DE2213553A1 - Substituierte benzimidazole - Google Patents
Substituierte benzimidazoleInfo
- Publication number
- DE2213553A1 DE2213553A1 DE2213553A DE2213553A DE2213553A1 DE 2213553 A1 DE2213553 A1 DE 2213553A1 DE 2213553 A DE2213553 A DE 2213553A DE 2213553 A DE2213553 A DE 2213553A DE 2213553 A1 DE2213553 A1 DE 2213553A1
- Authority
- DE
- Germany
- Prior art keywords
- ocf
- formula
- compounds
- general formula
- ccl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 150000001556 benzimidazoles Chemical class 0.000 title claims description 6
- 150000001875 compounds Chemical class 0.000 claims description 22
- 239000004480 active ingredient Substances 0.000 claims description 21
- 239000000460 chlorine Substances 0.000 claims description 18
- 238000002360 preparation method Methods 0.000 claims description 13
- 150000001412 amines Chemical class 0.000 claims description 9
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 8
- 229910052801 chlorine Inorganic materials 0.000 claims description 8
- 239000000203 mixture Substances 0.000 claims description 8
- 125000004432 carbon atom Chemical group C* 0.000 claims description 7
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 6
- 125000000217 alkyl group Chemical group 0.000 claims description 6
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 6
- 229910052794 bromium Inorganic materials 0.000 claims description 6
- 238000000034 method Methods 0.000 claims description 6
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 claims description 5
- 239000011737 fluorine Substances 0.000 claims description 5
- 229910052731 fluorine Inorganic materials 0.000 claims description 5
- 229910052739 hydrogen Inorganic materials 0.000 claims description 5
- 239000001257 hydrogen Substances 0.000 claims description 4
- 125000004435 hydrogen atom Chemical class [H]* 0.000 claims description 4
- 239000012948 isocyanate Substances 0.000 claims description 4
- 150000002513 isocyanates Chemical class 0.000 claims description 4
- 239000000417 fungicide Substances 0.000 claims description 3
- HYZJCKYKOHLVJF-UHFFFAOYSA-N 1H-benzimidazole Chemical compound C1=CC=C2NC=NC2=C1 HYZJCKYKOHLVJF-UHFFFAOYSA-N 0.000 claims description 2
- 208000031888 Mycoses Diseases 0.000 claims description 2
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical group [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 2
- 239000002253 acid Substances 0.000 claims description 2
- 125000003342 alkenyl group Chemical group 0.000 claims description 2
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical group [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 2
- LTQXVMLZHLJHIN-UHFFFAOYSA-N benzimidazol-2-ylidenemethanone Chemical class C1=CC=CC2=NC(=C=O)N=C21 LTQXVMLZHLJHIN-UHFFFAOYSA-N 0.000 claims description 2
- 230000002538 fungal effect Effects 0.000 claims description 2
- 229910052760 oxygen Inorganic materials 0.000 claims description 2
- 239000001301 oxygen Substances 0.000 claims description 2
- 229910052717 sulfur Chemical group 0.000 claims description 2
- 239000011593 sulfur Chemical group 0.000 claims description 2
- 150000004820 halides Chemical class 0.000 claims 1
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 21
- 241000196324 Embryophyta Species 0.000 description 17
- 241000221785 Erysiphales Species 0.000 description 17
- RIOXQFHNBCKOKP-UHFFFAOYSA-N benomyl Chemical compound C1=CC=C2N(C(=O)NCCCC)C(NC(=O)OC)=NC2=C1 RIOXQFHNBCKOKP-UHFFFAOYSA-N 0.000 description 13
- -1 2-n-propoxy- Chemical class 0.000 description 12
- 240000008067 Cucumis sativus Species 0.000 description 9
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 9
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 8
- 208000015181 infectious disease Diseases 0.000 description 8
