DE2120471C3 - Hochdruckentladungslampe mit Alkalihalogenid-Zusätzen und Getter - Google Patents
Hochdruckentladungslampe mit Alkalihalogenid-Zusätzen und GetterInfo
- Publication number
- DE2120471C3 DE2120471C3 DE2120471A DE2120471A DE2120471C3 DE 2120471 C3 DE2120471 C3 DE 2120471C3 DE 2120471 A DE2120471 A DE 2120471A DE 2120471 A DE2120471 A DE 2120471A DE 2120471 C3 DE2120471 C3 DE 2120471C3
- Authority
- DE
- Germany
- Prior art keywords
- getter
- lamp
- quartz
- sodium
- discharge tube
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000003513 alkali Substances 0.000 title claims description 5
- 239000000654 additive Substances 0.000 title claims description 4
- 150000004820 halides Chemical class 0.000 title 1
- 239000001257 hydrogen Substances 0.000 claims description 44
- 229910052739 hydrogen Inorganic materials 0.000 claims description 44
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 42
- 239000011734 sodium Substances 0.000 claims description 31
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 claims description 28
- 229910052708 sodium Inorganic materials 0.000 claims description 28
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 claims description 26
- 239000010453 quartz Substances 0.000 claims description 23
- 229910052783 alkali metal Inorganic materials 0.000 claims description 16
- 150000001340 alkali metals Chemical class 0.000 claims description 15
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 14
- QCWXUUIWCKQGHC-UHFFFAOYSA-N Zirconium Chemical compound [Zr] QCWXUUIWCKQGHC-UHFFFAOYSA-N 0.000 claims description 12
- FVAUCKIRQBBSSJ-UHFFFAOYSA-M sodium iodide Chemical compound [Na+].[I-] FVAUCKIRQBBSSJ-UHFFFAOYSA-M 0.000 claims description 12
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 claims description 10
- 229910052726 zirconium Inorganic materials 0.000 claims description 10
- 229910001415 sodium ion Inorganic materials 0.000 claims description 8
- 229910052753 mercury Inorganic materials 0.000 claims description 6
- 229910001507 metal halide Inorganic materials 0.000 claims description 6
- 238000009792 diffusion process Methods 0.000 claims description 5
- 239000011521 glass Substances 0.000 claims description 5
- 229910052751 metal Inorganic materials 0.000 claims description 5
- 239000002184 metal Substances 0.000 claims description 5
- 229910001508 alkali metal halide Inorganic materials 0.000 claims description 4
- 150000008045 alkali metal halides Chemical class 0.000 claims description 4
- -1 alkali metal halogen Chemical class 0.000 claims description 4
- 235000009518 sodium iodide Nutrition 0.000 claims description 4
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 claims description 3
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical compound [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 claims description 3
- 229910001093 Zr alloy Inorganic materials 0.000 claims description 3
- 238000005868 electrolysis reaction Methods 0.000 claims description 3
- 239000007789 gas Substances 0.000 claims description 3
- 229910052744 lithium Inorganic materials 0.000 claims description 3
- 229910001511 metal iodide Inorganic materials 0.000 claims description 3
- 239000010936 titanium Substances 0.000 claims description 3
- 238000010276 construction Methods 0.000 claims description 2
- 150000002739 metals Chemical class 0.000 claims description 2
- 239000000126 substance Substances 0.000 claims description 2
- 229910052719 titanium Inorganic materials 0.000 claims description 2
- 239000000463 material Substances 0.000 claims 9
