.000 claims description 5
- 239000011260 aqueous acid Substances 0.000 claims description 4
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 4
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 claims description 4
- ZNZYKNKBJPZETN-WELNAUFTSA-N Dialdehyde 11678 Chemical compound N1C2=CC=CC=C2C2=C1[C@H](C[C@H](/C(=C/O)C(=O)OC)[C@@H](C=C)C=O)NCC2 ZNZYKNKBJPZETN-WELNAUFTSA-N 0.000 claims description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 claims 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 claims 1
- 239000011541 reaction mixture Substances 0.000 description 15
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 9
- 238000004821 distillation Methods 0.000 description 8
- 239000007858 starting material Substances 0.000 description 8
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 6
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- VEEFADFWCHSFIU-UHFFFAOYSA-N 3-methylbut-3-enal Chemical compound CC(=C)CC=O VEEFADFWCHSFIU-UHFFFAOYSA-N 0.000 description 5
- 239000002585 base Substances 0.000 description 5
- 238000009835 boiling Methods 0.000 description 5
- 238000004817 gas chromatography Methods 0.000 description 5
- 238000007239 Wittig reaction Methods 0.000 description 4
- 239000000047 product Substances 0.000 description 4
- 230000002829 reductive effect Effects 0.000 description 4
- 230000002207 retinal effect Effects 0.000 description 4
- SPEUIVXLLWOEMJ-UHFFFAOYSA-N 1,1-dimethoxyethane Chemical group COC(C)OC SPEUIVXLLWOEMJ-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 3
- 238000005903 acid hydrolysis reaction Methods 0.000 description 3
- 150000001336 alkenes Chemical class 0.000 description 3
- FPIPGXGPPPQFEQ-OVSJKPMPSA-N all-trans-retinol Chemical compound OC\C=C(/C)\C=C\C=C(/C)\C=C\C1=C(C)CCCC1(C)C FPIPGXGPPPQFEQ-OVSJKPMPSA-N 0.000 description 3
- 239000003054 catalyst Substances 0.000 description 3
- 230000007062 hydrolysis Effects 0.000 description 3
- 238000006460 hydrolysis reaction Methods 0.000 description 3
- CPJRRXSHAYUTGL-UHFFFAOYSA-N isopentenyl alcohol Chemical compound CC(=C)CCO CPJRRXSHAYUTGL-UHFFFAOYSA-N 0.000 description 3
- QQONPFPTGQHPMA-UHFFFAOYSA-N propylene Natural products CC=C QQONPFPTGQHPMA-UHFFFAOYSA-N 0.000 description 3
- 230000035484 reaction time Effects 0.000 description 3
- PUPZLCDOIYMWBV-UHFFFAOYSA-N (+/-)-1,3-Butanediol Chemical compound CC(O)CCO PUPZLCDOIYMWBV-UHFFFAOYSA-N 0.000 description 2
- FPIPGXGPPPQFEQ-UHFFFAOYSA-N 13-cis retinol Natural products OCC=C(C)C=CC=C(C)C=CC1=C(C)CCCC1(C)C FPIPGXGPPPQFEQ-UHFFFAOYSA-N 0.000 description 2
- 238000005160 1H NMR spectroscopy Methods 0.000 description 2
- QWGRWMMWNDWRQN-UHFFFAOYSA-N 2-methylpropane-1,3-diol Chemical compound OCC(C)CO QWGRWMMWNDWRQN-UHFFFAOYSA-N 0.000 description 2
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 2
- 238000005481 NMR spectroscopy Methods 0.000 description 2
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- DKGAVHZHDRPRBM-UHFFFAOYSA-N Tert-Butanol Chemical compound CC(C)(C)O DKGAVHZHDRPRBM-UHFFFAOYSA-N 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- 230000002378 acidificating effect Effects 0.000 description 2
- 150000001299 aldehydes Chemical class 0.000 description 2
- 238000004458 analytical method Methods 0.000 description 2
- OENHQHLEOONYIE-UKMVMLAPSA-N beta-Carotene Chemical compound CC=1CCCC(C)(C)C=1/C=C/C(/C)=C/C=C/C(/C)=C/C=C/C=C(C)C=CC=C(C)C=CC1=C(C)CCCC1(C)C OENHQHLEOONYIE-UKMVMLAPSA-N 0.000 description 2
