DE1593043A1 - Verfahren zur Herstellung von biologisch abbaufaehigen fuessigen Spuelzusaetzen fuer Geschirrspuelautomaten - Google Patents
Verfahren zur Herstellung von biologisch abbaufaehigen fuessigen Spuelzusaetzen fuer GeschirrspuelautomatenInfo
- Publication number
- DE1593043A1 DE1593043A1 DE19661593043 DE1593043A DE1593043A1 DE 1593043 A1 DE1593043 A1 DE 1593043A1 DE 19661593043 DE19661593043 DE 19661593043 DE 1593043 A DE1593043 A DE 1593043A DE 1593043 A1 DE1593043 A1 DE 1593043A1
- Authority
- DE
- Germany
- Prior art keywords
- alcohol
- carbon atoms
- weight
- mixture
- percent
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 238000000034 method Methods 0.000 title claims description 10
- 239000000654 additive Substances 0.000 title description 21
- 238000004519 manufacturing process Methods 0.000 title description 6
- 239000007788 liquid Substances 0.000 title description 4
- 239000003599 detergent Substances 0.000 title description 3
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 53
- 239000000203 mixture Substances 0.000 claims description 42
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 claims description 33
- 125000004432 carbon atom Chemical group C* 0.000 claims description 31
- GOOHAUXETOMSMM-UHFFFAOYSA-N Propylene oxide Chemical compound CC1CO1 GOOHAUXETOMSMM-UHFFFAOYSA-N 0.000 claims description 29
- 125000001931 aliphatic group Chemical group 0.000 claims description 7
- 238000009833 condensation Methods 0.000 claims description 7
- 230000005494 condensation Effects 0.000 claims description 7
- -1 aliphatic alcohols Chemical class 0.000 claims description 6
- 239000007859 condensation product Substances 0.000 claims description 6
- 125000004430 oxygen atom Chemical group O* 0.000 claims description 3
- 239000000047 product Substances 0.000 description 34
- 229940117927 ethylene oxide Drugs 0.000 description 28
- 239000011521 glass Substances 0.000 description 17
- 150000001875 compounds Chemical class 0.000 description 14
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 9
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 8
- 230000000996 additive effect Effects 0.000 description 7
- 150000001298 alcohols Chemical class 0.000 description 6
- 125000002947 alkylene group Chemical group 0.000 description 6
- 125000004429 atom Chemical group 0.000 description 5
- 230000015572 biosynthetic process Effects 0.000 description 5
- 238000004851 dishwashing Methods 0.000 description 5
- 238000005406 washing Methods 0.000 description 5
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 4
- 230000002209 hydrophobic effect Effects 0.000 description 4
- 239000000843 powder Substances 0.000 description 4
- 239000004094 surface-active agent Substances 0.000 description 4
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 239000007640 basal medium Substances 0.000 description 3
- 238000001035 drying Methods 0.000 description 3
- 238000011156 evaluation Methods 0.000 description 3
- 239000006260 foam Substances 0.000 description 3
- 239000004615 ingredient Substances 0.000 description 3
- QBUKAFSEUHGMMX-MTJSOVHGSA-N (5z)-5-[[3-(1-hydroxyethyl)thiophen-2-yl]methylidene]-10-methoxy-2,2,4-trimethyl-1h-chromeno[3,4-f]quinolin-9-ol Chemical compound C1=CC=2NC(C)(C)C=C(C)C=2C2=C1C=1C(OC)=C(O)C=CC=1O\C2=C/C=1SC=CC=1C(C)O QBUKAFSEUHGMMX-MTJSOVHGSA-N 0.000 description 2
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 2
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 2
- WCUXLLCKKVVCTQ-UHFFFAOYSA-M Potassium chloride Chemical compound [Cl-].[K+] WCUXLLCKKVVCTQ-UHFFFAOYSA-M 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 2
- 239000003054 catalyst Substances 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- 238000006482 condensation reaction Methods 0.000 description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- 150000002894 organic compounds Chemical class 0.000 description 2
- 229910052700 potassium Inorganic materials 0.000 description 2
- SCVFZCLFOSHCOH-UHFFFAOYSA-M potassium acetate Chemical compound [K+].CC([O-])=O SCVFZCLFOSHCOH-UHFFFAOYSA-M 0.000 description 2
