DE2422211A1 - Verfahren zur herstellung von alkylisocyanaten - Google Patents
Verfahren zur herstellung von alkylisocyanatenInfo
- Publication number
- DE2422211A1 DE2422211A1 DE2422211A DE2422211A DE2422211A1 DE 2422211 A1 DE2422211 A1 DE 2422211A1 DE 2422211 A DE2422211 A DE 2422211A DE 2422211 A DE2422211 A DE 2422211A DE 2422211 A1 DE2422211 A1 DE 2422211A1
- Authority
- DE
- Germany
- Prior art keywords
- reaction
- decomposition
- isocyanates
- isocyanate
- alkyl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Withdrawn
Links
- 239000012948 isocyanate Substances 0.000 title claims description 25
- 150000002513 isocyanates Chemical class 0.000 title claims description 18
- 238000000034 method Methods 0.000 title description 16
- 238000002360 preparation method Methods 0.000 title description 4
- 238000006243 chemical reaction Methods 0.000 claims description 53
- 229910000039 hydrogen halide Inorganic materials 0.000 claims description 15
- 239000012433 hydrogen halide Substances 0.000 claims description 15
- 238000009835 boiling Methods 0.000 claims description 12
- 238000004519 manufacturing process Methods 0.000 claims description 7
- 238000005979 thermal decomposition reaction Methods 0.000 claims description 4
- 239000011541 reaction mixture Substances 0.000 claims description 2
- -1 alkyl isocyanates Chemical class 0.000 description 28
- 238000000354 decomposition reaction Methods 0.000 description 22
- 239000007858 starting material Substances 0.000 description 16
- 238000010992 reflux Methods 0.000 description 14
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 13
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 12
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 12
- 239000007795 chemical reaction product Substances 0.000 description 11
- 239000002904 solvent Substances 0.000 description 8
- CKDWPUIZGOQOOM-UHFFFAOYSA-N Carbamyl chloride Chemical class NC(Cl)=O CKDWPUIZGOQOOM-UHFFFAOYSA-N 0.000 description 7
- 239000011261 inert gas Substances 0.000 description 7
- 125000004432 carbon atom Chemical group C* 0.000 description 6
- 239000000203 mixture Substances 0.000 description 6
- 238000005194 fractionation Methods 0.000 description 5
- 239000003513 alkali Substances 0.000 description 4
- 125000000217 alkyl group Chemical group 0.000 description 4
- 229910052799 carbon Inorganic materials 0.000 description 4
- 238000001704 evaporation Methods 0.000 description 4
- 230000008020 evaporation Effects 0.000 description 4
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 125000001309 chloro group Chemical group Cl* 0.000 description 3
- 238000004821 distillation Methods 0.000 description 3
- OFBQJSOFQDEBGM-UHFFFAOYSA-N n-pentane Natural products CCCCC OFBQJSOFQDEBGM-UHFFFAOYSA-N 0.000 description 3
- 239000000243 solution Substances 0.000 description 3
- GSLTVFIVJMCNBH-UHFFFAOYSA-N 2-isocyanatopropane Chemical compound CC(C)N=C=O GSLTVFIVJMCNBH-UHFFFAOYSA-N 0.000 description 2
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 2
- LCGLNKUTAGEVQW-UHFFFAOYSA-N Dimethyl ether Chemical compound COC LCGLNKUTAGEVQW-UHFFFAOYSA-N 0.000 description 2
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 2
- ATUOYWHBWRKTHZ-UHFFFAOYSA-N Propane Chemical compound CCC ATUOYWHBWRKTHZ-UHFFFAOYSA-N 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 125000003342 alkenyl group Chemical group 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 150000001714 carbamic acid halides Chemical class 0.000 description 2
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 2
- NEHMKBQYUWJMIP-UHFFFAOYSA-N chloromethane Chemical compound ClC NEHMKBQYUWJMIP-UHFFFAOYSA-N 0.000 description 2
- 238000005260 corrosion Methods 0.000 description 2
- 230000007797 corrosion Effects 0.000 description 2
- NNPPMTNAJDCUHE-UHFFFAOYSA-N isobutane Chemical compound CC(C)C NNPPMTNAJDCUHE-UHFFFAOYSA-N 0.000 description 2
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Chemical compound C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 description 2
- HAMGRBXTJNITHG-UHFFFAOYSA-N methyl isocyanate Chemical compound CN=C=O HAMGRBXTJNITHG-UHFFFAOYSA-N 0.000 description 2