- 239000006227 byproduct Substances 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- 238000003776 cleavage reaction Methods 0.000 description 2
- 230000008030 elimination Effects 0.000 description 2
- 238000003379 elimination reaction Methods 0.000 description 2
- LEQAOMBKQFMDFZ-UHFFFAOYSA-N glyoxal Chemical compound O=CC=O LEQAOMBKQFMDFZ-UHFFFAOYSA-N 0.000 description 2
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 2
- BLLFVUPNHCTMSV-UHFFFAOYSA-N methyl nitrite Chemical compound CON=O BLLFVUPNHCTMSV-UHFFFAOYSA-N 0.000 description 2
- 239000000203 mixture Substances 0.000 description 2
- JRZJOMJEPLMPRA-UHFFFAOYSA-N olefin Natural products CCCCCCCC=C JRZJOMJEPLMPRA-UHFFFAOYSA-N 0.000 description 2
- 230000003647 oxidation Effects 0.000 description 2
- 238000007254 oxidation reaction Methods 0.000 description 2
- 230000000144 pharmacologic effect Effects 0.000 description 2
- YPFDHNVEDLHUCE-UHFFFAOYSA-N propane-1,3-diol Chemical compound OCCCO YPFDHNVEDLHUCE-UHFFFAOYSA-N 0.000 description 2
- 239000002994 raw material Substances 0.000 description 2
- 239000000376 reactant Substances 0.000 description 2
- 150000003839 salts Chemical class 0.000 description 2
- 230000007017 scission Effects 0.000 description 2
- 238000000926 separation method Methods 0.000 description 2
- MFRIHAYPQRLWNB-UHFFFAOYSA-N sodium tert-butoxide Chemical compound [Na+].CC(C)(C)[O-] MFRIHAYPQRLWNB-UHFFFAOYSA-N 0.000 description 2
- 238000004611 spectroscopical analysis Methods 0.000 description 2
- 238000003786 synthesis reaction Methods 0.000 description 2
- 150000003505 terpenes Chemical class 0.000 description 2
- 235000007586 terpenes Nutrition 0.000 description 2
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 2
- 238000010626 work up procedure Methods 0.000 description 2
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- HTSGKJQDMSTCGS-UHFFFAOYSA-N 1,4-bis(4-chlorophenyl)-2-(4-methylphenyl)sulfonylbutane-1,4-dione Chemical compound C1=CC(C)=CC=C1S(=O)(=O)C(C(=O)C=1C=CC(Cl)=CC=1)CC(=O)C1=CC=C(Cl)C=C1 HTSGKJQDMSTCGS-UHFFFAOYSA-N 0.000 description 1
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 1
- OCKGFTQIICXDQW-ZEQRLZLVSA-N 5-[(1r)-1-hydroxy-2-[4-[(2r)-2-hydroxy-2-(4-methyl-1-oxo-3h-2-benzofuran-5-yl)ethyl]piperazin-1-yl]ethyl]-4-methyl-3h-2-benzofuran-1-one Chemical compound C1=C2C(=O)OCC2=C(C)C([C@@H](O)CN2CCN(CC2)C[C@H](O)C2=CC=C3C(=O)OCC3=C2C)=C1 OCKGFTQIICXDQW-ZEQRLZLVSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical compound OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 1
- 239000004358 Butane-1, 3-diol Substances 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- VQTUBCCKSQIDNK-UHFFFAOYSA-N Isobutene Chemical group CC(C)=C VQTUBCCKSQIDNK-UHFFFAOYSA-N 0.000 description 1
- CBENFWSGALASAD-UHFFFAOYSA-N Ozone Chemical compound [O-][O+]=O CBENFWSGALASAD-UHFFFAOYSA-N 0.000 description 1
- 125000000066 S-methyl group Chemical group [H]C([H])([H])S* 0.000 description 1
- BUGBHKTXTAQXES-UHFFFAOYSA-N Selenium Chemical compound [Se] BUGBHKTXTAQXES-UHFFFAOYSA-N 0.000 description 1
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 description 1
- FPIPGXGPPPQFEQ-BOOMUCAASA-N Vitamin A Natural products OC/C=C(/C)\C=C\C=C(\C)/C=C/C1=C(C)CCCC1(C)C FPIPGXGPPPQFEQ-BOOMUCAASA-N 0.000 description 1
- 125000004036 acetal group Chemical group 0.000 description 1
- 230000021736 acetylation Effects 0.000 description 1
