DE2336708C3 - Ophthalmische Linse mit progressiv sich ändernder Brechkraft - Google Patents
Ophthalmische Linse mit progressiv sich ändernder BrechkraftInfo
- Publication number
- DE2336708C3 DE2336708C3 DE2336708A DE2336708A DE2336708C3 DE 2336708 C3 DE2336708 C3 DE 2336708C3 DE 2336708 A DE2336708 A DE 2336708A DE 2336708 A DE2336708 A DE 2336708A DE 2336708 C3 DE2336708 C3 DE 2336708C3
- Authority
- DE
- Germany
- Prior art keywords
- lens
- curve
- curvature
- point
- vision
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 230000004438 eyesight Effects 0.000 claims description 32
- 208000001491 myopia Diseases 0.000 claims description 12
- 230000003287 optical effect Effects 0.000 claims description 9
- 230000000750 progressive effect Effects 0.000 claims description 8
- 230000003068 static effect Effects 0.000 claims description 5
- 230000004305 hyperopia Effects 0.000 claims description 4
- 201000006318 hyperopia Diseases 0.000 claims description 4
- 230000004075 alteration Effects 0.000 claims description 3
- 239000011521 glass Substances 0.000 claims description 3
- 230000007423 decrease Effects 0.000 claims description 2
- 239000007787 solid Substances 0.000 claims description 2
- 201000009310 astigmatism Diseases 0.000 claims 3
- 238000003384 imaging method Methods 0.000 claims 2
- 238000007493 shaping process Methods 0.000 claims 2
- 230000000694 effects Effects 0.000 description 4
- RXOIEVSUURELPG-UHFFFAOYSA-N fenozolone Chemical compound O1C(NCC)=NC(=O)C1C1=CC=CC=C1 RXOIEVSUURELPG-UHFFFAOYSA-N 0.000 description 4
- 238000010408 sweeping Methods 0.000 description 3
- 238000006073 displacement reaction Methods 0.000 description 2
- 101100408383 Mus musculus Piwil1 gene Proteins 0.000 description 1
- 229910000831 Steel Inorganic materials 0.000 description 1
- 240000007313 Tilia cordata Species 0.000 description 1
- 206010047571 Visual impairment Diseases 0.000 description 1
- 210000004556 brain Anatomy 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 238000005266 casting Methods 0.000 description 1
- 230000003247 decreasing effect Effects 0.000 description 1
- 238000013461 design Methods 0.000 description 1
- 229910003460 diamond Inorganic materials 0.000 description 1
- 239000010432 diamond Substances 0.000 description 1
- 230000014509 gene expression Effects 0.000 description 1
- 210000003128 head Anatomy 0.000 description 1
- 238000011835 investigation Methods 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 238000000034 method Methods 0.000 description 1
- 230000004379 myopia Effects 0.000 description 1
- 238000005498 polishing Methods 0.000 description 1
- 238000012545 processing Methods 0.000 description 1
- 238000001454 recorded image Methods 0.000 description 1
- 239000010959 steel Substances 0.000 description 1
- 238000012360 testing method Methods 0.000 description 1
- 208000029257 vision disease Diseases 0.000 description 1
- 208000013021 vision distortion Diseases 0.000 description 1
- 230000000007 visual effect Effects 0.000 description 1
- 230000004393 visual impairment Effects 0.000 description 1
Classifications
-
- G—PHYSICS
- G02—OPTICS
- G02C—SPECTACLES; SUNGLASSES OR GOGGLES INSOFAR AS THEY HAVE THE SAME FEATURES AS SPECTACLES; CONTACT LENSES
- G02C7/00—Optical parts
- G02C7/02—Lenses; Lens systems ; Methods of designing lenses
- G02C7/06—Lenses; Lens systems ; Methods of designing lenses bifocal; multifocal ; progressive
- G02C7/061—Spectacle lenses with progressively varying focal power
- G02C7/063—Shape of the progressive surface
- G02C7/065—Properties on the principal line
