DE2302574C3 - Schleifmittel und Verfahren zu seiner Herstellung - Google Patents
Schleifmittel und Verfahren zu seiner HerstellungInfo
- Publication number
- DE2302574C3 DE2302574C3 DE2302574A DE2302574A DE2302574C3 DE 2302574 C3 DE2302574 C3 DE 2302574C3 DE 2302574 A DE2302574 A DE 2302574A DE 2302574 A DE2302574 A DE 2302574A DE 2302574 C3 DE2302574 C3 DE 2302574C3
- Authority
- DE
- Germany
- Prior art keywords
- metal
- abrasive
- particles
- tungsten
- diamonds
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000000034 method Methods 0.000 title claims description 40
- 239000003082 abrasive agent Substances 0.000 title claims description 34
- 238000004519 manufacturing process Methods 0.000 title claims description 12
- 230000008569 process Effects 0.000 title description 21
- 229910052751 metal Inorganic materials 0.000 claims description 139
- 239000002184 metal Substances 0.000 claims description 139
- 239000002245 particle Substances 0.000 claims description 103
- 239000010432 diamond Substances 0.000 claims description 67
- 229910003460 diamond Inorganic materials 0.000 claims description 33
- 239000011159 matrix material Substances 0.000 claims description 33
- WFKWXMTUELFFGS-UHFFFAOYSA-N tungsten Chemical compound [W] WFKWXMTUELFFGS-UHFFFAOYSA-N 0.000 claims description 30
- 229910052721 tungsten Inorganic materials 0.000 claims description 29
- 239000010937 tungsten Substances 0.000 claims description 29
- UONOETXJSWQNOL-UHFFFAOYSA-N tungsten carbide Chemical compound [W+]#[C-] UONOETXJSWQNOL-UHFFFAOYSA-N 0.000 claims description 25
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 12
- 239000001257 hydrogen Substances 0.000 claims description 12
- 229910052739 hydrogen Inorganic materials 0.000 claims description 12
- 229910052750 molybdenum Inorganic materials 0.000 claims description 10
- 239000011733 molybdenum Substances 0.000 claims description 10
- ZOKXTWBITQBERF-UHFFFAOYSA-N Molybdenum Chemical compound [Mo] ZOKXTWBITQBERF-UHFFFAOYSA-N 0.000 claims description 9
- 229910010271 silicon carbide Inorganic materials 0.000 claims description 8
- TWNQGVIAIRXVLR-UHFFFAOYSA-N oxo(oxoalumanyloxy)alumane Chemical compound O=[Al]O[Al]=O TWNQGVIAIRXVLR-UHFFFAOYSA-N 0.000 claims description 6
- 239000007789 gas Substances 0.000 claims description 5
- 239000010955 niobium Substances 0.000 claims description 5
- 229910052715 tantalum Inorganic materials 0.000 claims description 5
- GUVRBAGPIYLISA-UHFFFAOYSA-N tantalum atom Chemical compound [Ta] GUVRBAGPIYLISA-UHFFFAOYSA-N 0.000 claims description 5
- 229910052758 niobium Inorganic materials 0.000 claims description 4
- GUCVJGMIXFAOAE-UHFFFAOYSA-N niobium atom Chemical compound [Nb] GUCVJGMIXFAOAE-UHFFFAOYSA-N 0.000 claims description 4
- 229910002651 NO3 Inorganic materials 0.000 claims description 3
- NHNBFGGVMKEFGY-UHFFFAOYSA-N Nitrate Chemical compound [O-][N+]([O-])=O NHNBFGGVMKEFGY-UHFFFAOYSA-N 0.000 claims description 3
- 238000000354 decomposition reaction Methods 0.000 claims description 3
- 210000001787 dendrite Anatomy 0.000 claims description 3
- -1 metal compound Halide Chemical class 0.000 claims description 3
- 229910001963 alkali metal nitrate Inorganic materials 0.000 claims description 2
- 230000001427 coherent effect Effects 0.000 claims description 2
- 239000000758 substrate Substances 0.000 description 34
- 238000000227 grinding Methods 0.000 description 21
- 150000002739 metals Chemical class 0.000 description 21
- 238000006243 chemical reaction Methods 0.000 description 18
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 17
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 14
- 239000000463 material Substances 0.000 description 14
- 230000008018 melting Effects 0.000 description 14
- 238000002844 melting Methods 0.000 description 14
- 238000000576 coating method Methods 0.000 description 13
- 239000000203 mixture Substances 0.000 description 13
- 239000011248 coating agent Substances 0.000 description 10
- 238000005538 encapsulation Methods 0.000 description 10
- 239000012071 phase Substances 0.000 description 10
- 239000011230 binding agent Substances 0.000 description 9
