DE1945703A1 - Verfahren zur Herstellung von Arylchlorcarbonylketenen - Google Patents
Verfahren zur Herstellung von ArylchlorcarbonylketenenInfo
- Publication number
- DE1945703A1 DE1945703A1 DE19691945703 DE1945703A DE1945703A1 DE 1945703 A1 DE1945703 A1 DE 1945703A1 DE 19691945703 DE19691945703 DE 19691945703 DE 1945703 A DE1945703 A DE 1945703A DE 1945703 A1 DE1945703 A1 DE 1945703A1
- Authority
- DE
- Germany
- Prior art keywords
- reaction
- aryl
- chlorocarbonyl
- acid
- ketenes
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- -1 aryl chlorocarbonyl ketenes Chemical class 0.000 title claims description 29
- 238000000034 method Methods 0.000 title claims description 23
- 238000002360 preparation method Methods 0.000 title claims description 7
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 claims description 30
- 238000006243 chemical reaction Methods 0.000 claims description 29
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 claims description 26
- 238000010992 reflux Methods 0.000 claims description 15
- 239000002253 acid Substances 0.000 claims description 14
- 239000003795 chemical substances by application Substances 0.000 claims description 11
- 230000002140 halogenating effect Effects 0.000 claims description 10
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 7
- 239000011261 inert gas Substances 0.000 claims description 5
- 239000000460 chlorine Substances 0.000 claims description 4
- 239000012442 inert solvent Substances 0.000 claims description 4
- 125000000217 alkyl group Chemical group 0.000 claims description 3
- 125000000896 monocarboxylic acid group Chemical group 0.000 claims description 3
- 125000001424 substituent group Chemical group 0.000 claims description 3
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 2
- 125000003545 alkoxy group Chemical group 0.000 claims description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 2
- 229910052794 bromium Inorganic materials 0.000 claims description 2
- 229910052801 chlorine Inorganic materials 0.000 claims description 2
- 125000004663 dialkyl amino group Chemical group 0.000 claims description 2
- 125000002541 furyl group Chemical group 0.000 claims description 2
- 125000004076 pyridyl group Chemical group 0.000 claims description 2
- 125000001544 thienyl group Chemical group 0.000 claims description 2
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 2
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 12
- 239000000047 product Substances 0.000 description 11
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 10
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 8
- UHZYTMXLRWXGPK-UHFFFAOYSA-N phosphorus pentachloride Chemical compound ClP(Cl)(Cl)(Cl)Cl UHZYTMXLRWXGPK-UHFFFAOYSA-N 0.000 description 7
- 239000011541 reaction mixture Substances 0.000 description 7
- 239000000243 solution Substances 0.000 description 7
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 6
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 6
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 6
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 6
- 239000000203 mixture Substances 0.000 description 6
- 239000002904 solvent Substances 0.000 description 6
- 239000006227 byproduct Substances 0.000 description 5
- 238000004821 distillation Methods 0.000 description 5
