DE19627424A1 - Verfahren zur Herstellung von 4-Hydroxyanilinen - Google Patents
Verfahren zur Herstellung von 4-HydroxyanilinenInfo
- Publication number
- DE19627424A1 DE19627424A1 DE19627424A DE19627424A DE19627424A1 DE 19627424 A1 DE19627424 A1 DE 19627424A1 DE 19627424 A DE19627424 A DE 19627424A DE 19627424 A DE19627424 A DE 19627424A DE 19627424 A1 DE19627424 A1 DE 19627424A1
- Authority
- DE
- Germany
- Prior art keywords
- formula
- compounds
- chlorine
- so3h
- cooh
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Withdrawn
Links
- 238000002360 preparation method Methods 0.000 title claims abstract description 5
- 238000000034 method Methods 0.000 title claims description 24
- PLIKAWJENQZMHA-UHFFFAOYSA-N 4-aminophenol Chemical class NC1=CC=C(O)C=C1 PLIKAWJENQZMHA-UHFFFAOYSA-N 0.000 title 1
- JCXJVPUVTGWSNB-UHFFFAOYSA-N Nitrogen dioxide Chemical compound O=[N]=O JCXJVPUVTGWSNB-UHFFFAOYSA-N 0.000 claims abstract description 13
- -1 2,3-di-substituted 4-hydroxyaniline Chemical class 0.000 claims abstract description 11
- 239000012954 diazonium Substances 0.000 claims abstract description 11
- 150000001989 diazonium salts Chemical class 0.000 claims abstract description 11
- 229910006069 SO3H Inorganic materials 0.000 claims abstract description 9
- 125000000896 monocarboxylic acid group Chemical group 0.000 claims abstract description 9
- 125000000020 sulfo group Chemical group O=S(=O)([*])O[H] 0.000 claims abstract description 9
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 5
- 125000003545 alkoxy group Chemical group 0.000 claims abstract description 4
- 150000001875 compounds Chemical class 0.000 claims description 17
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 11
- 239000000460 chlorine Substances 0.000 claims description 11
- 229910052801 chlorine Inorganic materials 0.000 claims description 11
- 239000003054 catalyst Substances 0.000 claims description 8
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 7
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 claims description 7
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 7
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 7
- 229910052794 bromium Inorganic materials 0.000 claims description 7
- 229910052731 fluorine Inorganic materials 0.000 claims description 7
- 239000011737 fluorine Substances 0.000 claims description 7
- 229910052736 halogen Inorganic materials 0.000 claims description 7
- 150000002367 halogens Chemical class 0.000 claims description 7
- 229910052739 hydrogen Inorganic materials 0.000 claims description 7
- 239000001257 hydrogen Substances 0.000 claims description 7
- 238000005984 hydrogenation reaction Methods 0.000 claims description 6
- 229910000071 diazene Inorganic materials 0.000 claims description 5
- 150000002989 phenols Chemical class 0.000 claims description 5
- RAABOESOVLLHRU-UHFFFAOYSA-N diazene Chemical compound N=N RAABOESOVLLHRU-UHFFFAOYSA-N 0.000 claims description 4
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 4
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 4
- 239000012736 aqueous medium Substances 0.000 claims 1
- 239000002609 medium Substances 0.000 claims 1
- 238000011946 reduction process Methods 0.000 claims 1
- 239000000543 intermediate Substances 0.000 abstract description 2
- 125000001475 halogen functional group Chemical group 0.000 abstract 2
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 21
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 21
- 239000000243 solution Substances 0.000 description 20
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 15
