DE2428139A1 - Cephalosporine, verfahren zu ihrer herstellung und diese verbindungen enthaltende arzneipraeparate - Google Patents
Cephalosporine, verfahren zu ihrer herstellung und diese verbindungen enthaltende arzneipraeparateInfo
- Publication number
- DE2428139A1 DE2428139A1 DE19742428139 DE2428139A DE2428139A1 DE 2428139 A1 DE2428139 A1 DE 2428139A1 DE 19742428139 DE19742428139 DE 19742428139 DE 2428139 A DE2428139 A DE 2428139A DE 2428139 A1 DE2428139 A1 DE 2428139A1
- Authority
- DE
- Germany
- Prior art keywords
- protons
- radical
- methyl
- cephalosporins
- formula
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 150000001875 compounds Chemical class 0.000 title claims description 26
- 238000000034 method Methods 0.000 title claims description 8
- 238000002360 preparation method Methods 0.000 title claims description 7
- 238000004519 manufacturing process Methods 0.000 title claims description 6
- 230000008569 process Effects 0.000 title claims description 6
- HOKIDJSKDBPKTQ-UHFFFAOYSA-N 3-(acetyloxymethyl)-7-[(5-amino-5-carboxypentanoyl)amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound S1CC(COC(=O)C)=C(C(O)=O)N2C(=O)C(NC(=O)CCCC(N)C(O)=O)C12 HOKIDJSKDBPKTQ-UHFFFAOYSA-N 0.000 title 1
- -1 alkyl radical Chemical class 0.000 claims description 149
- 125000003118 aryl group Chemical group 0.000 claims description 74
- 229930186147 Cephalosporin Natural products 0.000 claims description 41
- 229940124587 cephalosporin Drugs 0.000 claims description 41
- 150000001780 cephalosporins Chemical class 0.000 claims description 36
- 239000002253 acid Substances 0.000 claims description 28
- 150000003839 salts Chemical class 0.000 claims description 28
- 229910052799 carbon Inorganic materials 0.000 claims description 24
- 150000002148 esters Chemical class 0.000 claims description 24
- 125000004432 carbon atom Chemical group C* 0.000 claims description 20
- OLRJXMHANKMLTD-UHFFFAOYSA-N silyl Chemical compound [SiH3] OLRJXMHANKMLTD-UHFFFAOYSA-N 0.000 claims description 12
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical group [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims description 11
- 125000000217 alkyl group Chemical group 0.000 claims description 10
- 125000003277 amino group Chemical group 0.000 claims description 8
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 8
- 125000001181 organosilyl group Chemical group [SiH3]* 0.000 claims description 8
- 125000002541 furyl group Chemical group 0.000 claims description 7
- 230000000269 nucleophilic effect Effects 0.000 claims description 7
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 7
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 6
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical group [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 6
- 125000005843 halogen group Chemical group 0.000 claims description 6
- 229910052757 nitrogen Chemical group 0.000 claims description 6
- 229910052717 sulfur Inorganic materials 0.000 claims description 6
- 125000001544 thienyl group Chemical group 0.000 claims description 6
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical compound [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 claims description 5
- 125000003668 acetyloxy group Chemical group [H]C([H])([H])C(=O)O[*] 0.000 claims description 5
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 5
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 5
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 5
- 150000003254 radicals Chemical class 0.000 claims description 5
- 125000003545 alkoxy group Chemical group 0.000 claims description 4
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 4
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 claims description 4
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 4
- 125000000636 p-nitrophenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)[N+]([O-])=O 0.000 claims description 4
- 239000011734 sodium Substances 0.000 claims description 4
- 229910052708 sodium Inorganic materials 0.000 claims description 4
- 125000000175 2-thienyl group Chemical group S1C([*])=C([H])C([H])=C1[H] 0.000 claims description 3
- SLRMQYXOBQWXCR-UHFFFAOYSA-N 2154-56-5 Chemical compound [CH2]C1=CC=CC=C1 SLRMQYXOBQWXCR-UHFFFAOYSA-N 0.000 claims description 3
- 125000004203 4-hydroxyphenyl group Chemical group [H]OC1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 3
- MYMOFIZGZYHOMD-UHFFFAOYSA-N Dioxygen Chemical compound O=O MYMOFIZGZYHOMD-UHFFFAOYSA-N 0.000 claims description 3
- 238000006136 alcoholysis reaction Methods 0.000 claims description 3
- 238000003776 cleavage reaction Methods 0.000 claims description 3
- 230000007062 hydrolysis Effects 0.000 claims description 3
- 238000006460 hydrolysis reaction Methods 0.000 claims description 3
- 229910052760 oxygen Inorganic materials 0.000 claims description 3
- 239000001301 oxygen Substances 0.000 claims description 3
- 125000006239 protecting group Chemical group 0.000 claims description 3
- 230000009467 reduction Effects 0.000 claims description 3