- 206010061217 Infestation Diseases 0.000 description 7
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 7
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 6
- 235000010799 Cucumis sativus var sativus Nutrition 0.000 description 6
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 6
- 239000003795 chemical substances by application Substances 0.000 description 6
- 239000007921 spray Substances 0.000 description 6
- 239000000725 suspension Substances 0.000 description 6
- 241000896238 Oidium Species 0.000 description 5
- 239000013543 active substance Substances 0.000 description 5
- 238000011534 incubation Methods 0.000 description 5
- UQSXHKLRYXJYBZ-UHFFFAOYSA-N Iron oxide Chemical compound [Fe]=O UQSXHKLRYXJYBZ-UHFFFAOYSA-N 0.000 description 4
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 4
- 238000006243 chemical reaction Methods 0.000 description 4
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 4
- 239000002689 soil Substances 0.000 description 4
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 3
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- 241000896246 Golovinomyces cichoracearum Species 0.000 description 3
- 241000220225 Malus Species 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 239000008346 aqueous phase Substances 0.000 description 3
- TWFZGCMQGLPBSX-UHFFFAOYSA-N carbendazim Chemical compound C1=CC=C2NC(NC(=O)OC)=NC2=C1 TWFZGCMQGLPBSX-UHFFFAOYSA-N 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- 230000000855 fungicidal effect Effects 0.000 description 3
- 239000003960 organic solvent Substances 0.000 description 3
- 238000005507 spraying Methods 0.000 description 3
- 239000007858 starting material Substances 0.000 description 3
- 238000011282 treatment Methods 0.000 description 3
- OPMAJTTXWQKVIG-UHFFFAOYSA-N 1-(difluoromethylsulfanyl)-4-nitrobenzene Chemical compound [O-][N+](=O)C1=CC=C(SC(F)F)C=C1 OPMAJTTXWQKVIG-UHFFFAOYSA-N 0.000 description 2
- 240000007087 Apium graveolens Species 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- 125000006414 CCl Chemical group ClC* 0.000 description 2
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- 241001597359 Septoria apiicola Species 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- 241000209140 Triticum Species 0.000 description 2
- 244000309464 bull Species 0.000 description 2
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 150000001714 carbamic acid halides Chemical class 0.000 description 2
- 239000007795 chemical reaction product Substances 0.000 description 2
- 239000011248 coating agent Substances 0.000 description 2
- 238000000576 coating method Methods 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 238000009109 curative therapy Methods 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- 229910000027 potassium carbonate Inorganic materials 0.000 description 2
- 230000009885 systemic effect Effects 0.000 description 2
- 150000003512 tertiary amines Chemical class 0.000 description 2
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 2
- BHNZEZWIUMJCGF-UHFFFAOYSA-N 1-chloro-1,1-difluoroethane Chemical compound CC(F)(F)Cl BHNZEZWIUMJCGF-UHFFFAOYSA-N 0.000 description 1
- SJICFMKLYLHIRN-UHFFFAOYSA-N 1h-benzimidazole-2-carbonyl chloride Chemical class C1=CC=C2NC(C(=O)Cl)=NC2=C1 SJICFMKLYLHIRN-UHFFFAOYSA-N 0.000 description 1
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 1
- AMADQOOKSJKRHE-UHFFFAOYSA-N 2-isocyanato-1h-benzimidazole Chemical compound C1=CC=C2NC(N=C=O)=NC2=C1 AMADQOOKSJKRHE-UHFFFAOYSA-N 0.000 description 1
- LNYQHKQXQRKPRM-UHFFFAOYSA-N 2-methylpropyl n-(1h-benzimidazol-2-yl)carbamate Chemical compound C1=CC=C2NC(NC(=O)OCC(C)C)=NC2=C1 LNYQHKQXQRKPRM-UHFFFAOYSA-N 0.000 description 1