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 12
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical class Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 12
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 10
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 10
- 239000000203 mixture Substances 0.000 description 9
- 238000006243 chemical reaction Methods 0.000 description 8
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 7
- 239000002904 solvent Substances 0.000 description 7
- 239000002253 acid Substances 0.000 description 6
- 150000003464 sulfur compounds Chemical class 0.000 description 6
- 229910052751 metal Inorganic materials 0.000 description 5
- 239000002184 metal Substances 0.000 description 5
- 235000010288 sodium nitrite Nutrition 0.000 description 5
- UMPSXRYVXUPCOS-UHFFFAOYSA-N 2,3-dichlorophenol Chemical compound OC1=CC=CC(Cl)=C1Cl UMPSXRYVXUPCOS-UHFFFAOYSA-N 0.000 description 4
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 4
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 4
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 4
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 4
- 150000007513 acids Chemical class 0.000 description 4
- 238000010438 heat treatment Methods 0.000 description 4
- 229910052500 inorganic mineral Inorganic materials 0.000 description 4
- 238000002844 melting Methods 0.000 description 4
- 230000008018 melting Effects 0.000 description 4
- 239000011707 mineral Substances 0.000 description 4
- 238000001953 recrystallisation Methods 0.000 description 4
- YODZTKMDCQEPHD-UHFFFAOYSA-N thiodiglycol Chemical compound OCCSCCO YODZTKMDCQEPHD-UHFFFAOYSA-N 0.000 description 4
- CGAZPXJWRJJHMH-UHFFFAOYSA-N 2,3-dichloro-4-phenyldiazenylphenol Chemical compound ClC1=C(Cl)C(O)=CC=C1N=NC1=CC=CC=C1 CGAZPXJWRJJHMH-UHFFFAOYSA-N 0.000 description 3
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- 239000007832 Na2SO4 Substances 0.000 description 3
- 239000007868 Raney catalyst Substances 0.000 description 3
- 229910000564 Raney nickel Inorganic materials 0.000 description 3
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 3
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 3
- XEEYBQQBJWHFJM-UHFFFAOYSA-N iron Substances [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 3
- 238000004519 manufacturing process Methods 0.000 description 3
- 239000012074 organic phase Substances 0.000 description 3
- 229910052938 sodium sulfate Inorganic materials 0.000 description 3
- 235000011152 sodium sulphate Nutrition 0.000 description 3
- 239000007787 solid Substances 0.000 description 3
- 239000000725 suspension Substances 0.000 description 3
- HVBSAKJJOYLTQU-UHFFFAOYSA-N 4-aminobenzenesulfonic acid Chemical compound NC1=CC=C(S(O)(=O)=O)C=C1 HVBSAKJJOYLTQU-UHFFFAOYSA-N 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- 230000003197 catalytic effect Effects 0.000 description 2
- 229910017052 cobalt Inorganic materials 0.000 description 2
- 239000010941 cobalt Substances 0.000 description 2
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 description 2
- 239000007789 gas Substances 0.000 description 2
- 239000012442 inert solvent Substances 0.000 description 2
- 229910052759 nickel Inorganic materials 0.000 description 2
- 229910000510 noble metal Inorganic materials 0.000 description 2
- 229910052763 palladium Inorganic materials 0.000 description 2
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 2
- 239000010970 precious metal Substances 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 238000000746 purification Methods 0.000 description 2