- 230000007017 scission Effects 0.000 claims description 3
- 239000011593 sulfur Substances 0.000 claims description 3
- 125000004434 sulfur atom Chemical group 0.000 claims description 3
- 125000001541 3-thienyl group Chemical group S1C([H])=C([*])C([H])=C1[H] 0.000 claims description 2
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical class [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 claims description 2
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical class [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 claims description 2
- 239000004480 active ingredient Substances 0.000 claims description 2
- 125000002252 acyl group Chemical group 0.000 claims description 2
- 125000003342 alkenyl group Chemical group 0.000 claims description 2
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 2
- 150000001721 carbon Chemical group 0.000 claims description 2
- 239000003795 chemical substances by application Substances 0.000 claims description 2
- 125000002150 cyclohexa-1,4-dienyl group Chemical group [H]C1=C([H])C([H])(*)C([H])=C([H])C1([H])[H] 0.000 claims description 2
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 claims description 2
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 claims description 2
- 239000003085 diluting agent Substances 0.000 claims description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 2
- 239000011777 magnesium Chemical class 0.000 claims description 2
- 229910052749 magnesium Inorganic materials 0.000 claims description 2
- WCYWZMWISLQXQU-UHFFFAOYSA-N methyl Chemical group [CH3] WCYWZMWISLQXQU-UHFFFAOYSA-N 0.000 claims description 2
- 125000004092 methylthiomethyl group Chemical group [H]C([H])([H])SC([H])([H])* 0.000 claims description 2
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 claims description 2
- 229910017464 nitrogen compound Inorganic materials 0.000 claims description 2
- 150000002830 nitrogen compounds Chemical class 0.000 claims description 2
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 claims description 2
- 125000003261 o-tolyl group Chemical group [H]C1=C([H])C(*)=C(C([H])=C1[H])C([H])([H])[H] 0.000 claims description 2
- 125000004430 oxygen atom Chemical group O* 0.000 claims description 2
- KHUXNRRPPZOJPT-UHFFFAOYSA-N phenoxy radical Chemical compound O=C1C=C[CH]C=C1 KHUXNRRPPZOJPT-UHFFFAOYSA-N 0.000 claims description 2
- 125000005633 phthalidyl group Chemical group 0.000 claims description 2
- 239000011591 potassium Chemical class 0.000 claims description 2
- 229910052700 potassium Inorganic materials 0.000 claims description 2
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 claims description 2
- 101150061972 zur gene Proteins 0.000 claims description 2
- 125000000896 monocarboxylic acid group Chemical group 0.000 claims 2
- 125000004455 (C1-C3) alkylthio group Chemical group 0.000 claims 1
- 125000004974 2-butenyl group Chemical group C(C=CC)* 0.000 claims 1
- 125000000094 2-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 claims 1
- 101100384908 Artemia franciscana COII gene Proteins 0.000 claims 1
- 101000870345 Vasconcellea cundinamarcensis Cysteine proteinase 1 Proteins 0.000 claims 1
- AZDRQVAHHNSJOQ-UHFFFAOYSA-N alumane Chemical class [AlH3] AZDRQVAHHNSJOQ-UHFFFAOYSA-N 0.000 claims 1
- 239000012050 conventional carrier Substances 0.000 claims 1
- 125000000000 cycloalkoxy group Chemical group 0.000 claims 1
- UKJLNMAFNRKWGR-UHFFFAOYSA-N cyclohexatrienamine Chemical group NC1=CC=C=C[CH]1 UKJLNMAFNRKWGR-UHFFFAOYSA-N 0.000 claims 1
- 125000006606 n-butoxy group Chemical group 0.000 claims 1
- 230000000144 pharmacologic effect Effects 0.000 claims 1
- 125000005920 sec-butoxy group Chemical group 0.000 claims 1
- 150000003385 sodium Chemical class 0.000 claims 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 136
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 135
- 238000004816 paper chromatography Methods 0.000 description 70
- 238000002211 ultraviolet spectrum Methods 0.000 description 56
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 54
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 52
- 239000000243 solution Substances 0.000 description 49
- 159000000000 sodium salts Chemical class 0.000 description 46
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 40
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 34
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 30
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 30
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 28
- 150000004683 dihydrates Chemical class 0.000 description 28
- 125000000325 methylidene group Chemical group [H]C([H])=* 0.000 description 24
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 16
- SJRJJKPEHAURKC-UHFFFAOYSA-N N-Methylmorpholine Chemical compound CN1CCOCC1 SJRJJKPEHAURKC-UHFFFAOYSA-N 0.000 description 16
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical class [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 16
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 15
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 14
