DE2629898A1 - Maschine mit kugelfoermigem kolben - Google Patents
Maschine mit kugelfoermigem kolbenInfo
- Publication number
- DE2629898A1 DE2629898A1 DE19762629898 DE2629898A DE2629898A1 DE 2629898 A1 DE2629898 A1 DE 2629898A1 DE 19762629898 DE19762629898 DE 19762629898 DE 2629898 A DE2629898 A DE 2629898A DE 2629898 A1 DE2629898 A1 DE 2629898A1
- Authority
- DE
- Germany
- Prior art keywords
- piston
- machine
- machine according
- axis
- elements
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Withdrawn
Links
- 230000005540 biological transmission Effects 0.000 claims description 8
- 230000008878 coupling Effects 0.000 claims description 8
- 238000010168 coupling process Methods 0.000 claims description 8
- 238000005859 coupling reaction Methods 0.000 claims description 8
- 238000006073 displacement reaction Methods 0.000 claims description 8
- 230000001154 acute effect Effects 0.000 claims 2
- 238000002485 combustion reaction Methods 0.000 description 7
- 238000004880 explosion Methods 0.000 description 7
- 238000000034 method Methods 0.000 description 5
- 239000000203 mixture Substances 0.000 description 5
- 230000008569 process Effects 0.000 description 5
- 230000008859 change Effects 0.000 description 4
- 238000004891 communication Methods 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 230000009467 reduction Effects 0.000 description 2
- 230000007704 transition Effects 0.000 description 2
- FGRBYDKOBBBPOI-UHFFFAOYSA-N 10,10-dioxo-2-[4-(N-phenylanilino)phenyl]thioxanthen-9-one Chemical compound O=C1c2ccccc2S(=O)(=O)c2ccc(cc12)-c1ccc(cc1)N(c1ccccc1)c1ccccc1 FGRBYDKOBBBPOI-UHFFFAOYSA-N 0.000 description 1
- 241001620634 Roger Species 0.000 description 1
- 230000008901 benefit Effects 0.000 description 1
- 239000000567 combustion gas Substances 0.000 description 1
- 230000006835 compression Effects 0.000 description 1
- 238000007906 compression Methods 0.000 description 1
- 238000010276 construction Methods 0.000 description 1
- 230000007423 decrease Effects 0.000 description 1
- 239000012530 fluid Substances 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 210000000056 organ Anatomy 0.000 description 1
- 230000010355 oscillation Effects 0.000 description 1
- 238000007789 sealing Methods 0.000 description 1
Classifications
-
- F—MECHANICAL ENGINEERING; LIGHTING; HEATING; WEAPONS; BLASTING
- F01—MACHINES OR ENGINES IN GENERAL; ENGINE PLANTS IN GENERAL; STEAM ENGINES
- F01C—ROTARY-PISTON OR OSCILLATING-PISTON MACHINES OR ENGINES
- F01C9/00—Oscillating-piston machines or engines
- F01C9/005—Oscillating-piston machines or engines the piston oscillating in the space, e.g. around a fixed point
Landscapes
- Engineering & Computer Science (AREA)
- Mechanical Engineering (AREA)
- General Engineering & Computer Science (AREA)
- Reciprocating Pumps (AREA)
- Hydraulic Motors (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH865075A CH597502A5 (enExample) | 1975-07-03 | 1975-07-03 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2629898A1 true DE2629898A1 (de) | 1977-01-27 |
Family
ID=4343086
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19762629898 Withdrawn DE2629898A1 (de) | 1975-07-03 | 1976-07-02 | Maschine mit kugelfoermigem kolben |
Country Status (8)
| Country | Link |
|---|---|
| US (1) | US4021158A (enExample) |
| JP (1) | JPS528503A (enExample) |
| CA (1) | CA1058964A (enExample) |
| CH (1) | CH597502A5 (enExample) |
| DE (1) | DE2629898A1 (enExample) |
| FR (1) | FR2316433A1 (enExample) |
| GB (1) | GB1549269A (enExample) |
| IT (1) | IT1063697B (enExample) |
Families Citing this family (16)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NO148042C (no) * | 1981-03-02 | 1983-07-27 | Thor Larsen | Kraftomsetningsmaskin med et stempel som kan foreta en kombinert dreie- og vippebevegelse |
| CH645698A5 (fr) * | 1982-03-25 | 1984-10-15 | Roger Bajulaz | Machine a chambres et pistons oscillants. |
| EP0127694B1 (fr) * | 1983-06-04 | 1988-05-11 | Roger Bajulaz | Machine à chambres et pistons oscillants |
| JP2604159B2 (ja) * | 1986-06-25 | 1997-04-30 | 邦夫 岡部 | 三次元的容積変化ロータリ機構 |
| NO160540C (no) * | 1986-11-24 | 1989-04-26 | 3 D Int As | Kraftomsetningsmaskin med stempler som beveges i en dreiebevegelse i et sfaerisk hus. |
| US4979882A (en) * | 1989-03-13 | 1990-12-25 | Wisconsin Alumni Research Foundation | Spherical rotary machine having six rotary pistons |
| US5404849A (en) * | 1991-12-11 | 1995-04-11 | Fenton; John W. | Spherical engine |
| PT885358E (pt) * | 1996-12-13 | 2001-07-31 | Juri Keikov | Bomba de embolo rotativo |