- 150000005309 metal halides Chemical class 0.000 claims 4
- 229910052736 halogen Inorganic materials 0.000 claims 2
- 229910021645 metal ion Inorganic materials 0.000 claims 2
- 235000019687 Lamb Nutrition 0.000 claims 1
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 claims 1
- 241000219492 Quercus Species 0.000 claims 1
- BQCADISMDOOEFD-UHFFFAOYSA-N Silver Chemical compound [Ag] BQCADISMDOOEFD-UHFFFAOYSA-N 0.000 claims 1
- 238000010521 absorption reaction Methods 0.000 claims 1
- 238000007792 addition Methods 0.000 claims 1
- 238000010494 dissociation reaction Methods 0.000 claims 1
- 230000005593 dissociations Effects 0.000 claims 1
- 230000000694 effects Effects 0.000 claims 1
- 230000008030 elimination Effects 0.000 claims 1
- 238000003379 elimination reaction Methods 0.000 claims 1
- 230000002349 favourable effect Effects 0.000 claims 1
- 210000003608 fece Anatomy 0.000 claims 1
- 238000005247 gettering Methods 0.000 claims 1
- FOVZCYAIUZHXGB-UHFFFAOYSA-M indium(1+);iodide Chemical compound I[In] FOVZCYAIUZHXGB-UHFFFAOYSA-M 0.000 claims 1
- 239000010871 livestock manure Substances 0.000 claims 1
- 229910052756 noble gas Inorganic materials 0.000 claims 1
- 230000002085 persistent effect Effects 0.000 claims 1
- 229940072033 potash Drugs 0.000 claims 1
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Substances [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 claims 1
- 235000015320 potassium carbonate Nutrition 0.000 claims 1
- 229910052716 thallium Inorganic materials 0.000 claims 1
- BKVIYDNLLOSFOA-UHFFFAOYSA-N thallium Chemical compound [Tl] BKVIYDNLLOSFOA-UHFFFAOYSA-N 0.000 claims 1
- 238000006243 chemical reaction Methods 0.000 description 23
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 18
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 9
- MCMNRKCIXSYSNV-UHFFFAOYSA-N Zirconium dioxide Chemical group O=[Zr]=O MCMNRKCIXSYSNV-UHFFFAOYSA-N 0.000 description 7
- WMFOQBRAJBCJND-UHFFFAOYSA-M Lithium hydroxide Chemical compound [Li+].[OH-] WMFOQBRAJBCJND-UHFFFAOYSA-M 0.000 description 4
- 238000000034 method Methods 0.000 description 4
- FKNQFGJONOIPTF-UHFFFAOYSA-N Sodium cation Chemical compound [Na+] FKNQFGJONOIPTF-UHFFFAOYSA-N 0.000 description 3
- 150000002431 hydrogen Chemical class 0.000 description 3
- 238000004804 winding Methods 0.000 description 3
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 150000002500 ions Chemical class 0.000 description 2
- 108090000623 proteins and genes Proteins 0.000 description 2
- 239000006104 solid solution Substances 0.000 description 2
- WFKWXMTUELFFGS-UHFFFAOYSA-N tungsten Chemical compound [W] WFKWXMTUELFFGS-UHFFFAOYSA-N 0.000 description 2
- 238000003466 welding Methods 0.000 description 2
- QSGNKXDSTRDWKA-UHFFFAOYSA-N zirconium dihydride Chemical compound [ZrH2] QSGNKXDSTRDWKA-UHFFFAOYSA-N 0.000 description 2
- 229910000568 zirconium hydride Inorganic materials 0.000 description 2
- ZOKXTWBITQBERF-UHFFFAOYSA-N Molybdenum Chemical compound [Mo] ZOKXTWBITQBERF-UHFFFAOYSA-N 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 229910001069 Ti alloy Inorganic materials 0.000 description 1
- 239000006096 absorbing agent Substances 0.000 description 1
- 229910001516 alkali metal iodide Inorganic materials 0.000 description 1
- 229910052786 argon Inorganic materials 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 229910052792 caesium Inorganic materials 0.000 description 1
- TVFDJXOCXUVLDH-UHFFFAOYSA-N caesium atom Chemical compound [Cs] TVFDJXOCXUVLDH-UHFFFAOYSA-N 0.000 description 1
