DE1166366B - Natriumdampfentladungslampe - Google Patents
NatriumdampfentladungslampeInfo
- Publication number
- DE1166366B DE1166366B DEN22158A DEN0022158A DE1166366B DE 1166366 B DE1166366 B DE 1166366B DE N22158 A DEN22158 A DE N22158A DE N0022158 A DEN0022158 A DE N0022158A DE 1166366 B DE1166366 B DE 1166366B
- Authority
- DE
- Germany
- Prior art keywords
- lamp
- discharge lamp
- sodium
- sodium vapor
- discharge tube
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 229910052708 sodium Inorganic materials 0.000 title claims description 16
- 239000011734 sodium Substances 0.000 title claims description 16
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 title claims description 15
- 230000005855 radiation Effects 0.000 claims description 5
- XOLBLPGZBRYERU-UHFFFAOYSA-N tin dioxide Chemical compound O=[Sn]=O XOLBLPGZBRYERU-UHFFFAOYSA-N 0.000 claims description 5
- 229910001887 tin oxide Inorganic materials 0.000 claims description 5
- 239000011248 coating agent Substances 0.000 claims 1
- 238000000576 coating method Methods 0.000 claims 1
- 239000010410 layer Substances 0.000 description 13
- PCHJSUWPFVWCPO-UHFFFAOYSA-N gold Chemical compound [Au] PCHJSUWPFVWCPO-UHFFFAOYSA-N 0.000 description 4
- 239000010931 gold Substances 0.000 description 4
- 229910052737 gold Inorganic materials 0.000 description 4
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 2
- 239000011521 glass Substances 0.000 description 2
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 1
- 229910006404 SnO 2 Inorganic materials 0.000 description 1
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 1
- 229910052787 antimony Inorganic materials 0.000 description 1
- WATWJIUSRGPENY-UHFFFAOYSA-N antimony atom Chemical compound [Sb] WATWJIUSRGPENY-UHFFFAOYSA-N 0.000 description 1
- 229910052786 argon Inorganic materials 0.000 description 1
- 230000005540 biological transmission Effects 0.000 description 1
- 239000011247 coating layer Substances 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 229910052738 indium Inorganic materials 0.000 description 1
- APFVFJFRJDLVQX-UHFFFAOYSA-N indium atom Chemical compound [In] APFVFJFRJDLVQX-UHFFFAOYSA-N 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 229910052754 neon Inorganic materials 0.000 description 1
- GKAOGPIIYCISHV-UHFFFAOYSA-N neon atom Chemical compound [Ne] GKAOGPIIYCISHV-UHFFFAOYSA-N 0.000 description 1
- 229910052698 phosphorus Inorganic materials 0.000 description 1
- 239000011574 phosphorus Substances 0.000 description 1
- 150000003385 sodium Chemical class 0.000 description 1
Classifications
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01J—ELECTRIC DISCHARGE TUBES OR DISCHARGE LAMPS
- H01J61/00—Gas-discharge or vapour-discharge lamps
- H01J61/02—Details
- H01J61/30—Vessels; Containers
- H01J61/34—Double-wall vessels or containers
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01J—ELECTRIC DISCHARGE TUBES OR DISCHARGE LAMPS
- H01J61/00—Gas-discharge or vapour-discharge lamps
- H01J61/02—Details
- H01J61/30—Vessels; Containers
- H01J61/35—Vessels; Containers provided with coatings on the walls thereof; Selection of materials for the coatings
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01J—ELECTRIC DISCHARGE TUBES OR DISCHARGE LAMPS
- H01J61/00—Gas-discharge or vapour-discharge lamps
- H01J61/02—Details
- H01J61/38—Devices for influencing the colour or wavelength of the light
Landscapes
- Vessels And Coating Films For Discharge Lamps (AREA)
- Discharge Lamp (AREA)
- Other Surface Treatments For Metallic Materials (AREA)
- Resistance Heating (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| NL269925 | 1961-10-04 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1166366B true DE1166366B (de) | 1964-03-26 |
Family
ID=19753325
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEN22158A Pending DE1166366B (de) | 1961-10-04 | 1962-09-29 | Natriumdampfentladungslampe |
Country Status (11)
| Country | Link |
|---|---|
| US (1) | US3221198A (enExample) |
| AT (1) | AT242238B (enExample) |
| BE (1) | BE623133A (enExample) |
| CH (1) | CH419344A (enExample) |
| DE (1) | DE1166366B (enExample) |
| DK (1) | DK103623C (enExample) |
| ES (1) | ES281215A1 (enExample) |
| FR (1) | FR1335389A (enExample) |
| GB (1) | GB987938A (enExample) |
| NL (1) | NL269925A (enExample) |
| OA (1) | OA00844A (enExample) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1228717B (de) | 1962-05-02 | 1966-11-17 | Philips Nv | Hochdruck-Entladungslampe |
Families Citing this family (12)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1260627B (de) * | 1965-11-13 | 1968-02-08 | Philips Nv | Natriumdampfentladungslampe |
| NL164423C (nl) * | 1969-12-13 | 1980-12-15 | Philips Nv | Lagedruknatriumdampontladingslamp. |
