DE2405036A1 - Akustische vorrichtungen aus amorphen metallegierungen - Google Patents
Akustische vorrichtungen aus amorphen metallegierungenInfo
- Publication number
- DE2405036A1 DE2405036A1 DE19742405036 DE2405036A DE2405036A1 DE 2405036 A1 DE2405036 A1 DE 2405036A1 DE 19742405036 DE19742405036 DE 19742405036 DE 2405036 A DE2405036 A DE 2405036A DE 2405036 A1 DE2405036 A1 DE 2405036A1
- Authority
- DE
- Germany
- Prior art keywords
- amorphous
- delay
- acoustic
- wire
- attenuation
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Ceased
Links
- 229910001092 metal group alloy Inorganic materials 0.000 title description 5
- 229910052751 metal Inorganic materials 0.000 claims description 17
- 239000002184 metal Substances 0.000 claims description 17
- 229910000808 amorphous metal alloy Inorganic materials 0.000 claims description 9
- 239000000203 mixture Substances 0.000 claims description 8
- 229910052782 aluminium Inorganic materials 0.000 claims description 6
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 claims description 6
- 229910052710 silicon Inorganic materials 0.000 claims description 5
- 229910052723 transition metal Inorganic materials 0.000 claims description 5
- 150000003624 transition metals Chemical class 0.000 claims description 5
- 229910052759 nickel Inorganic materials 0.000 claims description 4
- 229910052763 palladium Inorganic materials 0.000 claims description 4
- 229910052742 iron Inorganic materials 0.000 claims description 3
- 229910052698 phosphorus Inorganic materials 0.000 claims description 3
- ZOXJGFHDIHLPTG-UHFFFAOYSA-N Boron Chemical compound [B] ZOXJGFHDIHLPTG-UHFFFAOYSA-N 0.000 claims description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims description 2
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 claims description 2
- XUIMIQQOPSSXEZ-UHFFFAOYSA-N Silicon Chemical compound [Si] XUIMIQQOPSSXEZ-UHFFFAOYSA-N 0.000 claims description 2
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 claims description 2
- 229910052787 antimony Inorganic materials 0.000 claims description 2
- WATWJIUSRGPENY-UHFFFAOYSA-N antimony atom Chemical compound [Sb] WATWJIUSRGPENY-UHFFFAOYSA-N 0.000 claims description 2
- 229910052790 beryllium Inorganic materials 0.000 claims description 2
- ATBAMAFKBVZNFJ-UHFFFAOYSA-N beryllium atom Chemical compound [Be] ATBAMAFKBVZNFJ-UHFFFAOYSA-N 0.000 claims description 2
- 229910052796 boron Inorganic materials 0.000 claims description 2
- 229910052799 carbon Inorganic materials 0.000 claims description 2
- 229910052802 copper Inorganic materials 0.000 claims description 2
- 229910052732 germanium Inorganic materials 0.000 claims description 2
- GNPVGFCGXDBREM-UHFFFAOYSA-N germanium atom Chemical compound [Ge] GNPVGFCGXDBREM-UHFFFAOYSA-N 0.000 claims description 2
- 229910052738 indium Inorganic materials 0.000 claims description 2
- APFVFJFRJDLVQX-UHFFFAOYSA-N indium atom Chemical compound [In] APFVFJFRJDLVQX-UHFFFAOYSA-N 0.000 claims description 2
- 239000011574 phosphorus Substances 0.000 claims description 2
- 239000010703 silicon Substances 0.000 claims description 2
- 229910052709 silver Inorganic materials 0.000 claims description 2
- 229910052718 tin Inorganic materials 0.000 claims description 2
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 27
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 23
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 21
- 239000000463 material Substances 0.000 description 20
- 229910045601 alloy Inorganic materials 0.000 description 19
- 239000000956 alloy Substances 0.000 description 19
- 239000011651 chromium Substances 0.000 description 12
- 238000000034 method Methods 0.000 description 11