- 239000008346 aqueous phase Substances 0.000 description 13
- VLLMWSRANPNYQX-UHFFFAOYSA-N thiadiazole Chemical compound C1=CSN=N1.C1=CSN=N1 VLLMWSRANPNYQX-UHFFFAOYSA-N 0.000 description 13
- 239000000203 mixture Substances 0.000 description 12
- 239000012071 phase Substances 0.000 description 12
- AXZPMKATFNMZNE-UHFFFAOYSA-M sodium;3-ethylheptanoate Chemical compound [Na+].CCCCC(CC)CC([O-])=O AXZPMKATFNMZNE-UHFFFAOYSA-M 0.000 description 12
- NTIZESTWPVYFNL-UHFFFAOYSA-N Methyl isobutyl ketone Chemical compound CC(C)CC(C)=O NTIZESTWPVYFNL-UHFFFAOYSA-N 0.000 description 11
- UIHCLUNTQKBZGK-UHFFFAOYSA-N Methyl isobutyl ketone Natural products CCC(C)C(C)=O UIHCLUNTQKBZGK-UHFFFAOYSA-N 0.000 description 11
- 239000005977 Ethylene Substances 0.000 description 10
- 239000007787 solid Substances 0.000 description 10
- 238000001228 spectrum Methods 0.000 description 10
- 150000003536 tetrazoles Chemical class 0.000 description 10
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 8
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 7
- HSHGZXNAXBPPDL-HZGVNTEJSA-N 7beta-aminocephalosporanic acid Chemical compound S1CC(COC(=O)C)=C(C([O-])=O)N2C(=O)[C@@H]([NH3+])[C@@H]12 HSHGZXNAXBPPDL-HZGVNTEJSA-N 0.000 description 6
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 6
- 238000006243 chemical reaction Methods 0.000 description 6
- 239000012074 organic phase Substances 0.000 description 6
- 239000007864 aqueous solution Substances 0.000 description 5
- RIFGWPKJUGCATF-UHFFFAOYSA-N ethyl chloroformate Chemical compound CCOC(Cl)=O RIFGWPKJUGCATF-UHFFFAOYSA-N 0.000 description 5
- 239000000047 product Substances 0.000 description 5
- ZHNUHDYFZUAESO-UHFFFAOYSA-N Formamide Chemical compound NC=O ZHNUHDYFZUAESO-UHFFFAOYSA-N 0.000 description 4
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Chemical compound C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 description 4
- RAHZWNYVWXNFOC-UHFFFAOYSA-N Sulphur dioxide Chemical compound O=S=O RAHZWNYVWXNFOC-UHFFFAOYSA-N 0.000 description 4
- 125000000738 acetamido group Chemical group [H]C([H])([H])C(=O)N([H])[*] 0.000 description 4
- 230000002378 acidificating effect Effects 0.000 description 4
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 4
- 235000019341 magnesium sulphate Nutrition 0.000 description 4
- 229960003424 phenylacetic acid Drugs 0.000 description 4
- 239000003279 phenylacetic acid Substances 0.000 description 4
- 235000017557 sodium bicarbonate Nutrition 0.000 description 4
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 4
- DLYUQMMRRRQYAE-UHFFFAOYSA-N tetraphosphorus decaoxide Chemical compound O1P(O2)(=O)OP3(=O)OP1(=O)OP2(=O)O3 DLYUQMMRRRQYAE-UHFFFAOYSA-N 0.000 description 4
- NWUYHJFMYQTDRP-UHFFFAOYSA-N 1,2-bis(ethenyl)benzene;1-ethenyl-2-ethylbenzene;styrene Chemical compound C=CC1=CC=CC=C1.CCC1=CC=CC=C1C=C.C=CC1=CC=CC=C1C=C NWUYHJFMYQTDRP-UHFFFAOYSA-N 0.000 description 3
- NXJZQSRAFBHNLI-UHFFFAOYSA-N 2-oxoimidazolidine-1-carbonyl chloride Chemical compound ClC(=O)N1CCNC1=O NXJZQSRAFBHNLI-UHFFFAOYSA-N 0.000 description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- 150000008064 anhydrides Chemical class 0.000 description 3
- 238000006073 displacement reaction Methods 0.000 description 3
- 235000013601 eggs Nutrition 0.000 description 3
- 239000002024 ethyl acetate extract Substances 0.000 description 3
- 239000000284 extract Substances 0.000 description 3
- 239000003456 ion exchange resin Substances 0.000 description 3
- 229920003303 ion-exchange polymer Polymers 0.000 description 3
- OREITQJKVIZZDA-UHFFFAOYSA-N n-methyl-n-(4-phenylbutanoyl)carbamoyl chloride Chemical compound ClC(=O)N(C)C(=O)CCCC1=CC=CC=C1 OREITQJKVIZZDA-UHFFFAOYSA-N 0.000 description 3
- 239000002244 precipitate Substances 0.000 description 3
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 3
- 239000011780 sodium chloride Substances 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- 239000000725 suspension Substances 0.000 description 3
- 125000003541 2-chlorobenzoyl group Chemical group ClC1=C(C(=O)*)C=CC=C1 0.000 description 2
- CCRQBNJTBJRTJD-UHFFFAOYSA-N 3-acetyl-2-oxoimidazolidine-1-carbonyl chloride Chemical compound CC(=O)N1CCN(C(Cl)=O)C1=O CCRQBNJTBJRTJD-UHFFFAOYSA-N 0.000 description 2
- 241000894006 Bacteria Species 0.000 description 2
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical group C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 2
- 241000282414 Homo sapiens Species 0.000 description 2
- SIKJAQJRHWYJAI-UHFFFAOYSA-N Indole Chemical compound C1=CC=C2NC=CC2=C1 SIKJAQJRHWYJAI-UHFFFAOYSA-N 0.000 description 2
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- 230000010933 acylation Effects 0.000 description 2
- 238000005917 acylation reaction Methods 0.000 description 2
- 239000002585 base Substances 0.000 description 2
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 description 2
- 229920001429 chelating resin Polymers 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- 238000001914 filtration Methods 0.000 description 2
- 210000002837 heart atrium Anatomy 0.000 description 2