- KEZYHIPQRGTUDU-UHFFFAOYSA-N 2-[dithiocarboxy(methyl)amino]acetic acid Chemical compound SC(=S)N(C)CC(O)=O KEZYHIPQRGTUDU-UHFFFAOYSA-N 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 1
- 229960000583 acetic acid Drugs 0.000 description 1
- 206010000496 acne Diseases 0.000 description 1
- 239000013543 active substance Substances 0.000 description 1
- 235000019270 ammonium chloride Nutrition 0.000 description 1
- 229940041514 candida albicans extract Drugs 0.000 description 1
- 230000015556 catabolic process Effects 0.000 description 1
- 238000004140 cleaning Methods 0.000 description 1
- 235000019864 coconut oil Nutrition 0.000 description 1
- 239000003240 coconut oil Substances 0.000 description 1
- 239000000470 constituent Substances 0.000 description 1
- 238000006731 degradation reaction Methods 0.000 description 1
- 239000008367 deionised water Substances 0.000 description 1
- 229910021641 deionized water Inorganic materials 0.000 description 1
- ZPWVASYFFYYZEW-UHFFFAOYSA-L dipotassium hydrogen phosphate Chemical compound [K+].[K+].OP([O-])([O-])=O ZPWVASYFFYYZEW-UHFFFAOYSA-L 0.000 description 1
- 235000019797 dipotassium phosphate Nutrition 0.000 description 1
- 229910000396 dipotassium phosphate Inorganic materials 0.000 description 1
- 239000012153 distilled water Substances 0.000 description 1
- 230000008030 elimination Effects 0.000 description 1
- 238000003379 elimination reaction Methods 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 238000011010 flushing procedure Methods 0.000 description 1
- 238000005187 foaming Methods 0.000 description 1
- 239000012362 glacial acetic acid Substances 0.000 description 1
- 239000008233 hard water Substances 0.000 description 1
- BAUYGSIQEAFULO-UHFFFAOYSA-L iron(2+) sulfate (anhydrous) Chemical compound [Fe+2].[O-]S([O-])(=O)=O BAUYGSIQEAFULO-UHFFFAOYSA-L 0.000 description 1
- 229910000359 iron(II) sulfate Inorganic materials 0.000 description 1
- 239000012263 liquid product Substances 0.000 description 1
- WRUGWIBCXHJTDG-UHFFFAOYSA-L magnesium sulfate heptahydrate Chemical compound O.O.O.O.O.O.O.[Mg+2].[O-]S([O-])(=O)=O WRUGWIBCXHJTDG-UHFFFAOYSA-L 0.000 description 1
- 229940061634 magnesium sulfate heptahydrate Drugs 0.000 description 1
- 239000003264 margarine Substances 0.000 description 1
- 235000013310 margarine Nutrition 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 125000005702 oxyalkylene group Chemical group 0.000 description 1
- 229920001983 poloxamer Polymers 0.000 description 1
- 229920005862 polyol Polymers 0.000 description 1
- 150000003077 polyols Chemical class 0.000 description 1
- 229920001451 polypropylene glycol Polymers 0.000 description 1
- 229910052573 porcelain Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 235000011056 potassium acetate Nutrition 0.000 description 1
- 239000001103 potassium chloride Substances 0.000 description 1
- 235000011164 potassium chloride Nutrition 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 238000012807 shake-flask culturing Methods 0.000 description 1
- 235000020183 skimmed milk Nutrition 0.000 description 1
- 230000035943 smell Effects 0.000 description 1
- 239000001632 sodium acetate Substances 0.000 description 1
- 235000017281 sodium acetate Nutrition 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- QDRKDTQENPPHOJ-UHFFFAOYSA-N sodium ethoxide Chemical compound [Na+].CC[O-] QDRKDTQENPPHOJ-UHFFFAOYSA-N 0.000 description 1
- 235000019832 sodium triphosphate Nutrition 0.000 description 1
- 238000010186 staining Methods 0.000 description 1
- 230000008961 swelling Effects 0.000 description 1
- 239000003760 tallow Substances 0.000 description 1
- 238000002255 vaccination Methods 0.000 description 1
- 238000009423 ventilation Methods 0.000 description 1
- 239000012138 yeast extract Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C11—ANIMAL OR VEGETABLE OILS, FATS, FATTY SUBSTANCES OR WAXES; FATTY ACIDS THEREFROM; DETERGENTS; CANDLES
- C11D—DETERGENT COMPOSITIONS; USE OF SINGLE SUBSTANCES AS DETERGENTS; SOAP OR SOAP-MAKING; RESIN SOAPS; RECOVERY OF GLYCEROL