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 10
- 150000002739 metals Chemical class 0.000 description 10
- 230000001934 delay Effects 0.000 description 9
- 239000005300 metallic glass Substances 0.000 description 9
- 238000013016 damping Methods 0.000 description 6
- 239000011521 glass Substances 0.000 description 6
- 230000003993 interaction Effects 0.000 description 5
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 4
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 4
- 230000008901 benefit Effects 0.000 description 4
- 239000010949 copper Substances 0.000 description 4
- 239000013078 crystal Substances 0.000 description 4
- 238000005259 measurement Methods 0.000 description 4
- 239000000377 silicon dioxide Substances 0.000 description 4
- 238000002441 X-ray diffraction Methods 0.000 description 3
- 238000010521 absorption reaction Methods 0.000 description 3
- 230000005291 magnetic effect Effects 0.000 description 3
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 3
- 239000007787 solid Substances 0.000 description 3
- 229910002555 FeNi Inorganic materials 0.000 description 2
- 229910001030 Iron–nickel alloy Inorganic materials 0.000 description 2
- 230000005535 acoustic phonon Effects 0.000 description 2
- 229910052804 chromium Inorganic materials 0.000 description 2
- 150000001875 compounds Chemical class 0.000 description 2
- 238000005260 corrosion Methods 0.000 description 2
- 230000007797 corrosion Effects 0.000 description 2
- 230000005496 eutectics Effects 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 239000000155 melt Substances 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- 230000010355 oscillation Effects 0.000 description 2
- 229910052697 platinum Inorganic materials 0.000 description 2
- 238000010791 quenching Methods 0.000 description 2
- 230000000171 quenching effect Effects 0.000 description 2
- 239000012266 salt solution Substances 0.000 description 2
- 239000011780 sodium chloride Substances 0.000 description 2
- 239000000243 solution Substances 0.000 description 2
- 229910052719 titanium Inorganic materials 0.000 description 2
- 239000010936 titanium Substances 0.000 description 2
- 229910052720 vanadium Inorganic materials 0.000 description 2
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- ZOKXTWBITQBERF-UHFFFAOYSA-N Molybdenum Chemical compound [Mo] ZOKXTWBITQBERF-UHFFFAOYSA-N 0.000 description 1
- 241001605695 Pareronia Species 0.000 description 1
- KJTLSVCANCCWHF-UHFFFAOYSA-N Ruthenium Chemical compound [Ru] KJTLSVCANCCWHF-UHFFFAOYSA-N 0.000 description 1
- BQCADISMDOOEFD-UHFFFAOYSA-N Silver Chemical compound [Ag] BQCADISMDOOEFD-UHFFFAOYSA-N 0.000 description 1
- 229910000831 Steel Inorganic materials 0.000 description 1
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical compound [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 description 1
- QCWXUUIWCKQGHC-UHFFFAOYSA-N Zirconium Chemical compound [Zr] QCWXUUIWCKQGHC-UHFFFAOYSA-N 0.000 description 1
- 239000012814 acoustic material Substances 0.000 description 1
- 229910052767 actinium Inorganic materials 0.000 description 1
- QQINRWTZWGJFDB-UHFFFAOYSA-N actinium atom Chemical compound [Ac] QQINRWTZWGJFDB-UHFFFAOYSA-N 0.000 description 1
- 239000012300 argon atmosphere Substances 0.000 description 1
- 239000012267 brine Substances 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 241001233037 catfish Species 0.000 description 1
- 239000000919 ceramic Substances 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 229910017052 cobalt Inorganic materials 0.000 description 1
- 239000010941 cobalt Substances 0.000 description 1
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 description 1
- 238000004891 communication Methods 0.000 description 1
