DE1917488C3 - - Google Patents
Info
- Publication number
- DE1917488C3 DE1917488C3 DE19691917488 DE1917488A DE1917488C3 DE 1917488 C3 DE1917488 C3 DE 1917488C3 DE 19691917488 DE19691917488 DE 19691917488 DE 1917488 A DE1917488 A DE 1917488A DE 1917488 C3 DE1917488 C3 DE 1917488C3
- Authority
- DE
- Germany
- Prior art keywords
- pressure
- line
- chamber
- high pressure
- valve
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 230000003247 decreasing effect Effects 0.000 claims description 2
- 238000006073 displacement reaction Methods 0.000 description 3
- 230000000694 effects Effects 0.000 description 2
- 230000002411 adverse Effects 0.000 description 1
- 238000002485 combustion reaction Methods 0.000 description 1
- 230000007423 decrease Effects 0.000 description 1
- 230000003111 delayed effect Effects 0.000 description 1
- 239000012530 fluid Substances 0.000 description 1
- ZZUFCTLCJUWOSV-UHFFFAOYSA-N furosemide Chemical compound C1=C(Cl)C(S(=O)(=O)N)=CC(C(O)=O)=C1NCC1=CC=CO1 ZZUFCTLCJUWOSV-UHFFFAOYSA-N 0.000 description 1
- 210000000056 organ Anatomy 0.000 description 1
- 230000001105 regulatory effect Effects 0.000 description 1
- 230000002441 reversible effect Effects 0.000 description 1
Priority Applications (6)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19691917488 DE1917488B2 (de) | 1969-04-05 | 1969-04-05 | Steuereinrichtung fuer eine hydromaschine |
| CH346970A CH503321A (de) | 1969-04-05 | 1970-03-10 | Regeleinrichtung für eine hubveränderbare Hydromaschine |
| FR7010325A FR2039080A5 (enExample) | 1969-04-05 | 1970-03-23 | |
| GB1585770A GB1306114A (enExample) | 1969-04-05 | 1970-04-03 | |
| JP45027979A JPS514281B1 (enExample) | 1969-04-05 | 1970-04-03 | |
| US25701A US3644063A (en) | 1969-04-05 | 1970-04-06 | Regulated hydraulic apparatus |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19691917488 DE1917488B2 (de) | 1969-04-05 | 1969-04-05 | Steuereinrichtung fuer eine hydromaschine |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE1917488A1 DE1917488A1 (de) | 1970-10-08 |
| DE1917488B2 DE1917488B2 (de) | 1977-06-23 |
| DE1917488C3 true DE1917488C3 (enExample) | 1978-02-02 |
Family
ID=5730384
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19691917488 Granted DE1917488B2 (de) | 1969-04-05 | 1969-04-05 | Steuereinrichtung fuer eine hydromaschine |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US3644063A (enExample) |
| JP (1) | JPS514281B1 (enExample) |
| CH (1) | CH503321A (enExample) |
| DE (1) | DE1917488B2 (enExample) |
| FR (1) | FR2039080A5 (enExample) |
| GB (1) | GB1306114A (enExample) |
Families Citing this family (15)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3732037A (en) * | 1971-05-27 | 1973-05-08 | F Carlson | Pump displacement control |
| US3813189A (en) * | 1972-05-24 | 1974-05-28 | L Tompkins | Low fluid fluid motor |
| US3856436A (en) * | 1972-12-18 | 1974-12-24 | Sperry Rand Corp | Power transmission |
| DE2318915C2 (de) * | 1973-04-14 | 1982-09-23 | Robert Bosch Gmbh, 7000 Stuttgart | Folgesteuereinrichtung für eine einseitig verstellbare hydrostatische Verdrängermaschine |
| US3865514A (en) * | 1973-07-25 | 1975-02-11 | Sperry Rand Corp | Power transmission |
| DE2349124C2 (de) * | 1973-09-29 | 1985-09-05 | Mannesmann Rexroth GmbH, 8770 Lohr | Steuervorrichtung für eine im Speicherbetrieb arbeitende hydraulische Verstellpumpe |
| DE2356795A1 (de) * | 1973-11-14 | 1975-05-15 | Bosch Gmbh Robert | Steuereinrichtung fuer eine verstellbare pumpe |
| JPS514606A (enExample) * | 1974-07-01 | 1976-01-14 | Daikin Ind Ltd | |
| US3908519A (en) * | 1974-10-16 | 1975-09-30 | Abex Corp | Control systems for a variable displacement pump |
| DE2724264C2 (de) * | 1977-05-28 | 1985-12-19 | Robert Bosch Gmbh, 7000 Stuttgart | Folgeverstelleinrichtung für eine Hydromaschine |
| DE3434588A1 (de) * | 1983-09-20 | 1985-04-11 | Linde Ag, 6200 Wiesbaden | Steuer- oder regeleinrichtung fuer ein hydrostatisches getriebe |