- 239000011248 coating agent Substances 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- 239000004020 conductor Substances 0.000 description 1
- 238000011109 contamination Methods 0.000 description 1
- 230000009089 cytolysis Effects 0.000 description 1
- 230000005611 electricity Effects 0.000 description 1
- 239000011888 foil Substances 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- 230000001939 inductive effect Effects 0.000 description 1
- 239000011810 insulating material Substances 0.000 description 1
- 239000010410 layer Substances 0.000 description 1
- WABPQHHGFIMREM-UHFFFAOYSA-N lead(0) Chemical compound [Pb] WABPQHHGFIMREM-UHFFFAOYSA-N 0.000 description 1
- 238000012423 maintenance Methods 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 229910052750 molybdenum Inorganic materials 0.000 description 1
- 239000011733 molybdenum Substances 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 230000005855 radiation Effects 0.000 description 1
- 229910052701 rubidium Inorganic materials 0.000 description 1
- IGLNJRXAVVLDKE-UHFFFAOYSA-N rubidium atom Chemical compound [Rb] IGLNJRXAVVLDKE-UHFFFAOYSA-N 0.000 description 1
- 125000006850 spacer group Chemical group 0.000 description 1
- 230000003595 spectral effect Effects 0.000 description 1
- 239000002344 surface layer Substances 0.000 description 1
- CMJCEVKJYRZMIA-UHFFFAOYSA-M thallium(i) iodide Chemical compound [Tl]I CMJCEVKJYRZMIA-UHFFFAOYSA-M 0.000 description 1
- ZCUFMDLYAMJYST-UHFFFAOYSA-N thorium dioxide Chemical compound O=[Th]=O ZCUFMDLYAMJYST-UHFFFAOYSA-N 0.000 description 1
- 229910003452 thorium oxide Inorganic materials 0.000 description 1
- RMUKCGUDVKEQPL-UHFFFAOYSA-K triiodoindigane Chemical compound I[In](I)I RMUKCGUDVKEQPL-UHFFFAOYSA-K 0.000 description 1
- 229910052721 tungsten Inorganic materials 0.000 description 1
- 239000010937 tungsten Substances 0.000 description 1
- 229910052845 zircon Inorganic materials 0.000 description 1
- GFQYVLUOOAAOGM-UHFFFAOYSA-N zirconium(iv) silicate Chemical compound [Zr+4].[O-][Si]([O-])([O-])[O-] GFQYVLUOOAAOGM-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01J—ELECTRIC DISCHARGE TUBES OR DISCHARGE LAMPS
- H01J61/00—Gas-discharge or vapour-discharge lamps
- H01J61/02—Details
- H01J61/24—Means for obtaining or maintaining the desired pressure within the vessel
- H01J61/26—Means for absorbing or adsorbing gas, e.g. by gettering; Means for preventing blackening of the envelope
Landscapes
- Discharge Lamp (AREA)
- Vessels And Coating Films For Discharge Lamps (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US3292770A | 1970-04-29 | 1970-04-29 |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE2120471A1 DE2120471A1 (de) | 1971-11-18 |
| DE2120471B2 DE2120471B2 (de) | 1974-09-05 |
| DE2120471C3 true DE2120471C3 (de) | 1975-04-30 |
Family
ID=21867614
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2120471A Expired DE2120471C3 (de) | 1970-04-29 | 1971-04-27 | Hochdruckentladungslampe mit Alkalihalogenid-Zusätzen und Getter |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US3626229A (enExample) |
| JP (1) | JPS5038269B1 (enExample) |
| BE (1) | BE765484A (enExample) |
| DE (1) | DE2120471C3 (enExample) |
| FR (1) | FR2089721A5 (enExample) |
| GB (1) | GB1311644A (enExample) |
| NL (1) | NL157454B (enExample) |
Families Citing this family (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL7011321A (enExample) * | 1970-07-31 | 1972-02-02 | ||
| US3805105A (en) * | 1971-06-30 | 1974-04-16 | Gte Sylvania Inc | High pressure electric discharge device with zirconium-aluminum getter |