-
- G—PHYSICS
- G02—OPTICS
- G02C—SPECTACLES; SUNGLASSES OR GOGGLES INSOFAR AS THEY HAVE THE SAME FEATURES AS SPECTACLES; CONTACT LENSES
- G02C7/00—Optical parts
- G02C7/02—Lenses; Lens systems ; Methods of designing lenses
- G02C7/06—Lenses; Lens systems ; Methods of designing lenses bifocal; multifocal ; progressive
- G02C7/061—Spectacle lenses with progressively varying focal power
Landscapes
- Health & Medical Sciences (AREA)
- Ophthalmology & Optometry (AREA)
- Physics & Mathematics (AREA)
- General Health & Medical Sciences (AREA)
- General Physics & Mathematics (AREA)
- Optics & Photonics (AREA)
- Eyeglasses (AREA)
- Lenses (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| FR7226947A FR2193989B2 (enExample) | 1972-07-26 | 1972-07-26 |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE2336708A1 DE2336708A1 (de) | 1974-02-07 |
| DE2336708B2 DE2336708B2 (de) | 1980-07-03 |
| DE2336708C3 true DE2336708C3 (de) | 1981-03-12 |
Family
ID=9102395
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2336708A Expired DE2336708C3 (de) | 1972-07-26 | 1973-07-19 | Ophthalmische Linse mit progressiv sich ändernder Brechkraft |
Country Status (17)
| Country | Link |
|---|---|
| US (1) | US3910691A (enExample) |
| JP (1) | JPS5220271B2 (enExample) |
| AT (1) | AT328765B (enExample) |
| AU (1) | AU471562B2 (enExample) |
| BE (1) | BE802400A (enExample) |
| BR (1) | BR7305631D0 (enExample) |
| CA (1) | CA981075A (enExample) |
| CS (1) | CS167393B2 (enExample) |
| DD (1) | DD107152A5 (enExample) |
| DE (1) | DE2336708C3 (enExample) |
| FR (1) | FR2193989B2 (enExample) |
| GB (1) | GB1403675A (enExample) |
| HU (1) | HU167920B (enExample) |
| IT (1) | IT991863B (enExample) |
| NL (1) | NL176811C (enExample) |
| RO (1) | RO72099A (enExample) |
| SU (1) | SU515473A3 (enExample) |
Families Citing this family (28)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4056311A (en) * | 1973-08-16 | 1977-11-01 | American Optical Corporation | Progressive power ophthalmic lens having a plurality of viewing zones with non-discontinuous variations therebetween |
| US4055379A (en) * | 1973-08-16 | 1977-10-25 | American Optical Corporation | Multifocal lens |
| CA1012392A (en) * | 1973-08-16 | 1977-06-21 | American Optical Corporation | Progressive power ophthalmic lens |
| DE2610203B2 (de) * | 1976-03-11 | 1981-01-22 | Optische Werke G. Rodenstock, 8000 Muenchen | Progressives Brillenglas |
| DE2814916C3 (de) | 1978-04-06 | 1982-01-07 | Optische Werke G. Rodenstock, 8000 München | Brillenglas mit einem zwischen Fernteil und Nahteil liegenden Progressionsbereich |
| FR2425653A1 (fr) * | 1978-05-12 | 1979-12-07 | Essilor Int | Procede pour elaborer une surface de refraction d'une lentille ophtalmique a puissance focale progressivement variable |
| US4292030A (en) * | 1980-01-16 | 1981-09-29 | Itek Corporation | Teaching device for progressive power lenses |
| US4307945A (en) * | 1980-02-14 | 1981-12-29 | Itek Corporation | Progressively varying focal power opthalmic lens |
| JPS57210320A (en) * | 1981-06-19 | 1982-12-23 | Hoya Corp | Progressive focus lens |
| JPS5958415A (ja) * | 1982-09-29 | 1984-04-04 | Seiko Epson Corp | 累進多焦点レンズ |
| GB2146791B (en) * | 1983-09-16 | 1987-01-28 | Suwa Seikosha Kk | Progressive multifocal ophthalmic lens |
| FR2617989B1 (fr) * | 1987-07-07 | 1989-10-27 | Essilor Int | Lentille ophtalmique multifocale |
| US5000559A (en) * | 1988-02-29 | 1991-03-19 | Nikon Corporation | Ophthalmic lenses having progressively variable refracting power |
