DE1593442B - - Google Patents
Info
- Publication number
- DE1593442B DE1593442B DE1593442B DE 1593442 B DE1593442 B DE 1593442B DE 1593442 B DE1593442 B DE 1593442B
- Authority
- DE
- Germany
- Prior art keywords
- tetramethyl
- acetyl
- enol
- formula
- boiling point
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 125000005594 diketone group Chemical group 0.000 claims description 6
- 238000009835 boiling Methods 0.000 description 24
- -1 enol esters Chemical class 0.000 description 24
- 150000002084 enol ethers Chemical class 0.000 description 13
- 238000000034 method Methods 0.000 description 13
- 239000000203 mixture Substances 0.000 description 13
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 12
- 125000000217 alkyl group Chemical group 0.000 description 11
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 9
- KZMGYPLQYOPHEL-UHFFFAOYSA-N Boron trifluoride etherate Chemical compound FB(F)F.CCOCC KZMGYPLQYOPHEL-UHFFFAOYSA-N 0.000 description 9
- 125000004432 carbon atom Chemical group C* 0.000 description 9
- OZXIZRZFGJZWBF-UHFFFAOYSA-N 1,3,5-trimethyl-2-(2,4,6-trimethylphenoxy)benzene Chemical compound CC1=CC(C)=CC(C)=C1OC1=C(C)C=C(C)C=C1C OZXIZRZFGJZWBF-UHFFFAOYSA-N 0.000 description 8
- 238000006243 chemical reaction Methods 0.000 description 8
- SHOJXDKTYKFBRD-UHFFFAOYSA-N mesityl oxide Natural products CC(C)=CC(C)=O SHOJXDKTYKFBRD-UHFFFAOYSA-N 0.000 description 8
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 6
- 150000002148 esters Chemical class 0.000 description 6
- LYCAIKOWRPUZTN-UHFFFAOYSA-N ethylene glycol Natural products OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 6
- PYOKUURKVVELLB-UHFFFAOYSA-N trimethyl orthoformate Chemical compound COC(OC)OC PYOKUURKVVELLB-UHFFFAOYSA-N 0.000 description 6
- BFDXJNAUFLSGBZ-UHFFFAOYSA-N 4-acetyl-3,3,5,5-tetramethylcyclohexan-1-one Chemical compound CC(=O)C1C(C)(C)CC(=O)CC1(C)C BFDXJNAUFLSGBZ-UHFFFAOYSA-N 0.000 description 5
- 239000002841 Lewis acid Substances 0.000 description 5
- 150000001875 compounds Chemical class 0.000 description 5
- WBJINCZRORDGAQ-UHFFFAOYSA-N formic acid ethyl ester Natural products CCOC=O WBJINCZRORDGAQ-UHFFFAOYSA-N 0.000 description 5
- 150000002576 ketones Chemical class 0.000 description 5
- 150000007517 lewis acids Chemical class 0.000 description 5
- 230000002378 acidificating effect Effects 0.000 description 4
- 125000003500 enol ether group Chemical group 0.000 description 4
- 150000002085 enols Chemical class 0.000 description 4
- 150000002170 ethers Chemical class 0.000 description 4
- 239000011541 reaction mixture Substances 0.000 description 4
- GKASDNZWUGIAMG-UHFFFAOYSA-N triethyl orthoformate Chemical group CCOC(OCC)OCC GKASDNZWUGIAMG-UHFFFAOYSA-N 0.000 description 4
- QCZZSANNLWPGEA-UHFFFAOYSA-N 1-(4-phenylphenyl)ethanone Chemical compound C1=CC(C(=O)C)=CC=C1C1=CC=CC=C1 QCZZSANNLWPGEA-UHFFFAOYSA-N 0.000 description 3
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 3
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 3
- 229910052799 carbon Inorganic materials 0.000 description 3
- 239000003054 catalyst Substances 0.000 description 3
- 239000007795 chemical reaction product Substances 0.000 description 3
- 239000003205 fragrance Substances 0.000 description 3
- 238000005907 ketalization reaction Methods 0.000 description 3
- 238000002844 melting Methods 0.000 description 3
- 230000008018 melting Effects 0.000 description 3
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 3
- 239000000047 product Substances 0.000 description 3
- 229910000029 sodium carbonate Inorganic materials 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- YLNYLLVKHRZLGO-UHFFFAOYSA-N 4-(1-ethoxyethenyl)-3,3,5,5-tetramethylcyclohexan-1-one Chemical compound CCOC(=C)C1C(C)(C)CC(=O)CC1(C)C YLNYLLVKHRZLGO-UHFFFAOYSA-N 0.000 description 2
