DE2100036C2 - Verfahren zur Herstellung von Hydroxylammoniumnitrat - Google Patents
Verfahren zur Herstellung von HydroxylammoniumnitratInfo
- Publication number
- DE2100036C2 DE2100036C2 DE2100036A DE2100036A DE2100036C2 DE 2100036 C2 DE2100036 C2 DE 2100036C2 DE 2100036 A DE2100036 A DE 2100036A DE 2100036 A DE2100036 A DE 2100036A DE 2100036 C2 DE2100036 C2 DE 2100036C2
- Authority
- DE
- Germany
- Prior art keywords
- reaction
- nitric acid
- acid
- concentration
- hydrogen
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000000034 method Methods 0.000 title claims description 7
- 238000004519 manufacturing process Methods 0.000 title claims description 4
- CRJZNQFRBUFHTE-UHFFFAOYSA-N hydroxylammonium nitrate Chemical compound O[NH3+].[O-][N+]([O-])=O CRJZNQFRBUFHTE-UHFFFAOYSA-N 0.000 title description 2
- 238000006243 chemical reaction Methods 0.000 claims description 24
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 claims description 18
- 229910017604 nitric acid Inorganic materials 0.000 claims description 18
- 239000002253 acid Substances 0.000 claims description 17
- 239000003054 catalyst Substances 0.000 claims description 17
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 claims description 16
- MWUXSHHQAYIFBG-UHFFFAOYSA-N Nitric oxide Chemical compound O=[N] MWUXSHHQAYIFBG-UHFFFAOYSA-N 0.000 claims description 12
- 239000001257 hydrogen Substances 0.000 claims description 12
- 229910052739 hydrogen Inorganic materials 0.000 claims description 12
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 11
- 229910052697 platinum Inorganic materials 0.000 claims description 7
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 4
- 229910052717 sulfur Inorganic materials 0.000 claims description 4
- 239000011593 sulfur Substances 0.000 claims description 4
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 4
- 239000000706 filtrate Substances 0.000 claims description 3
- RBLWMQWAHONKNC-UHFFFAOYSA-N hydroxyazanium Chemical compound O[NH3+] RBLWMQWAHONKNC-UHFFFAOYSA-N 0.000 claims description 3
- 239000007864 aqueous solution Substances 0.000 claims 1
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 10
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 6
- AVXURJPOCDRRFD-UHFFFAOYSA-N Hydroxylamine Chemical compound ON AVXURJPOCDRRFD-UHFFFAOYSA-N 0.000 description 5
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 4
- 239000007789 gas Substances 0.000 description 4
- 239000000203 mixture Substances 0.000 description 4
- 230000004913 activation Effects 0.000 description 3
- 230000015572 biosynthetic process Effects 0.000 description 3
- 229910000378 hydroxylammonium sulfate Inorganic materials 0.000 description 3
- 229910052757 nitrogen Inorganic materials 0.000 description 3
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 2
- 150000001242 acetic acid derivatives Chemical class 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 150000001805 chlorine compounds Chemical class 0.000 description 2
- 238000005260 corrosion Methods 0.000 description 2
- 230000007797 corrosion Effects 0.000 description 2
- VGYYSIDKAKXZEE-UHFFFAOYSA-L hydroxylammonium sulfate Chemical compound O[NH3+].O[NH3+].[O-]S([O-])(=O)=O VGYYSIDKAKXZEE-UHFFFAOYSA-L 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- 238000003786 synthesis reaction Methods 0.000 description 2
- ZNBNBTIDJSKEAM-UHFFFAOYSA-N 4-[7-hydroxy-2-[5-[5-[6-hydroxy-6-(hydroxymethyl)-3,5-dimethyloxan-2-yl]-3-methyloxolan-2-yl]-5-methyloxolan-2-yl]-2,8-dimethyl-1,10-dioxaspiro[4.5]decan-9-yl]-2-methyl-3-propanoyloxypentanoic acid Chemical compound C1C(O)C(C)C(C(C)C(OC(=O)CC)C(C)C(O)=O)OC11OC(C)(C2OC(C)(CC2)C2C(CC(O2)C2C(CC(C)C(O)(CO)O2)C)C)CC1 ZNBNBTIDJSKEAM-UHFFFAOYSA-N 0.000 description 1
- 229910002651 NO3 Inorganic materials 0.000 description 1
- NHNBFGGVMKEFGY-UHFFFAOYSA-N Nitrate Chemical compound [O-][N+]([O-])=O NHNBFGGVMKEFGY-UHFFFAOYSA-N 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- 229910000831 Steel Inorganic materials 0.000 description 1
- 230000032683 aging Effects 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 235000019270 ammonium chloride Nutrition 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 238000009903 catalytic hydrogenation reaction Methods 0.000 description 1
- 238000004140 cleaning Methods 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 239000012153 distilled water Substances 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 230000036571 hydration Effects 0.000 description 1