- 238000006640 acetylation reaction Methods 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 150000001350 alkyl halides Chemical class 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- 239000011648 beta-carotene Substances 0.000 description 1
- TUPZEYHYWIEDIH-WAIFQNFQSA-N beta-carotene Natural products CC(=C/C=C/C=C(C)/C=C/C=C(C)/C=C/C1=C(C)CCCC1(C)C)C=CC=C(/C)C=CC2=CCCCC2(C)C TUPZEYHYWIEDIH-WAIFQNFQSA-N 0.000 description 1
- 235000013734 beta-carotene Nutrition 0.000 description 1
- 229960002747 betacarotene Drugs 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 239000001273 butane Substances 0.000 description 1
- 235000019437 butane-1,3-diol Nutrition 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- KRVSOGSZCMJSLX-UHFFFAOYSA-L chromic acid Substances O[Cr](O)(=O)=O KRVSOGSZCMJSLX-UHFFFAOYSA-L 0.000 description 1
- 150000001845 chromium compounds Chemical class 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- 239000010949 copper Substances 0.000 description 1
- MLUCVPSAIODCQM-UHFFFAOYSA-N crotonaldehyde Natural products CC=CC=O MLUCVPSAIODCQM-UHFFFAOYSA-N 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 125000004122 cyclic group Chemical group 0.000 description 1
- 238000006356 dehydrogenation reaction Methods 0.000 description 1
- KPVWDKBJLIDKEP-UHFFFAOYSA-L dihydroxy(dioxo)chromium;sulfuric acid Chemical compound OS(O)(=O)=O.O[Cr](O)(=O)=O KPVWDKBJLIDKEP-UHFFFAOYSA-L 0.000 description 1
- 150000002009 diols Chemical class 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 235000019253 formic acid Nutrition 0.000 description 1
- AWJWCTOOIBYHON-UHFFFAOYSA-N furo[3,4-b]pyrazine-5,7-dione Chemical compound C1=CN=C2C(=O)OC(=O)C2=N1 AWJWCTOOIBYHON-UHFFFAOYSA-N 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 229940015043 glyoxal Drugs 0.000 description 1
- 150000008282 halocarbons Chemical class 0.000 description 1
- 231100000086 high toxicity Toxicity 0.000 description 1
- 229910000039 hydrogen halide Inorganic materials 0.000 description 1
- 239000012433 hydrogen halide Substances 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- SKRDXYBATCVEMS-UHFFFAOYSA-N isopropyl nitrite Chemical compound CC(C)ON=O SKRDXYBATCVEMS-UHFFFAOYSA-N 0.000 description 1
- XGZVUEUWXADBQD-UHFFFAOYSA-L lithium carbonate Chemical compound [Li+].[Li+].[O-]C([O-])=O XGZVUEUWXADBQD-UHFFFAOYSA-L 0.000 description 1
- 229910052808 lithium carbonate Inorganic materials 0.000 description 1
- 229910044991 metal oxide Inorganic materials 0.000 description 1
- 150000004706 metal oxides Chemical class 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- IJDNQMDRQITEOD-UHFFFAOYSA-N n-butane Chemical compound CCCC IJDNQMDRQITEOD-UHFFFAOYSA-N 0.000 description 1
- OFBQJSOFQDEBGM-UHFFFAOYSA-N n-pentane Natural products CCCCC OFBQJSOFQDEBGM-UHFFFAOYSA-N 0.000 description 1
- SLCVBVWXLSEKPL-UHFFFAOYSA-N neopentyl glycol Chemical compound OCC(C)(C)CO SLCVBVWXLSEKPL-UHFFFAOYSA-N 0.000 description 1
- 238000006386 neutralization reaction Methods 0.000 description 1
- 150000002826 nitrites Chemical class 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 239000012074 organic phase Substances 0.000 description 1
- 239000007800 oxidant agent Substances 0.000 description 1
- 230000001590 oxidative effect Effects 0.000 description 1
- 238000005949 ozonolysis reaction Methods 0.000 description 1