- ODJCIHKBMUREOC-UHFFFAOYSA-N 4-(difluoromethylsulfanyl)aniline Chemical compound NC1=CC=C(SC(F)F)C=C1 ODJCIHKBMUREOC-UHFFFAOYSA-N 0.000 description 1
- AXBVSRMHOPMXBA-UHFFFAOYSA-N 4-nitrothiophenol Chemical compound [O-][N+](=O)C1=CC=C(S)C=C1 AXBVSRMHOPMXBA-UHFFFAOYSA-N 0.000 description 1
- QCVGEOXPDFCNHA-UHFFFAOYSA-N 5,5-dimethyl-2,4-dioxo-1,3-oxazolidine-3-carboxamide Chemical compound CC1(C)OC(=O)N(C(N)=O)C1=O QCVGEOXPDFCNHA-UHFFFAOYSA-N 0.000 description 1
- 235000015849 Apium graveolens Dulce Group Nutrition 0.000 description 1
- 235000010591 Appio Nutrition 0.000 description 1
- 241000123650 Botrytis cinerea Species 0.000 description 1
- 241000530549 Cercospora beticola Species 0.000 description 1
- 102000002322 Egg Proteins Human genes 0.000 description 1
- 108010000912 Egg Proteins Proteins 0.000 description 1
- 241000510928 Erysiphe necator Species 0.000 description 1
- 241000233866 Fungi Species 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- 241000184297 Pseudocercospora musae Species 0.000 description 1
- 241000813090 Rhizoctonia solani Species 0.000 description 1
- 241001617088 Thanatephorus sasakii Species 0.000 description 1
- 235000021307 Triticum Nutrition 0.000 description 1
- 241000221577 Uromyces appendiculatus Species 0.000 description 1
- 241000228452 Venturia inaequalis Species 0.000 description 1
- 230000000895 acaricidal effect Effects 0.000 description 1
- 239000000642 acaricide Substances 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 125000004414 alkyl thio group Chemical group 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- 230000003115 biocidal effect Effects 0.000 description 1
- 125000001246 bromo group Chemical group Br* 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 239000013065 commercial product Substances 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- 239000002361 compost Substances 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 201000010099 disease Diseases 0.000 description 1
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 1
- 235000014103 egg white Nutrition 0.000 description 1
- 210000000969 egg white Anatomy 0.000 description 1
- 239000004495 emulsifiable concentrate Substances 0.000 description 1
- 239000012259 ether extract Substances 0.000 description 1
- 239000000284 extract Substances 0.000 description 1
- 235000013312 flour Nutrition 0.000 description 1
- 238000009472 formulation Methods 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 239000004009 herbicide Substances 0.000 description 1
- 239000002917 insecticide Substances 0.000 description 1
- 239000010985 leather Substances 0.000 description 1
- 231100000053 low toxicity Toxicity 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- SYSQUGFVNFXIIT-UHFFFAOYSA-N n-[4-(1,3-benzoxazol-2-yl)phenyl]-4-nitrobenzenesulfonamide Chemical class C1=CC([N+](=O)[O-])=CC=C1S(=O)(=O)NC1=CC=C(C=2OC3=CC=CC=C3N=2)C=C1 SYSQUGFVNFXIIT-UHFFFAOYSA-N 0.000 description 1
- 150000002828 nitro derivatives Chemical class 0.000 description 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 239000003921 oil Substances 0.000 description 1
- 239000011368 organic material Substances 0.000 description 1
- 239000003973 paint Substances 0.000 description 1
- DGTNSSLYPYDJGL-UHFFFAOYSA-N phenyl isocyanate Chemical compound O=C=NC1=CC=CC=C1 DGTNSSLYPYDJGL-UHFFFAOYSA-N 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 238000011321 prophylaxis Methods 0.000 description 1
- 230000001681 protective effect Effects 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 239000000344 soap Substances 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 239000004753 textile Substances 0.000 description 1
- 239000002023 wood Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D235/00—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, condensed with other rings