- 150000002148 esters Chemical class 0.000 description 5
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 4
- LCGLNKUTAGEVQW-UHFFFAOYSA-N Dimethyl ether Chemical compound COC LCGLNKUTAGEVQW-UHFFFAOYSA-N 0.000 description 4
- 238000004519 manufacturing process Methods 0.000 description 4
- WWYDYZMNFQIYPT-UHFFFAOYSA-N ru78191 Chemical compound OC(=O)C(C(O)=O)C1=CC=CC=C1 WWYDYZMNFQIYPT-UHFFFAOYSA-N 0.000 description 4
- 238000003756 stirring Methods 0.000 description 4
- ZEHCNHDIBSTCCY-UHFFFAOYSA-N 3-oxo-2-phenylprop-2-enoyl chloride Chemical compound ClC(=O)C(=C=O)C1=CC=CC=C1 ZEHCNHDIBSTCCY-UHFFFAOYSA-N 0.000 description 3
- WVDDGKGOMKODPV-UHFFFAOYSA-N Benzyl alcohol Chemical compound OCC1=CC=CC=C1 WVDDGKGOMKODPV-UHFFFAOYSA-N 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 3
- 150000007513 acids Chemical class 0.000 description 3
- CCGKOQOJPYTBIH-UHFFFAOYSA-N ethenone Chemical compound C=C=O CCGKOQOJPYTBIH-UHFFFAOYSA-N 0.000 description 3
- 238000001704 evaporation Methods 0.000 description 3
- 239000007789 gas Substances 0.000 description 3
- 150000002561 ketenes Chemical class 0.000 description 3
- 230000035484 reaction time Effects 0.000 description 3
- 238000005979 thermal decomposition reaction Methods 0.000 description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 3
- NGHVIOIJCVXTGV-ALEPSDHESA-N 6-aminopenicillanic acid Chemical class [O-]C(=O)[C@H]1C(C)(C)S[C@@H]2[C@H]([NH3+])C(=O)N21 NGHVIOIJCVXTGV-ALEPSDHESA-N 0.000 description 2
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 2
- KWOLFJPFCHCOCG-UHFFFAOYSA-N Acetophenone Chemical compound CC(=O)C1=CC=CC=C1 KWOLFJPFCHCOCG-UHFFFAOYSA-N 0.000 description 2
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 2
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 2
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- RAHZWNYVWXNFOC-UHFFFAOYSA-N Sulphur dioxide Chemical compound O=S=O RAHZWNYVWXNFOC-UHFFFAOYSA-N 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- 125000003118 aryl group Chemical group 0.000 description 2
- 239000007979 citrate buffer Substances 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 238000005695 dehalogenation reaction Methods 0.000 description 2
- 238000006471 dimerization reaction Methods 0.000 description 2
- 230000008020 evaporation Effects 0.000 description 2
- 150000002691 malonic acids Chemical class 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- 239000012299 nitrogen atmosphere Substances 0.000 description 2
- FAIAAWCVCHQXDN-UHFFFAOYSA-N phosphorus trichloride Chemical compound ClP(Cl)Cl FAIAAWCVCHQXDN-UHFFFAOYSA-N 0.000 description 2
- 239000000376 reactant Substances 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- 239000008096 xylene Substances 0.000 description 2
- FYDUUODXZQITBF-UHFFFAOYSA-N 1-[2-(trifluoromethyl)phenyl]ethanone Chemical compound CC(=O)C1=CC=CC=C1C(F)(F)F FYDUUODXZQITBF-UHFFFAOYSA-N 0.000 description 1
- GPDNXGRQQQQPFF-UHFFFAOYSA-N 2-chloro-2-phenylpropanedioyl dichloride Chemical compound ClC(=O)C(Cl)(C(Cl)=O)C1=CC=CC=C1 GPDNXGRQQQQPFF-UHFFFAOYSA-N 0.000 description 1
- CGBAPPTZYRUHEM-UHFFFAOYSA-N 2-diazoethenone Chemical group [N-]=[N+]=C=C=O CGBAPPTZYRUHEM-UHFFFAOYSA-N 0.000 description 1
- DLTWEQZAWUHBDH-UHFFFAOYSA-N 2-phenylpropanedioyl dichloride Chemical compound ClC(=O)C(C(Cl)=O)C1=CC=CC=C1 DLTWEQZAWUHBDH-UHFFFAOYSA-N 0.000 description 1