- FFUAGWLWBBFQJT-UHFFFAOYSA-N hexamethyldisilazane Chemical compound C[Si](C)(C)N[Si](C)(C)C FFUAGWLWBBFQJT-UHFFFAOYSA-N 0.000 description 2
- 238000011065 in-situ storage Methods 0.000 description 2
- 230000004048 modification Effects 0.000 description 2
- 238000012986 modification Methods 0.000 description 2
- IMZSUCIRMLSHKF-ONEGZZNKSA-N n-[(e)-but-2-enoyl]-n-methylcarbamoyl chloride Chemical compound C\C=C\C(=O)N(C)C(Cl)=O IMZSUCIRMLSHKF-ONEGZZNKSA-N 0.000 description 2
- VNWREJGHKGOVEE-UHFFFAOYSA-N n-methyl-n-(3-phenylprop-2-enoyl)carbamoyl chloride Chemical compound ClC(=O)N(C)C(=O)C=CC1=CC=CC=C1 VNWREJGHKGOVEE-UHFFFAOYSA-N 0.000 description 2
- WLJVXDMOQOGPHL-UHFFFAOYSA-N phenylacetic acid Chemical compound OC(=O)CC1=CC=CC=C1 WLJVXDMOQOGPHL-UHFFFAOYSA-N 0.000 description 2
- 239000011347 resin Substances 0.000 description 2
- 229920005989 resin Polymers 0.000 description 2
- GEHJYWRUCIMESM-UHFFFAOYSA-L sodium sulfite Chemical compound [Na+].[Na+].[O-]S([O-])=O GEHJYWRUCIMESM-UHFFFAOYSA-L 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 125000000446 sulfanediyl group Chemical group *S* 0.000 description 2
- 125000003375 sulfoxide group Chemical group 0.000 description 2
- RIOQSEWOXXDEQQ-UHFFFAOYSA-N triphenylphosphine Chemical compound C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 RIOQSEWOXXDEQQ-UHFFFAOYSA-N 0.000 description 2
- XUTQHTOXGKVJPN-XCGJVMPOSA-N (6r)-7-amino-3-[(1-methyltetrazol-5-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound CN1N=NN=C1SCC1=C(C(O)=O)N2C(=O)C(N)[C@H]2SC1 XUTQHTOXGKVJPN-XCGJVMPOSA-N 0.000 description 1
- JNXLTSSPACJLEG-BQYQJAHWSA-N (e)-n-methyl-3-phenylprop-2-enamide Chemical compound CNC(=O)\C=C\C1=CC=CC=C1 JNXLTSSPACJLEG-BQYQJAHWSA-N 0.000 description 1
- BCMCBBGGLRIHSE-UHFFFAOYSA-N 1,3-benzoxazole Chemical compound C1=CC=C2OC=NC2=C1 BCMCBBGGLRIHSE-UHFFFAOYSA-N 0.000 description 1
- ADFXKUOMJKEIND-UHFFFAOYSA-N 1,3-dicyclohexylurea Chemical compound C1CCCCC1NC(=O)NC1CCCCC1 ADFXKUOMJKEIND-UHFFFAOYSA-N 0.000 description 1
- OHVLMTFVQDZYHP-UHFFFAOYSA-N 1-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)-2-[4-[2-[[3-(trifluoromethoxy)phenyl]methylamino]pyrimidin-5-yl]piperazin-1-yl]ethanone Chemical compound N1N=NC=2CN(CCC=21)C(CN1CCN(CC1)C=1C=NC(=NC=1)NCC1=CC(=CC=C1)OC(F)(F)F)=O OHVLMTFVQDZYHP-UHFFFAOYSA-N 0.000 description 1
- ASOKPJOREAFHNY-UHFFFAOYSA-N 1-Hydroxybenzotriazole Chemical compound C1=CC=C2N(O)N=NC2=C1 ASOKPJOREAFHNY-UHFFFAOYSA-N 0.000 description 1
- PJUPKRYGDFTMTM-UHFFFAOYSA-N 1-hydroxybenzotriazole;hydrate Chemical compound O.C1=CC=C2N(O)N=NC2=C1 PJUPKRYGDFTMTM-UHFFFAOYSA-N 0.000 description 1
- XOHZHMUQBFJTNH-UHFFFAOYSA-N 1-methyl-2h-tetrazole-5-thione Chemical compound CN1N=NN=C1S XOHZHMUQBFJTNH-UHFFFAOYSA-N 0.000 description 1
- VEUMBMHMMCOFAG-UHFFFAOYSA-N 2,3-dihydrooxadiazole Chemical compound N1NC=CO1 VEUMBMHMMCOFAG-UHFFFAOYSA-N 0.000 description 1
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 1
- 125000004182 2-chlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(*)C([H])=C1[H] 0.000 description 1
- FLFWJIBUZQARMD-UHFFFAOYSA-N 2-mercapto-1,3-benzoxazole Chemical compound C1=CC=C2OC(S)=NC2=C1 FLFWJIBUZQARMD-UHFFFAOYSA-N 0.000 description 1
- LBXFCUWIEJKZFT-UHFFFAOYSA-N 2-oxoazepane-1-carbonyl chloride Chemical compound ClC(=O)N1CCCCCC1=O LBXFCUWIEJKZFT-UHFFFAOYSA-N 0.000 description 1
- 125000005809 3,4,5-trimethoxyphenyl group Chemical group [H]C1=C(OC([H])([H])[H])C(OC([H])([H])[H])=C(OC([H])([H])[H])C([H])=C1* 0.000 description 1
- ZWTPALHHEULAPI-UHFFFAOYSA-N 3-methylsulfonyl-2-oxoimidazolidine-1-carbonyl chloride Chemical compound CS(=O)(=O)N1CCN(C(Cl)=O)C1=O ZWTPALHHEULAPI-UHFFFAOYSA-N 0.000 description 1
- 125000004172 4-methoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C([H])C([H])=C1* 0.000 description 1
- ULBNVDPBWRTOPN-UHFFFAOYSA-N 4-sulfanylbenzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC=C(S)C=C1 ULBNVDPBWRTOPN-UHFFFAOYSA-N 0.000 description 1
- NGHVIOIJCVXTGV-ALEPSDHESA-N 6-aminopenicillanic acid Chemical compound [O-]C(=O)[C@H]1C(C)(C)S[C@@H]2[C@H]([NH3+])C(=O)N21 NGHVIOIJCVXTGV-ALEPSDHESA-N 0.000 description 1
- NGHVIOIJCVXTGV-UHFFFAOYSA-N 6beta-amino-penicillanic acid Natural products OC(=O)C1C(C)(C)SC2C(N)C(=O)N21 NGHVIOIJCVXTGV-UHFFFAOYSA-N 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 1
- 108020004256 Beta-lactamase Proteins 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- 239000004215 Carbon black (E152) Substances 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- BWLUMTFWVZZZND-UHFFFAOYSA-N Dibenzylamine Chemical compound C=1C=CC=CC=1CNCC1=CC=CC=C1 BWLUMTFWVZZZND-UHFFFAOYSA-N 0.000 description 1
- QOSSAOTZNIDXMA-UHFFFAOYSA-N Dicylcohexylcarbodiimide Chemical compound C1CCCCC1N=C=NC1CCCCC1 QOSSAOTZNIDXMA-UHFFFAOYSA-N 0.000 description 1
- 241000588914 Enterobacter Species 0.000 description 1
- UYBSQMGPXYQBMU-GUNDQUCTSA-N FC(C(=O)O)(F)F.CC1S[C@H]2N(C(=C1)C(=O)O)C(C2)=O Chemical compound FC(C(=O)O)(F)F.CC1S[C@H]2N(C(=C1)C(=O)O)C(C2)=O UYBSQMGPXYQBMU-GUNDQUCTSA-N 0.000 description 1
- 241000192125 Firmicutes Species 0.000 description 1