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 8
- 229910045601 alloy Inorganic materials 0.000 description 8
- 239000000956 alloy Substances 0.000 description 8
- 239000010941 cobalt Substances 0.000 description 8
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 description 8
- 229910052759 nickel Inorganic materials 0.000 description 8
- 230000008901 benefit Effects 0.000 description 7
- 229910017052 cobalt Inorganic materials 0.000 description 7
- 239000013078 crystal Substances 0.000 description 7
- 239000000047 product Substances 0.000 description 7
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 6
- 229910052742 iron Inorganic materials 0.000 description 6
- 230000000704 physical effect Effects 0.000 description 6
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 5
- 230000015572 biosynthetic process Effects 0.000 description 5
- 150000001875 compounds Chemical class 0.000 description 5
- 230000006835 compression Effects 0.000 description 5
- 238000007906 compression Methods 0.000 description 5
- 238000005520 cutting process Methods 0.000 description 5
- 230000005484 gravity Effects 0.000 description 5
- 238000007731 hot pressing Methods 0.000 description 5
- 150000002736 metal compounds Chemical class 0.000 description 5
- 239000000843 powder Substances 0.000 description 5
- 239000000126 substance Substances 0.000 description 5
- 229910052786 argon Inorganic materials 0.000 description 4
- 238000009835 boiling Methods 0.000 description 4
- 239000010949 copper Substances 0.000 description 4
- 238000000151 deposition Methods 0.000 description 4
- 230000008595 infiltration Effects 0.000 description 4
- 238000001764 infiltration Methods 0.000 description 4
- FGIUAXJPYTZDNR-UHFFFAOYSA-N potassium nitrate Chemical compound [K+].[O-][N+]([O-])=O FGIUAXJPYTZDNR-UHFFFAOYSA-N 0.000 description 4
- 238000001556 precipitation Methods 0.000 description 4
- 239000010936 titanium Substances 0.000 description 4
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 3
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical compound [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 description 3
- 229910052799 carbon Inorganic materials 0.000 description 3
- 239000011651 chromium Substances 0.000 description 3
- 229910052802 copper Inorganic materials 0.000 description 3
- 230000008021 deposition Effects 0.000 description 3
- 238000005553 drilling Methods 0.000 description 3
- 238000005530 etching Methods 0.000 description 3
- 229910002804 graphite Inorganic materials 0.000 description 3
- 239000010439 graphite Substances 0.000 description 3
- 239000007788 liquid Substances 0.000 description 3
- 239000003921 oil Substances 0.000 description 3
- 239000011148 porous material Substances 0.000 description 3
- 230000009467 reduction Effects 0.000 description 3
- 229910052719 titanium Inorganic materials 0.000 description 3
- NXHILIPIEUBEPD-UHFFFAOYSA-H tungsten hexafluoride Chemical compound F[W](F)(F)(F)(F)F NXHILIPIEUBEPD-UHFFFAOYSA-H 0.000 description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 3
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- 229910000906 Bronze Inorganic materials 0.000 description 2
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 2
- 238000010521 absorption reaction Methods 0.000 description 2
- YRKCREAYFQTBPV-UHFFFAOYSA-N acetylacetone Chemical compound CC(=O)CC(C)=O YRKCREAYFQTBPV-UHFFFAOYSA-N 0.000 description 2
- IWOUKMZUPDVPGQ-UHFFFAOYSA-N barium nitrate Chemical compound [Ba+2].[O-][N+]([O-])=O.[O-][N+]([O-])=O IWOUKMZUPDVPGQ-UHFFFAOYSA-N 0.000 description 2
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 2
- 239000012159 carrier gas Substances 0.000 description 2
- 239000007795 chemical reaction product Substances 0.000 description 2
- 238000005253 cladding Methods 0.000 description 2
- 238000010276 construction Methods 0.000 description 2
- 239000000356 contaminant Substances 0.000 description 2
- 230000008602 contraction Effects 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 210000003298 dental enamel Anatomy 0.000 description 2