- 125000004105 2-pyridyl group Chemical group N1=C([*])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- 125000000175 2-thienyl group Chemical group S1C([*])=C([H])C([H])=C1[H] 0.000 description 1
- 125000006275 3-bromophenyl group Chemical group [H]C1=C([H])C(Br)=C([H])C(*)=C1[H] 0.000 description 1
- 125000004179 3-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(Cl)=C1[H] 0.000 description 1
- 125000003349 3-pyridyl group Chemical group N1=C([H])C([*])=C([H])C([H])=C1[H] 0.000 description 1
- 125000000339 4-pyridyl group Chemical group N1=C([H])C([H])=C([*])C([H])=C1[H] 0.000 description 1
- JKGZEHXJVWQUTK-UHFFFAOYSA-N C(C)OC(C(CC)=C=O)=O Chemical compound C(C)OC(C(CC)=C=O)=O JKGZEHXJVWQUTK-UHFFFAOYSA-N 0.000 description 1
- OIFBSDVPJOWBCH-UHFFFAOYSA-N Diethyl carbonate Chemical compound CCOC(=O)OCC OIFBSDVPJOWBCH-UHFFFAOYSA-N 0.000 description 1
- QXNVGIXVLWOKEQ-UHFFFAOYSA-N Disodium Chemical class [Na][Na] QXNVGIXVLWOKEQ-UHFFFAOYSA-N 0.000 description 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 1
- 238000003747 Grignard reaction Methods 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- 244000269722 Thea sinensis Species 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- 229960000583 acetic acid Drugs 0.000 description 1
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical class CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 1
- 239000003570 air Substances 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 125000005910 alkyl carbonate group Chemical group 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- 239000003242 anti bacterial agent Substances 0.000 description 1
- 229940088710 antibiotic agent Drugs 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 235000019445 benzyl alcohol Nutrition 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 239000007853 buffer solution Substances 0.000 description 1
- 229910002092 carbon dioxide Inorganic materials 0.000 description 1
- 239000001569 carbon dioxide Substances 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000002026 chloroform extract Substances 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 230000003247 decreasing effect Effects 0.000 description 1
- 238000006704 dehydrohalogenation reaction Methods 0.000 description 1
- 125000004177 diethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- SBZXBUIDTXKZTM-UHFFFAOYSA-N diglyme Chemical compound COCCOCCOC SBZXBUIDTXKZTM-UHFFFAOYSA-N 0.000 description 1
- ZWJPCOALBPMBIC-UHFFFAOYSA-N diphenylketene Chemical compound C=1C=CC=CC=1C(=C=O)C1=CC=CC=C1 ZWJPCOALBPMBIC-UHFFFAOYSA-N 0.000 description 1
- POLCUAVZOMRGSN-UHFFFAOYSA-N dipropyl ether Chemical compound CCCOCCC POLCUAVZOMRGSN-UHFFFAOYSA-N 0.000 description 1
- 239000012259 ether extract Substances 0.000 description 1
- FONOSWYYBCBQGN-UHFFFAOYSA-N ethylene dione Chemical compound O=C=C=O FONOSWYYBCBQGN-UHFFFAOYSA-N 0.000 description 1
- 230000007717 exclusion Effects 0.000 description 1
- 239000012362 glacial acetic acid Substances 0.000 description 1
- 230000026030 halogenation Effects 0.000 description 1
- 238000005658 halogenation reaction Methods 0.000 description 1
- 239000001307 helium Substances 0.000 description 1
- 229910052734 helium Inorganic materials 0.000 description 1