| US3662208A (en) * | 1970-01-27 | 1972-05-09 | Tokyo Shibaura Electric Co | Reflector type incandescent lamps |
| US3931536A (en) * | 1974-07-15 | 1976-01-06 | Gte Sylvania Incorporated | Efficiency arc discharge lamp |
| US4080545A (en) * | 1976-12-27 | 1978-03-21 | Xerox Corporation | Sodium vapor lamp with emission aperture |
| US4071798A (en) * | 1977-04-01 | 1978-01-31 | Xerox Corporation | Sodium vapor lamp with emission aperture |
| DE2840771A1 (de) * | 1978-09-19 | 1980-03-27 | Patra Patent Treuhand | Hochdruckentladungslampe mit metallhalogeniden |
| EP0015026B1 (de) * | 1979-02-19 | 1983-05-25 | Heinz Sovilla | Glühfadenlampe |
| NL185481C (nl) * | 1979-11-14 | 1990-04-17 | Philips Nv | Lagedruknatriumdampontladingslamp. |
| US4467238A (en) * | 1981-09-03 | 1984-08-21 | General Electric Company | High-pressure sodium lamp with improved IR reflector |
| US4678960A (en) * | 1985-08-01 | 1987-07-07 | General Electric Company | Metallic halide electric discharge lamps |
| US5276763A (en) * | 1990-07-09 | 1994-01-04 | Heraeus Quarzglas Gmbh | Infrared radiator with protected reflective coating and method for manufacturing same |
Citations (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| AT139286B (de) * | 1933-06-27 | 1934-11-10 | Patent Treuhand Ges Fuer Elektrische Gluehlampen Mbh | Doppelwandige elektrische Leuchtröhre. |
| GB826615A (en) * | 1955-05-31 | 1960-01-13 | Gen Electric Co Ltd | Improvements in or relating to electric discharge lamps |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2795721A (en) * | 1951-10-19 | 1957-06-11 | Gen Electric | Ultraviolet lamp |
| US2899584A (en) * | 1955-01-24 | 1959-08-11 | Verwey |
-
0
- BE BE623133D patent/BE623133A/xx unknown
- NL NL269925D patent/NL269925A/xx unknown
-
1962
- 1962-09-26 US US226337A patent/US3221198A/en not_active Expired - Lifetime
- 1962-09-29 DE DEN22158A patent/DE1166366B/de active Pending
- 1962-10-01 CH CH1152762A patent/CH419344A/de unknown
- 1962-10-01 GB GB37120/62A patent/GB987938A/en not_active Expired
- 1962-10-01 AT AT775562A patent/AT242238B/de active
- 1962-10-01 DK DK424462AA patent/DK103623C/da active
- 1962-10-02 ES ES281215A patent/ES281215A1/es not_active Expired
- 1962-10-03 FR FR911191A patent/FR1335389A/fr not_active Expired
-
1964
- 1964-12-19 OA OA50930A patent/OA00844A/xx unknown
Patent Citations (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| AT139286B (de) * | 1933-06-27 | 1934-11-10 | Patent Treuhand Ges Fuer Elektrische Gluehlampen Mbh | Doppelwandige elektrische Leuchtröhre. |
| GB826615A (en) * | 1955-05-31 | 1960-01-13 | Gen Electric Co Ltd | Improvements in or relating to electric discharge lamps |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1228717B (de) | 1962-05-02 | 1966-11-17 | Philips Nv | Hochdruck-Entladungslampe |
Also Published As
| Publication number | Publication date |
|---|---|
| FR1335389A (fr) | 1963-08-16 |
| US3221198A (en) | 1965-11-30 |
| CH419344A (de) | 1966-08-31 |
| NL269925A (enExample) | |
| OA00844A (fr) | 1967-11-15 |
| ES281215A1 (es) | 1963-01-01 |
| GB987938A (en) | 1965-03-31 |
| BE623133A (enExample) | |
| AT242238B (de) | 1965-09-10 |
| DK103623C (da) | 1966-01-31 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2624897A1 (de) | Aluminiumoxyd-ueberzuege fuer quecksilberdampf-lampen | |
| DE1166366B (de) | Natriumdampfentladungslampe | |
| DE1464181A1 (de) | Elektrische Gasentladungslampe | |
| DE2854223C2 (de) | Hochdruckentladungslampe | |
| DE3428125A1 (de) | Verbesserte gluehlampe | |
| DE2225308C3 (de) | Hochdruckgasentladungslampe | |
| DE1260627B (de) | Natriumdampfentladungslampe | |
| DE3038993A1 (de) | Metalldampfentladungslampe | |
| EP0492205B1 (de) | Metallhalogenid-Hochdruckentladungslampe | |
| DE2042577A1 (de) | Hochdruckmetalldampfentladungsrohre | |
| DE2118828C3 (de) | Hochdruck-Natriumdampf-Entladungslampe | |
| EP0456907B1 (de) | Hochdruckentladungslampe | |
| DE2028781A1 (de) | Hochdruck-Quecksilberdampf Jodid-Entladungslampe | |
| DE3233966A1 (de) | Entladungslampe hoher intensitaet mit einer einrichtung zum reflektieren von infrarot zur verbesserung der wirksamkeit | |
| DE2106447A1 (de) | Quecksilberdampf-Hochdruckentladungslampe mit einem Zusatz von Metallhalogeniden | |
| DE1489406C3 (de) | Hochdruck-Quecksilberdampf entladungslampe | |
| DE3702481A1 (de) | Gasentladungslampe | |
| DE3910431C2 (enExample) | ||
| DE1260023B (de) | Hochdruck-Quecksilberdampflampe | |
| DE8805183U1 (de) | Hochdruckentladungslampe | |
| DE2448348A1 (de) | Gluehlampe mit hohem wirkungsgrad | |
| DE702410C (de) | Aus Hohlglasbausteinen bestehende Gebaeudewand | |
| AT119228B (de) | Stromzuleitungen für Gefäße aus Glas, insbesondere aus Quarzglas. | |
| DE1228717B (de) | Hochdruck-Entladungslampe | |
| DE3200698A1 (de) | Hochdruck-natriumdampflampe |