- 238000009713 electroplating Methods 0.000 description 2
- 230000008020 evaporation Effects 0.000 description 2
- 238000001704 evaporation Methods 0.000 description 2
- 150000004820 halides Chemical class 0.000 description 2
- 239000012535 impurity Substances 0.000 description 2
- 239000011261 inert gas Substances 0.000 description 2
- 239000000155 melt Substances 0.000 description 2
- 229910001092 metal group alloy Inorganic materials 0.000 description 2
- 238000001465 metallisation Methods 0.000 description 2
- NFFIWVVINABMKP-UHFFFAOYSA-N methylidynetantalum Chemical compound [Ta]#C NFFIWVVINABMKP-UHFFFAOYSA-N 0.000 description 2
- 235000010333 potassium nitrate Nutrition 0.000 description 2
- 239000004323 potassium nitrate Substances 0.000 description 2
- 239000011347 resin Substances 0.000 description 2
- 229920005989 resin Polymers 0.000 description 2
- HBMJWWWQQXIZIP-UHFFFAOYSA-N silicon carbide Chemical compound [Si+]#[C-] HBMJWWWQQXIZIP-UHFFFAOYSA-N 0.000 description 2
- PUZPDOWCWNUUKD-UHFFFAOYSA-M sodium fluoride Chemical compound [F-].[Na+] PUZPDOWCWNUUKD-UHFFFAOYSA-M 0.000 description 2
- VWDWKYIASSYTQR-UHFFFAOYSA-N sodium nitrate Chemical compound [Na+].[O-][N+]([O-])=O VWDWKYIASSYTQR-UHFFFAOYSA-N 0.000 description 2
- 229910000679 solder Inorganic materials 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 239000004575 stone Substances 0.000 description 2
- 229910003468 tantalcarbide Inorganic materials 0.000 description 2
- 210000002268 wool Anatomy 0.000 description 2
- QYEXBYZXHDUPRC-UHFFFAOYSA-N B#[Ti]#B Chemical compound B#[Ti]#B QYEXBYZXHDUPRC-UHFFFAOYSA-N 0.000 description 1
- 229910001369 Brass Inorganic materials 0.000 description 1
- 229910001018 Cast iron Inorganic materials 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 description 1
- 229910000531 Co alloy Inorganic materials 0.000 description 1
- 229910000599 Cr alloy Inorganic materials 0.000 description 1
- 229910000570 Cupronickel Inorganic materials 0.000 description 1
- BQRLJJVONXNNNX-UHFFFAOYSA-H F[Ni](F)(F)(F)(F)F Chemical compound F[Ni](F)(F)(F)(F)F BQRLJJVONXNNNX-UHFFFAOYSA-H 0.000 description 1
- KRHYYFGTRYWZRS-UHFFFAOYSA-N Fluorane Chemical compound F KRHYYFGTRYWZRS-UHFFFAOYSA-N 0.000 description 1
- KRHYYFGTRYWZRS-UHFFFAOYSA-M Fluoride anion Chemical compound [F-] KRHYYFGTRYWZRS-UHFFFAOYSA-M 0.000 description 1
- 229910015275 MoF 6 Inorganic materials 0.000 description 1
- 229910019800 NbF 5 Inorganic materials 0.000 description 1
- 229910000676 Si alloy Inorganic materials 0.000 description 1
- 229910001128 Sn alloy Inorganic materials 0.000 description 1
- 229910004529 TaF 5 Inorganic materials 0.000 description 1
- 229910033181 TiB2 Inorganic materials 0.000 description 1
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 description 1
- 229910021552 Vanadium(IV) chloride Inorganic materials 0.000 description 1
- 229910001080 W alloy Inorganic materials 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- DBNPLCUZNLSUCT-UHFFFAOYSA-N [B].[B].[B].[B].[B].[B].[Ba] Chemical compound [B].[B].[B].[B].[B].[B].[Ba] DBNPLCUZNLSUCT-UHFFFAOYSA-N 0.000 description 1
- PQZSQOYXZGDGQW-UHFFFAOYSA-N [W].[Pb] Chemical compound [W].[Pb] PQZSQOYXZGDGQW-UHFFFAOYSA-N 0.000 description 1
- JJTJVUVSSNKMBH-UHFFFAOYSA-N [Zr+4].[V+5] Chemical compound [Zr+4].[V+5] JJTJVUVSSNKMBH-UHFFFAOYSA-N 0.000 description 1
- 238000005299 abrasion Methods 0.000 description 1
- 230000009471 action Effects 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 239000007767 bonding agent Substances 0.000 description 1
- 239000010951 brass Substances 0.000 description 1
- 239000011449 brick Substances 0.000 description 1
- 239000010974 bronze Substances 0.000 description 1
- 230000005587 bubbling Effects 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- FQNHWXHRAUXLFU-UHFFFAOYSA-N carbon monoxide;tungsten Chemical group [W].[O+]#[C-].[O+]#[C-].[O+]#[C-].[O+]#[C-].[O+]#[C-].[O+]#[C-] FQNHWXHRAUXLFU-UHFFFAOYSA-N 0.000 description 1
- 230000015556 catabolic process Effects 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 239000000919 ceramic Substances 0.000 description 1