- SWQJXJOGLNCZEY-UHFFFAOYSA-N helium atom Chemical compound [He] SWQJXJOGLNCZEY-UHFFFAOYSA-N 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- ORTFAQDWJHRMNX-UHFFFAOYSA-N hydroxidooxidocarbon(.) Chemical compound O[C]=O ORTFAQDWJHRMNX-UHFFFAOYSA-N 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- IVSZLXZYQVIEFR-UHFFFAOYSA-N m-xylene Chemical group CC1=CC=CC(C)=C1 IVSZLXZYQVIEFR-UHFFFAOYSA-N 0.000 description 1
- VXWPONVCMVLXBW-UHFFFAOYSA-M magnesium;carbanide;iodide Chemical compound [CH3-].[Mg+2].[I-] VXWPONVCMVLXBW-UHFFFAOYSA-M 0.000 description 1
- 150000002690 malonic acid derivatives Chemical class 0.000 description 1
- KKHUSADXXDNRPW-UHFFFAOYSA-N malonic anhydride Chemical class O=C1CC(=O)O1 KKHUSADXXDNRPW-UHFFFAOYSA-N 0.000 description 1
- 150000004702 methyl esters Chemical class 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 150000002825 nitriles Chemical class 0.000 description 1
- 125000003261 o-tolyl group Chemical group [H]C1=C([H])C(*)=C(C([H])=C1[H])C([H])([H])[H] 0.000 description 1
- KMLKXMDYCDGHPQ-UHFFFAOYSA-N pentachloro-lambda5-phosphane trichlorophosphane Chemical compound ClP(Cl)Cl.ClP(Cl)(Cl)(Cl)Cl KMLKXMDYCDGHPQ-UHFFFAOYSA-N 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- QDRKDTQENPPHOJ-UHFFFAOYSA-N sodium ethoxide Chemical compound [Na+].CC[O-] QDRKDTQENPPHOJ-UHFFFAOYSA-N 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- 150000003613 toluenes Chemical class 0.000 description 1
- 238000005292 vacuum distillation Methods 0.000 description 1
- 239000011701 zinc Substances 0.000 description 1
- 229910052725 zinc Inorganic materials 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D499/00—Heterocyclic compounds containing 4-thia-1-azabicyclo [3.2.0] heptane ring systems, i.e. compounds containing a ring system of the formula:, e.g. penicillins, penems; Such ring systems being further condensed, e.g. 2,3-condensed with an oxygen-, nitrogen- or sulfur-containing hetero ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C51/00—Preparation of carboxylic acids or their salts, halides or anhydrides
- C07C51/58—Preparation of carboxylic acid halides
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Engineering & Computer Science (AREA)
- Oil, Petroleum & Natural Gas (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US77009868A | 1968-10-23 | 1968-10-23 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1945703A1 true DE1945703A1 (de) | 1970-07-02 |
Family
ID=25087471
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19691945703 Pending DE1945703A1 (de) | 1968-10-23 | 1969-09-10 | Verfahren zur Herstellung von Arylchlorcarbonylketenen |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US3542809A (enExample) |
| BR (1) | BR6912255D0 (enExample) |
| DE (1) | DE1945703A1 (enExample) |
| ES (1) | ES371426A1 (enExample) |
| FR (1) | FR2021331A1 (enExample) |
| GB (1) | GB1243208A (enExample) |
Cited By (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| WO1998005638A3 (de) * | 1996-08-05 | 1998-03-19 | Bayer Ag | 2- und 2,5-substituierte phenylketoenole |
| EP1277751A1 (de) * | 1996-08-05 | 2003-01-22 | Bayer CropScience AG | 2- und 2,5-substituierte Phenylketoenole |
| US7420062B2 (en) | 2003-07-14 | 2008-09-02 | Bayer Cropscience, Ag | Hetaryl-substituted pyrazolidindione derivatives with pesticidal characteristics |
| EP2184275A1 (de) | 2006-02-21 | 2010-05-12 | Bayer CropScience AG | Cycloalkyl-phenylsubstituierte cyclische Ketoenole |