- 241000282412 Homo Species 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- WRYCSMQKUKOKBP-UHFFFAOYSA-N Imidazolidine Chemical compound C1CNCN1 WRYCSMQKUKOKBP-UHFFFAOYSA-N 0.000 description 1
- RRHGJUQNOFWUDK-UHFFFAOYSA-N Isoprene Chemical compound CC(=C)C=C RRHGJUQNOFWUDK-UHFFFAOYSA-N 0.000 description 1
- 150000000994 L-ascorbates Chemical class 0.000 description 1
- 239000002841 Lewis acid Substances 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- NQTADLQHYWFPDB-UHFFFAOYSA-N N-Hydroxysuccinimide Chemical compound ON1C(=O)CCC1=O NQTADLQHYWFPDB-UHFFFAOYSA-N 0.000 description 1
- 230000006181 N-acylation Effects 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- 229930182555 Penicillin Natural products 0.000 description 1
- 241000009328 Perro Species 0.000 description 1
- 241000588769 Proteus <enterobacteria> Species 0.000 description 1
- 241000589516 Pseudomonas Species 0.000 description 1
- GSEJCLTVZPLZKY-UHFFFAOYSA-N Triethanolamine Chemical compound OCCN(CCO)CCO GSEJCLTVZPLZKY-UHFFFAOYSA-N 0.000 description 1
- 150000001242 acetic acid derivatives Chemical class 0.000 description 1
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 1
- 239000012346 acetyl chloride Substances 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 125000004390 alkyl sulfonyl group Chemical group 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- 150000003863 ammonium salts Chemical class 0.000 description 1
- 150000001448 anilines Chemical class 0.000 description 1
- 239000003242 anti bacterial agent Substances 0.000 description 1
- 229940088710 antibiotic agent Drugs 0.000 description 1
- 239000003125 aqueous solvent Substances 0.000 description 1
- 125000006615 aromatic heterocyclic group Chemical group 0.000 description 1
- 150000005840 aryl radicals Chemical class 0.000 description 1
- 235000010323 ascorbic acid Nutrition 0.000 description 1
- ZSIQJIWKELUFRJ-UHFFFAOYSA-N azepane Chemical compound C1CCCNCC1 ZSIQJIWKELUFRJ-UHFFFAOYSA-N 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- 230000008901 benefit Effects 0.000 description 1
- 150000001642 boronic acid derivatives Chemical class 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 125000001951 carbamoylamino group Chemical group C(N)(=O)N* 0.000 description 1
- 150000001718 carbodiimides Chemical class 0.000 description 1
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 1
- PFKFTWBEEFSNDU-UHFFFAOYSA-N carbonyldiimidazole Chemical compound C1=CN=CN1C(=O)N1C=CN=C1 PFKFTWBEEFSNDU-UHFFFAOYSA-N 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- FUBBGQLTSCSAON-PBFPGSCMSA-N cefaloglycin Chemical compound C1([C@@H](N)C(=O)N[C@H]2[C@@H]3N(C2=O)C(=C(CS3)COC(=O)C)C(O)=O)=CC=CC=C1 FUBBGQLTSCSAON-PBFPGSCMSA-N 0.000 description 1
- 229950004030 cefaloglycin Drugs 0.000 description 1
- 150000001782 cephems Chemical group 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 150000001860 citric acid derivatives Chemical class 0.000 description 1
- 239000012141 concentrate Substances 0.000 description 1
- 230000008878 coupling Effects 0.000 description 1
- 238000010168 coupling process Methods 0.000 description 1
- 238000005859 coupling reaction Methods 0.000 description 1
- GCFAUZGWPDYAJN-UHFFFAOYSA-N cyclohexyl 3-phenylprop-2-enoate Chemical compound C=1C=CC=CC=1C=CC(=O)OC1CCCCC1 GCFAUZGWPDYAJN-UHFFFAOYSA-N 0.000 description 1
- 239000012990 dithiocarbamate Substances 0.000 description 1
- 150000004659 dithiocarbamates Chemical class 0.000 description 1
- JBKVHLHDHHXQEQ-UHFFFAOYSA-N epsilon-caprolactam Chemical compound O=C1CCCCCN1 JBKVHLHDHHXQEQ-UHFFFAOYSA-N 0.000 description 1
- 125000005678 ethenylene group Chemical group [H]C([*:1])=C([H])[*:2] 0.000 description 1
- 125000005745 ethoxymethyl group Chemical group [H]C([H])([H])C([H])([H])OC([H])([H])* 0.000 description 1
- 125000004494 ethyl ester group Chemical group 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- 150000002440 hydroxy compounds Chemical class 0.000 description 1
- PZOUSPYUWWUPPK-UHFFFAOYSA-N indole Natural products CC1=CC=CC2=C1C=CN2 PZOUSPYUWWUPPK-UHFFFAOYSA-N 0.000 description 1
- RKJUIXBNRJVNHR-UHFFFAOYSA-N indolenine Natural products C1=CC=C2CC=NC2=C1 RKJUIXBNRJVNHR-UHFFFAOYSA-N 0.000 description 1
- 239000013067 intermediate product Substances 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- 238000006317 isomerization reaction Methods 0.000 description 1
- 150000002596 lactones Chemical class 0.000 description 1
- 229960003881 letrozole Drugs 0.000 description 1
- 150000007517 lewis acids Chemical class 0.000 description 1
- 150000004701 malic acid derivatives Chemical class 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 229940126601 medicinal product Drugs 0.000 description 1
- AFVFQIVMOAPDHO-UHFFFAOYSA-M methanesulfonate group Chemical class CS(=O)(=O)[O-] AFVFQIVMOAPDHO-UHFFFAOYSA-M 0.000 description 1
- 125000004184 methoxymethyl group Chemical group [H]C([H])([H])OC([H])([H])* 0.000 description 1
- 244000005700 microbiome Species 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 239000002808 molecular sieve Substances 0.000 description 1