- 239000011195 cermet Substances 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 238000005229 chemical vapour deposition Methods 0.000 description 1
- 238000004140 cleaning Methods 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- YOCUPQPZWBBYIX-UHFFFAOYSA-N copper nickel Chemical compound [Ni].[Cu] YOCUPQPZWBBYIX-UHFFFAOYSA-N 0.000 description 1
- KUNSUQLRTQLHQQ-UHFFFAOYSA-N copper tin Chemical compound [Cu].[Sn] KUNSUQLRTQLHQQ-UHFFFAOYSA-N 0.000 description 1
- 230000006378 damage Effects 0.000 description 1
- 230000003247 decreasing effect Effects 0.000 description 1
- 238000005137 deposition process Methods 0.000 description 1
- 230000001627 detrimental effect Effects 0.000 description 1
- 238000010586 diagram Methods 0.000 description 1
- 238000009826 distribution Methods 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 239000003792 electrolyte Substances 0.000 description 1
- 239000008393 encapsulating agent Substances 0.000 description 1
- 239000006023 eutectic alloy Substances 0.000 description 1
- 239000004744 fabric Substances 0.000 description 1
- 239000011888 foil Substances 0.000 description 1
- 239000003292 glue Substances 0.000 description 1
- MELCCCHYSRGEEL-UHFFFAOYSA-N hafnium diboride Chemical compound [Hf]1B=B1 MELCCCHYSRGEEL-UHFFFAOYSA-N 0.000 description 1
- PFSXARRIPPWGNC-UHFFFAOYSA-J hexafluorotitanium(2-);hydron Chemical compound [H+].[H+].[F-].[F-].[F-].[F-].[F-].[F-].[Ti+4] PFSXARRIPPWGNC-UHFFFAOYSA-J 0.000 description 1
- 229910000040 hydrogen fluoride Inorganic materials 0.000 description 1
- 229910000039 hydrogen halide Inorganic materials 0.000 description 1
- 239000012433 hydrogen halide Substances 0.000 description 1
- 238000007654 immersion Methods 0.000 description 1
- 238000005470 impregnation Methods 0.000 description 1
- 230000006872 improvement Effects 0.000 description 1
- 230000006698 induction Effects 0.000 description 1
- 238000003780 insertion Methods 0.000 description 1
- 230000037431 insertion Effects 0.000 description 1
- 229940087654 iron carbonyl Drugs 0.000 description 1
- 239000007791 liquid phase Substances 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- WPBNNNQJVZRUHP-UHFFFAOYSA-L manganese(2+);methyl n-[[2-(methoxycarbonylcarbamothioylamino)phenyl]carbamothioyl]carbamate;n-[2-(sulfidocarbothioylamino)ethyl]carbamodithioate Chemical compound [Mn+2].[S-]C(=S)NCCNC([S-])=S.COC(=O)NC(=S)NC1=CC=CC=C1NC(=S)NC(=O)OC WPBNNNQJVZRUHP-UHFFFAOYSA-L 0.000 description 1
- 238000005259 measurement Methods 0.000 description 1
- 150000001247 metal acetylides Chemical class 0.000 description 1
- 229910001507 metal halide Inorganic materials 0.000 description 1
- 150000005309 metal halides Chemical class 0.000 description 1
- 238000001000 micrograph Methods 0.000 description 1
- 238000000465 moulding Methods 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- DSYRJFDOOSKABR-UHFFFAOYSA-I niobium(v) bromide Chemical compound [Br-].[Br-].[Br-].[Br-].[Br-].[Nb+5] DSYRJFDOOSKABR-UHFFFAOYSA-I 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 230000001590 oxidative effect Effects 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 229910052763 palladium Inorganic materials 0.000 description 1
- YHBDIEWMOMLKOO-UHFFFAOYSA-I pentachloroniobium Chemical compound Cl[Nb](Cl)(Cl)(Cl)Cl YHBDIEWMOMLKOO-UHFFFAOYSA-I 0.000 description 1
- AOLPZAHRYHXPLR-UHFFFAOYSA-I pentafluoroniobium Chemical compound F[Nb](F)(F)(F)F AOLPZAHRYHXPLR-UHFFFAOYSA-I 0.000 description 1
- 238000007747 plating Methods 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 230000001376 precipitating effect Effects 0.000 description 1
- 230000002028 premature Effects 0.000 description 1
- 238000012545 processing Methods 0.000 description 1
- 108090000623 proteins and genes Proteins 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 230000004044 response Effects 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 229910052709 silver Inorganic materials 0.000 description 1
- 239000004332 silver Substances 0.000 description 1
- 238000005245 sintering Methods 0.000 description 1
- 235000013024 sodium fluoride Nutrition 0.000 description 1