| DE3901775A1 (de) * | 1988-06-22 | 1990-07-26 | Rodenstock Optik G | Brillenglas mit einem sich aendernden brechungsindex |
| US5048945A (en) * | 1989-07-14 | 1991-09-17 | Nikon Corporation | Progressive power lens |
| WO1992012452A1 (fr) * | 1990-12-27 | 1992-07-23 | Seiko Epson Corporation | Lentille progressive |
| US5110199A (en) * | 1991-02-01 | 1992-05-05 | Takeshi Ishida | Distortion free ophthalmic lens for presbyopia having wide range distinct views |
| FR2683643B1 (fr) * | 1991-11-12 | 1994-01-14 | Essilor Internal Cie Gle Optique | Lentille ophtalmique multifocale progressive. |
| FR2683642B1 (fr) * | 1991-11-12 | 1994-01-14 | Essilor Internal Cie Gle Optique | Lentille ophtalmique multifocale progressive. |
| DE4210008A1 (de) * | 1992-03-27 | 1993-09-30 | Zeiss Carl Fa | Brillenlinse |
| FR2704327B1 (fr) * | 1993-04-23 | 1995-06-23 | Essilor Int | Paire de lentilles ophtalmiques multifocales progressives. |
| JPH06337380A (ja) * | 1993-05-31 | 1994-12-06 | Nikon Corp | 累進多焦点レンズ |
| ATE203835T1 (de) * | 1994-03-30 | 2001-08-15 | Rodenstock Optik G | Serie progressiver brillengläser |
| WO1996013748A2 (de) * | 1994-10-29 | 1996-05-09 | Optische Werke G. Rodenstock | Serie progressiver brillengläser |
| US5861934A (en) * | 1996-05-06 | 1999-01-19 | Innotech, Inc. | Refractive index gradient lens |
| EP2075622A3 (fr) | 2007-11-27 | 2010-01-13 | Optofinanz AG | Lentilles ophtalmiques multifocales progressives à distribution constante |
| CN101952767B (zh) * | 2008-02-20 | 2014-04-02 | 瑞士风尼克斯股份有限公司 | 对于宽范围的折射率、基曲线和附加值同一地最优化的渐进多焦点眼镜片 |
| EP3685387A4 (en) | 2017-09-18 | 2021-06-16 | Indizen Optical Technologies Of America, LLC | EYEGLASSES DESIGN WITH VISUAL SHARPNESS PROFILE |
Family Cites Families (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2109474A (en) * | 1931-12-07 | 1938-03-01 | Evans Charles Ernest | Spectacle lens |
| DE1151955B (de) * | 1953-11-25 | 1963-07-25 | & Commerciale Des Ouvriers Lun | Optisches Element mit stetig veraenderlicher Brechkraft |
| US2878721A (en) * | 1954-02-03 | 1959-03-24 | Farrand Optical Co Inc | Multifocal ophthalmic lenses |
| FR67669E (fr) * | 1955-03-09 | 1958-03-17 | Comm Ouvriers Lunetiers Soc In | Systèmes optiques à puissance localement variable |
| FR1509090A (fr) * | 1966-11-29 | 1968-01-12 | Lunetiers Cottet Poichet Soc D | Perfectionnements aux lentilles ophtalmiques à puissance focale progressivement variable |
| US3468067A (en) * | 1967-02-13 | 1969-09-23 | Lawrence H Larson | Apparatus for use in grinding lenses |
| BE755907A (fr) * | 1969-09-11 | 1971-02-15 | Lunetiers | Lentilles a puissance focale progressive |
| US3711191A (en) * | 1971-09-16 | 1973-01-16 | L Tagnon | Aberration corrected ophthalmic progressive power lenses |
-
1972
- 1972-07-26 FR FR7226947A patent/FR2193989B2/fr not_active Expired
-
1973
- 1973-07-16 BE BE133528A patent/BE802400A/xx not_active IP Right Cessation
- 1973-07-19 CA CA176,833A patent/CA981075A/en not_active Expired
- 1973-07-19 DE DE2336708A patent/DE2336708C3/de not_active Expired
- 1973-07-20 NL NLAANVRAGE7310190,A patent/NL176811C/xx not_active IP Right Cessation
- 1973-07-20 GB GB3469073A patent/GB1403675A/en not_active Expired
- 1973-07-23 US US381476A patent/US3910691A/en not_active Expired - Lifetime
- 1973-07-24 DD DD172484A patent/DD107152A5/xx unknown
- 1973-07-24 AT AT650873A patent/AT328765B/de not_active IP Right Cessation
- 1973-07-25 BR BR5631/73A patent/BR7305631D0/pt unknown
- 1973-07-25 CS CS5319A patent/CS167393B2/cs unknown
- 1973-07-25 RO RO7375583A patent/RO72099A/ro unknown
- 1973-07-25 JP JP48083962A patent/JPS5220271B2/ja not_active Expired