| DE102005007912A1 (de) * | 2005-02-08 | 2006-08-17 | Hüttlin, Herbert, Dr. h.c. | Schwenkkolbenmaschine sowie Schwenkkolbenmaschinenanordnung |
| DE102005010775B3 (de) * | 2005-02-25 | 2006-04-20 | Hüttlin, Herbert, Dr. h.c. | Schwenkkolbenmaschine |
| WO2006099606A2 (en) * | 2005-03-16 | 2006-09-21 | Searchmont Llc. | Radial axis, spherical based rotary machines |
| WO2009127791A1 (fr) * | 2008-04-17 | 2009-10-22 | Olivier Joseph | Dispositif mecanique |
| PT105954B (pt) * | 2011-10-21 | 2014-10-27 | Jorge De Herédia | Motor rotativo de combustão interna |
| GB201520830D0 (en) | 2015-11-25 | 2016-01-06 | Fenton Jonathan P | Fluid compression apparatus |
| GB2571354B (en) | 2018-02-27 | 2020-04-15 | Fetu Ltd | Roticulating thermodynamic apparatus |
| PL448938A1 (pl) * | 2024-06-22 | 2025-03-17 | Henryk Sobczuk | Maszyna rotacyjna |
Family Cites Families (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US1186610A (en) * | 1915-08-20 | 1916-06-13 | Walter H Richards | Water-meter. |
| US2060209A (en) * | 1935-03-07 | 1936-11-10 | Frederick W Heckert | Fuel pump for aircraft engines |
| US2197959A (en) * | 1937-06-02 | 1940-04-23 | Roland Stanley Quartermaine | Rotary prime mover, pump, compressor, and the like |
| US2496668A (en) * | 1946-02-18 | 1950-02-07 | David O Manseau | Nutating axis rotary compressor |
| US2982222A (en) * | 1958-04-14 | 1961-05-02 | Thompson Ramo Wooldridge Inc | Dual nutating disc apparatus |
| IT699973A (enExample) * | 1961-03-10 | |||
| GB1259801A (en) * | 1968-01-26 | 1972-01-12 | Riccardo Bertoni | A nutating piston fluid machine |
| US3556696A (en) * | 1968-01-26 | 1971-01-19 | Riccardo Bertoni | Spherical motor |
-
1975
- 1975-07-03 CH CH865075A patent/CH597502A5/xx not_active IP Right Cessation
- 1975-09-02 US US05/609,817 patent/US4021158A/en not_active Expired - Lifetime
-
1976
- 1976-06-25 CA CA255,678A patent/CA1058964A/en not_active Expired
- 1976-06-28 GB GB26850/76A patent/GB1549269A/en not_active Expired
- 1976-06-30 IT IT24844/76A patent/IT1063697B/it active
- 1976-07-01 FR FR7620050A patent/FR2316433A1/fr active Granted
- 1976-07-02 DE DE19762629898 patent/DE2629898A1/de not_active Withdrawn
- 1976-07-02 JP JP51077972A patent/JPS528503A/ja active Pending
Also Published As
| Publication number | Publication date |
|---|---|
| FR2316433A1 (fr) | 1977-01-28 |
| CA1058964A (en) | 1979-07-24 |
| GB1549269A (en) | 1979-08-01 |
| FR2316433B1 (enExample) | 1981-08-07 |
| IT1063697B (it) | 1985-02-11 |
| JPS528503A (en) | 1977-01-22 |
| US4021158A (en) | 1977-05-03 |
| CH597502A5 (enExample) | 1978-04-14 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2629898A1 (de) | Maschine mit kugelfoermigem kolben | |
| DE2631234A1 (de) | Von einem fluessigen oder gasfoermigen medium betriebene kraftmaschine | |
| EP0548297B1 (de) | Schwenkkolbenmaschine | |
| DE2209996C3 (de) | Einrichtung zum Verändern der Arbeitsmittelmenge einer Druckflüssigkeit«-Axialkolbenmaschine | |
| DE3331636A1 (de) | Aggregat bestehend aus einer hubkolbenmaschine und einem getriebe | |
| DE1451690B2 (de) | Parallel- und innenachsige Kreiskolbenmaschine mit Kämmeingriff | |
| DE1551082C3 (de) | Schrägachsige Rotationskolbenmaschine | |
| DE3343826C2 (enExample) | ||
| DE3347859A1 (de) | Zweitakt-kolben-brennkraftmaschine | |
| DE3420956A1 (de) | Synchronisiergetriebe fuer ein zentrisches, gleichschenkliges geradschubkurbelgetriebe einer hubkolbenmaschine | |
| AT227054B (de) | Kraft- bzw. Arbeitsmaschine mit rotierenden Kolben | |
| DE2321763A1 (de) | Rotationskolbenmaschine | |
| DE1803362A1 (de) | Drehkolbenmaschine | |
| DE2808769A1 (de) | Schwenkkolben-maschine | |
| DE2201427C3 (de) | Parallel- und auBenachsige Rotationskolben-Brennkraftmaschine | |
| DE666396C (de) | Drehkolbenmaschine mit zwei axial nebeneinanderliegenden Arbeitsraeumen und parallelzur Achse angeordnetem, zwangslaeufig gesteuertem Widerlagerschieber | |
| EP3522724B1 (de) | Verstellbarer wirkexzenter | |
| AT258040B (de) | Innenachsige Rotationskolbenmaschine der Trochoidenbauweise | |
| DE2132834B2 (de) | Umlaufkolbenmaschine | |
| DE242140C (enExample) | ||
| DE3824539A1 (de) | Kraftmaschine, insbesondere brennkraftmaschine | |
| DE9016807U1 (de) | Drehkolbenmaschine | |
| DE2529351A1 (de) | Rotationskolbenmaschine | |
| DE2610969A1 (de) | Kolben-kraft- und arbeitsmaschine | |
| DE2353008A1 (de) | Schwingkolbenmaschine |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8141 | Disposal/no request for examination |