- MFPXPCGVNXPRLZ-UHFFFAOYSA-N n-propan-2-ylcarbamoyl chloride Chemical compound CC(C)NC(Cl)=O MFPXPCGVNXPRLZ-UHFFFAOYSA-N 0.000 description 2
- CRSOQBOWXPBRES-UHFFFAOYSA-N neopentane Chemical compound CC(C)(C)C CRSOQBOWXPBRES-UHFFFAOYSA-N 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- 238000012856 packing Methods 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 239000002994 raw material Substances 0.000 description 2
- 230000009257 reactivity Effects 0.000 description 2
- 238000000926 separation method Methods 0.000 description 2
- 150000003512 tertiary amines Chemical class 0.000 description 2
- 125000001340 2-chloroethyl group Chemical group [H]C([H])(Cl)C([H])([H])* 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- 101100387923 Caenorhabditis elegans dos-1 gene Proteins 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- OTMSDBZUPAUEDD-UHFFFAOYSA-N Ethane Chemical compound CC OTMSDBZUPAUEDD-UHFFFAOYSA-N 0.000 description 1
- XOBKSJJDNFUZPF-UHFFFAOYSA-N Methoxyethane Chemical compound CCOC XOBKSJJDNFUZPF-UHFFFAOYSA-N 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- 239000000853 adhesive Substances 0.000 description 1
- 230000001070 adhesive effect Effects 0.000 description 1
- 239000003570 air Substances 0.000 description 1
- 150000001335 aliphatic alkanes Chemical class 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 229910001854 alkali hydroxide Inorganic materials 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 239000007900 aqueous suspension Substances 0.000 description 1
- 229910052786 argon Inorganic materials 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- GZUXJHMPEANEGY-UHFFFAOYSA-N bromomethane Chemical compound BrC GZUXJHMPEANEGY-UHFFFAOYSA-N 0.000 description 1
- 239000001273 butane Substances 0.000 description 1
- 150000001715 carbamic acids Chemical class 0.000 description 1
- 235000013877 carbamide Nutrition 0.000 description 1
- RTTSQSBCRXBLAU-UHFFFAOYSA-N carbamoyl bromide Chemical class NC(Br)=O RTTSQSBCRXBLAU-UHFFFAOYSA-N 0.000 description 1
- 239000001569 carbon dioxide Substances 0.000 description 1
- 229910002092 carbon dioxide Inorganic materials 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-N carbonic acid Chemical class OC(O)=O BVKZGUZCCUSVTD-UHFFFAOYSA-N 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 150000008280 chlorinated hydrocarbons Chemical class 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- HRYZWHHZPQKTII-UHFFFAOYSA-N chloroethane Chemical compound CCCl HRYZWHHZPQKTII-UHFFFAOYSA-N 0.000 description 1
- 125000004218 chloromethyl group Chemical group [H]C([H])(Cl)* 0.000 description 1
- 238000003776 cleavage reaction Methods 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 239000003599 detergent Substances 0.000 description 1
- 239000000975 dye Substances 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 229960003750 ethyl chloride Drugs 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- WUDNUHPRLBTKOJ-UHFFFAOYSA-N ethyl isocyanate Chemical compound CCN=C=O WUDNUHPRLBTKOJ-UHFFFAOYSA-N 0.000 description 1
- 239000011552 falling film Substances 0.000 description 1
- 238000011049 filling Methods 0.000 description 1
- 239000010408 film Substances 0.000 description 1
- UHCBBWUQDAVSMS-UHFFFAOYSA-N fluoroethane Chemical compound CCF UHCBBWUQDAVSMS-UHFFFAOYSA-N 0.000 description 1
- 239000006260 foam Substances 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 150000008282 halocarbons Chemical class 0.000 description 1
- 239000001307 helium Substances 0.000 description 1
- 229910052734 helium Inorganic materials 0.000 description 1
- SWQJXJOGLNCZEY-UHFFFAOYSA-N helium atom Chemical compound [He] SWQJXJOGLNCZEY-UHFFFAOYSA-N 0.000 description 1
- WMIYKQLTONQJES-UHFFFAOYSA-N hexafluoroethane Chemical compound FC(F)(F)C(F)(F)F WMIYKQLTONQJES-UHFFFAOYSA-N 0.000 description 1
- 150000004679 hydroxides Chemical class 0.000 description 1
- 150000007529 inorganic bases Chemical class 0.000 description 1
- 239000001282 iso-butane Substances 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- IJDNQMDRQITEOD-UHFFFAOYSA-N n-butane Chemical compound CCCC IJDNQMDRQITEOD-UHFFFAOYSA-N 0.000 description 1