- 1973-07-25 SU SU1942491A patent/SU515473A3/ru active
- 1973-07-25 HU HUEI487A patent/HU167920B/hu unknown
- 1973-07-25 AU AU58511/73A patent/AU471562B2/en not_active Expired
- 1973-07-25 IT IT69234/73A patent/IT991863B/it active
Also Published As
| Publication number | Publication date |
|---|---|
| US3910691A (en) | 1975-10-07 |
| DE2336708A1 (de) | 1974-02-07 |
| CS167393B2 (enExample) | 1976-04-29 |
| FR2193989A2 (enExample) | 1974-02-22 |
| NL176811B (nl) | 1985-01-02 |
| DD107152A5 (enExample) | 1974-07-12 |
| GB1403675A (en) | 1975-08-28 |
| JPS4959652A (enExample) | 1974-06-10 |
| BE802400A (fr) | 1973-11-16 |
| BR7305631D0 (pt) | 1974-08-22 |
| CA981075A (en) | 1976-01-06 |
| ATA650873A (de) | 1975-06-15 |
| FR2193989B2 (enExample) | 1975-03-07 |
| AU5851173A (en) | 1975-01-30 |
| NL7310190A (enExample) | 1974-01-29 |
| JPS5220271B2 (enExample) | 1977-06-02 |
| DE2336708B2 (de) | 1980-07-03 |
| RO72099A (ro) | 1981-06-26 |
| AU471562B2 (en) | 1976-04-29 |
| NL176811C (nl) | 1985-06-03 |
| HU167920B (enExample) | 1976-01-28 |
| AT328765B (de) | 1976-04-12 |
| IT991863B (it) | 1975-08-30 |
| SU515473A3 (ru) | 1976-05-25 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2336708C3 (de) | Ophthalmische Linse mit progressiv sich ändernder Brechkraft | |
| DE2044639C3 (de) | Ophthalmische Linse mit progressiv sich ändernder Brechkraft | |
| EP0191831B1 (de) | Progressives brillenglas | |
| EP0202559B1 (de) | Multifokale Brillenlinse mit mindestens einer Gleitsichtfläche | |
| DE4342234C2 (de) | Gleitsichtbrillenlinse | |
| DE69714273T2 (de) | Serie progressiver ophtalmischer multifokaler linsen | |
| DE3018578A1 (de) | Ophthalmische progressive linse sowie verfahren zu ihrer herstellung | |
| DE69722076T2 (de) | Superposition vor entwürfen für weiche und harte progressive linse | |
| DE3634844C2 (de) | Gleitsichtglas | |
| WO2001081979A2 (de) | Verfahren zum berechnen eines progressiven brillenglases sowie verahren zur herstellung eines derartigen brillenglases | |
| EP1150140B1 (de) | Verfahren zur Herstellung einer Brillenlinse, Brillenlinse und Brillenlinsefamilie | |
| DD144126A5 (de) | Ophthalmische linse mit stetig veraenderlicher brechkraft | |
| EP0452802A2 (de) | Gleitsichtfläche für eine Gleitsichtbrillenlinse | |
| DE3151766A1 (de) | Brillenglas mit zwei brechflaechen | |
| EP1410098A2 (de) | Verfahren zur herstellung von progressiven brillengläsern | |
| EP0291094A1 (de) | Progressives Brillenglas | |
| DE3822376A1 (de) | Ophthalmische gleitlinse | |
| DE3856153T2 (de) | Progressive Multifokallinse | |
| EP1488274B1 (de) | Progressives brillenglas mit zwei asphärischen, progressiven flächen | |
| DE69431271T2 (de) | Progressive Multifokallinse | |
| DE3218139A1 (de) | Rohform fuer brillenlinsen und mittel zur auswahl der geeigneten rohform | |
| EP0864112A1 (de) | Progressives brillenglas | |
| DE3307009A1 (de) | Brillenglas mit sich verlaufend aendernder brechkraft | |
| DE3635777A1 (de) | Progressives brillenglas | |
| DE10191693B4 (de) | Progressives Brillenglas mit geringer Änderung der binokularen Eigenschaften bei einer Blickbewegung |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OGA | New person/name/address of the applicant | ||
| C3 | Grant after two publication steps (3rd publication) | ||
| 8328 | Change in the person/name/address of the agent |
Free format text: DEUFEL, P., DIPL.-CHEM.DIPL.-WIRTSCH.-ING.DR.RER.NAT SCHOEN, A., DIPL.-CHEM. DR.RER.NAT. HERTEL, W., DIPL.-PHYS. LEWALD, D., DIPL.-ING. OTTO, D., DIPL.-ING. DR.-ING., PAT.-ANW., 8000 MUENCHEN |