| US4906887A (en) * | 1988-12-19 | 1990-03-06 | Gte Products Corporation | High pressure metal vapor lamp with outer protective envelope and getters therein |
| US5229681A (en) * | 1989-10-10 | 1993-07-20 | Musco Corporation | Discharge lamp with offset or tilted arc tube |
| HU207174B (en) * | 1991-01-31 | 1993-03-01 | Tungsram Reszvenytarsasag | High pressure discharge lamp with a getter appliance increasing life |
| CA2197017C (en) * | 1996-02-08 | 2004-04-27 | Richard A. Parrott | Metal halide lamp |
| US6586878B1 (en) * | 1999-12-16 | 2003-07-01 | Koninklijke Philips Electronics N.V. | Metal halide lamp with improved getter orientation |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2749462A (en) * | 1952-05-31 | 1956-06-05 | Gen Electric | High pressure mercury vapor lamp with zirconium getter |
-
1970
- 1970-04-29 US US32927A patent/US3626229A/en not_active Expired - Lifetime
-
1971
- 1971-03-31 JP JP46018836A patent/JPS5038269B1/ja active Pending
- 1971-04-07 NL NL7104712.A patent/NL157454B/xx not_active IP Right Cessation
- 1971-04-08 BE BE765484A patent/BE765484A/xx not_active IP Right Cessation
- 1971-04-15 FR FR7113383A patent/FR2089721A5/fr not_active Expired
- 1971-04-19 GB GB2531071*A patent/GB1311644A/en not_active Expired
- 1971-04-27 DE DE2120471A patent/DE2120471C3/de not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| NL7104712A (enExample) | 1971-11-02 |
| BE765484A (fr) | 1971-10-08 |
| GB1311644A (en) | 1973-03-28 |
| DE2120471B2 (de) | 1974-09-05 |
| FR2089721A5 (enExample) | 1972-01-07 |
| NL157454B (nl) | 1978-07-17 |
| US3626229A (en) | 1971-12-07 |
| JPS5038269B1 (enExample) | 1975-12-08 |
| DE2120471A1 (de) | 1971-11-18 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE69102791T2 (de) | Niederleistungsmetallhalogenidlampe. | |
| DE3329280A1 (de) | Metallhalogenid-bogenentladungslampe und verfahren zu ihrer herstellung und zu ihrem betrieb | |
| DE2161173C3 (de) | Oxydelektrode für elektrische Hochleistungs-Gasentladungslampen | |
| DE1464181B2 (de) | Elektrische hochdruck dampfentladungslampe | |
| DE2432210C3 (de) | Halogenmetalldampflampe | |
| DE3042291C2 (de) | Hochdruck-Metallhalogenid-Entladungslampe | |
| DE3428137A1 (de) | Allzweckgluehlampe | |
| DE2303066A1 (de) | Metallhalogenid-bogenentladungslampe | |
| DE2120471C3 (de) | Hochdruckentladungslampe mit Alkalihalogenid-Zusätzen und Getter | |
| DE3210809C2 (de) | Miniatur-Hochdruckentladungslampe | |
| DE2707204C2 (de) | Hochdruck-Entladungslampe mit Metallhalogenid-Zusatz | |
| DE69405181T2 (de) | Hochdruck-Entladungslampe | |
| DE60127201T2 (de) | Hochdruckentladungslampe | |
| DE2645930A1 (de) | Alkalimetall-lampe mit einem rohr aus aluminiumoxidkeramik und einer metallgetter-struktur | |
| EP1481417A1 (de) | Quecksilber-kurzbogenlampe mit lanthanoxid-haltiger kathode | |
| DE2625554C2 (de) | Wandstabilisierte Blitzröhre | |
| DE2433334A1 (de) | Wolfram-halogen-lampe | |
| DE2118828A1 (de) | Hochdruck-Natriumdampf-Entladungslampe | |
| DE2550661A1 (de) | Metallhalogenidlampe | |
| DE3733217C2 (enExample) | ||
| DE2102112A1 (de) | Hochdruck Gasentladungslampe | |
| DE2149033A1 (de) | Zinnchlorid-Molekular-Strahlungslampe | |
| DE2846816A1 (de) | Niederdruckquecksilberdampfentladungslampe | |
| DE2023770C3 (de) | Hochleistungsbogenlampe | |
| DE3123605A1 (de) | Metalldampf-hochdruckentladungslampe |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| C3 | Grant after two publication steps (3rd publication) | ||
| E77 | Valid patent as to the heymanns-index 1977 |