- 239000002131 composite material Substances 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 230000007423 decrease Effects 0.000 description 1
- 230000003111 delayed effect Effects 0.000 description 1
- 230000008021 deposition Effects 0.000 description 1
- 238000005516 engineering process Methods 0.000 description 1
- 230000007613 environmental effect Effects 0.000 description 1
- 230000005294 ferromagnetic effect Effects 0.000 description 1
- 239000005350 fused silica glass Substances 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- PCHJSUWPFVWCPO-UHFFFAOYSA-N gold Chemical compound [Au] PCHJSUWPFVWCPO-UHFFFAOYSA-N 0.000 description 1
- 229910052737 gold Inorganic materials 0.000 description 1
- 239000010931 gold Substances 0.000 description 1
- 229910052735 hafnium Inorganic materials 0.000 description 1
- VBJZVLUMGGDVMO-UHFFFAOYSA-N hafnium atom Chemical compound [Hf] VBJZVLUMGGDVMO-UHFFFAOYSA-N 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 229910052741 iridium Inorganic materials 0.000 description 1
- GKOZUEZYRPOHIO-UHFFFAOYSA-N iridium atom Chemical compound [Ir] GKOZUEZYRPOHIO-UHFFFAOYSA-N 0.000 description 1
- UGKDIUIOSMUOAW-UHFFFAOYSA-N iron nickel Chemical compound [Fe].[Ni] UGKDIUIOSMUOAW-UHFFFAOYSA-N 0.000 description 1
- 229910052746 lanthanum Inorganic materials 0.000 description 1
- FZLIPJUXYLNCLC-UHFFFAOYSA-N lanthanum atom Chemical compound [La] FZLIPJUXYLNCLC-UHFFFAOYSA-N 0.000 description 1
- WPBNNNQJVZRUHP-UHFFFAOYSA-L manganese(2+);methyl n-[[2-(methoxycarbonylcarbamothioylamino)phenyl]carbamothioyl]carbamate;n-[2-(sulfidocarbothioylamino)ethyl]carbamodithioate Chemical compound [Mn+2].[S-]C(=S)NCCNC([S-])=S.COC(=O)NC(=S)NC1=CC=CC=C1NC(=S)NC(=O)OC WPBNNNQJVZRUHP-UHFFFAOYSA-L 0.000 description 1
- 230000007246 mechanism Effects 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 229910052750 molybdenum Inorganic materials 0.000 description 1
- 239000011733 molybdenum Substances 0.000 description 1
- 229910052758 niobium Inorganic materials 0.000 description 1
- 239000010955 niobium Substances 0.000 description 1
- GUCVJGMIXFAOAE-UHFFFAOYSA-N niobium atom Chemical compound [Nb] GUCVJGMIXFAOAE-UHFFFAOYSA-N 0.000 description 1
- 229910052762 osmium Inorganic materials 0.000 description 1
- SYQBFIAQOQZEGI-UHFFFAOYSA-N osmium atom Chemical compound [Os] SYQBFIAQOQZEGI-UHFFFAOYSA-N 0.000 description 1
- 230000000737 periodic effect Effects 0.000 description 1
- 230000000704 physical effect Effects 0.000 description 1
- 230000008569 process Effects 0.000 description 1
- 238000012545 processing Methods 0.000 description 1
- 239000010453 quartz Substances 0.000 description 1
- 229910052702 rhenium Inorganic materials 0.000 description 1
- WUAPFZMCVAUBPE-UHFFFAOYSA-N rhenium atom Chemical compound [Re] WUAPFZMCVAUBPE-UHFFFAOYSA-N 0.000 description 1
- 229910052703 rhodium Inorganic materials 0.000 description 1
- 239000010948 rhodium Substances 0.000 description 1
- MHOVAHRLVXNVSD-UHFFFAOYSA-N rhodium atom Chemical compound [Rh] MHOVAHRLVXNVSD-UHFFFAOYSA-N 0.000 description 1
- 229910052707 ruthenium Inorganic materials 0.000 description 1
- 229910052706 scandium Inorganic materials 0.000 description 1
- SIXSYDAISGFNSX-UHFFFAOYSA-N scandium atom Chemical compound [Sc] SIXSYDAISGFNSX-UHFFFAOYSA-N 0.000 description 1
- 239000004332 silver Substances 0.000 description 1
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 1
- 239000002689 soil Substances 0.000 description 1
- 239000011343 solid material Substances 0.000 description 1
- 239000010959 steel Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 229910052715 tantalum Inorganic materials 0.000 description 1