- 239000011775 sodium fluoride Substances 0.000 description 1
- 235000010344 sodium nitrate Nutrition 0.000 description 1
- 239000004317 sodium nitrate Substances 0.000 description 1
- 238000010025 steaming Methods 0.000 description 1
- 238000003860 storage Methods 0.000 description 1
- RCKBMGHMPOIFND-UHFFFAOYSA-N sulfanylidene(sulfanylidenegallanylsulfanyl)gallane Chemical compound S=[Ga]S[Ga]=S RCKBMGHMPOIFND-UHFFFAOYSA-N 0.000 description 1
- YRGLXIVYESZPLQ-UHFFFAOYSA-I tantalum pentafluoride Chemical compound F[Ta](F)(F)(F)F YRGLXIVYESZPLQ-UHFFFAOYSA-I 0.000 description 1
- 239000011135 tin Substances 0.000 description 1
- 229910052718 tin Inorganic materials 0.000 description 1
- XJDNKRIXUMDJCW-UHFFFAOYSA-J titanium tetrachloride Chemical compound Cl[Ti](Cl)(Cl)Cl XJDNKRIXUMDJCW-UHFFFAOYSA-J 0.000 description 1
- 238000012546 transfer Methods 0.000 description 1
- 238000005292 vacuum distillation Methods 0.000 description 1
- 229910052720 vanadium Inorganic materials 0.000 description 1
- LEONUFNNVUYDNQ-UHFFFAOYSA-N vanadium atom Chemical compound [V] LEONUFNNVUYDNQ-UHFFFAOYSA-N 0.000 description 1
- JTJFQBNJBPPZRI-UHFFFAOYSA-J vanadium tetrachloride Chemical compound Cl[V](Cl)(Cl)Cl JTJFQBNJBPPZRI-UHFFFAOYSA-J 0.000 description 1
- 238000005019 vapor deposition process Methods 0.000 description 1
- 239000003039 volatile agent Substances 0.000 description 1
Classifications
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B24—GRINDING; POLISHING
- B24D—TOOLS FOR GRINDING, BUFFING OR SHARPENING
- B24D7/00—Bonded abrasive wheels, or wheels with inserted abrasive blocks, designed for acting otherwise than only by their periphery, e.g. by the front face; Bushings or mountings therefor
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09K—MATERIALS FOR MISCELLANEOUS APPLICATIONS, NOT PROVIDED FOR ELSEWHERE
- C09K3/00—Materials not provided for elsewhere
- C09K3/14—Anti-slip materials; Abrasives
- C09K3/1436—Composite particles, e.g. coated particles
- C09K3/1445—Composite particles, e.g. coated particles the coating consisting exclusively of metals
Landscapes
- Chemical & Material Sciences (AREA)
- Engineering & Computer Science (AREA)
- Mechanical Engineering (AREA)
- Composite Materials (AREA)
- Materials Engineering (AREA)
- Organic Chemistry (AREA)
- Polishing Bodies And Polishing Tools (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US219973A US3871840A (en) | 1972-01-24 | 1972-01-24 | Abrasive particles encapsulated with a metal envelope of allotriomorphic dentrites |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE2302574A1 DE2302574A1 (de) | 1973-08-02 |
| DE2302574B2 DE2302574B2 (de) | 1979-10-31 |
| DE2302574C3 true DE2302574C3 (de) | 1980-07-10 |
Family
ID=22821507
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2302574A Expired DE2302574C3 (de) | 1972-01-24 | 1973-01-19 | Schleifmittel und Verfahren zu seiner Herstellung |
Country Status (4)
| Country | Link |
|---|---|
| US (1) | US3871840A (enExample) |
| JP (2) | JPS5337599B2 (enExample) |
| DE (1) | DE2302574C3 (enExample) |
| FR (1) | FR2169573A5 (enExample) |
Families Citing this family (61)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3929432A (en) * | 1970-05-29 | 1975-12-30 | De Beers Ind Diamond | Diamond particle having a composite coating of titanium and a metal layer |
| US4142869A (en) * | 1973-12-29 | 1979-03-06 | Vereschagin Leonid F | Compact-grained diamond material |
| US4063909A (en) * | 1974-09-18 | 1977-12-20 | Robert Dennis Mitchell | Abrasive compact brazed to a backing |
| US4164527A (en) * | 1974-11-01 | 1979-08-14 | Bakul Valentin N | Method of making superhard articles |
| ZA762258B (en) * | 1976-04-14 | 1977-11-30 | De Beers Ind Diamond | Abrasive compacts |
| US4110084A (en) * | 1977-04-15 | 1978-08-29 | General Electric Company | Composite of bonded cubic boron nitride crystals on a silicon carbide substrate |
| USRE30503E (en) * | 1979-04-16 | 1981-02-03 | General Electric Company | Composite of bonded cubic boron nitride crystals on a silicon carbide substrate |
| US4744725A (en) * | 1984-06-25 | 1988-05-17 | United Technologies Corporation | Abrasive surfaced article for high temperature service |