- 239000000741 silica gel Substances 0.000 description 2
- 229910002027 silica gel Inorganic materials 0.000 description 2
- 239000011780 sodium chloride Substances 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 2
- 125000004400 (C1-C12) alkyl group Chemical group 0.000 description 1
- 125000004169 (C1-C6) alkyl group Chemical group 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- FMJLXZXGNFFIHV-UHFFFAOYSA-N 2,3-dichloro-4-[(2,3-dichlorophenyl)diazenyl]phenol Chemical compound ClC1=C(Cl)C(O)=CC=C1N=NC1=CC=CC(Cl)=C1Cl FMJLXZXGNFFIHV-UHFFFAOYSA-N 0.000 description 1
- BRPSAOUFIJSKOT-UHFFFAOYSA-N 2,3-dichloroaniline Chemical compound NC1=CC=CC(Cl)=C1Cl BRPSAOUFIJSKOT-UHFFFAOYSA-N 0.000 description 1
- OQHWFUQNSLMSBG-UHFFFAOYSA-N 4-amino-2,3-dichlorophenol Chemical compound NC1=CC=C(O)C(Cl)=C1Cl OQHWFUQNSLMSBG-UHFFFAOYSA-N 0.000 description 1
- 241001026509 Kata Species 0.000 description 1
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 1
- KJTLSVCANCCWHF-UHFFFAOYSA-N Ruthenium Chemical compound [Ru] KJTLSVCANCCWHF-UHFFFAOYSA-N 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 229910000063 azene Inorganic materials 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 239000012876 carrier material Substances 0.000 description 1
- 238000004140 cleaning Methods 0.000 description 1
- 239000003245 coal Substances 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 229910052741 iridium Inorganic materials 0.000 description 1
- GKOZUEZYRPOHIO-UHFFFAOYSA-N iridium atom Chemical compound [Ir] GKOZUEZYRPOHIO-UHFFFAOYSA-N 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- 239000007791 liquid phase Substances 0.000 description 1
- 150000002736 metal compounds Chemical class 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- KUDPGZONDFORKU-UHFFFAOYSA-N n-chloroaniline Chemical compound ClNC1=CC=CC=C1 KUDPGZONDFORKU-UHFFFAOYSA-N 0.000 description 1
- 150000002826 nitrites Chemical class 0.000 description 1
- 229910052762 osmium Inorganic materials 0.000 description 1
- SYQBFIAQOQZEGI-UHFFFAOYSA-N osmium atom Chemical compound [Os] SYQBFIAQOQZEGI-UHFFFAOYSA-N 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 239000000575 pesticide Substances 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- HKOOXMFOFWEVGF-UHFFFAOYSA-N phenylhydrazine Chemical compound NNC1=CC=CC=C1 HKOOXMFOFWEVGF-UHFFFAOYSA-N 0.000 description 1
- 229940067157 phenylhydrazine Drugs 0.000 description 1
- 229910052697 platinum Inorganic materials 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 229910052703 rhodium Inorganic materials 0.000 description 1
- 239000010948 rhodium Substances 0.000 description 1
- MHOVAHRLVXNVSD-UHFFFAOYSA-N rhodium atom Chemical compound [Rh] MHOVAHRLVXNVSD-UHFFFAOYSA-N 0.000 description 1
- 229910052707 ruthenium Inorganic materials 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- JVBXVOWTABLYPX-UHFFFAOYSA-L sodium dithionite Chemical compound [Na+].[Na+].[O-]S(=O)S([O-])=O JVBXVOWTABLYPX-UHFFFAOYSA-L 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- 229950000244 sulfanilic acid Drugs 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C213/00—Preparation of compounds containing amino and hydroxy, amino and etherified hydroxy or amino and esterified hydroxy groups bound to the same carbon skeleton