- GTCCGKPBSJZVRZ-UHFFFAOYSA-N pentane-2,4-diol Chemical compound CC(O)CC(C)O GTCCGKPBSJZVRZ-UHFFFAOYSA-N 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 1
- 150000003254 radicals Chemical class 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 229960003471 retinol Drugs 0.000 description 1
- 235000020944 retinol Nutrition 0.000 description 1
- 239000011607 retinol Substances 0.000 description 1
- 229910052711 selenium Inorganic materials 0.000 description 1
- 239000011669 selenium Substances 0.000 description 1
- JPJALAQPGMAKDF-UHFFFAOYSA-N selenium dioxide Chemical compound O=[Se]=O JPJALAQPGMAKDF-UHFFFAOYSA-N 0.000 description 1
- 239000010865 sewage Substances 0.000 description 1
- 229910052709 silver Inorganic materials 0.000 description 1
- 239000004332 silver Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- QDRKDTQENPPHOJ-UHFFFAOYSA-N sodium ethoxide Chemical compound [Na+].CC[O-] QDRKDTQENPPHOJ-UHFFFAOYSA-N 0.000 description 1
- SUBJHSREKVAVAR-UHFFFAOYSA-N sodium;methanol;methanolate Chemical compound [Na+].OC.[O-]C SUBJHSREKVAVAR-UHFFFAOYSA-N 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- 231100000419 toxicity Toxicity 0.000 description 1
- 230000001988 toxicity Effects 0.000 description 1
- 238000006886 vinylation reaction Methods 0.000 description 1
- 235000019155 vitamin A Nutrition 0.000 description 1
- 239000011719 vitamin A Substances 0.000 description 1
- 229940045997 vitamin a Drugs 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D319/00—Heterocyclic compounds containing six-membered rings having two oxygen atoms as the only ring hetero atoms
- C07D319/04—1,3-Dioxanes; Hydrogenated 1,3-dioxanes
- C07D319/06—1,3-Dioxanes; Hydrogenated 1,3-dioxanes not condensed with other rings
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Heterocyclic Compounds That Contain Two Or More Ring Oxygen Atoms (AREA)
Priority Applications (6)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19782842715 DE2842715A1 (de) | 1978-09-30 | 1978-09-30 | 3-chlor-3-methyl-butan- bzw. 3-methyl- 2-buten-1,4-dial-bis-acetale, ein verfahren zur herstellung dieser verbindungen sowie deren verwendung |
| CA335,668A CA1130811A (en) | 1978-09-30 | 1979-09-14 | 3-chloro-3-methyl-butane-1,4-dial-bis- acetals and 3-methyl-but-2-ene-1,4-dial- bis-acetals, a process for the preparation of these compounds and their use |
| US06/076,412 US4256643A (en) | 1978-09-30 | 1979-09-17 | 3-Chloro-3-methyl-butane-1,4-dial-bis-acetals and 3-methyl-but-2-ene-1,4-dial-bis-acetals, a process for the preparation of these compounds and their use |
| DE7979103630T DE2960253D1 (en) | 1978-09-30 | 1979-09-25 | 3-chloro-3-methyl-butane- or 3-methyl-2-butene-1,4-dial-bis acetals, process for their preparation and their use |
| EP79103630A EP0009752B1 (de) | 1978-09-30 | 1979-09-25 | 3-Chlor-3-methyl-butan- bzw. 3-Methyl-2-buten-1,4-dial-bis-acetale, ein Verfahren zur Herstellung dieser Verbindungen sowie deren Verwendung |
| JP12543479A JPS5549373A (en) | 1978-09-30 | 1979-10-01 | 33chloroo33methyllbutanee or 33methyll22butenee1*44diaryllbisacetal and its manufacture |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19782842715 DE2842715A1 (de) | 1978-09-30 | 1978-09-30 | 3-chlor-3-methyl-butan- bzw. 3-methyl- 2-buten-1,4-dial-bis-acetale, ein verfahren zur herstellung dieser verbindungen sowie deren verwendung |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2842715A1 true DE2842715A1 (de) | 1980-04-10 |
Family
ID=6051012