| US4610698A (en) * | 1984-06-25 | 1986-09-09 | United Technologies Corporation | Abrasive surface coating process for superalloys |
| DE3425678C1 (de) * | 1984-07-12 | 1985-10-24 | Bayerische Motoren Werke AG, 8000 München | Verwendung eines zerstäubten Schnellarbeitsstahles |
| US5030276A (en) * | 1986-10-20 | 1991-07-09 | Norton Company | Low pressure bonding of PCD bodies and method |
| US4943488A (en) * | 1986-10-20 | 1990-07-24 | Norton Company | Low pressure bonding of PCD bodies and method for drill bits and the like |
| US5116568A (en) * | 1986-10-20 | 1992-05-26 | Norton Company | Method for low pressure bonding of PCD bodies |
| US5062865A (en) * | 1987-12-04 | 1991-11-05 | Norton Company | Chemically bonded superabrasive grit |
| US5011514A (en) * | 1988-07-29 | 1991-04-30 | Norton Company | Cemented and cemented/sintered superabrasive polycrystalline bodies and methods of manufacture thereof |
| US5074970A (en) * | 1989-07-03 | 1991-12-24 | Kostas Routsis | Method for applying an abrasive layer to titanium alloy compressor airfoils |
| US5096465A (en) * | 1989-12-13 | 1992-03-17 | Norton Company | Diamond metal composite cutter and method for making same |
| GB2242443B (en) * | 1990-03-28 | 1994-04-06 | Nisshin Flour Milling Co | Coated particles of inorganic or metallic materials and processes of producing the same |
| US5126207A (en) * | 1990-07-20 | 1992-06-30 | Norton Company | Diamond having multiple coatings and methods for their manufacture |
| US5164220A (en) * | 1990-10-29 | 1992-11-17 | Diamond Technologies Company | Method for treating diamonds to produce bondable diamonds for depositing same on a substrate |
| AU1050695A (en) | 1994-08-12 | 1996-03-07 | U. S. Synthetic | Prosthetic joint with diamond coated interfaces |
| US6596225B1 (en) * | 2000-01-31 | 2003-07-22 | Diamicron, Inc. | Methods for manufacturing a diamond prosthetic joint component |
| RU2167262C2 (ru) * | 1995-08-03 | 2001-05-20 | Дрессер Индастриз, Инк. | Наплавка твердым сплавом с покрытыми алмазными частицами (варианты), присадочный пруток для наплавки твердым сплавом, способ наплавки твердым сплавом (варианты), коническое шарошечное долото для вращательного бурения (варианты), коническая шарошка |
| US5755299A (en) * | 1995-08-03 | 1998-05-26 | Dresser Industries, Inc. | Hardfacing with coated diamond particles |
| US5758733A (en) * | 1996-04-17 | 1998-06-02 | Baker Hughes Incorporated | Earth-boring bit with super-hard cutting elements |
| US6068071A (en) * | 1996-05-23 | 2000-05-30 | U.S. Synthetic Corporation | Cutter with polycrystalline diamond layer and conic section profile |
| US5733350A (en) * | 1996-08-13 | 1998-03-31 | Purafil, Inc. | Container for solid filtration media and filtration system utilizing same |
| US5871060A (en) * | 1997-02-20 | 1999-02-16 | Jensen; Kenneth M. | Attachment geometry for non-planar drill inserts |
| KR100769157B1 (ko) * | 1997-05-13 | 2007-10-23 | 리챠드 에드먼드 토드 | 연성을 갖도록 코팅된 경질 분말과 이것의 소결제품 |
| US20040052984A1 (en) | 1997-05-13 | 2004-03-18 | Toth Richard E. | Apparatus and method of treating fine powders |
| US5979579A (en) * | 1997-07-11 | 1999-11-09 | U.S. Synthetic Corporation | Polycrystalline diamond cutter with enhanced durability |
| US6170583B1 (en) | 1998-01-16 | 2001-01-09 | Dresser Industries, Inc. | Inserts and compacts having coated or encrusted cubic boron nitride particles |
| US6102140A (en) * | 1998-01-16 | 2000-08-15 | Dresser Industries, Inc. | Inserts and compacts having coated or encrusted diamond particles |
| US6138779A (en) * | 1998-01-16 | 2000-10-31 | Dresser Industries, Inc. | Hardfacing having coated ceramic particles or coated particles of other hard materials placed on a rotary cone cutter |
| US6241036B1 (en) | 1998-09-16 | 2001-06-05 | Baker Hughes Incorporated | Reinforced abrasive-impregnated cutting elements, drill bits including same |
| ZA200104825B (en) * | 2000-06-28 | 2001-12-13 | Gen Electric | CVD Titanium-Boron and Chromium-Boron Coating of Diamond. |
| CN100348776C (zh) | 2000-06-30 | 2007-11-14 | 圣戈本磨料股份有限公司 | 用金属涂覆超级磨料的方法 |