- 238000006703 hydration reaction Methods 0.000 description 1
- 238000005984 hydrogenation reaction Methods 0.000 description 1
- XBUFCZMOAHHGMX-UHFFFAOYSA-N hydroxylamine;phosphoric acid Chemical class ON.ON.ON.OP(O)(O)=O XBUFCZMOAHHGMX-UHFFFAOYSA-N 0.000 description 1
- 239000011261 inert gas Substances 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 230000000977 initiatory effect Effects 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 230000002045 lasting effect Effects 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 235000010755 mineral Nutrition 0.000 description 1
- 230000001590 oxidative effect Effects 0.000 description 1
- 235000021317 phosphate Nutrition 0.000 description 1
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 1
- 239000011241 protective layer Substances 0.000 description 1
- 239000012495 reaction gas Substances 0.000 description 1
- 239000012429 reaction media Substances 0.000 description 1
- 238000004064 recycling Methods 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 238000007086 side reaction Methods 0.000 description 1
- 229910052814 silicon oxide Inorganic materials 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000010959 steel Substances 0.000 description 1
- 235000013619 trace mineral Nutrition 0.000 description 1
- 239000011573 trace mineral Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C01—INORGANIC CHEMISTRY
- C01B—NON-METALLIC ELEMENTS; COMPOUNDS THEREOF; METALLOIDS OR COMPOUNDS THEREOF NOT COVERED BY SUBCLASS C01C
- C01B21/00—Nitrogen; Compounds thereof
- C01B21/082—Compounds containing nitrogen and non-metals and optionally metals
- C01B21/14—Hydroxylamine; Salts thereof
- C01B21/1409—Preparation
- C01B21/1418—Preparation by catalytic reduction of nitrogen oxides or nitrates with hydrogen
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Inorganic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Catalysts (AREA)
Priority Applications (8)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2100036A DE2100036C2 (de) | 1971-01-02 | 1971-01-02 | Verfahren zur Herstellung von Hydroxylammoniumnitrat |
| US00212663A US3856924A (en) | 1971-01-02 | 1971-12-27 | Production of hydroxylammonium nitrate |
| FR7147079A FR2121005A5 (enExample) | 1971-01-02 | 1971-12-28 | |
| NLAANVRAGE7118059,A NL173946C (nl) | 1971-01-02 | 1971-12-29 | Werkwijze voor de bereiding van een waterige oplossing van hydroxylammoniumnitraat. |
| IT55125/71A IT945741B (it) | 1971-01-02 | 1971-12-30 | Procedimento per la produzione di idrossilammonio nitrato |
| LU64539D LU64539A1 (enExample) | 1971-01-02 | 1971-12-30 | |
| GB6067371A GB1372108A (en) | 1971-01-02 | 1971-12-30 | Production of hydroxylammonium nitrate |
| BE777643A BE777643A (fr) | 1971-01-02 | 1972-01-03 | Procede de preparation de nitrate d'hydroxylammonium |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2100036A DE2100036C2 (de) | 1971-01-02 | 1971-01-02 | Verfahren zur Herstellung von Hydroxylammoniumnitrat |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE2100036A1 DE2100036A1 (de) | 1972-07-27 |
| DE2100036C2 true DE2100036C2 (de) | 1983-07-14 |
Family
ID=5795094
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2100036A Expired DE2100036C2 (de) | 1971-01-02 | 1971-01-02 | Verfahren zur Herstellung von Hydroxylammoniumnitrat |
Country Status (8)
| Country | Link |
|---|---|
| US (1) | US3856924A (enExample) |
| BE (1) | BE777643A (enExample) |
| DE (1) | DE2100036C2 (enExample) |
| FR (1) | FR2121005A5 (enExample) |
| GB (1) | GB1372108A (enExample) |
| IT (1) | IT945741B (enExample) |
| LU (1) | LU64539A1 (enExample) |
| NL (1) | NL173946C (enExample) |
Families Citing this family (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CH587188A5 (enExample) * | 1974-05-10 | 1977-04-29 | Inventa Ag | |
| DE2736906C2 (de) * | 1977-08-16 | 1979-10-31 | Basf Ag, 6700 Ludwigshafen | Verfahren zur Herstellung von Hydroxylammoniumsalzen |
| DE2743324C2 (de) * | 1977-09-27 | 1979-11-22 | Basf Ag, 6700 Ludwigshafen | Verfahren zur Herstellung von Hydroxylammoniumsalzen |
| DE2743346C3 (de) * | 1977-09-27 | 1980-04-03 | Basf Ag, 6700 Ludwigshafen | Verfahren zur Herstellung von Hydroxylammoniumsalzen |
| DE2743297C2 (de) * | 1977-09-27 | 1979-11-22 | Basf Ag, 6700 Ludwigshafen | Verfahren zur Herstellung von Hydroxylanunoniumsalzen |
