DE1909939A1 - Gas- und/oder Dampfentladungslampe - Google Patents
Gas- und/oder DampfentladungslampeInfo
- Publication number
- DE1909939A1 DE1909939A1 DE19691909939 DE1909939A DE1909939A1 DE 1909939 A1 DE1909939 A1 DE 1909939A1 DE 19691909939 DE19691909939 DE 19691909939 DE 1909939 A DE1909939 A DE 1909939A DE 1909939 A1 DE1909939 A1 DE 1909939A1
- Authority
- DE
- Germany
- Prior art keywords
- discharge
- discharge tube
- lamp
- outer bulb
- gas
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 239000004020 conductor Substances 0.000 claims description 25
- 239000007789 gas Substances 0.000 claims description 18
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 claims description 8
- 229910052756 noble gas Inorganic materials 0.000 claims description 7
- 229910052786 argon Inorganic materials 0.000 claims description 4
- 230000005611 electricity Effects 0.000 claims description 4
- TWNQGVIAIRXVLR-UHFFFAOYSA-N oxo(oxoalumanyloxy)alumane Chemical compound O=[Al]O[Al]=O TWNQGVIAIRXVLR-UHFFFAOYSA-N 0.000 claims description 4
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 claims description 3
- 229910052708 sodium Inorganic materials 0.000 claims description 3
- 239000011734 sodium Substances 0.000 claims description 3
- 239000002131 composite material Substances 0.000 claims 1
- 239000000203 mixture Substances 0.000 claims 1
- 230000008901 benefit Effects 0.000 description 9
- 239000000463 material Substances 0.000 description 3
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- 230000004907 flux Effects 0.000 description 2
- 101100165798 Arabidopsis thaliana CYP86A1 gene Proteins 0.000 description 1
- 101100129922 Caenorhabditis elegans pig-1 gene Proteins 0.000 description 1
- 101100520057 Drosophila melanogaster Pig1 gene Proteins 0.000 description 1
- 241000508725 Elymus repens Species 0.000 description 1
- -1 a.B Inorganic materials 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 1
- 230000003466 anti-cipated effect Effects 0.000 description 1
- 238000010292 electrical insulation Methods 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 description 1
- 229910052753 mercury Inorganic materials 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 238000000034 method Methods 0.000 description 1
- 229910052758 niobium Inorganic materials 0.000 description 1
- 239000010955 niobium Substances 0.000 description 1
- GUCVJGMIXFAOAE-UHFFFAOYSA-N niobium atom Chemical compound [Nb] GUCVJGMIXFAOAE-UHFFFAOYSA-N 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- 238000005245 sintering Methods 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- WFKWXMTUELFFGS-UHFFFAOYSA-N tungsten Chemical compound [W] WFKWXMTUELFFGS-UHFFFAOYSA-N 0.000 description 1
- 229910052721 tungsten Inorganic materials 0.000 description 1
- 239000010937 tungsten Substances 0.000 description 1
- 229910052724 xenon Inorganic materials 0.000 description 1
- FHNFHKCVQCLJFQ-UHFFFAOYSA-N xenon atom Chemical compound [Xe] FHNFHKCVQCLJFQ-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01J—ELECTRIC DISCHARGE TUBES OR DISCHARGE LAMPS
- H01J61/00—Gas-discharge or vapour-discharge lamps
- H01J61/02—Details
- H01J61/54—Igniting arrangements, e.g. promoting ionisation for starting
Landscapes
- Vessels And Coating Films For Discharge Lamps (AREA)
- Discharge Lamps And Accessories Thereof (AREA)
- Gas-Filled Discharge Tubes (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| NL6803905A NL6803905A (enExample) | 1968-03-19 | 1968-03-19 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1909939A1 true DE1909939A1 (de) | 1969-10-16 |
Family
ID=19803076
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19691909939 Pending DE1909939A1 (de) | 1968-03-19 | 1969-02-27 | Gas- und/oder Dampfentladungslampe |
Country Status (13)
| Country | Link |
|---|---|
| JP (1) | JPS4825221B1 (enExample) |
| AT (1) | AT285736B (enExample) |
| AU (1) | AU5188569A (enExample) |
| BE (1) | BE729978A (enExample) |