- C07C213/02—Preparation of compounds containing amino and hydroxy, amino and etherified hydroxy or amino and esterified hydroxy groups bound to the same carbon skeleton by reactions involving the formation of amino groups from compounds containing hydroxy groups or etherified or esterified hydroxy groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C245/00—Compounds containing chains of at least two nitrogen atoms with at least one nitrogen-to-nitrogen multiple bond
- C07C245/02—Azo compounds, i.e. compounds having the free valencies of —N=N— groups attached to different atoms, e.g. diazohydroxides
- C07C245/06—Azo compounds, i.e. compounds having the free valencies of —N=N— groups attached to different atoms, e.g. diazohydroxides with nitrogen atoms of azo groups bound to carbon atoms of six-membered aromatic rings
- C07C245/08—Azo compounds, i.e. compounds having the free valencies of —N=N— groups attached to different atoms, e.g. diazohydroxides with nitrogen atoms of azo groups bound to carbon atoms of six-membered aromatic rings with the two nitrogen atoms of azo groups bound to carbon atoms of six-membered aromatic rings, e.g. azobenzene
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C309/00—Sulfonic acids; Halides, esters, or anhydrides thereof
- C07C309/01—Sulfonic acids
- C07C309/28—Sulfonic acids having sulfo groups bound to carbon atoms of six-membered aromatic rings of a carbon skeleton
- C07C309/45—Sulfonic acids having sulfo groups bound to carbon atoms of six-membered aromatic rings of a carbon skeleton containing nitrogen atoms, not being part of nitro or nitroso groups, bound to the carbon skeleton
- C07C309/46—Sulfonic acids having sulfo groups bound to carbon atoms of six-membered aromatic rings of a carbon skeleton containing nitrogen atoms, not being part of nitro or nitroso groups, bound to the carbon skeleton having the sulfo groups bound to carbon atoms of non-condensed six-membered aromatic rings
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Compounds Of Alkaline-Earth Elements, Aluminum Or Rare-Earth Metals (AREA)
- Medicines Containing Plant Substances (AREA)
Priority Applications (16)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19627424A DE19627424A1 (de) | 1996-07-08 | 1996-07-08 | Verfahren zur Herstellung von 4-Hydroxyanilinen |
| EP97110358A EP0818436B1 (de) | 1996-07-08 | 1997-06-25 | Verfahren zur Herstellung von 4-Hydroxyanilinen |
| ES97110358T ES2174150T3 (es) | 1996-07-08 | 1997-06-25 | Procedimiento para la obtencion de 4-hidroxianilinas. |
| AT97110358T ATE214688T1 (de) | 1996-07-08 | 1997-06-25 | Verfahren zur herstellung von 4-hydroxyanilinen |
| DE59706652T DE59706652D1 (de) | 1996-07-08 | 1997-06-25 | Verfahren zur Herstellung von 4-Hydroxyanilinen |
| US08/883,672 US6124504A (en) | 1996-07-08 | 1997-06-27 | Process for preparing 4-hydroxyanilines |
| JP19204697A JP4127878B2 (ja) | 1996-07-08 | 1997-07-03 | 4−ヒドロキシアニリン類の製法 |
| IN1860DE1997 IN186300B (https=) | 1996-07-08 | 1997-07-03 | |
| CA002209579A CA2209579C (en) | 1996-07-08 | 1997-07-04 | Process for preparing 4-hydroxyanilines |
| IL12123797A IL121237A (en) | 1996-07-08 | 1997-07-04 | Process and intermediates for preparing 2, 3-disubstituted 4-hydroxyanilines |
| KR1019970031182A KR100487882B1 (ko) | 1996-07-08 | 1997-07-04 | 4-하이드록시아닐린의제조방법 |
| ZA9706023A ZA976023B (en) | 1996-07-08 | 1997-07-07 | Process for preparing 4-hydroxyanilines. |
| MXPA/A/1997/005092A MXPA97005092A (en) | 1996-07-08 | 1997-07-07 | Process for preparing 4-hydroxanylin |
| BRPI9703887-3A BR9703887B1 (pt) | 1996-07-08 | 1997-07-08 | 4-hidróxianilinas e processo para preparação das mesmas. |
| CNB971145601A CN1198791C (zh) | 1996-07-08 | 1997-07-08 | 制备4-羟基苯胺的方法 |