| US6524357B2 (en) | 2000-06-30 | 2003-02-25 | Saint-Gobain Abrasives Technology Company | Process for coating superabrasive with metal |
| US20060213128A1 (en) * | 2002-09-24 | 2006-09-28 | Chien-Min Sung | Methods of maximizing retention of superabrasive particles in a metal matrix |
| US20060059785A1 (en) * | 2002-09-24 | 2006-03-23 | Chien-Min Sung | Methods of maximizing retention of superabrasive particles in a metal matrix |
| US20050108948A1 (en) * | 2002-09-24 | 2005-05-26 | Chien-Min Sung | Molten braze-coated superabrasive particles and associated methods |
| KR101215656B1 (ko) * | 2004-06-10 | 2013-01-10 | 알로메트 코포레이션 | 고성능을 갖도록 코팅된 경질 분말을 성형하는 방법 |
| US20070032877A1 (en) * | 2005-08-05 | 2007-02-08 | Whiteside Leo A | Coated ceramic total joint arthroplasty and method of making same |
| US20080187769A1 (en) * | 2006-04-13 | 2008-08-07 | 3M Innovative Properties | Metal-coated superabrasive material and methods of making the same |
| US7793940B2 (en) * | 2006-05-16 | 2010-09-14 | Skf Usa Inc. | Mechanical end face seal with ultrahard face material |
| US20080096479A1 (en) * | 2006-10-18 | 2008-04-24 | Chien-Min Sung | Low-melting point superabrasive tools and associated methods |
| US7810588B2 (en) * | 2007-02-23 | 2010-10-12 | Baker Hughes Incorporated | Multi-layer encapsulation of diamond grit for use in earth-boring bits |
| US20100193255A1 (en) * | 2008-08-21 | 2010-08-05 | Stevens John H | Earth-boring metal matrix rotary drill bit |
| WO2011017318A1 (en) * | 2009-08-04 | 2011-02-10 | Allomet Corporation | Tough coated hard particles consolidated in a tough matrix material |
| WO2011049479A1 (en) * | 2009-10-21 | 2011-04-28 | Andrey Mikhailovich Abyzov | Composite material having high thermal conductivity and process of fabricating same |
| US8672634B2 (en) | 2010-08-30 | 2014-03-18 | United Technologies Corporation | Electroformed conforming rubstrip |
| EP2495062A1 (en) * | 2011-03-04 | 2012-09-05 | NV Bekaert SA | Sawing Bead |
| US8778259B2 (en) | 2011-05-25 | 2014-07-15 | Gerhard B. Beckmann | Self-renewing cutting surface, tool and method for making same using powder metallurgy and densification techniques |
| KR20140075719A (ko) * | 2011-09-29 | 2014-06-19 | 생-고뱅 어브레이시브즈, 인코포레이티드 | 일축 열간 가압성형에 의해 형성되는 결합 연마제 |
| GB201119329D0 (en) * | 2011-11-09 | 2011-12-21 | Element Six Ltd | Method of making cutter elements,cutter element and tools comprising same |
| US10246335B2 (en) * | 2016-05-27 | 2019-04-02 | Baker Hughes, A Ge Company, Llc | Methods of modifying surfaces of diamond particles, and related diamond particles and earth-boring tools |
| CN108015906A (zh) * | 2016-10-28 | 2018-05-11 | 圣戈班磨料磨具有限公司 | 空芯钻头及其制造方法 |
| WO2022187720A1 (en) | 2021-03-05 | 2022-09-09 | Saint-Gobain Abrasives, Inc. | Abrasive articles and methods for forming same |
| WO2022187721A1 (en) | 2021-03-05 | 2022-09-09 | Saint-Gobain Abrasives, Inc. | Abrasive articles and methods for forming same |
| WO2023130082A1 (en) | 2021-12-30 | 2023-07-06 | Saint-Gobain Abrasives, Inc. | Abrasive articles and methods for forming same |
| EP4457057A4 (en) | 2021-12-30 | 2025-12-31 | Saint Gobain Abrasives Inc | ABRASIVE ARTICLES AND THEIR FORMATION PROCESSES |
Family Cites Families (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2367404A (en) * | 1943-07-09 | 1945-01-16 | Fish Schurman Corp | Abrasive composition of matter and method of forming same |
| US2382666A (en) * | 1943-12-13 | 1945-08-14 | Ignatius A Rohrig | Manufacture of diamond tools |
| US3356473A (en) * | 1964-05-28 | 1967-12-05 | Gen Electric | Metal-bonded diamond abrasive body |
| US3528788A (en) * | 1967-07-03 | 1970-09-15 | Engelhard Ind Inc | Etched metal coated diamond grains in grinding wheels |
| US3518068A (en) * | 1967-12-04 | 1970-06-30 | Gen Electric | Process for manufacturing grinding wheels containing coppercoated grains |
| US3650714A (en) * | 1969-03-04 | 1972-03-21 | Permattach Diamond Tool Corp | A method of coating diamond particles with metal |
| US3585013A (en) * | 1969-03-26 | 1971-06-15 | Du Pont | Polyimide grinding wheels containing diamonds having a barbed metal coating |