- GUVRBAGPIYLISA-UHFFFAOYSA-N tantalum atom Chemical compound [Ta] GUVRBAGPIYLISA-UHFFFAOYSA-N 0.000 description 1
- 229910052713 technetium Inorganic materials 0.000 description 1
- GKLVYJBZJHMRIY-UHFFFAOYSA-N technetium atom Chemical compound [Tc] GKLVYJBZJHMRIY-UHFFFAOYSA-N 0.000 description 1
- 239000011135 tin Substances 0.000 description 1
- 238000012546 transfer Methods 0.000 description 1
- WFKWXMTUELFFGS-UHFFFAOYSA-N tungsten Chemical compound [W] WFKWXMTUELFFGS-UHFFFAOYSA-N 0.000 description 1
- 229910052721 tungsten Inorganic materials 0.000 description 1
- 239000010937 tungsten Substances 0.000 description 1
- GPPXJZIENCGNKB-UHFFFAOYSA-N vanadium Chemical compound [V]#[V] GPPXJZIENCGNKB-UHFFFAOYSA-N 0.000 description 1
- 230000000007 visual effect Effects 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
- 238000010626 work up procedure Methods 0.000 description 1
- 229910052727 yttrium Inorganic materials 0.000 description 1
- VWQVUPCCIRVNHF-UHFFFAOYSA-N yttrium atom Chemical compound [Y] VWQVUPCCIRVNHF-UHFFFAOYSA-N 0.000 description 1
- 229910052726 zirconium Inorganic materials 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C22—METALLURGY; FERROUS OR NON-FERROUS ALLOYS; TREATMENT OF ALLOYS OR NON-FERROUS METALS
- C22C—ALLOYS
- C22C19/00—Alloys based on nickel or cobalt
-
- C—CHEMISTRY; METALLURGY
- C22—METALLURGY; FERROUS OR NON-FERROUS ALLOYS; TREATMENT OF ALLOYS OR NON-FERROUS METALS
- C22C—ALLOYS
- C22C45/00—Amorphous alloys
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01F—MAGNETS; INDUCTANCES; TRANSFORMERS; SELECTION OF MATERIALS FOR THEIR MAGNETIC PROPERTIES
- H01F1/00—Magnets or magnetic bodies characterised by the magnetic materials therefor; Selection of materials for their magnetic properties
- H01F1/01—Magnets or magnetic bodies characterised by the magnetic materials therefor; Selection of materials for their magnetic properties of inorganic materials
- H01F1/03—Magnets or magnetic bodies characterised by the magnetic materials therefor; Selection of materials for their magnetic properties of inorganic materials characterised by their coercivity
- H01F1/12—Magnets or magnetic bodies characterised by the magnetic materials therefor; Selection of materials for their magnetic properties of inorganic materials characterised by their coercivity of soft-magnetic materials
- H01F1/14—Magnets or magnetic bodies characterised by the magnetic materials therefor; Selection of materials for their magnetic properties of inorganic materials characterised by their coercivity of soft-magnetic materials metals or alloys
- H01F1/147—Alloys characterised by their composition
- H01F1/153—Amorphous metallic alloys, e.g. glassy metals
-
- H—ELECTRICITY
- H03—ELECTRONIC CIRCUITRY
- H03H—IMPEDANCE NETWORKS, e.g. RESONANT CIRCUITS; RESONATORS
- H03H9/00—Networks comprising electromechanical or electro-acoustic elements; Electromechanical resonators
- H03H9/30—Time-delay networks
- H03H9/36—Time-delay networks with non-adjustable delay time
Landscapes
- Chemical & Material Sciences (AREA)
- Engineering & Computer Science (AREA)
- Materials Engineering (AREA)
- Mechanical Engineering (AREA)
- Metallurgy (AREA)
- Organic Chemistry (AREA)
- Physics & Mathematics (AREA)
- Electromagnetism (AREA)
- Dispersion Chemistry (AREA)
- Power Engineering (AREA)
- Acoustics & Sound (AREA)
- Soundproofing, Sound Blocking, And Sound Damping (AREA)
- Soft Magnetic Materials (AREA)
- Piezo-Electric Or Mechanical Vibrators, Or Delay Or Filter Circuits (AREA)
- Transducers For Ultrasonic Waves (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US00329935A US3838365A (en) | 1973-02-05 | 1973-02-05 | Acoustic devices using amorphous metal alloys |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2405036A1 true DE2405036A1 (de) | 1974-08-08 |