| HU9701168A HU219609B (hu) | 1996-07-08 | 1997-07-08 | Eljárás 4-hidroxi-anilin- és (4-hidroxi-fenil)-fenil-diazén-származékok előállítására, és a diazénszármazékok |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19627424A DE19627424A1 (de) | 1996-07-08 | 1996-07-08 | Verfahren zur Herstellung von 4-Hydroxyanilinen |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE19627424A1 true DE19627424A1 (de) | 1998-01-15 |
Family
ID=7799213
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19627424A Withdrawn DE19627424A1 (de) | 1996-07-08 | 1996-07-08 | Verfahren zur Herstellung von 4-Hydroxyanilinen |
| DE59706652T Expired - Lifetime DE59706652D1 (de) | 1996-07-08 | 1997-06-25 | Verfahren zur Herstellung von 4-Hydroxyanilinen |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE59706652T Expired - Lifetime DE59706652D1 (de) | 1996-07-08 | 1997-06-25 | Verfahren zur Herstellung von 4-Hydroxyanilinen |
Country Status (14)
| Country | Link |
|---|---|
| US (1) | US6124504A (https=) |
| EP (1) | EP0818436B1 (https=) |
| JP (1) | JP4127878B2 (https=) |
| KR (1) | KR100487882B1 (https=) |
| CN (1) | CN1198791C (https=) |
| AT (1) | ATE214688T1 (https=) |
| BR (1) | BR9703887B1 (https=) |
| CA (1) | CA2209579C (https=) |
| DE (2) | DE19627424A1 (https=) |
| ES (1) | ES2174150T3 (https=) |
| HU (1) | HU219609B (https=) |
| IL (1) | IL121237A (https=) |
| IN (1) | IN186300B (https=) |
| ZA (1) | ZA976023B (https=) |
Families Citing this family (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DK1313697T3 (da) | 2000-08-29 | 2006-04-10 | Nobex Corp | Immunregulatoriske forbindelser, derivater deraf samt anvendelse deraf |
| US8048924B2 (en) | 2001-08-29 | 2011-11-01 | Biocon Limited | Methods and compositions employing 4-aminophenylacetic acid compounds |
| DE10341533A1 (de) * | 2003-09-09 | 2005-03-31 | Bayer Chemicals Ag | Verfahren zur Herstellung von halogenhaltigen 4-Aminophenolen |
| DK1773767T3 (en) | 2004-07-07 | 2016-03-21 | Biocon Ltd | Synthesis of azo bound in immune regulatory relations |
| JP5581927B2 (ja) * | 2010-09-14 | 2014-09-03 | オリヱント化学工業株式会社 | 4−アミノ−m−クレゾールの製造方法 |
| AR100506A1 (es) * | 2014-05-19 | 2016-10-12 | Basf Se | Proceso de obtención del herbicida dicamba |
| CN105418441A (zh) * | 2015-12-22 | 2016-03-23 | 中国工程物理研究院化工材料研究所 | 2,3-二氯-4-羟基苯胺的制备方法 |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2362508A (en) * | 1940-12-06 | 1944-11-14 | Merck & Co Inc | Therapeutic substances |
| FR2487832A1 (fr) * | 1980-07-30 | 1982-02-05 | Rhone Poulenc Ind | Polyhydroxyphenyl-2, 2h-benzotriazoles et leurs procedes d'obtention et leurs utilisations a titre de stabilisant anti-uv |
| DE4040853A1 (de) * | 1990-12-20 | 1992-06-25 | Bayer Ag | Verfahren zur herstellung von 2,3-dichlor-4-aminophenol |
-
1996
- 1996-07-08 DE DE19627424A patent/DE19627424A1/de not_active Withdrawn
-
1997
- 1997-06-25 DE DE59706652T patent/DE59706652D1/de not_active Expired - Lifetime
- 1997-06-25 EP EP97110358A patent/EP0818436B1/de not_active Expired - Lifetime
- 1997-06-25 ES ES97110358T patent/ES2174150T3/es not_active Expired - Lifetime
- 1997-06-25 AT AT97110358T patent/ATE214688T1/de not_active IP Right Cessation
- 1997-06-27 US US08/883,672 patent/US6124504A/en not_active Expired - Lifetime
- 1997-07-03 IN IN1860DE1997 patent/IN186300B/en unknown
- 1997-07-03 JP JP19204697A patent/JP4127878B2/ja not_active Expired - Lifetime
- 1997-07-04 CA CA002209579A patent/CA2209579C/en not_active Expired - Fee Related
- 1997-07-04 IL IL12123797A patent/IL121237A/en not_active IP Right Cessation
- 1997-07-04 KR KR1019970031182A patent/KR100487882B1/ko not_active Expired - Lifetime