- RDRHJSCUWXKCDK-UHFFFAOYSA-N n-(furan-2-carbonyl)-n-methylcarbamoyl chloride Chemical compound ClC(=O)N(C)C(=O)C1=CC=CO1 RDRHJSCUWXKCDK-UHFFFAOYSA-N 0.000 description 1
- XHLLMVSEBKZODD-UHFFFAOYSA-N n-acetyl-n-methylcarbamoyl chloride Chemical compound CC(=O)N(C)C(Cl)=O XHLLMVSEBKZODD-UHFFFAOYSA-N 0.000 description 1
- KTJVZEYNPCIDBG-UHFFFAOYSA-N n-benzoyl-n-methylcarbamoyl chloride Chemical compound ClC(=O)N(C)C(=O)C1=CC=CC=C1 KTJVZEYNPCIDBG-UHFFFAOYSA-N 0.000 description 1
- LWYMRJIPTMILOP-UHFFFAOYSA-N n-cyclohexyloxymethanamine Chemical compound CNOC1CCCCC1 LWYMRJIPTMILOP-UHFFFAOYSA-N 0.000 description 1
- HONYYHGLJDLXGX-UHFFFAOYSA-N n-ethyl-n-(3-phenylprop-2-enoyl)carbamoyl chloride Chemical compound CCN(C(Cl)=O)C(=O)C=CC1=CC=CC=C1 HONYYHGLJDLXGX-UHFFFAOYSA-N 0.000 description 1
- 125000003136 n-heptyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000001280 n-hexyl group Chemical group C(CCCCC)* 0.000 description 1
- NQSQOQXKIFAEDO-UHFFFAOYSA-N n-methyl-n-(2-phenylpropanoyl)carbamoyl chloride Chemical compound ClC(=O)N(C)C(=O)C(C)C1=CC=CC=C1 NQSQOQXKIFAEDO-UHFFFAOYSA-N 0.000 description 1
- NBOIFQAMFDHKFA-UHFFFAOYSA-N n-methyl-n-(2-thiophen-2-ylprop-2-enoyl)carbamoyl chloride Chemical compound ClC(=O)N(C)C(=O)C(=C)C1=CC=CS1 NBOIFQAMFDHKFA-UHFFFAOYSA-N 0.000 description 1
- ZKSHERRCCNQIAJ-UHFFFAOYSA-N n-methyl-n-(3,4,5-trimethoxybenzoyl)carbamoyl chloride Chemical compound COC1=CC(C(=O)N(C)C(Cl)=O)=CC(OC)=C1OC ZKSHERRCCNQIAJ-UHFFFAOYSA-N 0.000 description 1
- JIQBLONORFFMKH-UHFFFAOYSA-N n-methyl-n-(methylcarbamoyl)carbamoyl chloride Chemical compound CNC(=O)N(C)C(Cl)=O JIQBLONORFFMKH-UHFFFAOYSA-N 0.000 description 1
- QQQGJPZRNVPXRV-SNAWJCMRSA-N n-methyl-n-[(e)-2-methylbut-2-enoyl]carbamoyl chloride Chemical compound C\C=C(/C)C(=O)N(C)C(Cl)=O QQQGJPZRNVPXRV-SNAWJCMRSA-N 0.000 description 1
- DWMAGRUGLIVVKK-UHFFFAOYSA-N n-methyl-n-[3-(4-nitrophenyl)prop-2-enoyl]carbamoyl chloride Chemical compound ClC(=O)N(C)C(=O)C=CC1=CC=C([N+]([O-])=O)C=C1 DWMAGRUGLIVVKK-UHFFFAOYSA-N 0.000 description 1
- 150000002823 nitrates Chemical class 0.000 description 1
- 239000012038 nucleophile Substances 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- WCPAKWJPBJAGKN-UHFFFAOYSA-N oxadiazole Chemical compound C1=CON=N1 WCPAKWJPBJAGKN-UHFFFAOYSA-N 0.000 description 1
- 150000003891 oxalate salts Chemical class 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- 244000052769 pathogen Species 0.000 description 1
- 150000002960 penicillins Chemical class 0.000 description 1
- 235000021317 phosphate Nutrition 0.000 description 1
- 239000008363 phosphate buffer Substances 0.000 description 1
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 1
- 229920001296 polysiloxane Polymers 0.000 description 1
- 244000144977 poultry Species 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- MFDFERRIHVXMIY-UHFFFAOYSA-N procaine Chemical compound CCN(CC)CCOC(=O)C1=CC=C(N)C=C1 MFDFERRIHVXMIY-UHFFFAOYSA-N 0.000 description 1
- 229960004919 procaine Drugs 0.000 description 1
- 238000011321 prophylaxis Methods 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 150000003222 pyridines Chemical class 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 239000012048 reactive intermediate Substances 0.000 description 1
- URGAHOPLAPQHLN-UHFFFAOYSA-N sodium aluminosilicate Chemical compound [Na+].[Al+3].[O-][Si]([O-])=O.[O-][Si]([O-])=O URGAHOPLAPQHLN-UHFFFAOYSA-N 0.000 description 1
- 235000010265 sodium sulphite Nutrition 0.000 description 1
- 241000894007 species Species 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 150000003890 succinate salts Chemical class 0.000 description 1
- 150000003464 sulfur compounds Chemical class 0.000 description 1
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 1
- 150000003892 tartrate salts Chemical class 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 125000005931 tert-butyloxycarbonyl group Chemical group [H]C([H])([H])C(OC(*)=O)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- 238000002560 therapeutic procedure Methods 0.000 description 1
- 238000011282 treatment Methods 0.000 description 1
- 150000003852 triazoles Chemical group 0.000 description 1
- 239000012991 xanthate Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D501/00—Heterocyclic compounds containing 5-thia-1-azabicyclo [4.2.0] octane ring systems, i.e. compounds containing a ring system of the formula:, e.g. cephalosporins; Such ring systems being further condensed, e.g. 2,3-condensed with an oxygen-, nitrogen- or sulfur-containing hetero ring
- C07D501/14—Compounds having a nitrogen atom directly attached in position 7
- C07D501/16—Compounds having a nitrogen atom directly attached in position 7 with a double bond between positions 2 and 3
- C07D501/20—7-Acylaminocephalosporanic or substituted 7-acylaminocephalosporanic acids in which the acyl radicals are derived from carboxylic acids
- C07D501/24—7-Acylaminocephalosporanic or substituted 7-acylaminocephalosporanic acids in which the acyl radicals are derived from carboxylic acids with hydrocarbon radicals, substituted by hetero atoms or hetero rings, attached in position 3