| US3650715A (en) * | 1969-04-04 | 1972-03-21 | Du Pont | Abrasive compositions |
| BE758964A (fr) * | 1969-11-14 | 1971-05-13 | Norton Co | Elements abrasifs |
| BE760012A (fr) * | 1969-12-16 | 1971-05-17 | Gen Electric | Perfectionnements aux meules abrasives du genre des meules |
| US3663191A (en) * | 1970-07-23 | 1972-05-16 | Dentsply Int Inc | Diamond tool and method of making the same |
-
1972
- 1972-01-24 US US219973A patent/US3871840A/en not_active Expired - Lifetime
- 1972-11-02 JP JP11019072A patent/JPS5337599B2/ja not_active Expired
- 1972-11-22 FR FR7241531A patent/FR2169573A5/fr not_active Expired
-
1973
- 1973-01-19 DE DE2302574A patent/DE2302574C3/de not_active Expired
-
1977
- 1977-12-12 JP JP14915477A patent/JPS54108994A/ja active Pending
Also Published As
| Publication number | Publication date |
|---|---|
| JPS5337599B2 (enExample) | 1978-10-09 |
| JPS54108994A (en) | 1979-08-27 |
| US3871840A (en) | 1975-03-18 |
| JPS4886189A (enExample) | 1973-11-14 |
| DE2302574B2 (de) | 1979-10-31 |
| DE2302574A1 (de) | 1973-08-02 |
| FR2169573A5 (enExample) | 1973-09-07 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2302574C3 (de) | Schleifmittel und Verfahren zu seiner Herstellung | |
| DE2302595C3 (de) | Schleifmittelkorper und Verfahren zu seiner Herstellung | |
| DE69115511T2 (de) | Mehrfachbeschichteter Schleifkörper zur Verbindung mit einem Träger | |
| DE69011538T2 (de) | Verfahren zur Herstellung von selbsttragenden Körpern mit kontrollierter Porosität und abgestuften Eigenschaften sowie damit hergestellte Körper. | |
| DE2657685C2 (de) | Verfahren zur Herstellung von Aluminium-, Aluminiumlegierungs- oder Magnesiumlegierungs-Verbundwerkstoffen und dessen Anwendung | |
| EP1751320B1 (de) | Verschleissteil aus einem diamanthaltigen verbundwerkstoff | |
| DE69837619T2 (de) | Elektrodenstab für funkenbeschichtung, verfahren zu dessen herstellung und verfahren zur beschichtung mit supraschleif-enthaltender schicht | |
| DE69014161T2 (de) | Werkzeug unter Verwendung von Gold als Bindemittel und Verfahren zu dessen Herstellung. | |
| DE69031381T2 (de) | Integrierter Matrixkörper, Verfahren und Infiltrationslegierung zur Herstellung davon | |
| DE3587133T2 (de) | Im fluessiger phase gebundene amorphe materialien und deren herstellung. | |
| DE68910082T2 (de) | Verfahren zur Verbindung der Oberflächen von Materialien unter Verwendung einer Metallmatrixzusammensetzung und dadurch hergestellte Produkte. | |
| DE69013697T2 (de) | Verfahren zur Herstellung selbsttragender Körper und nach dem Verfahren hergestellte Produkte. | |
| EP1678733B1 (de) | Verfahren zur herstellung eines verbundkörpers durch hochtemperaturlöten einer nichtmetallischen komponente mit einer metallischen oder nichtmetallischen komponente | |
| DE2920198A1 (de) | Beschichtungsstoff und verfahren zum aufbringen desselben zwecks herstellung von verschleissfesten und korrosionsbestaendigen beschichteten gegenstaenden | |
| DE2556679A1 (de) | Verbundwerkstoff und verfahren zu seiner herstellung | |
| DE1521369B2 (de) | Pulverfoermige, selbstfliessende flammspritzmasse | |
| DD301925A9 (de) | Verfahren zur Herstellung von Keramik-Metall-Verbundwerkstoffen | |
| DE3824849A1 (de) | Unter druck gesinterte, polykristalline mischwerkstoffe auf basis von hexagonalem bornitrid, oxiden und carbiden | |
| DE3214552C2 (de) | Verfahren zur Herstellung zäher, verschleißfester Formkörper | |
| DE2018032A1 (de) | Infiltrierte zementierte Karbide | |
| DE69130237T2 (de) | Verfahren zur Herstellung von Kompositmaterial | |
| DE2302571A1 (de) | Schleifmittel und verfahren zu seiner herstellung | |
| DE3837378A1 (de) | Keramischer verbundwerkstoff, verfahren zu seiner herstellung und verwendung | |
| DE3221884C2 (de) | Verschleißbeständiges Bauteil zur Verwendung in Brennkraftmaschinen | |
| DD301859A9 (de) | Verfahren zur Bildung von Makroverbundkoerpern durch selbsterzeugte Vakuumtechnologien und daraus hergestellte Produkte |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| C3 | Grant after two publication steps (3rd publication) | ||
| 8339 | Ceased/non-payment of the annual fee |