- 1997-07-07 ZA ZA9706023A patent/ZA976023B/xx unknown
- 1997-07-08 HU HU9701168A patent/HU219609B/hu not_active IP Right Cessation
- 1997-07-08 BR BRPI9703887-3A patent/BR9703887B1/pt not_active IP Right Cessation
- 1997-07-08 CN CNB971145601A patent/CN1198791C/zh not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| IL121237A (en) | 2002-04-21 |
| HU219609B (hu) | 2001-05-28 |
| KR980009229A (ko) | 1998-04-30 |
| DE59706652D1 (de) | 2002-04-25 |
| BR9703887A (pt) | 1998-11-03 |
| MX9705092A (es) | 1998-06-30 |
| BR9703887B1 (pt) | 2009-05-05 |
| CN1180696A (zh) | 1998-05-06 |
| ATE214688T1 (de) | 2002-04-15 |
| IN186300B (https=) | 2001-07-28 |
| US6124504A (en) | 2000-09-26 |
| EP0818436B1 (de) | 2002-03-20 |
| CN1198791C (zh) | 2005-04-27 |
| JPH1067718A (ja) | 1998-03-10 |
| ES2174150T3 (es) | 2002-11-01 |
| HUP9701168A3 (en) | 1999-03-29 |
| CA2209579A1 (en) | 1998-01-08 |
| HU9701168D0 (en) | 1997-08-28 |
| HUP9701168A2 (hu) | 1998-05-28 |
| CA2209579C (en) | 2005-06-28 |
| IL121237A0 (en) | 1998-01-04 |
| EP0818436A1 (de) | 1998-01-14 |
| JP4127878B2 (ja) | 2008-07-30 |
| KR100487882B1 (ko) | 2005-08-01 |
| ZA976023B (en) | 1998-02-02 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0784049A1 (de) | Verfahren zur Herstellung von gegebenenfalls substituierten 4-Aminodiphenylaminen | |
| AT397960B (de) | Verfahren zur herstellung des neuen r-(-)-5-(2-((2-(o-äthoxyphenoxy)-äthyl)-amino)- propyl)-2-methoxybenzolsulfonamids | |
| CH626866A5 (en) | Process for preparing aromatic or heteroaromatic ethers | |
| DE3688575T2 (de) | Gemilderte Reduktionsreaktion zur Herstellung von Arylhydroxylaminen. | |
| EP0171611A1 (de) | Substituierte Phenyloxethylsulfone und Verfahren zu ihrer Herstellung | |
| EP0294685B1 (de) | Verfahren zur Herstellung von Chinolinen | |
| DE19627424A1 (de) | Verfahren zur Herstellung von 4-Hydroxyanilinen | |
| DE3514450A1 (de) | Verfahren zur herstellung von imidaten sowie neue arylsubstituierte imidate | |
| DE2806909C2 (https=) | ||
| DE19801598C2 (de) | Katalytische Synthese von N-alkylierten Anilinen aus Olefinen und Anilinen | |
| EP0915840B1 (de) | Verfahren zur herstellung von substituierten valinamid-derivaten | |
| EP0008323B1 (de) | Verfahren zur Herstellung von Pyridinaldehyden, Derivaten davon und nach dem Verfahren hergestellte Verbindungen | |
| DE2652810C3 (de) | Verfahren zur Herstellung von aromatischen Fluorverbindungen | |
| EP0057861A2 (de) | Verfahren zur Herstellung von Nitroanilinen | |
| EP0206147A2 (de) | Verfahren zur Herstellung von 4,4'-Dinitrodibenzylen | |
| EP0470375B1 (de) | Verfahren zur Herstellung von in p-Stellung durch C1-C4-alkoxysubstituierten aromatischen Aminen | |
| DE3689764T2 (de) | Zwischenprodukte und Verfahren zu ihrer Herstellung. | |
| EP0285109B1 (de) | Verfahren zur Herstellung von 2-Amino-4-acylaminophenylethern | |
| DE2413189C2 (de) | Verfahren zur Herstellung von Benzohydrochinonen | |
| EP0161548B1 (de) | Verbessertes Verfahren zur Herstellung von Riboflavin und neue Zwischenprodukte für dieses Verfahren | |
| DE3044156C2 (de) | Verfahren zur Herstellung von aromatischen Mono- und Diisocyanaten | |
| EP0065733B1 (de) | Verfahren zur Herstellung von 3-Alkylaminophenolen | |
| DE2514553A1 (de) | Verfahren zur herstellung von propanolaminderivaten | |
| EP1514865A1 (de) | Verfahren zur Herstellung von Halogenhaltigen 4-Aminophenolen | |
| EP0054859B1 (de) | Naphthalin-Derivate, ihre Herstellung und ihre Verwendung |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8139 | Disposal/non-payment of the annual fee |