| US4696162A (en) * | 1984-05-09 | 1987-09-29 | Sundstrand Corporation | Multi-function valve |
| DE4214770C1 (de) * | 1992-05-04 | 1993-10-07 | Brueninghaus Hydraulik Gmbh | Regelvorrichtung zur Regelung des Verdrängungsvolumens einer hydrostatischen Maschine |
| DE102007033146B4 (de) * | 2007-07-13 | 2012-02-02 | Schwäbische Hüttenwerke Automotive GmbH & Co. KG | Verstellventil für die Verstellung des Fördervolumens einer Verdrängerpumpe |
| GB2501598B (en) * | 2011-02-17 | 2018-10-24 | Halliburton Energy Services Inc | Methods and systems of collecting and analyzing drilling fluids in conjunction with drilling operations |
Family Cites Families (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2284897A (en) * | 1940-10-26 | 1942-06-02 | Vickers Inc | Power transmission |
| US2845876A (en) * | 1954-03-01 | 1958-08-05 | Vickers Inc | Power transmission |
| US2892311A (en) * | 1958-01-08 | 1959-06-30 | Deere & Co | Hydraulic apparatus |
| US2892312A (en) * | 1958-01-27 | 1959-06-30 | Deere & Co | Demand compensated hydraulic system |
| US3067693A (en) * | 1958-12-24 | 1962-12-11 | United Aircraft Corp | Control means for variable delivery pump |
| US3017750A (en) * | 1959-07-13 | 1962-01-23 | Dowty Hydraulic Units Ltd | Hydraulic apparatus |
| GB1007223A (en) * | 1961-09-04 | 1965-10-13 | Kuze Yoshikazu | Improvements in or relating to variable delivery oil pumps |
| US3495536A (en) * | 1968-05-14 | 1970-02-17 | Rex Chainbelt Inc | Controls for fluid translating apparatus |
| US3543508A (en) * | 1968-10-16 | 1970-12-01 | Hyster Co | Hydrostatic transmission with pressure control |
-
1969
- 1969-04-05 DE DE19691917488 patent/DE1917488B2/de active Granted
-
1970
- 1970-03-10 CH CH346970A patent/CH503321A/de not_active IP Right Cessation
- 1970-03-23 FR FR7010325A patent/FR2039080A5/fr not_active Expired
- 1970-04-03 GB GB1585770A patent/GB1306114A/en not_active Expired
- 1970-04-03 JP JP45027979A patent/JPS514281B1/ja active Pending
- 1970-04-06 US US25701A patent/US3644063A/en not_active Expired - Lifetime
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1528550C3 (de) | Hydrostatisches Getriebe mit einer Pumpe und mehreren über je ein Wegventil anschließbaren Hydromotoren sowie einem Servostellgerät | |
| DE1917488C3 (enExample) | ||
| DE3643110C2 (de) | Wegventil mit Belastungsrückmeldung | |
| DE2543466A1 (de) | Fluidgesteuertes ventil | |
| DE1917488B2 (de) | Steuereinrichtung fuer eine hydromaschine | |
| DE19524900C2 (de) | Vorgesteuertes Druckbegrenzungsventil | |
| DE69102079T2 (de) | Bremsventil mit Druckbegrenzungsfunktion. | |
| DE2843576A1 (de) | Pumpensteueranordnung | |
| DE2159766A1 (de) | Druckregelung mit verstellpumpe | |
| DE3919175C2 (enExample) | ||
| DE10357471A1 (de) | Hydraulische Steueranordnung | |
| WO2003093676A1 (de) | Regeleinrichtung mit grenzwertregelventil | |
| DE2419460A1 (de) | Einrichtung zur regelung einer pumpe | |
| DE19950910B4 (de) | Hydraulisches Antriebssystem und darin verwendbares hydraulisches 4/3-Wegeventil | |
| DE3508432C2 (enExample) | ||
| DE2205508C2 (de) | Hydraulische Steuereinrichtung | |
| DE4119297A1 (de) | Hydraulische ventileinrichtung zur steuerung des leerlaufs, der druckbegrenzung und der lastdruckkompensation | |
| DE2121267A1 (de) | Verstellpumpe mit Verstellvorrichtung | |
| EP0877169B1 (de) | Hydraulische Steuereinrichtung zur lastdruckunabhängigen Steuerung eines doppeltwirkenden Motors | |
| DE2841083C2 (enExample) | ||
| DE2655965C3 (de) | Hydraulisches Fördermengenstellsystem für die Stellpumpe eines hydrostatischen Getriebes | |
| DE3239965A1 (de) | Elektrohydraulische steuereinrichtung | |
| DE3434588A1 (de) | Steuer- oder regeleinrichtung fuer ein hydrostatisches getriebe | |
| DE19601544C1 (de) | Förderstromregler | |
| DE19547687A1 (de) | Hydraulischer Antrieb, insbesondere für ein Ruder eines Schiffes |