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 2
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 2
- 244000223014 Syzygium aromaticum Species 0.000 description 2
- 235000016639 Syzygium aromaticum Nutrition 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- WTEOIRVLGSZEPR-UHFFFAOYSA-N boron trifluoride Chemical compound FB(F)F WTEOIRVLGSZEPR-UHFFFAOYSA-N 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- 239000007799 cork Substances 0.000 description 2
- JHIVVAPYMSGYDF-UHFFFAOYSA-N cyclohexanone Chemical compound O=C1CCCCC1 JHIVVAPYMSGYDF-UHFFFAOYSA-N 0.000 description 2
- HGCIXCUEYOPUTN-UHFFFAOYSA-N cyclohexene Chemical compound C1CCC=CC1 HGCIXCUEYOPUTN-UHFFFAOYSA-N 0.000 description 2
- 238000004821 distillation Methods 0.000 description 2
- 230000032050 esterification Effects 0.000 description 2
- 238000005886 esterification reaction Methods 0.000 description 2
- 238000006266 etherification reaction Methods 0.000 description 2
- 238000004508 fractional distillation Methods 0.000 description 2
- 230000007062 hydrolysis Effects 0.000 description 2
- 238000006460 hydrolysis reaction Methods 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 2
- 229920002554 vinyl polymer Polymers 0.000 description 2
- MDIXEIPKOGLAPR-UHFFFAOYSA-N 1-(4,4-dimethoxy-2,2,6,6-tetramethylcyclohexyl)ethanone Chemical compound COC1(OC)CC(C)(C)C(C(C)=O)C(C)(C)C1 MDIXEIPKOGLAPR-UHFFFAOYSA-N 0.000 description 1
- OVRLIQFCLQOCRB-UHFFFAOYSA-N 1-(4-ethoxy-2,2,6,6-tetramethylcyclohex-3-en-1-yl)ethanone Chemical compound CCOC1=CC(C)(C)C(C(C)=O)C(C)(C)C1 OVRLIQFCLQOCRB-UHFFFAOYSA-N 0.000 description 1
- ZGMRSDALCWKJIM-UHFFFAOYSA-N 1-(4-methoxy-2,2,6,6-tetramethylcyclohex-3-en-1-yl)ethanone Chemical compound COC1=CC(C)(C)C(C(C)=O)C(C)(C)C1 ZGMRSDALCWKJIM-UHFFFAOYSA-N 0.000 description 1
- AKQOWURCNQEVNF-UHFFFAOYSA-N 1-(7,7,9,9-tetramethyl-1,4-dioxaspiro[4.5]decan-8-yl)ethanone Chemical compound C1C(C)(C)C(C(=O)C)C(C)(C)CC21OCCO2 AKQOWURCNQEVNF-UHFFFAOYSA-N 0.000 description 1
- MEZUBVMPZHGTTQ-UHFFFAOYSA-N 1-[2,2,6,6-tetramethyl-4,4-bis(2-methylpropoxy)cyclohexyl]ethanone Chemical compound CC(C)COC1(OCC(C)C)CC(C)(C)C(C(C)=O)C(C)(C)C1 MEZUBVMPZHGTTQ-UHFFFAOYSA-N 0.000 description 1
- UCXHCWOVLRUIMX-UHFFFAOYSA-N 1-[2,2,6,6-tetramethyl-4-(3-methylbutoxy)cyclohex-3-en-1-yl]ethanone Chemical compound CC(C)CCOC1=CC(C)(C)C(C(C)=O)C(C)(C)C1 UCXHCWOVLRUIMX-UHFFFAOYSA-N 0.000 description 1
- HTKHARRVPIOLGW-UHFFFAOYSA-N 2-methylpropoxymethanediol Chemical compound CC(C)COC(O)O HTKHARRVPIOLGW-UHFFFAOYSA-N 0.000 description 1
- XVKHDCUUIANMFL-UHFFFAOYSA-N 3-methylbutoxymethanediol Chemical compound CC(C)CCOC(O)O XVKHDCUUIANMFL-UHFFFAOYSA-N 0.000 description 1
- 229910015900 BF3 Inorganic materials 0.000 description 1
- YSQXQZWCWSBCJH-UHFFFAOYSA-N COC(=C)C1C(CC(CC1(C)C)=O)(C)C Chemical compound COC(=C)C1C(CC(CC1(C)C)=O)(C)C YSQXQZWCWSBCJH-UHFFFAOYSA-N 0.000 description 1
- 229930192694 Caryophyllenol Natural products 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- 239000005977 Ethylene Substances 0.000 description 1
- 241000208152 Geranium Species 0.000 description 1
- HETCEOQFVDFGSY-UHFFFAOYSA-N Isopropenyl acetate Chemical compound CC(=C)OC(C)=O HETCEOQFVDFGSY-UHFFFAOYSA-N 0.000 description 1
- XBDQKXXYIPTUBI-UHFFFAOYSA-M Propionate Chemical compound CCC([O-])=O XBDQKXXYIPTUBI-UHFFFAOYSA-M 0.000 description 1
- 240000000513 Santalum album Species 0.000 description 1
- 235000008632 Santalum album Nutrition 0.000 description 1
- 238000005903 acid hydrolysis reaction Methods 0.000 description 1