- 125000001280 n-hexyl group Chemical group C(CCCCC)* 0.000 description 1
- GRRYSIXDUIAUGY-UHFFFAOYSA-N n-methylcarbamoyl chloride Chemical compound CNC(Cl)=O GRRYSIXDUIAUGY-UHFFFAOYSA-N 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- ZVBUWBGCYFNHNT-UHFFFAOYSA-N n-tert-butyl-n-ethoxycarbamoyl chloride Chemical compound CCON(C(Cl)=O)C(C)(C)C ZVBUWBGCYFNHNT-UHFFFAOYSA-N 0.000 description 1
- 229910052754 neon Inorganic materials 0.000 description 1
- GKAOGPIIYCISHV-UHFFFAOYSA-N neon atom Chemical compound [Ne] GKAOGPIIYCISHV-UHFFFAOYSA-N 0.000 description 1
- 125000001971 neopentyl group Chemical group [H]C([*])([H])C(C([H])([H])[H])(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 229910052756 noble gas Inorganic materials 0.000 description 1
- 150000002835 noble gases Chemical class 0.000 description 1
- 150000007530 organic bases Chemical class 0.000 description 1
- 150000002894 organic compounds Chemical class 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 1
- 239000000575 pesticide Substances 0.000 description 1
- 239000004033 plastic Substances 0.000 description 1
- 229920003023 plastic Polymers 0.000 description 1
- 231100000614 poison Toxicity 0.000 description 1
- 230000007096 poisonous effect Effects 0.000 description 1
- 229920000642 polymer Polymers 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 239000001294 propane Substances 0.000 description 1
- 239000011814 protection agent Substances 0.000 description 1
- 150000003254 radicals Chemical class 0.000 description 1
- 230000001105 regulatory effect Effects 0.000 description 1
- 230000007017 scission Effects 0.000 description 1
- 229920003002 synthetic resin Polymers 0.000 description 1
- 239000000057 synthetic resin Substances 0.000 description 1
- TXEYQDLBPFQVAA-UHFFFAOYSA-N tetrafluoromethane Chemical compound FC(F)(F)F TXEYQDLBPFQVAA-UHFFFAOYSA-N 0.000 description 1
- CZDYPVPMEAXLPK-UHFFFAOYSA-N tetramethylsilane Chemical compound C[Si](C)(C)C CZDYPVPMEAXLPK-UHFFFAOYSA-N 0.000 description 1
- 239000004753 textile Substances 0.000 description 1
- 239000010409 thin film Substances 0.000 description 1
- 238000011144 upstream manufacturing Methods 0.000 description 1
- 150000003672 ureas Chemical class 0.000 description 1
- 150000003673 urethanes Chemical class 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
- 238000004078 waterproofing Methods 0.000 description 1
- 229910052724 xenon Inorganic materials 0.000 description 1
- FHNFHKCVQCLJFQ-UHFFFAOYSA-N xenon atom Chemical compound [Xe] FHNFHKCVQCLJFQ-UHFFFAOYSA-N 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C263/00—Preparation of derivatives of isocyanic acid
- C07C263/04—Preparation of derivatives of isocyanic acid from or via carbamates or carbamoyl halides
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Priority Applications (6)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2422211A DE2422211A1 (de) | 1974-05-08 | 1974-05-08 | Verfahren zur herstellung von alkylisocyanaten |
| US05/569,209 US3969388A (en) | 1974-05-08 | 1975-04-18 | Manufacture of alkylisocyanates |
| BE155954A BE828592A (fr) | 1974-05-08 | 1975-04-30 | Procede pour la preparation d'isocyanates d'alkyle |
| GB18654/75A GB1499128A (en) | 1974-05-08 | 1975-05-05 | Manufacture of aliphatic isocyanates |
| FR7513918A FR2270240B3 (cg-RX-API-DMAC7.html) | 1974-05-08 | 1975-05-05 | |
| JP50053934A JPS50149624A (cg-RX-API-DMAC7.html) | 1974-05-08 | 1975-05-07 |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2422211A DE2422211A1 (de) | 1974-05-08 | 1974-05-08 | Verfahren zur herstellung von alkylisocyanaten |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2422211A1 true DE2422211A1 (de) | 1975-11-27 |
Family
ID=5914956
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2422211A Withdrawn DE2422211A1 (de) | 1974-05-08 | 1974-05-08 | Verfahren zur herstellung von alkylisocyanaten |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US3969388A (cg-RX-API-DMAC7.html) |
| JP (1) | JPS50149624A (cg-RX-API-DMAC7.html) |
| BE (1) | BE828592A (cg-RX-API-DMAC7.html) |
| DE (1) | DE2422211A1 (cg-RX-API-DMAC7.html) |
| FR (1) | FR2270240B3 (cg-RX-API-DMAC7.html) |