| WO2010102758A2 (de) | 2009-03-11 | 2010-09-16 | Bayer Cropscience Ag | Halogenalkylmethylenoxy-phenyl-substituierte ketoenole |
| US8119566B2 (en) | 2003-08-14 | 2012-02-21 | Bayer Cropscience Ag | 4-biphenyl-substituted pyrazolidin-3,5-dione derivatives |
| WO2013021044A1 (de) | 2011-08-11 | 2013-02-14 | Bayer Intellectual Property Gmbh | 1,2,4-triazolyl-substituierte ketoenole |
Families Citing this family (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE788928A (fr) * | 1971-10-01 | 1973-03-15 | Pfizer | Procede de preparation des alpha-carboxyarylmethyl- et alpha-carboaryloxyarylmethyl penicillines |
| CN1156470C (zh) * | 1996-05-10 | 2004-07-07 | 拜尔公司 | 新的取代的吡啶基酮烯醇 |
| DE19846517A1 (de) | 1998-10-09 | 2000-04-20 | Bayer Ag | 3-Phenyl-pyrone |
| DE10016544A1 (de) * | 2000-04-03 | 2001-10-11 | Bayer Ag | C2-phenylsubstituierte Ketoenole |
| DE10030094A1 (de) | 2000-06-19 | 2001-12-20 | Bayer Ag | Phenylsubstituierte 5,6-Dihydro-pyron-Derivate |
| DE10311300A1 (de) | 2003-03-14 | 2004-09-23 | Bayer Cropscience Ag | 2,4,6-Phenylsubstituierte cyclische Ketoenole |
| DE10326386A1 (de) | 2003-06-12 | 2004-12-30 | Bayer Cropscience Ag | N-Heterocyclyl-phenylsubstituierte cyclische Ketoenole |
| DE102004014620A1 (de) * | 2004-03-25 | 2005-10-06 | Bayer Cropscience Ag | 2,4,6-phenylsubstituierte cyclische Ketoenole |
| DE102004044827A1 (de) | 2004-09-16 | 2006-03-23 | Bayer Cropscience Ag | Jod-phenylsubstituierte cyclische Ketoenole |
| US7749224B2 (en) * | 2005-12-08 | 2010-07-06 | Ebi, Llc | Foot plate fixation |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3408348A (en) * | 1966-05-26 | 1968-10-29 | Eastman Kodak Co | Azinediones |
-
1968
- 1968-10-23 US US770098A patent/US3542809A/en not_active Expired - Lifetime
- 1968-12-16 GB GB59810/68A patent/GB1243208A/en not_active Expired
-
1969
- 1969-09-09 BR BR212255/69A patent/BR6912255D0/pt unknown
- 1969-09-10 DE DE19691945703 patent/DE1945703A1/de active Pending
- 1969-09-11 ES ES371426A patent/ES371426A1/es not_active Expired
- 1969-09-11 FR FR6930979A patent/FR2021331A1/fr not_active Withdrawn
Cited By (13)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP1277751A1 (de) * | 1996-08-05 | 2003-01-22 | Bayer CropScience AG | 2- und 2,5-substituierte Phenylketoenole |
| WO1998005638A3 (de) * | 1996-08-05 | 1998-03-19 | Bayer Ag | 2- und 2,5-substituierte phenylketoenole |
| US7420062B2 (en) | 2003-07-14 | 2008-09-02 | Bayer Cropscience, Ag | Hetaryl-substituted pyrazolidindione derivatives with pesticidal characteristics |
| US8119566B2 (en) | 2003-08-14 | 2012-02-21 | Bayer Cropscience Ag | 4-biphenyl-substituted pyrazolidin-3,5-dione derivatives |
| US8987500B2 (en) | 2003-08-14 | 2015-03-24 | Bayer Cropscience Ag | 4-biphenyl-substituted pyrazolidin-3,5-dione derivatives |
| US8586783B2 (en) | 2003-08-14 | 2013-11-19 | Bayer Cropscience Ag | 4-biphenyl-substituted pyrazolidin-3,5-dione derivatives |
| EP2184275A1 (de) | 2006-02-21 | 2010-05-12 | Bayer CropScience AG | Cycloalkyl-phenylsubstituierte cyclische Ketoenole |
| EP2186805A1 (de) | 2006-02-21 | 2010-05-19 | Bayer CropScience AG | Cycloalkyl-phenylsubstituierte cyclische Ketoenole |
| EP2186791A1 (de) | 2006-02-21 | 2010-05-19 | Bayer CropScience AG | Cycloalkyl-phenylsubstituierte cyclische Ketoenole |