- C07D501/36—Methylene radicals, substituted by sulfur atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D501/00—Heterocyclic compounds containing 5-thia-1-azabicyclo [4.2.0] octane ring systems, i.e. compounds containing a ring system of the formula:, e.g. cephalosporins; Such ring systems being further condensed, e.g. 2,3-condensed with an oxygen-, nitrogen- or sulfur-containing hetero ring
- C07D501/14—Compounds having a nitrogen atom directly attached in position 7
- C07D501/16—Compounds having a nitrogen atom directly attached in position 7 with a double bond between positions 2 and 3
- C07D501/20—7-Acylaminocephalosporanic or substituted 7-acylaminocephalosporanic acids in which the acyl radicals are derived from carboxylic acids
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Cephalosporin Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB27970/73A GB1479711A (en) | 1973-06-12 | 1973-06-12 | Acylureido cephalosporins |
| GB4896873 | 1973-10-20 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2428139A1 true DE2428139A1 (de) | 1975-01-09 |
Family
ID=26259100
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19742428139 Pending DE2428139A1 (de) | 1973-06-12 | 1974-06-11 | Cephalosporine, verfahren zu ihrer herstellung und diese verbindungen enthaltende arzneipraeparate |
Country Status (16)
| Country | Link |
|---|---|
| US (1) | US4312982A (cg-RX-API-DMAC10.html) |
| JP (1) | JPS5047990A (cg-RX-API-DMAC10.html) |
| AR (1) | AR219722A1 (cg-RX-API-DMAC10.html) |
| AU (1) | AU475246B2 (cg-RX-API-DMAC10.html) |
| BE (1) | BE816238A (cg-RX-API-DMAC10.html) |
| CH (1) | CH609350A5 (cg-RX-API-DMAC10.html) |
| DD (1) | DD111581A5 (cg-RX-API-DMAC10.html) |
| DE (1) | DE2428139A1 (cg-RX-API-DMAC10.html) |
| DK (1) | DK311874A (cg-RX-API-DMAC10.html) |
| GB (1) | GB1479711A (cg-RX-API-DMAC10.html) |
| IE (1) | IE39294B1 (cg-RX-API-DMAC10.html) |
| IL (2) | IL44959A (cg-RX-API-DMAC10.html) |
| MW (1) | MW2474A1 (cg-RX-API-DMAC10.html) |
| NL (1) | NL7407815A (cg-RX-API-DMAC10.html) |
| SE (2) | SE7407713L (cg-RX-API-DMAC10.html) |
| ZM (1) | ZM8574A1 (cg-RX-API-DMAC10.html) |
Families Citing this family (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4071683A (en) * | 1973-10-30 | 1978-01-31 | Bayer Aktiengesellschaft | Oxoimidazolidinylthiocarbonyl derivatives of ceph-3-em-4-carboxylic acids |
| US4086340A (en) * | 1974-02-18 | 1978-04-25 | Bayer Aktiengesellschaft | Cephalosporins and their production |
| US4107304A (en) | 1974-02-18 | 1978-08-15 | Bayer Aktiengesellschaft | Oxo-imidazolidine substituted cephalosporins and antibacterial compositions and methods of combatting bacteria employing them |
| US4224442A (en) * | 1975-03-03 | 1980-09-23 | Eli Lilly And Company | 7-Ureido acetamido substituted cephalosporin antibiotics |
| US4061630A (en) * | 1976-02-20 | 1977-12-06 | Eli Lilly And Company | 7-Substituted-ureido-3-carbamoyloxymethyl cephalosporin antibiotics |
| US4061861A (en) * | 1976-06-21 | 1977-12-06 | Eli Lilly And Company | 7-[α-(2,3-DIHYDRO-2-OXO-1H-benzimidazol-1-ylcarbonyl-amino)arylacetamido]cephalosporins |
| CH634848A5 (de) * | 1976-08-17 | 1983-02-28 | Fujisawa Pharmaceutical Co | Verfahren zur herstellung neuer 7-(n-substituierter 2-phenylglycinamido)-3-substituierte-3-cephem-4-carbonsaeuren. |
| JPS5346996A (en) * | 1976-10-13 | 1978-04-27 | Sangyo Kagaku Kenkyu Kyokai | Antifungal compound |
| DK225179A (da) | 1978-06-22 | 1979-12-23 | Chugai Pharmaceutical Co Ltd | Fremgangsmaade til fremstilling af cephalosporinderivater |
| US4217348A (en) | 1978-09-28 | 1980-08-12 | E. R. Squibb & Sons, Inc. | Cephalosporins having an oxazolidonyloxamido substituted acyl sidechain |
| US4436903A (en) * | 1980-12-22 | 1984-03-13 | Ciba-Geigy Corporation | Process for the production of 7 β-substituted-3-unsubstituted-3-cephem-4-carboxylic acid compounds |
Family Cites Families (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3687949A (en) * | 1969-01-21 | 1972-08-29 | Bristol Myers Co | Synthetic cephalosporins |
| US3673183A (en) * | 1969-11-17 | 1972-06-27 | Squibb & Sons Inc | {60 -ureidocephalosporanic acid compounds |
| US3741962A (en) * | 1971-05-21 | 1973-06-26 | Squibb & Sons Inc | Alpha-thioureidocephalosporanic acid compounds |
| CH570407A5 (cg-RX-API-DMAC10.html) * | 1972-03-29 | 1975-12-15 | Ciba Geigy Ag | |
| US4086340A (en) * | 1974-02-18 | 1978-04-25 | Bayer Aktiengesellschaft | Cephalosporins and their production |
| US4107304A (en) * | 1974-02-18 | 1978-08-15 | Bayer Aktiengesellschaft | Oxo-imidazolidine substituted cephalosporins and antibacterial compositions and methods of combatting bacteria employing them |
| US3925368A (en) * | 1974-04-01 | 1975-12-09 | Lilly Co Eli | Acylureido substituted cephalosporins |
| US3956292A (en) * | 1974-04-01 | 1976-05-11 | Eli Lilly And Company | 7-(α-FUROYLUREIDOARYL AND CYCLOHEXADIENYLACETAMIDO) CEPHALOSPORIN ANTIBIOTICS |
| US4224442A (en) * | 1975-03-03 | 1980-09-23 | Eli Lilly And Company | 7-Ureido acetamido substituted cephalosporin antibiotics |