- C07D235/02—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, condensed with other rings condensed with carbocyclic rings or ring systems
- C07D235/04—Benzimidazoles; Hydrogenated benzimidazoles
- C07D235/24—Benzimidazoles; Hydrogenated benzimidazoles with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached in position 2
- C07D235/30—Nitrogen atoms not forming part of a nitro radical
- C07D235/32—Benzimidazole-2-carbamic acids, unsubstituted or substituted; Esters thereof; Thio-analogues thereof
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C323/00—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Priority Applications (15)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2213553A DE2213553A1 (de) | 1972-03-21 | 1972-03-21 | Substituierte benzimidazole |
| ZA731572A ZA731572B (en) | 1972-03-21 | 1973-03-07 | Substituted benzimidazoles |
| US341760A US3887576A (en) | 1972-03-21 | 1973-03-15 | Substituted phenyl-carbamoyl-alkyl carbonylamino-benzimidazoles |
| NL7303708A NL7303708A (https=) | 1972-03-21 | 1973-03-16 | |
| IT21809/73A IT981480B (it) | 1972-03-21 | 1973-03-16 | Benzimidazoli sostituiti |
| AT240173A AT328222B (de) | 1972-03-21 | 1973-03-19 | Fungizide mittel |
| CH398773A CH548400A (de) | 1972-03-21 | 1973-03-19 | Verfahren zur herstellung substituierter benzimidazole. |
| DD169547A DD107277A5 (https=) | 1972-03-21 | 1973-03-19 | |
| IL41808A IL41808A (en) | 1972-03-21 | 1973-03-19 | 1-((haloalkoxy or haloalkylmercapto)phenyl carbamoyl)-2-alkoxycarbonylamino benzimidazoles and fungicidal and anthelmintic preparations containing them |
| JP48031506A JPS496122A (https=) | 1972-03-21 | 1973-03-20 | |
| GB1335673A GB1374380A (en) | 1972-03-21 | 1973-03-20 | Substituted benzimidazoles their manufacture and compositions containing them |
| CS2034A CS169836B2 (https=) | 1972-03-21 | 1973-03-20 | |
| HUHO1552A HU166103B (https=) | 1972-03-21 | 1973-03-20 | |
| BE129074A BE797114A (fr) | 1972-03-21 | 1973-03-21 | Benzimidazoles substitues utilisables en phytopharmacie et egalement dans des medicaments |
| FR7310123A FR2182885B1 (https=) | 1972-03-21 | 1973-03-21 |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2213553A DE2213553A1 (de) | 1972-03-21 | 1972-03-21 | Substituierte benzimidazole |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2213553A1 true DE2213553A1 (de) | 1973-10-04 |
Family
ID=5839551
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2213553A Pending DE2213553A1 (de) | 1972-03-21 | 1972-03-21 | Substituierte benzimidazole |
Country Status (15)
| Country | Link |
|---|---|
| US (1) | US3887576A (https=) |
| JP (1) | JPS496122A (https=) |
| AT (1) | AT328222B (https=) |
| BE (1) | BE797114A (https=) |
| CH (1) | CH548400A (https=) |
| CS (1) | CS169836B2 (https=) |
| DD (1) | DD107277A5 (https=) |
| DE (1) | DE2213553A1 (https=) |
| FR (1) | FR2182885B1 (https=) |
| GB (1) | GB1374380A (https=) |
| HU (1) | HU166103B (https=) |
| IL (1) | IL41808A (https=) |
| IT (1) | IT981480B (https=) |
| NL (1) | NL7303708A (https=) |
| ZA (1) | ZA731572B (https=) |
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS59157382U (ja) * | 1983-04-07 | 1984-10-22 | 日本コロムビア株式会社 | パラメトリツク アレ−マイクロホン |
| US4857541A (en) * | 1986-08-07 | 1989-08-15 | Canadian Patents And Development Limited/Societe Canadienne Des Brevets Et D'exploitation Limitee | Substituted benzimidazole fungicide |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3541213A (en) * | 1966-05-06 | 1970-11-17 | Du Pont | Fungicidal and mite ovicidal substituted 2-aminobenzimidazoles |
| FR1523597A (fr) * | 1966-05-06 | 1968-05-03 | Du Pont | 2-aminobenzimidazoles substitués |
| US3626070A (en) * | 1968-03-20 | 1971-12-07 | Du Pont | Substituted 2-aminobenzimidazoles as anthelmintics |