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19782842715 Pending DE2842715A1 (de) | 1978-09-30 | 1978-09-30 | 3-chlor-3-methyl-butan- bzw. 3-methyl- 2-buten-1,4-dial-bis-acetale, ein verfahren zur herstellung dieser verbindungen sowie deren verwendung |
| DE7979103630T Expired DE2960253D1 (en) | 1978-09-30 | 1979-09-25 | 3-chloro-3-methyl-butane- or 3-methyl-2-butene-1,4-dial-bis acetals, process for their preparation and their use |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE7979103630T Expired DE2960253D1 (en) | 1978-09-30 | 1979-09-25 | 3-chloro-3-methyl-butane- or 3-methyl-2-butene-1,4-dial-bis acetals, process for their preparation and their use |
Country Status (5)
| Country | Link |
|---|---|
| US (1) | US4256643A (cg-RX-API-DMAC7.html) |
| EP (1) | EP0009752B1 (cg-RX-API-DMAC7.html) |
| JP (1) | JPS5549373A (cg-RX-API-DMAC7.html) |
| CA (1) | CA1130811A (cg-RX-API-DMAC7.html) |
| DE (2) | DE2842715A1 (cg-RX-API-DMAC7.html) |
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5120864A (en) * | 1989-12-01 | 1992-06-09 | Rhone-Poulenc Nutrition Animale | Intermediates, process for their preparation, and their use for the synthesis of vitamins a and e |
| US5266708A (en) * | 1989-12-01 | 1993-11-30 | Rhone-Poulenc Nutrition Animale | New intermediates, process for their preparation, and their use for the synthesis of vitamins A and E |
Families Citing this family (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2917413A1 (de) * | 1979-04-28 | 1980-11-06 | Basf Ag | Verfahren zur herstellung von cyclischen acetalen von trans-4-chlor-3-methyl- 2-buten-1-al sowie von trans-3-methyl-2- buten-1,4-dial-1-monoacetalen |
| DE3602253A1 (de) * | 1986-01-25 | 1987-07-30 | Basf Ag | Verfahren zur herstellung von 4-monoacetalen des 2-methyl-2-buten-1,4-dials |
| CN107108426A (zh) * | 2014-12-24 | 2017-08-29 | 株式会社可乐丽 | 醛化合物的制造方法及缩醛化合物 |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3671590A (en) * | 1968-09-09 | 1972-06-20 | Exxon Research Engineering Co | Process for forming carbonyl compounds |
| DE2225612C2 (de) * | 1972-05-26 | 1982-07-01 | Basf Ag, 6700 Ludwigshafen | Cyclische Methyl-fumardialdehyd-monoacetale und Verfahren zu ihrer Herstellung |
| DE2357752A1 (de) * | 1973-11-20 | 1975-05-28 | Basf Ag | Verfahren zur herstellung von cyclischen trans-3-methyl-2-buten-1,4-dial-1- acetalen |
| DE2513999A1 (de) * | 1975-03-29 | 1976-10-07 | Basf Ag | Verfahren zur herstellung von trans-3-methyl-2-buten-1,4-dial-1- acetalen |
| SU529170A1 (ru) * | 1975-07-30 | 1976-09-25 | Уфимский Нефтяной Институт | 2-Метил-2- -(4-метилдиоксан-2ил)-этил-1,3-диоксацикланы в качестве пластификаторов к поливинилхлориду |
| DE2659507A1 (de) * | 1976-12-30 | 1978-07-13 | Basf Ag | Cyclische 2-methyl-2,4-dialkoxy- 3-buten-1-al-acetale, deren herstellung und verwendung |
-
1978
- 1978-09-30 DE DE19782842715 patent/DE2842715A1/de active Pending
-
1979
- 1979-09-14 CA CA335,668A patent/CA1130811A/en not_active Expired
- 1979-09-17 US US06/076,412 patent/US4256643A/en not_active Expired - Lifetime
- 1979-09-25 EP EP79103630A patent/EP0009752B1/de not_active Expired
- 1979-09-25 DE DE7979103630T patent/DE2960253D1/de not_active Expired
- 1979-10-01 JP JP12543479A patent/JPS5549373A/ja active Granted
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5120864A (en) * | 1989-12-01 | 1992-06-09 | Rhone-Poulenc Nutrition Animale | Intermediates, process for their preparation, and their use for the synthesis of vitamins a and e |