- C11D1/00—Detergent compositions based essentially on surface-active compounds; Use of these compounds as a detergent
- C11D1/66—Non-ionic compounds
- C11D1/722—Ethers of polyoxyalkylene glycols having mixed oxyalkylene groups; Polyalkoxylated fatty alcohols or polyalkoxylated alkylaryl alcohols with mixed oxyalkylele groups
Landscapes
- Chemical & Material Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Engineering & Computer Science (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Oil, Petroleum & Natural Gas (AREA)
- Wood Science & Technology (AREA)
- Organic Chemistry (AREA)
- Detergent Compositions (AREA)
- Biological Depolymerization Polymers (AREA)
- Fats And Perfumes (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US467760A US3340309A (en) | 1965-06-28 | 1965-06-28 | Biodegradable, liquid, water-miscible alkylene oxide condensation products |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1593043A1 true DE1593043A1 (de) | 1970-07-23 |
Family
ID=23857062
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19661593043 Pending DE1593043A1 (de) | 1965-06-28 | 1966-06-25 | Verfahren zur Herstellung von biologisch abbaufaehigen fuessigen Spuelzusaetzen fuer Geschirrspuelautomaten |
Country Status (5)
| Country | Link |
|---|---|
| US (1) | US3340309A (enExample) |
| BE (1) | BE683227A (enExample) |
| DE (1) | DE1593043A1 (enExample) |
| GB (1) | GB1131333A (enExample) |
| NL (2) | NL6608854A (enExample) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0688755A1 (de) * | 1994-06-21 | 1995-12-27 | Hoechst Aktiengesellschaft | Alkoxylierungsprodukt-Mischungen mit enger Alkoxylverteilung |
Families Citing this family (25)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3504041A (en) * | 1966-02-14 | 1970-03-31 | Wyandotte Chemicals Corp | Nonionic condensation products having enhanced activity |
| DE1814439A1 (de) * | 1968-02-23 | 1969-10-16 | Continental Oil Co | Wenig schaeumende nichtionogene Detergentien |
| US3625901A (en) * | 1969-12-02 | 1971-12-07 | Economics Lab | Surface active dishwashing rinse aids |
| US3862243A (en) * | 1972-02-17 | 1975-01-21 | Int Flavors & Fragrances Inc | Mixed oxyalkylates employed as antifoamers |
| US4134854A (en) * | 1973-05-05 | 1979-01-16 | Texaco Development Corp. | Nonionic surfactant with low pour point |
| US4115457A (en) * | 1976-07-07 | 1978-09-19 | Sandoz Ltd. | Polyglycol ether derivatives |
| US4070298A (en) * | 1976-07-26 | 1978-01-24 | Olin Corporation | Defoaming detergent additive |
| US4179544A (en) * | 1977-12-05 | 1979-12-18 | Basf Wyandotte Corporation | Fiber finish compositions |
| DE2918047A1 (de) * | 1979-05-04 | 1980-12-11 | Huels Chemische Werke Ag | Biologisch abbaubare und schwachschaeumende tenside, verfahren zu ihrer herstellung und ihre verwendung in reinigungsmitteln |
| DE2918826A1 (de) * | 1979-05-10 | 1980-11-27 | Basf Ag | Verwendung von alkoxylierten alkoholen als biologisch abbaubare, schaumarme tenside in wasch- und reinigungsmitteln |
| DE2925628A1 (de) * | 1979-06-26 | 1981-01-22 | Huels Chemische Werke Ag | Zur erniedrigung der grenzflaechenspannung oeliger phasen gegen wasser geeignete verbindungen |
| US4361035A (en) * | 1979-08-15 | 1982-11-30 | Rockwell International Corporation | Nonstaining leak tracer solution and method employing same |
| US4518459A (en) * | 1979-11-13 | 1985-05-21 | Economics Laboratory, Inc. | Methods of deinking secondary fibers |
| US4469606A (en) * | 1982-07-26 | 1984-09-04 | Ciba-Geigy Corporation | Stabilization systems for fiber finishes |
| US4545917A (en) * | 1984-02-09 | 1985-10-08 | Creative Products Resource Associates Ltd. | Automatic dishwasher product in solid form |
| US4647314A (en) * | 1985-03-05 | 1987-03-03 | Drew Chemical Corporation | Rinse water additive |
| US4668423A (en) * | 1985-04-19 | 1987-05-26 | Sherex Chemical Company | Liquid biodegradable surfactant and use thereof |
| JP2634268B2 (ja) * | 1988-07-05 | 1997-07-23 | オリン コーポレイション | マレイン又はフマール酸とポリ(エトキシ)アルコールとのアニオン界面活性附加生成物 |