| GB (1) | GB1499128A (cg-RX-API-DMAC7.html) |
Families Citing this family (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4082787A (en) * | 1977-01-03 | 1978-04-04 | E. I. Du Pont De Nemours And Company | Methyl isocyanate process |
| DE2703281A1 (de) * | 1977-01-27 | 1978-08-03 | Basf Ag | Verfahren zur herstellung von aliphatischen isocyanaten |
| DE2806214A1 (de) * | 1978-02-14 | 1979-08-16 | Bayer Ag | Verfahren zur kontinuierlichen aufarbeitung von bei der phosgenierung von monoaminen anfallenden loesungen |
| CN107162934A (zh) * | 2017-06-07 | 2017-09-15 | 江苏蓝丰生物化工股份有限公司 | 异氰酸异丙酯的合成方法 |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2480089A (en) * | 1948-03-24 | 1949-08-23 | Monsanto Chemicals | Method of producing isocyanates |
| GB1047215A (cg-RX-API-DMAC7.html) * | 1963-07-12 |
-
1974
- 1974-05-08 DE DE2422211A patent/DE2422211A1/de not_active Withdrawn
-
1975
- 1975-04-18 US US05/569,209 patent/US3969388A/en not_active Expired - Lifetime
- 1975-04-30 BE BE155954A patent/BE828592A/xx unknown
- 1975-05-05 FR FR7513918A patent/FR2270240B3/fr not_active Expired
- 1975-05-05 GB GB18654/75A patent/GB1499128A/en not_active Expired
- 1975-05-07 JP JP50053934A patent/JPS50149624A/ja active Pending
Also Published As
| Publication number | Publication date |
|---|---|
| JPS50149624A (cg-RX-API-DMAC7.html) | 1975-11-29 |
| GB1499128A (en) | 1978-01-25 |
| BE828592A (fr) | 1975-10-30 |
| US3969388A (en) | 1976-07-13 |
| FR2270240A1 (cg-RX-API-DMAC7.html) | 1975-12-05 |
| FR2270240B3 (cg-RX-API-DMAC7.html) | 1979-06-08 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP1575906B1 (de) | Auftrennung eines stoffgemisches aus chlorwasserstoff und phosgen | |
| EP1616857B1 (de) | Verfahren zur Herstellung von Polyisocyanaten durch adiabate Phosgenierung von primären Aminen | |
| EP1575904B2 (de) | Verfahren zur kontinuierlichen herstellung von isocyanaten | |
| DE2633640C3 (de) | Verfahren zur Gewinnung von gasförmigem Chlorwasserstoff aus verdünnter wäBriger Salzsäure | |
| EP1575908A1 (de) | Verfahren zur abtrennung und reinigung von lösungsmittel von einem reaktionsgemisch aus einer isocyanatsynthese | |
| EP1615876B1 (de) | Verfahren zur reinigung von dimethylacetamid (dmac) | |
| DE3212510C3 (cg-RX-API-DMAC7.html) | ||
| EP1575905B1 (de) | Verfahren zur abtrennung von isocyanaten aus einem reaktionsgemisch | |
| EP0019699B1 (de) | Verfahren zur Gewinnung von gasförmigem Chlorwasserstoff aus verdünnter wässriger Salzsäure | |
| EP1546091B1 (de) | Aufarbeitung von reaktionsausträgen aus phosgenierreaktoren | |
| DE102006023581A1 (de) | Verfahren zur Abtrennung von Chlor aus dem Produktgas eines HCI-Oxidationsprozesses | |
| EP0106138B1 (de) | Verfahren zur kontinuierlichen Heissphosgenierung von Aminen | |
| DE2422211A1 (de) | Verfahren zur herstellung von alkylisocyanaten | |
| DE2411441A1 (de) | Verfahren zur herstellung von alkylisocyanaten | |
| DE2800153A1 (de) | Verfahren zur herstellung von methylisocyanat | |
| DE2411442A1 (de) | Verfahren zur herstellung von aliphatischen isocyanaten | |
| EP0042059A1 (de) | Verfahren zur Herstellung von Isocyanaten | |
| EP0003570B1 (de) | Verfahren zur kontinuierlichen Aufarbeitung von bei der Phosgenierung von Monoaminen anfallenden Lösungen | |
| EP4227291A1 (de) | Verfahren zur herstellung von isocyanaten | |
| EP0423679A2 (de) | Verfahren zur Herstellung von 5-(Carbamoyl)-5H-dibenz[b,f]azepin | |
| EP0025906A1 (de) | 1-Monohalogenierte Isocyanate und Verfahren zur Herstellung von Gemischen von 1-monohalogenierten Isocyanaten und 1,2-ungesättigten Isocyanaten | |
| EP0131859B1 (de) | Verfahren zur Herstellung von in 3-Stellung heterocyclisch oder durch Dialkylamino substituierten 2,2-Dialkylpropylisocyanaten | |
| EP0161600A2 (de) | Verfahren zur Isolierung von aromatischen Monoaminen aus Amingemischen | |
| DE19911234A1 (de) | Verfahren zur kontinuierlichen Herstellung von Methoxyamin-Hydrochlorid | |
| DE2343460A1 (de) | Verfahren zur herstellung von 2-phenylaethylen-phosphonsaeure |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8110 | Request for examination paragraph 44 | ||
| 8130 | Withdrawal |