| DE3713733A1 (de) * | 1987-04-24 | 1988-11-17 | Basf Ag | Verfahren zur herstellung von hydroxylammoniumsalzen |
| DE4125599A1 (de) * | 1991-08-02 | 1993-02-04 | Basf Ag | Verfahren zur herstellung von hydroxylammoniumsalzen |
| US5266290A (en) * | 1992-07-10 | 1993-11-30 | Thiokol Corporation | Process for making high purity hydroxylammonium nitrate |
| DE10062325A1 (de) * | 2000-12-14 | 2002-06-20 | Basf Ag | Verfahren zur kontinuierlichen Herstellung von Hydroxylammoniumsalzen |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL74063C (enExample) * | 1949-08-27 | |||
| US2628888A (en) * | 1950-11-08 | 1953-02-17 | Du Pont | Chemical process for the production of an acid salt of hydroxylamine |
| US2827363A (en) * | 1953-11-04 | 1958-03-18 | Spencer Chem Co | Preparation of hydroxylamine |
| DE956038C (de) * | 1954-04-01 | 1957-01-10 | Basf Ag | Verfahren zur Herstellung von Hydroxylammoniumsalzen |
| DE1567513B2 (de) * | 1965-12-28 | 1975-05-28 | Bayer Ag, 5090 Leverkusen | Verfahren zur Herstellung von Hydroxylammoniumsalzen |
-
1971
- 1971-01-02 DE DE2100036A patent/DE2100036C2/de not_active Expired
- 1971-12-27 US US00212663A patent/US3856924A/en not_active Expired - Lifetime
- 1971-12-28 FR FR7147079A patent/FR2121005A5/fr not_active Expired
- 1971-12-29 NL NLAANVRAGE7118059,A patent/NL173946C/xx not_active IP Right Cessation
- 1971-12-30 LU LU64539D patent/LU64539A1/xx unknown
- 1971-12-30 GB GB6067371A patent/GB1372108A/en not_active Expired
- 1971-12-30 IT IT55125/71A patent/IT945741B/it active
-
1972
- 1972-01-03 BE BE777643A patent/BE777643A/xx not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| US3856924A (en) | 1974-12-24 |
| BE777643A (fr) | 1972-07-03 |
| DE2100036A1 (de) | 1972-07-27 |
| IT945741B (it) | 1973-05-10 |
| NL173946B (nl) | 1983-11-01 |
| FR2121005A5 (enExample) | 1972-08-18 |
| NL7118059A (enExample) | 1972-07-04 |
| NL173946C (nl) | 1984-04-02 |
| LU64539A1 (enExample) | 1972-06-20 |
| GB1372108A (en) | 1974-10-30 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE968363C (de) | Verfahren zur Herstellung von Salzen des Hydroxylamins | |
| DE2164341C3 (de) | Verfahren zur katalytischen Hydrierung von Adiponitril zu Hexamethylendiamin | |
| DE1177118C2 (de) | Verfahren zur kontinuierlichen Herstellung von Hydroxylammoniumsalzen | |
| DE2100036C2 (de) | Verfahren zur Herstellung von Hydroxylammoniumnitrat | |
| DE1567513A1 (de) | Verfahren zur Herstellung von Hydroxylammoniumsalzen | |
| DE1667045A1 (de) | Verfahren zur Herstellung eines besonders fuer die NO-Hydrierung zu Hydroxylamin geeigneten Platinkatalysators | |
| DE2341743A1 (de) | Verfahren zur herstellung von dihydroxyphenolen | |
| EP0525603B1 (de) | Verfahren zur Herstellung von Hydroxylammoniumsalzen | |
| DE3809554A1 (de) | Verfahren zur herstellung von hydroxylammoniumsalzen | |
| DE2500866A1 (de) | Verfahren zur herstellung von platinmetallhaltigen katalysatoren | |
| DE3108075A1 (de) | Verfahren zur entfernung von distickstoffoxid aus solches enthaltenden abgasen | |
| DE2719745C3 (de) | Katalytisches Niederdruckverfahren zur Herstellung von Butindiol | |
| DE1567515A1 (de) | Verfahren zur Herstellung von Hydroxylammoniumsulfat | |
| DE550909C (de) | Verfahren zur katalytischen Gewinnung von Cyanwasserstoff | |
| DE2724189C3 (de) | Verfahren zur Herstellung von Äthylenglykol | |
| DE2545803A1 (de) | Verfahren zur behandlung von platinmetallhaltigen katalysatoren | |
| DE2736906C2 (de) | Verfahren zur Herstellung von Hydroxylammoniumsalzen | |
| DE2418712C2 (de) | Verfahren zur Herstellung von Formaldehyd durch Oxydation von Methanol in Gegenwart eines Silberkatalysators | |
| DE2165738A1 (de) | Verfahren zur Herstellung von Allylacetat | |
| DE2520734A1 (de) | Verfahren zur herstellung von hydroxylammoniumsalzen | |
| EP1343719A2 (de) | Verfahren zur kontinuierlichen herstellung von hydroxylammoniumsalzen | |
| DE1543079B1 (de) | Verfahren zur Herstellung von Essigsaeure | |
| DE2037611A1 (de) | Verfahren zur Verwertung von Abfall-Salpetersäure | |
| DE2346012C3 (de) | Verfahren zur Herstellung von Ketonen | |
| DE2059938A1 (de) | Verfahren zur Herstellung von Cyclohexanon durch katalytische Hydrierung von Phenol |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OD | Request for examination | ||
| D2 | Grant after examination | ||
| 8364 | No opposition during term of opposition |