- 125000002947 alkylene group Chemical group 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- TZIHFWKZFHZASV-UHFFFAOYSA-N anhydrous methyl formate Natural products COC=O TZIHFWKZFHZASV-UHFFFAOYSA-N 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 239000012459 cleaning agent Substances 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 239000002537 cosmetic Substances 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 125000004122 cyclic group Chemical group 0.000 description 1
- 239000003599 detergent Substances 0.000 description 1
- 235000019441 ethanol Nutrition 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000001972 isopentyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 125000000740 n-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 239000002304 perfume Substances 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- QCLYNERZQRZCKC-UHFFFAOYSA-N propoxymethanediol Chemical compound CCCOC(O)O QCLYNERZQRZCKC-UHFFFAOYSA-N 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 239000000344 soap Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1193490B (de) | Verfahren zur Herstellung von gamma,delta-ungesaettigten Aldehyden oder Ketonen | |
| DE2455761C2 (de) | Verwendung von hydrierten Methyljononen und deren Derivaten als Riechstoffe, Verfahren zu ihrer Herstellung und neue hydrierte Methyljononderivate | |
| DE1593442C (en:Method) | ||
| DE3004661A1 (de) | Verwendung alkylsubstituierter 1,3-dioxolane als riechstoffe, sowie diese enthaltende riechstoffkompositionen | |
| CH527897A (de) | Riech- oder Geschmackstoffkomposition | |
| DE1593442A1 (de) | Verfahren zur Herstellung von cyclischen Verbindungen | |
| CH621105A5 (en:Method) | ||
| EP0010213B1 (de) | Bicyclische Verbindungen, Verfahren zu deren Herstellung und deren Verwendung | |
| EP0028780B1 (de) | 2-Alkyl-1,4-dioxaspiro(4,n)alkane, deren Herstellung und Verwendung als Riechstoffe, sowie diese enthaltende Riechstoffkompositionen | |
| EP0044413B1 (de) | 3,6-Dimethyl-oct-1-in-3-ole und -oct-1-en-3-ole sowie Derivate davon und ihre Verwendung als Riechstoffe und Verfahren zur Herstellung von 3,6-Dimethyl-octan-3-ol | |
| DE2225612C2 (de) | Cyclische Methyl-fumardialdehyd-monoacetale und Verfahren zu ihrer Herstellung | |
| DE2108649C3 (de) | 2-Methyl-2-hepten-6-on-l-al und seine Acetale | |
| EP0269999B1 (de) | Neue aliphatische Alkohole und Ester, deren Herstellung und Verwendung als Riechstoffe | |
| DE2359659C3 (de) | 4-Tricyclo [5.2.1.02ยท6! decyl-8-butanal, Verfahren zu seiner Herstellung und Verwendung als Riechstoff | |
| EP0025869B1 (de) | 3-Methyl-cyclohexadecen-5-on-1, Verfahren zu seiner Herstellung und seine Verwendung als Riechstoff | |
| DE1593442B (en:Method) | ||
| EP0043507B1 (de) | 2,4-Dioxa-7,10-methano-spiro(5,5)undecane, deren Herstellung sowie diese enthaltende Riechstoffkompositionen | |
| DE2558657C2 (en:Method) | ||
| EP0021013B1 (de) | Neue 2,4-disubstituierte Pyranderivate, deren Herstellung und deren Verwendung als Riechstoffe | |
| EP0075237B1 (de) | Verfahren zur Herstellung von Derivaten des 1-Formyl-2,6,6-trimethyl-cyclohex-1-ens | |
| DE2945812A1 (de) | 1,5-dimethyl-bicyclo eckige klammer auf 3,2,1 eckige klammer zu octan-derivate, verfahren zu ihrer herstellung und ihre verwendung | |
| DE2313017C3 (de) | Cyclopentene und Verfahren zu deren Herstellung | |
| DE3629603A1 (de) | 2-tert-butyl-4-methyl-cyclohexanolderivate, deren herstellung und verwendung als riechstoffe | |
| DE2143991C3 (de) | 2,6-Dimethyl-2,6-undecadien-10on-l-al und seine Acetale | |
| DE2842715A1 (de) | 3-chlor-3-methyl-butan- bzw. 3-methyl- 2-buten-1,4-dial-bis-acetale, ein verfahren zur herstellung dieser verbindungen sowie deren verwendung |