| DE2012219A1 (de) * | 1970-03-14 | 1971-09-23 | Badische Anilin & Soda Fabrik AG, 6700 Ludwigshafen | Substituierte Benzimidazole |
-
1972
- 1972-03-21 DE DE2213553A patent/DE2213553A1/de active Pending
-
1973
- 1973-03-07 ZA ZA731572A patent/ZA731572B/xx unknown
- 1973-03-15 US US341760A patent/US3887576A/en not_active Expired - Lifetime
- 1973-03-16 IT IT21809/73A patent/IT981480B/it active
- 1973-03-16 NL NL7303708A patent/NL7303708A/xx unknown
- 1973-03-19 CH CH398773A patent/CH548400A/xx not_active IP Right Cessation
- 1973-03-19 IL IL41808A patent/IL41808A/en unknown
- 1973-03-19 AT AT240173A patent/AT328222B/de not_active IP Right Cessation
- 1973-03-19 DD DD169547A patent/DD107277A5/xx unknown
- 1973-03-20 CS CS2034A patent/CS169836B2/cs unknown
- 1973-03-20 JP JP48031506A patent/JPS496122A/ja active Pending
- 1973-03-20 HU HUHO1552A patent/HU166103B/hu unknown
- 1973-03-20 GB GB1335673A patent/GB1374380A/en not_active Expired
- 1973-03-21 BE BE129074A patent/BE797114A/xx unknown
- 1973-03-21 FR FR7310123A patent/FR2182885B1/fr not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| ATA240173A (de) | 1975-05-15 |
| IL41808A (en) | 1976-01-30 |
| NL7303708A (https=) | 1973-09-25 |
| GB1374380A (en) | 1974-11-20 |
| AT328222B (de) | 1976-03-10 |
| CS169836B2 (https=) | 1976-07-29 |
| FR2182885B1 (https=) | 1976-05-14 |
| IL41808A0 (en) | 1973-05-31 |
| DD107277A5 (https=) | 1974-07-20 |
| HU166103B (https=) | 1975-01-28 |
| ZA731572B (en) | 1973-12-19 |
| CH548400A (de) | 1974-04-30 |
| US3887576A (en) | 1975-06-03 |
| BE797114A (fr) | 1973-09-21 |
| IT981480B (it) | 1974-10-10 |
| JPS496122A (https=) | 1974-01-19 |
| FR2182885A1 (https=) | 1973-12-14 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0165448B1 (de) | 1-Heteroaryl-4-aryl-pyrozolin-5-one | |
| EP0212281B1 (de) | 1-Heteroaryl-4-aryl-pyrazol-Derivate | |
| DE2513789A1 (de) | Haloacylanilide als mikrobizide wirkstoffe | |
| EP0037971B1 (de) | Trisubstituierte Cyanguanidine, Verfahren zu ihrer Herstellung sowie ihre Verwendung als Fungizide | |
| DE3433391A1 (de) | Acylierte saccharin-derivate | |
| DE1543614C3 (de) | N-(Trihalogenmethylthio)-N-trifluor-methylamino-benzamide, Verfahren zu deren Herstellung und deren Verwendung | |
| EP0237912A1 (de) | Neue Sulfonylazole | |
| EP0094539B1 (de) | Halogenpropargylformamide | |
| DD248357A5 (de) | Verfahren zur herstellung von 9,10-phenonthrendion-derivaten | |
| DE3015090A1 (de) | ]-(trihalogenmethyl-sulfenyl)-4-aryl-1,2,4-triazolidin-5-one, verfahren zu ihrer herstellung, diese enthaltende fungizide und verfahren zur bekaempfung von pilzen mit diesen verbindungen | |
| DE2213553A1 (de) | Substituierte benzimidazole | |
| DE3216416A1 (de) | Heteroarylthiovinyl-verbindungen, ein verfahren zu ihrer herstellung und ihre verwendung als schaedlingsbekaempfungsmittel | |
| DD204200A5 (de) | Fungizide mittel | |
| DE3639901A1 (de) | Saccharin-salze von substituierten aminen | |
| EP0173918A2 (de) | Substituierte Phenylsulfonylazole | |
| EP0594963A1 (de) | Substituierte Hydroxyalkylpyridine | |
| EP0003975B1 (de) | Dichlormaleinsäurediamid-Derivate, Verfahren zu ihrer Herstellung und ihre Verwendung als Fungizide | |
| DE1668085A1 (de) | O-Halogenphenyl-carbamate | |
| DE4128789A1 (de) | Substituierte pyridyltriazine, verfahren zu ihrer herstellung, ihre verwendung und neue zwischenprodukte | |
| EP0161480B1 (de) | N-Jodpropargyl-chlormethansulfonamide | |
| DD248953A5 (de) | Schaedlingsbekaempfungsmittel | |
| EP0160931A2 (de) | Azolylvinylether | |
| EP0290906A2 (de) | Azolyl-tetrahydrofuran-2-yliden-methane | |
| DE2145512A1 (de) | 1-carbamoyl-benzimidazole, verfahren zu ihrer herstellung und ihre fungizide und bakterizide verwendung | |
| DE2659117A1 (de) | Trichlormethyl-(3-pyridyl)-carbinol |