| BR (1) | BR6907234D0 (enExample) |
| CH (1) | CH504781A (enExample) |
| DE (1) | DE1909939A1 (enExample) |
| ES (1) | ES364599A1 (enExample) |
| FR (1) | FR2004248A1 (enExample) |
| GB (1) | GB1234166A (enExample) |
| NL (1) | NL6803905A (enExample) |
| NO (1) | NO125021B (enExample) |
| SE (1) | SE339723B (enExample) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3044932A1 (de) * | 1979-11-28 | 1981-09-17 | Mitsubishi Denki K.K., Tokyo | Entladungslampe |
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL183069C (nl) * | 1979-04-26 | 1988-07-01 | Mitsubishi Electric Corp | Metaaldampontladingslamp. |
| DE202011103945U1 (de) | 2011-08-01 | 2011-11-03 | Osram Ag | Hochdruckentladungslampe mit Zündhilfe |
-
1968
- 1968-03-19 NL NL6803905A patent/NL6803905A/xx unknown
-
1969
- 1969-02-27 DE DE19691909939 patent/DE1909939A1/de active Pending
- 1969-03-11 ES ES364599A patent/ES364599A1/es not_active Expired
- 1969-03-14 AU AU51885/69A patent/AU5188569A/en not_active Expired
- 1969-03-14 GB GB1234166D patent/GB1234166A/en not_active Expired
- 1969-03-15 JP JP1952269A patent/JPS4825221B1/ja active Pending
- 1969-03-17 SE SE364469A patent/SE339723B/xx unknown
- 1969-03-17 NO NO110469A patent/NO125021B/no unknown
- 1969-03-17 BE BE729978D patent/BE729978A/xx unknown
- 1969-03-17 AT AT259969A patent/AT285736B/de not_active IP Right Cessation
- 1969-03-17 BR BR20723469A patent/BR6907234D0/pt unknown
- 1969-03-17 CH CH395969A patent/CH504781A/de not_active IP Right Cessation
- 1969-03-19 FR FR6907915A patent/FR2004248A1/fr not_active Withdrawn
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3044932A1 (de) * | 1979-11-28 | 1981-09-17 | Mitsubishi Denki K.K., Tokyo | Entladungslampe |
Also Published As
| Publication number | Publication date |
|---|---|
| GB1234166A (enExample) | 1971-06-03 |
| AT285736B (de) | 1970-11-10 |
| NO125021B (enExample) | 1972-07-03 |
| NL6803905A (enExample) | 1969-09-23 |
| ES364599A1 (es) | 1971-02-01 |
| FR2004248A1 (enExample) | 1969-11-21 |
| BE729978A (enExample) | 1969-09-17 |
| BR6907234D0 (pt) | 1973-04-10 |
| AU5188569A (en) | 1970-09-17 |
| SE339723B (enExample) | 1971-10-18 |
| CH504781A (de) | 1971-03-15 |
| JPS4825221B1 (enExample) | 1973-07-27 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE3607460C2 (de) | Elektrodenlose Niederdruckentladungslampe | |
| DE69804192T2 (de) | Hochdruckentladungslampe mit uv-verstärker | |
| DE69820992T2 (de) | Hochdruckentladungslampe | |
| DE60311670T2 (de) | Quecksilberfreie metallhalogenidlampe | |
| DE2815014C2 (de) | Hochdrucknatriumdampfentladungslampe | |
| DE2717853C2 (de) | Schaltungsanordnung zum Zünden von Dampfentladungslampen und mit einer solchen Schaltungsanordnung zu zündende Entladungslampe | |
| DE2951966C2 (de) | Hochdruck-Metalldampfentladungslampe | |
| DE2405335C3 (de) | Hochdruckentladungslampe | |
| DE2835183A1 (de) | Lampeneinheit | |
| DE10243867A1 (de) | Quecksilberfreie Bogenentladungsröhre für Entladungslampeneinheit | |
| DE60016362T2 (de) | Metallhalogenidlampe | |
| DE2641867A1 (de) | Elektrische entladungslampe | |
| DE3027536A1 (de) | Niederdruckquecksilberdampfentladungslampe | |
| DE2814411C2 (de) | Hochdruckmetalldampfentladungslampe | |
| DE69318817T2 (de) | Elektrodenlose Niederdruck-Entladungslampe | |
| DE2264005B2 (de) | Gasentladungsröhre | |
| WO2000062330A1 (de) | Entladungslampe mit sockel | |
| DE19908688A1 (de) | Metallhalogenidlampe mit keramischem Entladungsgefäß | |
| DE3027535A1 (de) | Niederdruckentladungslampe | |
| DE2733168A1 (de) | Rauscharme natriumdampflampe fuer tonfrequenz-impulsbetrieb | |
| DE68916346T2 (de) | Metallhalogenidentladungslampe mit verbesserter Farbwiedergabe. | |
| DE2461568A1 (de) | Dampfentladungslampe | |
| DE3200699A1 (de) | Entladungsgefaess fuer hochdruck-natriumdampflampen | |
| DE2746413C2 (de) | Niederdrucknatriumdampfentladungslampe | |
| DE2301465A1 (de) | Elektrische entladungslampe |