| US4061630A (en) * | 1976-02-20 | 1977-12-06 | Eli Lilly And Company | 7-Substituted-ureido-3-carbamoyloxymethyl cephalosporin antibiotics |
-
1973
- 1973-06-12 GB GB27970/73A patent/GB1479711A/en not_active Expired
-
1974
- 1974-05-29 IE IE1132/74A patent/IE39294B1/xx unknown
- 1974-06-03 IL IL44959A patent/IL44959A/xx unknown
- 1974-06-05 ZM ZM85/74A patent/ZM8574A1/xx unknown
- 1974-06-06 AU AU69843/74A patent/AU475246B2/en not_active Expired
- 1974-06-10 MW MW24/74*UA patent/MW2474A1/xx unknown
- 1974-06-11 DE DE19742428139 patent/DE2428139A1/de active Pending
- 1974-06-11 SE SE7407713A patent/SE7407713L/xx unknown
- 1974-06-11 JP JP49066446A patent/JPS5047990A/ja active Pending
- 1974-06-11 DD DD179086A patent/DD111581A5/xx unknown
- 1974-06-11 DK DK311874A patent/DK311874A/da unknown
- 1974-06-12 NL NL7407815A patent/NL7407815A/xx not_active Application Discontinuation
- 1974-06-12 BE BE145344A patent/BE816238A/xx unknown
- 1974-06-12 CH CH806474A patent/CH609350A5/xx not_active IP Right Cessation
-
1976
- 1976-05-06 US US05/683,792 patent/US4312982A/en not_active Expired - Lifetime
-
1977
- 1977-05-24 SE SE7706081A patent/SE7706081L/ not_active Application Discontinuation
- 1977-08-11 IL IL52704A patent/IL52704A0/xx unknown
- 1977-11-07 AR AR269874A patent/AR219722A1/es active
Also Published As
| Publication number | Publication date |
|---|---|
| JPS5047990A (cg-RX-API-DMAC10.html) | 1975-04-28 |
| CH609350A5 (cg-RX-API-DMAC10.html) | 1979-02-28 |
| IL52704A0 (en) | 1977-10-31 |
| AU475246B2 (en) | 1976-08-19 |
| NL7407815A (cg-RX-API-DMAC10.html) | 1974-12-16 |
| DD111581A5 (cg-RX-API-DMAC10.html) | 1975-02-20 |
| US4312982A (en) | 1982-01-26 |
| GB1479711A (en) | 1977-07-13 |
| IL44959A (en) | 1978-07-31 |
| AU6984374A (en) | 1975-12-11 |
| ZM8574A1 (en) | 1976-08-23 |
| SE7407713L (cg-RX-API-DMAC10.html) | 1974-12-13 |
| DK311874A (cg-RX-API-DMAC10.html) | 1975-02-17 |
| SE7706081L (sv) | 1977-05-24 |
| IL44959A0 (en) | 1974-09-10 |
| BE816238A (fr) | 1974-12-12 |
| AR219722A1 (es) | 1980-09-15 |
| MW2474A1 (en) | 1975-08-13 |
| IE39294L (en) | 1974-12-12 |
| IE39294B1 (en) | 1978-09-13 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2461478C2 (de) | Cephalosporinderivate und Verfahren zu deren Herstellung | |
| DE1795292B2 (de) | Cephalosporinderivate und Verfahren zu deren Herstellung | |
| DD208351A5 (de) | Verfahren zur herstellung eines 7-(subst.-oder unsubst.-amiono)-3-(subst.-methyl)-delta hoch 3-cephem-4-carbonsaeure | |
| DE1795188C3 (de) | 3-Alkoxymethylcephalosporine, Verfahren zu deren Herstellung und die diese enthaltenden pharmazeutischen Zusammensetzungen | |
| DE2736471C2 (cg-RX-API-DMAC10.html) | ||
| DE2428139A1 (de) | Cephalosporine, verfahren zu ihrer herstellung und diese verbindungen enthaltende arzneipraeparate | |
| DE2434340A1 (de) | 7-acylamido-3-cephem-4-carbonsaeurederivate, verfahren zu ihrer herstellung und ihre verwendung in pharmazeutischen zubereitungen | |
| DE2514020A1 (de) | Acylureidocephalosporine | |
| DE2735732A1 (de) | Cephalosporinester | |
| DE2638067C2 (de) | Penicilline und Verfahren zu deren Herstellung | |
| DE1953861C2 (de) | 7-Tetrazolylacetamido-3-thiomethyl-3-cephem-4- carbonsäuren | |
| DE2521063A1 (de) | Phenylacetamidocephalosporin- derivate | |
| EP0000500B1 (de) | Cephalosporinderivate, Verfahren zu deren Herstellung und deren pharmazeutische Präparate | |
| CH633802A5 (de) | Verfahren zur herstellung neuer beta-lactam-antibiotica. | |
| DE2700271A1 (de) | Thienopyridinderivate | |
| EP0035161B1 (de) | Cephalosporine, Verfahren zu ihrer Herstellung und diese Verbindungen enthaltende Arzneimittel | |
| DD204257A5 (de) | Verfahren zur herstellung von cephalosporinen, die in position 3 substituiert sind | |
| DE2655717A1 (de) | Thiadiazolylderivate von 7-acylamido-3-cephem-4-carbonsaeure, verfahren zu deren herstellung und dieselben enthaltende pharmazeutische und veterinaermedizinische mittel | |
| DE2550151A1 (de) | Neue cephalosporine, verfahren zu ihrer herstellung und diese verbindungen enthaltende arzneimittel | |
| DE2632006A1 (de) | 7- eckige klammer auf alpha-amino- omega-(3,4-methylendioxyphenyl)acylamido eckige klammer zu cephalosporansaeurederivate | |
| DE2626621A1 (de) | Cephalosporine, verfahren zu ihrer herstellung und diese verbindungen enthaltende arzneipraeparate | |
| DE2639380A1 (de) | 3- eckige klammer auf 1-(2-hydroxyalkyl)-tetrazol-5-ylthiomethyl eckige klammer zu -3-cephem-4-carbonsaeuren, verfahren zu ihrer herstellung und diese verbindungen enthaltende arzneimittel | |
| DE2345402B2 (de) | 7-(l,4-Dihydro-4-oxo-l-pyridylacetamido)-cephemderivate und Verfahren zu ihrer Herstellung | |
| DE2432190A1 (de) | Neue chemische verbindungen, verfahren zu ihrer herstellung und ihre verwendung in pharmazeutischen zubereitungen | |
| EP0090240A2 (de) | 7-Alpha-Aminoacyl-3-chlorcephalosporine, Verfahren zu ihrer Herstellung sowie ihrer Verwendung als Arzneimittel |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OI | Miscellaneous see part 1 | ||
| OI | Miscellaneous see part 1 | ||
| OHW | Rejection |