| US5151093A (en) * | 1990-10-29 | 1992-09-29 | Alza Corporation | Osmotically driven syringe with programmable agent delivery |
| US5417808A (en) * | 1991-08-30 | 1995-05-23 | Lion Corporation | Deinking composition for flotation and deinking method |
| SE501132C2 (sv) * | 1992-11-19 | 1994-11-21 | Berol Nobel Ab | Användning av alkoxilat av 2-propylheptanol i rengörande kompositioner |
| US5540665A (en) * | 1994-01-31 | 1996-07-30 | Alza Corporation | Gas driven dispensing device and gas generating engine therefor |
| US5464562A (en) * | 1995-04-24 | 1995-11-07 | Basf Corporation | Polyoxyalkylene polyether monool polyurethane foam additive |
| US6242389B1 (en) * | 1997-04-14 | 2001-06-05 | Bp Chemicals Limited | Ethers |
| JP5685067B2 (ja) * | 2009-12-08 | 2015-03-18 | 花王株式会社 | 木綿布に水拡散促進能を付与する木綿布の処理方法 |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3030426A (en) * | 1957-12-23 | 1962-04-17 | Shell Oil Co | Low ash polyoxyalkylene compounds and their preparation |
| DE1126140B (de) * | 1959-07-31 | 1962-03-22 | Boehme Fettchemie Gmbh | Verfahren zur Herstellung von Alkylenoxydanlagerungsprodukten mit geringem Schaeumvermoegen |
-
0
- NL NL134504D patent/NL134504C/xx active
-
1965
- 1965-06-28 US US467760A patent/US3340309A/en not_active Expired - Lifetime
-
1966
- 1966-06-24 NL NL6608854A patent/NL6608854A/xx unknown
- 1966-06-25 DE DE19661593043 patent/DE1593043A1/de active Pending
- 1966-06-27 BE BE683227D patent/BE683227A/xx not_active IP Right Cessation
- 1966-06-27 GB GB28813/66A patent/GB1131333A/en not_active Expired
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0688755A1 (de) * | 1994-06-21 | 1995-12-27 | Hoechst Aktiengesellschaft | Alkoxylierungsprodukt-Mischungen mit enger Alkoxylverteilung |
Also Published As
| Publication number | Publication date |
|---|---|
| BE683227A (enExample) | 1966-12-01 |
| GB1131333A (en) | 1968-10-23 |
| US3340309A (en) | 1967-09-05 |
| NL134504C (enExample) | |
| NL6608854A (enExample) | 1966-12-29 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1593043A1 (de) | Verfahren zur Herstellung von biologisch abbaufaehigen fuessigen Spuelzusaetzen fuer Geschirrspuelautomaten | |
| EP0019173B1 (de) | Verwendung von alkoxylierten Alkoholen als biologisch abbaubare, schaumarme Tenside in Maschinengeschirrspülmitteln | |
| EP0197434B1 (de) | Klarspülmittel für die maschinelle Geschirreinigung | |
| DE2106819C3 (de) | Klarspülmittel für die maschinelle Geschirreinigung | |
| DE2658073A1 (de) | Fluessiges wasch- und reinigungsmittel | |
| DE2724350C3 (de) | Klarspülmittel für die maschinelle Geschirreinigung | |
| EP1015538A1 (de) | Schaumarme tensidmischungen mit hydroxymischethern | |
| DE69522875T2 (de) | Reinigungsmittel für harte Oberflächen | |
| DE1617239A1 (de) | Wenig verschaeumende Detergentien | |
| EP0415988A1 (de) | Schaumdrückende alkylpolyglykolether für reinigungsmittel (i) | |
| DE2748800A1 (de) | Reinigungsmittel | |
| DE4233699A1 (de) | Klarspüler für das maschinelle Geschirrspülen | |
| DE2319892A1 (de) | Fluessige reinigungsmittelmischung | |
| EP0033111A1 (de) | Flüssiges Reinigungs- und Pflegemittel und seine Verwendung | |
| DE2608565C2 (de) | Flüssiges Reinigungsmittel und seine Verwendung in Geschirrspülmaschinen | |
| DE3437086A1 (de) | Klares, einphasiges, fluessiges, besonders zur reinigung harter oberflaechen geeignetes reinigungsmittel | |
| DE69424528T2 (de) | Reinigungsmittel für harte oberflächen | |
| EP0349906A2 (de) | Detergensmischung aus nichtionischen und anionischen Tensiden und deren Verwendung | |
| DE1692019A1 (de) | Schaumarme Spuel- und Reinigungsmittel fuer die Geschirreinigung | |
| DE3638315A1 (de) | Fluessige zusammensetzung zum spuelen von geschirr mit der hand in kaltem wasser | |
| DE2259830A1 (de) | Reinigungs- und klarspuelmittelkombination fuer das maschinelle spuelen von geschirr | |
| DE1934540C3 (de) | Verfahren zur Herstellung eines Waschmittelrohstoffgemisches | |
| DE1767384A1 (de) | Schaumarme Spuel- und Reinigungsmittel fuer die Geschirreinigung | |
| DE2059403B2 (de) | Oberflaechenaktive zusammensetzungen | |
| DE60220885T2 (de) | Flüssiges waschmittel |