| WO2010102758A2 (de) | 2009-03-11 | 2010-09-16 | Bayer Cropscience Ag | Halogenalkylmethylenoxy-phenyl-substituierte ketoenole |
| EP3153503A1 (de) | 2009-03-11 | 2017-04-12 | Bayer Intellectual Property GmbH | Zwischenprodukte für halogenalkylmethylenoxy-phenyl-substituierte ketoenole |
| WO2013021044A1 (de) | 2011-08-11 | 2013-02-14 | Bayer Intellectual Property Gmbh | 1,2,4-triazolyl-substituierte ketoenole |
| US9198432B2 (en) | 2011-08-11 | 2015-12-01 | Bayer Intellectual Property Gmbh | 1,2,4-triazolyl-substituted ketoenols |
Also Published As
| Publication number | Publication date |
|---|---|
| ES371426A1 (es) | 1971-10-16 |
| GB1243208A (en) | 1971-08-18 |
| US3542809A (en) | 1970-11-24 |
| BR6912255D0 (pt) | 1973-05-10 |
| FR2021331A1 (enExample) | 1970-07-24 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1945703A1 (de) | Verfahren zur Herstellung von Arylchlorcarbonylketenen | |
| DE2721264C2 (de) | Verfahren zur Herstellung von Di-n-propylessigsäure und deren nichttoxischen Alkali- und Erdalkalimetallsalzen | |
| DE1695753C3 (de) | Verfahren zur Herstellung von 6,6disubstituierten 2,2-Dimethyl-4-oxopiperidinen | |
| DE2259072A1 (de) | Verfahren zur herstellung von arylessigsaeuren | |
| DE2834547A1 (de) | Herstellung von (1r,cis)-caronaldehydsaeure | |
| DE2544150A1 (de) | Verfahren zur herstellung von substituierten cyclopropancarbonsaeuren und ihren estern | |
| DE2404158C3 (de) | Verfahren zur Herstellung eines 2-(4-Alkylphenyl)-propion-aldehyds | |
| DE2630981C2 (de) | 4-β,β-Dichlor- und 4-β,β-Dibromvinyl-3,3-dimethylbutyrolactone, Verfahren zu ihrer Herstellung und deren Verwendung zur Herstellung von Estern der 3-β,β-Dichlor- oder 3-β,β-Dibrom-vinyl-2,2-dimethylcyclopropancarbonsäure | |
| DE2339243A1 (de) | Verfahren zur herstellung von alpha, beta-aethylenisch ungesaettigten estern oder ungesaettigten carbonsaeuren | |
| DE2519990C3 (de) | Verfahren zur Herstellung von Humulonen | |
| DE2410782C2 (de) | Phenylendiessigsäuredialkylester und Verfahren zu deren Herstellung | |
| DE2852975C2 (de) | 5-Cyano-1-alkylpyrrol-2-essigsäure-Derivate, Verfahren zu ihrer Herstellung und ihre Verwendung | |
| EP1558557B1 (de) | Verfahren zur katalytischen oxidation von methan zu methanol über methanolester | |
| DE1951294C3 (de) | Verfahren zur Herstellung von 3-Hydroxy-2-methyl-y-pyron (Maltol) | |
| DE2658283A1 (de) | Verfahren zur herstellung von 1,1-dihalogen-4-methyl-1,3-pentadienen und ihren zwischenprodukten | |
| EP0051233B1 (de) | Verfahren zur Herstellung von 13-Oxabicyclo(10.3.0)-pentadecan | |
| DE2034682A1 (de) | Herstellung von eis 1 Propenylphos phonsaure | |
| DE60315391T2 (de) | Optisch aktive Epoxyverbindungen und Verfahren zu deren Herstellung | |
| DE2346021A1 (de) | Verfahren zur herstellung von ,5hexandion | |
| EP0514863B1 (de) | Verfahren zur Herstellung von 3,4,6-Trifluorphthalsäure und deren Anhydrid | |
| EP0421271B1 (de) | 3-substituierte 2-Hydroxy-3-formylpropionsäureester, Verfahren zu deren Herstellung sowie deren Verwendung zur Herstellung von 3-substituierten 3-Formyl-acrylsäurereestern | |
| EP0667334B1 (de) | Verfahren zur Herstellung von 4-Alkoxy-3,5,6-trifluorphthalsäuren und 3-Alkoxy-2,4,5-trifluorbenzoesäuren | |
| DE1945703C (enExample) | ||
| DE2451838A1 (de) | Cyclopropancarboxylate und verfahren zu ihrer herstellung | |
| DE3934957A1 (de) | Verfahren zur herstellung von 3-trichlormethyl-pyridin |