| US5266708A (en) * | 1989-12-01 | 1993-11-30 | Rhone-Poulenc Nutrition Animale | New intermediates, process for their preparation, and their use for the synthesis of vitamins A and E |
Also Published As
| Publication number | Publication date |
|---|---|
| JPS5549373A (en) | 1980-04-09 |
| CA1130811A (en) | 1982-08-31 |
| DE2960253D1 (en) | 1981-04-30 |
| EP0009752B1 (de) | 1981-04-08 |
| US4256643A (en) | 1981-03-17 |
| JPS6313995B2 (cg-RX-API-DMAC7.html) | 1988-03-29 |
| EP0009752A1 (de) | 1980-04-16 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP2432773B1 (de) | Verfahren zur Herstellung von 2-substituierten Tetrahydropyranolen | |
| EP0150280B1 (de) | Verfahren zur Herstellung von Acetalen | |
| DE2533920A1 (de) | Verfahren zur herstellung von resorcinen | |
| DE2715080C2 (de) | Verfahren zur Herstellung von Cyclopent-2-enon-Derivaten | |
| DE68922936T2 (de) | Verfahren zur Herstellung von Serinol. | |
| DE2216974C3 (de) | Verfahren zur Herstellung höhermolekularer ungesättigter Ketone | |
| EP0009752B1 (de) | 3-Chlor-3-methyl-butan- bzw. 3-Methyl-2-buten-1,4-dial-bis-acetale, ein Verfahren zur Herstellung dieser Verbindungen sowie deren Verwendung | |
| EP1241157B1 (de) | Verfahren zur Herstellung von 2,7-Dimethyl-2,4,6-octatrienal-monoacetalen | |
| EP0001089B1 (de) | Verfahren zur Herstellung von halogenvinylsubstituierten Tetrahydrofuran-2-onen, bestimmte halogenvinylsubstituierte Tetrahydrofuran-2-one | |
| EP0038480B1 (de) | Verfahren zur Herstellung von 1-(4-Hydroxy-phenyl)-butan-3-on sowie neue Zwischenprodukte dieses Verfahrens | |
| DE2952719A1 (de) | Verfahren zur herstellung von p-substituierten phenylpropanolen und deren estern | |
| EP0079432B1 (de) | Verfahren zur Herstellung von Methacrylsäure aus Isobutyraldehyd | |
| DE19647117A1 (de) | Verfahren zur Herstellung gamma,delta-ungesättigten Ketonen durch Caroll-Reaktion in cyclischen Carbonaten oder gamma-Lactonen als Lösungsmittel | |
| DE2157035C3 (de) | Verfahren zur Herstellung höhermolekularer alpha-beta-ungesättigter Aldehyde | |
| EP0019112B1 (de) | Verfahren zur Herstellung von cyclischen Acetalen von trans-4-Chlor-3-methyl-2-buten-1-al sowie von trans-3-Methyl-2-buten-1,4-dial-1-monoacetalen | |
| EP0502376B1 (de) | Verfahren zur Herstellen alpha, beta-ungesättigter Aldehyde und Ketone | |
| EP0182168B1 (de) | Verfahren zur Herstellung von Hydroxymethylen-alkoxyessigsäureestern | |
| DE2228333C3 (de) | Verfahren zur Herstellung von gegebenenfalls substituierten 2-Butin-4olen | |
| EP0436860A1 (de) | Verfahren zur Herstellung von 2-(4-Chlorphenyl)-3-methyl-buttersäure | |
| DE2143991C3 (de) | 2,6-Dimethyl-2,6-undecadien-10on-l-al und seine Acetale | |
| DE3738535A1 (de) | Verfahren zur herstellung von glyoxalmonoacetalen und neue glyoxalmonoacetale | |
| EP0591799B1 (de) | Oxidation von Hydroxybenzaldehyden zur Herstellung von Dihydroxybenzol Verbindungen | |
| EP0061669A1 (de) | Verbessertes Verfahren zur Herstellung von Cyclohexan-1,3-dionen sowie einige neue bicyclische Cyclohexan-1,3-dione | |
| DE2357753B2 (de) | 2- bzw. 3-Methyl-4-alkoxy(aryloxy)-3-buten-l-ale und Verfahren zu deren Herstellung | |
| EP0087712B1 (de) | Verfahren zur Herstellung von 3-Cyan-2-alkylalkanalen und die Verwendung von 3-Cyan-2-ethylhexanal zur Herstellung von 2-Propylpentansäure |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OHN | Withdrawal |