Family
ID=23287655
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19742405036 Ceased DE2405036A1 (de) | 1973-02-05 | 1974-02-02 | Akustische vorrichtungen aus amorphen metallegierungen |
Country Status (5)
| Country | Link |
|---|---|
| US (1) | US3838365A (enExample) |
| JP (1) | JPS5524727B2 (enExample) |
| DE (1) | DE2405036A1 (enExample) |
| GB (1) | GB1452541A (enExample) |
| NL (1) | NL7401006A (enExample) |
Cited By (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4188211A (en) * | 1977-02-18 | 1980-02-12 | Tdk Electronics Company, Limited | Thermally stable amorphous magnetic alloy |
| US4190438A (en) * | 1977-09-12 | 1980-02-26 | Sony Corporation | Amorphous magnetic alloy |
| US4495691A (en) * | 1981-03-31 | 1985-01-29 | Tsuyoshi Masumoto | Process for the production of fine amorphous metallic wires |
| DE3631830A1 (de) * | 1986-09-19 | 1988-03-31 | Demetron | Mehrstofflegierung fuer targets von kathodenzerstaeubungsanlagen und deren verwendung |
| DE4103145A1 (de) * | 1991-02-02 | 1992-08-13 | Schott Glaswerke | Ultraschallsonde |
Families Citing this family (16)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS5631882B2 (enExample) * | 1973-11-16 | 1981-07-24 | ||
| US4053333A (en) * | 1974-09-20 | 1977-10-11 | University Of Pennsylvania | Enhancing magnetic properties of amorphous alloys by annealing under stress |
| NL182182C (nl) * | 1974-11-29 | 1988-01-18 | Allied Chem | Inrichting met amorfe metaallegering. |
| US4030892A (en) * | 1976-03-02 | 1977-06-21 | Allied Chemical Corporation | Flexible electromagnetic shield comprising interlaced glassy alloy filaments |
| JPS52117002A (en) * | 1976-03-26 | 1977-10-01 | Shingijutsu Kaihatsu Jigyodan | Electric signal transmitter using ferromagnetic amorphous ribbon |
| US4116728B1 (en) * | 1976-09-02 | 1994-05-03 | Gen Electric | Treatment of amorphous magnetic alloys to produce a wide range of magnetic properties |
| US4085396A (en) * | 1976-09-27 | 1978-04-18 | Bell Telephone Laboratories, Incorporated | Electric fuse |
| JPS54139390A (en) * | 1977-09-24 | 1979-10-29 | Noboru Tsuya | Variable frequency electromagnetostrictive device |
| US4187128A (en) * | 1978-09-26 | 1980-02-05 | Bell Telephone Laboratories, Incorporated | Magnetic devices including amorphous alloys |
| JPS55152143A (en) * | 1979-05-16 | 1980-11-27 | Toyo Soda Mfg Co Ltd | Amorphous alloy electrode material for electrolysis |
| DE3066611D1 (en) * | 1979-10-05 | 1984-03-22 | Allied Corp | Core for electromagnetic induction device |
| US4389262A (en) * | 1980-12-31 | 1983-06-21 | Allied Corporation | Amorphous alloys of nickel, aluminum and boron |
| JPS5831053A (ja) * | 1981-08-18 | 1983-02-23 | Toshiba Corp | 非晶質合金 |
| JPS58213857A (ja) * | 1982-06-04 | 1983-12-12 | Takeshi Masumoto | 疲労特性に優れた非晶質鉄基合金 |
| JPS6425932A (en) * | 1988-07-06 | 1989-01-27 | Takeshi Masumoto | Co-type amorphous-metal filament |
| US5015993A (en) * | 1989-06-29 | 1991-05-14 | Pitney Bowes Inc. | Ferromagnetic alloys with high nickel content and high permeability |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2503831A (en) * | 1949-01-07 | 1950-04-11 | Bell Telephone Labor Inc | Fine wire delay line |
| US2672590A (en) * | 1950-03-22 | 1954-03-16 | Bell Telephone Labor Inc | Delay line |
| US2700738A (en) * | 1951-05-05 | 1955-01-25 | Ibm | Delay-line end cell |
| US3403271A (en) * | 1966-02-09 | 1968-09-24 | Hewlett Packard Co | Ultrasonic transducer with absorptive load |
-
1973
- 1973-02-05 US US00329935A patent/US3838365A/en not_active Expired - Lifetime
-
1974
- 1974-01-24 NL NL7401006A patent/NL7401006A/xx not_active Application Discontinuation
- 1974-02-02 DE DE19742405036 patent/DE2405036A1/de not_active Ceased
- 1974-02-05 GB GB529274A patent/GB1452541A/en not_active Expired
- 1974-02-05 JP JP1418574A patent/JPS5524727B2/ja not_active Expired
Non-Patent Citations (1)
| Title |
|---|
| US-Z.: Physical Acoustics, 1964, Bd.1A, S.418 * |
Cited By (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4188211A (en) * | 1977-02-18 | 1980-02-12 | Tdk Electronics Company, Limited | Thermally stable amorphous magnetic alloy |
| US4190438A (en) * | 1977-09-12 | 1980-02-26 | Sony Corporation | Amorphous magnetic alloy |
| US4495691A (en) * | 1981-03-31 | 1985-01-29 | Tsuyoshi Masumoto | Process for the production of fine amorphous metallic wires |
| DE3631830A1 (de) * | 1986-09-19 | 1988-03-31 | Demetron | Mehrstofflegierung fuer targets von kathodenzerstaeubungsanlagen und deren verwendung |
| US4808373A (en) * | 1986-09-19 | 1989-02-28 | Leybold-Heraeus Gmbh | Multiple-substance alloy for targets of cathode sputtering apparatus |
| DE4103145A1 (de) * | 1991-02-02 | 1992-08-13 | Schott Glaswerke | Ultraschallsonde |
Also Published As
| Publication number | Publication date |
|---|---|
| JPS5524727B2 (enExample) | 1980-07-01 |
| JPS49112551A (enExample) | 1974-10-26 |
| NL7401006A (enExample) | 1974-08-07 |
| GB1452541A (en) | 1976-10-13 |
| US3838365A (en) | 1974-09-24 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2405036A1 (de) | Akustische vorrichtungen aus amorphen metallegierungen | |
| DE2366326C2 (de) | Amorphe Nickel-Eisen-Basislegierung und deren Verwendung | |
| DE2516749C3 (de) | Verfahren zum Herstellen von Metallkörpern mit wiederholt reversiblem Gestaltwechselvermögen | |
| DE69300010T2 (de) | Hochfeste Aluminiumlegierung. | |
| DE3835986C2 (enExample) | ||
| DE69508319T2 (de) | Hochfeste und hochduktile Aluminium-Legierung und Verfahren zu deren Herstellung | |
| DE2721788A1 (de) | Magnetische bauelemente mit amorphen legierungen und deren herstellung | |
| DE4027483A1 (de) | Duenne folie und duenner draht aus einer legierung auf aluminium-basis und verfahren zur herstellung derselben | |
| DE2746712B2 (de) | Piezoelektrischer Resonator | |
| DE2855858A1 (de) | Amorphe legierung mit hoher magnetischer permeabilitaet | |
| EP0021101A1 (de) | Amorphe weichmagnetische Legierung | |
| DE3741004A1 (de) | Verfahren und vorrichtung zur herstellung supraleitender und permanentmagnetischer materialien | |
| DE4223645A1 (de) | Vibrations-bearbeitungsverfahren und schneidvorrichtung zu seiner durchfuehrung | |
| DE3035433A1 (de) | Ferromagnetische amorphe legierung | |
| DE68921856T2 (de) | Weichmagnetische auf Fe-basierende Legierung. | |
| DE69013227T2 (de) | Magnetkern. | |
| DE69224021T2 (de) | Verfahren zur Herstellung von einem Werkstoff aus einer amorphen Legierung mit hoher Festigkeit und guter Zähigkeit | |
| DE2915737A1 (de) | Amorphe metallegierung und baender daraus | |
| DE3021536C2 (de) | Amorpher Werkstoff | |
| DE69105363T2 (de) | Hochfeste Legierungen auf Magnesiumbasis. | |
| DE2134924C3 (de) | Werkstoff für einen metallischen Schall-Leiter oder Schallstrahler | |
| WO1997021242A2 (de) | Anzeigeelement für die verwendung in einem magnetischen diebstahlsicherungssystem | |
| DE69014049T2 (de) | Magnetostriktive Kobalt-Eisenlegierungen und ihre Produktanwendungen. | |
| DE1114957B (de) | Elektromechanische Verzoegerungsvorrichtung | |
| DE1303373B (enExample) |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8110 | Request for examination paragraph 44 | ||
| 8127 | New person/name/address of the applicant |
Owner name: ALLIED CORP., MORRIS TOWNSHIP, N.J., US |
|
| 8128 | New person/name/address of the agent |
Representative=s name: WEBER, D., DIPL.-CHEM. DR.RER.NAT. SEIFFERT, K., D |
|
| 8131 | Rejection |